This value set has >1000 codes in it. In order to keep the publication size manageable, only a selection (1000 codes) of the whole set of codes is shown
| Code | Display |
| 102002 | Hemoglobin Okaloosa (substance) |
| 120006 | Ornithine racemase (substance) |
| 125001 | Ferrous sulfate Fe^59^ (substance) |
| 126000 | Galactosyl-N-acetylglucosaminylgalactosylglucosylceramide alpha-galactosyltransferase (substance) |
| 130002 | Hemoglobin Hopkins-II (substance) |
| 131003 | Dolichyl-phosphate mannosyltransferase (substance) |
| 159002 | Ferrocyanide salt (substance) |
| 164003 | Phosphoenolpyruvate-protein phosphotransferase (substance) |
| 178002 | Uridine diphosphate galactose (substance) |
| 186002 | Human leukocyte antigen Cw9 (substance) |
| 187006 | Cyanocobalamin Co^57^ (substance) |
| 200001 | Berberine (substance) |
| 217008 | Blood group antigen IH (substance) |
| 231008 | 3-Hydroxyisobutyrate dehydrogenase (substance) |
| 238002 | Heptachlor (substance) |
| 261000 | Codeine phosphate (substance) |
| 296000 | Coumachlor (substance) |
| 322006 | Octylphenoxy P.H. ethanol (substance) |
| 327000 | ^76^Arsenic (substance) |
| 329002 | ^127^Antimony (substance) |
| 336001 | Fibrinogen Tokyo II (substance) |
| 340005 | Enzyme variant (substance) |
| 363000 | Fibrinogen San Juan (substance) |
| 370000 | beta>2S< Glycoprotein (substance) |
| 371001 | Acylcarnitine hydrolase (substance) |
| 377002 | Sparteine (substance) |
| 392001 | ^151^Gadolinium (substance) |
| 395004 | Immunoglobulin pentamer (substance) |
| 412004 | Phosphoriboisomerase |
| 424006 | Citramalyl-coenzyme A lyase (substance) |
| 425007 | Hemoglobin Nagoya (substance) |
| 432003 | Carminic acid stain (substance) |
| 438004 | 2-Hydroxyglutarate dehydrogenase (substance) |
| 462009 | Urease (adenosine triphosphate-hydrolysing) (substance) |
| 472007 | Vegetable textile fiber (substance) |
| 476005 | Lymphocyte antigen CD1b (substance) |
| 498001 | Nitrilase (substance) |
| 501001 | Blood group antibody Sf^a^ (substance) |
| 505005 | Blood group antibody M' (substance) |
| 506006 | 3-Oxosteroid delta^1^-dehydrogenase (substance) |
| 515004 | Blood group antigen Giaigue (substance) |
| 519005 | Free protein S (substance) |
| 521000 | ^197^Mercury (substance) |
| 529003 | Guanosine (substance) |
| 538001 | 2,3-Dihydroxybenzoate 3,4-dioxygenase (substance) |
| 566009 | Acrosin (substance) |
| 576007 | Blood group antibody Duck (substance) |
| 578008 | Hemoglobin Jianghua (substance) |
| 584006 | Blood group antibody Wr^b^ (substance) |
| 585007 | Substance P (substance) |
| 591009 | 2-Oxoisovalerate dehydrogenase (acylating) (substance) |
| 593007 | Blood group antibody Holmes (substance) |
| 594001 | 2-Oxoglutarate synthase (substance) |
| 597008 | ^247^Californium (substance) |
| 604000 | Plant sapogenin glycoside (substance) |
| 611001 | Hippurate hydrolase (substance) |
| 620005 | Trichlorophenol (substance) |
| 648005 | Oil of calamus (substance) |
| 662003 | Aeromonas proteolytica aminopeptidase (substance) |
| 668004 | ^185^Osmium (substance) |
| 683009 | Mercuric acetate |
| 686001 | Plastoquinol-plastocyanin reductase (substance) |
| 693002 | Trichothecenes (substance) |
| 698006 | Erythromycin lactobionate (substance) |
| 699003 | Coal tar extract (substance) |
| 704006 | Blood group antigen Rx (substance) |
| 732002 | N-valeraldehyde (substance) |
| 735000 | Blood group antigen Jobbins (substance) |
| 747006 | Oxamniquine (substance) |
| 773001 | Hemoglobin M-Iwate (substance) |
| 785009 | Dextranase |
| 804003 | Creosotic acid (substance) |
| 819002 | Lytic antibody (substance) |
| 850000 | Stizolobate synthase (substance) |
| 859004 | Peptide-N^4^-(N-acetyl-b-glucosaminyl) asparagine amidase (substance) |
| 860009 | Immunoglobulin, aggregated (substance) |
| 873008 | Urethan (substance) |
| 876000 | Blood group antigen D (substance) |
| 877009 | Carboxypeptidase A (substance) |
| 889006 | (Acetyl-coenzyme A carboxylase) kinase (substance) |
| 896008 | Ice (substance) |
| 905001 | o-Dihydroxycoumarin O^7^-glucosyltransferase (substance) |
| 923009 | Complement component C2 (substance) |
| 925002 | Sodium iodipamide (substance) |
| 963005 | Pyridoxine 4-dehydrogenase (substance) |
| 974001 | Adenosylmethionine decarboxylase (substance) |
| 979006 | Carbamate kinase (substance) |
| 993004 | Palladium compound (substance) |
| 1002007 | Mannotetraose 2-alpha-N-acetylglucosaminyltransferase (substance) |
| 1010008 | N-Acetylneuraminate monooxygenase (substance) |
| 1018001 | Nornicotine (substance) |
| 1025008 | ^93^Molybdenum (substance) |
| 1047008 | Guanine deaminase (substance) |
| 1050006 | Melilotate 3-monooxygenase (substance) |
| 1057009 | Phosphate salt (substance) |
| 1065007 | E. coli periplasmic proteinase (substance) |
| 1080001 | ^202^Thallium (substance) |
| 1091008 | Coagulation factor inhibitor (substance) |
| 1097007 | Blood group antigen M^A^ (substance) |
| 1105007 | Isochorismate synthase (substance) |
| 1113008 | Pancreatic ribonuclease (substance) |
| 1137008 | ^240^Uranium (substance) |
| 1149009 | Hemoglobin Barcelona (substance) |
| 1160000 | Blood group antibody Lutheran |
| 1166006 | Titanium (substance) |
| 1169004 | Hemoglobin Gower-2 (substance) |
| 1171004 | Fibrinogen Kawaguchi (substance) |
| 1185009 | Hemoglobin Roseau-Pointe à Pitre (substance) |
| 1189003 | Hemoglobin F-M-Osaka (substance) |
| 1190007 | Mephenoxalone (substance) |
| 1219001 | Diethyl xanthogen disulfide (substance) |
| 1223009 | Blood group antigen Marks (substance) |
| 1244009 | Fibrinogen Madrid I (substance) |
| 1248007 | Leucostoma neutral proteinase (substance) |
| 1269009 | Amikacin sulfate (substance) |
| 1272002 | Pteridine oxidase (substance) |
| 1273007 | Blood group antibody Evelyn (substance) |
| 1313002 | Nitrate reductase (cytochrome) (substance) |
| 1319003 | Blood group antibody K18 (substance) |
| 1320009 | Hemoglobin Manitoba (substance) |
| 1325004 | Metocurine iodide (substance) |
| 1331001 | Methamidophos (substance) |
| 1334009 | Estradiol receptor (substance) |
| 1336006 | 11-Deoxycorticosterone (substance) |
| 1341003 | Hemoglobin Ta-li (substance) |
| 1346008 | Blue shade eosin stain (substance) |
| 1355006 | Coagulation factor IX Oxford 3 variant (substance) |
| 1368003 | ^131^Iodine (substance) |
| 1371006 | Blood group antigen Big (substance) |
| 1373009 | ^93^Zirconium (substance) |
| 1381005 | ^126^Iodine (substance) |
| 1394007 | Iron pentacarbonyl (substance) |
| 1396009 | Actinium (substance) |
| 1405004 | Blood group antibody M^e^ (substance) |
| 1408002 | Blood group antibody 1123K (substance) |
| 1416006 | Radium compound (substance) |
| 1450002 | Methylparafynol (substance) |
| 1466000 | Cyclomaltodextrinase (substance) |
| 1471007 | Elastin (substance) |
| 1472000 | Adenosine-phosphate deaminase (substance) |
| 1476002 | Codeine sulfate (substance) |
| 1477006 | Hemoglobin Yatsushiro (substance) |
| 1496005 | Proto-oncogene (substance) |
| 1506001 | Blood group antigen Ch1 (substance) |
| 1517000 | Human leukocyte antigen B21 (substance) |
| 1530004 | 6-Carboxyhexanoate-coenzyme A ligase (substance) |
| 1535009 | Nitrogen fluoride (substance) |
| 1536005 | Pargyline hydrochloride (substance) |
| 1540001 | Tellurium radioisotope (substance) |
| 1545006 | Uridine phosphorylase (substance) |
| 1557002 | Talc (substance) |
| 1565004 | Blood group antibody Buckalew (substance) |
| 1575001 | Maltose tetrapalmitate (substance) |
| 1603001 | Cobalt isotope (substance) |
| 1607000 | Homoserine kinase (substance) |
| 1609002 | N-octyl isosafrole sulfoxide (substance) |
| 1634002 | Blood group antigen Ven (substance) |
| 1649005 | Blood group antigen Sul (substance) |
| 1656004 | Hemoglobin Shaare Zedek (substance) |
| 1660001 | Plant seeds (substance) |
| 1668008 | Ceforanide (substance) |
| 1672007 | Ligase (substance) |
| 1673002 | Xylenol (substance) |
| 1675009 | ^86^Rubidium (substance) |
| 1676005 | Blood group antibody LW^ab^ (substance) |
| 1681001 | Blood group antibody BLe^b^ (substance) |
| 1696002 | 12-Hydroperoxy eicosatetraenoic acid (substance) |
| 1701009 | ^191^Gold (substance) |
| 1710001 | Uric acid (substance) |
| 1726000 | Diamond |
| 1727009 | Deoxylimonate A-ring-lactonase (substance) |
| 1740004 | Deoxy cytidine triphosphate (substance) |
| 1764003 | Saccharopine dehydrogenase (NADP^+^,L-glutamate-forming) |
| 1768000 | Sucrose phosphorylase (substance) |
| 1786002 | Leucine-transfer ribonucleic acid ligase (substance) |
| 1793003 | Sodium trichloroacetate (substance) |
| 1795005 | Glyodin (substance) |
| 1798007 | Hemoglobin Hammersmith (substance) |
| 1799004 | L-Lysine oxidase (substance) |
| 1823002 | Hemoglobin Tochigi (substance) |
| 1827001 | Ribonuclease T>1< (substance) |
| 1886008 | Verdohemoglobin (substance) |
| 1904005 | Galactoside 3-fucosyltransferase (substance) |
| 1914001 | von Willebrand factor antibody (substance) |
| 1916004 | Boroglycerin (substance) |
| 1940007 | Immunoglobulin, GM>21< allotype (substance) |
| 1944003 | Coagulation factor X Patient variant (substance) |
| 1956002 | Buclizine hydrochloride (substance) |
| 1971003 | Loxapine hydrochloride (substance) |
| 1975007 | Blood group antibody Niemetz (substance) |
| 1978009 | Site-specific methyltransferase (cytosine-specific) (substance) |
| 1985008 | Vomitus (substance) |
| 1991005 | Lignins (substance) |
| 2000001 | Heavy nitrogen (substance) |
| 2006007 | Inosine diphosphate (substance) |
| 2008008 | ^67^Gallium (substance) |
| 2009000 | Cobalt carbonyl (substance) |
| 2017008 | Deoxyribonucleic acid topoisomerase (substance) |
| 2027002 | Alternaria serine proteinase (substance) |
| 2029004 | Fibrinogen Oslo II (substance) |
| 2038002 | Blood group antibody Bg^b^ (substance) |
| 2039005 | sym-Norspermidine synthase |
| 2050008 | Choloylglycine hydrolase (substance) |
| 2064008 | L-Xylulokinase (substance) |
| 2082006 | Lymphocyte antigen CD51 (substance) |
| 2085008 | Oncogene protein TCL (substance) |
| 2088005 | Page blue G-90 stain (substance) |
| 2096000 | Nicotinamide adenine dinucleotide ^+^ adenosine diphosphate-ribosyltransferase (substance) |
| 2100004 | Sulfonethylmethane (substance) |
| 2101000 | Yeast proteinase B (substance) |
| 2125008 | Betazole (substance) |
| 2130007 | Cyclohexane-1,2-diol dehydrogenase (substance) |
| 2141009 | Hydrogen (substance) |
| 2147008 | Blood group antigen Paular (substance) |
| 2151005 | Pyridoxamine-pyruvate aminotransferase (substance) |
| 2154002 | Tagaturonate reductase (substance) |
| 2159007 | Azorubin S stain (substance) |
| 2163000 | Dicofol (substance) |
| 2168009 | Bisphosphoglycerate mutase (substance) |
| 2179004 | Malonate-semialdehyde dehydratase |
| 2189000 | Hemoglobin F-Dammam (substance) |
| 2194000 | ^101^Rhodium (substance) |
| 2195004 | Tocainide hydrochloride (substance) |
| 2197007 | Boric acid topical agent (substance) |
| 2201007 | Bacteriopurpurin (substance) |
| 2208001 | Phenylserine aldolase (substance) |
| 2212007 | Fibrinogen Bethesda II (substance) |
| 2215009 | Azuresin (substance) |
| 2240002 | Guanidinobutyrase (substance) |
| 2249001 | Gentamicin sulfate (substance) |
| 2254005 | Orotate |
| 2260005 | Human leukocyte antigen DRw18 (substance) |
| 2262002 | Cellulose polysulfatase (substance) |
| 2264001 | Selenium isotope (substance) |
| 2309006 | Gold (substance) |
| 2311002 | Prostacyclin synthase (substance) |
| 2329007 | Blood group antibody Vel (substance) |
| 2331003 | Carbohydrate (substance) |
| 2338009 | Plant roots (substance) |
| 2343002 | Guthion (substance) |
| 2346005 | Vascormone |
| 2354007 | 3'-Nucleotidase (substance) |
| 2358005 | Glass fragment, device (substance) |
| 2369008 | Indole-3-acetate beta-glucosyltransferase |
| 2370009 | Uridine diphosphate-N-acetylmuramate-alanine ligase (substance) |
| 2376003 | Mercury compound (substance) |
| 2384004 | ^230^Uranium (substance) |
| 2404002 | Blood group antibody St^a^ (substance) |
| 2405001 | b- Propiolactone (substance) |
| 2414006 | Prolactin receptor (substance) |
| 2430003 | Silicon radioisotope (substance) |
| 2431004 | Blood group antibody Friedberg (substance) |
| 2441001 | Mercury radioisotope |
| 2444009 | Human leukocyte antigen Dw25 (substance) |
| 2450004 | Mannosamine (substance) |
| 2462000 | Glucose dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) |
| 2466002 | Chloride peroxidase (substance) |
| 2500009 | Lymphocyte antigen CDw41b (substance) |
| 2509005 | D-Glutamate oxidase (substance) |
| 2516006 | Metallic sulfide compound (substance) |
| 2522002 | Extravascular blood (substance) |
| 2529006 | Hemoglobin Wood (substance) |
| 2537003 | Antituberculosis agent (substance) |
| 2568004 | Blood group antigen McAuley (substance) |
| 2573005 | Immunoglobulin, GM>13< allotype (substance) |
| 2575003 | Zinc alpha>2< glycoprotein (substance) |
| 2595009 | ^119m^Tellurium (substance) |
| 2597001 | alpha 1 globulin (substance) |
| 2611008 | Blood group antibody La Fave (substance) |
| 2637006 | Indium isotope (substance) |
| 2648004 | Bile vomitus (substance) |
| 2649007 | Azo dye (substance) |
| 2660003 | Sodium dehydrocholate (substance) |
| 2671002 | 3-Methyl-2-oxobutanoate hydroxy-methyltransferase (substance) |
| 2674005 | ^128^Cesium (substance) |
| 2676007 | C3(H20) (substance) |
| 2678008 | Hemoglobin New Mexico (substance) |
| 2680002 | Factor XIII antibody (substance) |
| 2698003 | Natural gas |
| 2705002 | ^72^Arsenic (substance) |
| 2706001 | Blood group antigen Vennera (substance) |
| 2719002 | Tartrate dehydratase (substance) |
| 2721007 | Blood group antigen McC^f^ (substance) |
| 2728001 | Antigen in Lewis (Le) blood group system (substance) |
| 2753003 | Blood group antibody M>1< (substance) |
| 2754009 | Hemoglobin F-Kennestone (substance) |
| 2765004 | Blood group antigen Sc3 (substance) |
| 2778004 | Pleural fluid (substance) |
| 2796008 | Methantheline (substance) |
| 2799001 | Methylbenzethonium chloride (substance) |
| 2823004 | Hemoglobin Bristol (substance) |
| 2832002 | Molybdenum compound (substance) |
| 2846002 | Hemoglobin Saitama (substance) |
| 2869004 | Acetic acid (substance) |
| 2878005 | Meperidine hydrochloride (substance) |
| 2880004 | Calcium sulfate (substance) |
| 2883002 | Exopolygalacturonate lyase (substance) |
| 2913009 | Immunoglobulin E, H chain (substance) |
| 2916001 | ^22^Neon (substance) |
| 2925007 | Fluorometholone (substance) |
| 2927004 | Rescinnamine (substance) |
| 2938004 | Pyrazole (substance) |
| 2942001 | Carbon^14^ D-xylose (substance) |
| 2950005 | Hemoglobin L-Persian Gulf (substance) |
| 2958003 | Zinc caprylate (substance) |
| 2964005 | Dimethoxyamphetamine (substance) |
| 2974008 | Trichophyton schoenleinii collagenase (substance) |
| 2988007 | Human leukocyte antigen Aw (substance) |
| 2991007 | Mecamylamine hydrochloride (substance) |
| 2995003 | Arecoline (substance) |
| 3027009 | ^133^Barium (substance) |
| 3031003 | Dihydroxyaluminum sodium carbonate (substance) |
| 3040004 | Technetium Tc^99m^ disofenin (substance) |
| 3045009 | Nitrochlorobenzene (substance) |
| 3052006 | Ornithine-oxo-acid aminotransferase (substance) |
| 3066001 | Triiodothyroacetic acid (substance) |
| 3070009 | Aspartate-ammonia ligase (substance) |
| 3087006 | Oil of male fern (substance) |
| 3107005 | Hemoglobin Shuangfeng (substance) |
| 3108000 | Aspergillus deoxyribonuclease K>1< (substance) |
| 3131000 | Blood group antigen Middel (substance) |
| 3136005 | Cefoperazone sodium (substance) |
| 3142009 | Azacyclonol (substance) |
| 3145006 | Penicillic acid (substance) |
| 3150000 | Sialate O-acetylesterase (substance) |
| 3151001 | Left upper lobe mucus (substance) |
| 3155005 | 3-Phosphoglyceroyl-phosphate-polyphosphate phosphotransferase (substance) |
| 3161008 | 3-Methyl histidine (substance) |
| 3167007 | Hard coal (substance) |
| 3187008 | Blood group antigen Nielsen (substance) |
| 3193000 | alpha-1,4-Glucan-protein synthase (uridine diphosphate-forming) |
| 3197004 | Inosine monophosphate (substance) |
| 3209002 | Pancuronium sodium (substance) |
| 3212004 | Manganese sulfate (substance) |
| 3225007 | Fibrinogen Seattle I (substance) |
| 3232003 | o-Benzyl-parachlorophenol (substance) |
| 3271000 | Hemoglobin Southampton (substance) |
| 3273002 | Tyrosine-ester sulfotransferase (substance) |
| 3300001 | Euphorbain (substance) |
| 3318003 | Vaginal secretions (substance) |
| 3325005 | Lipopolysaccharide (substance) |
| 3339005 | (R)-20-Hydroxysteroid dehydrogenase (substance) |
| 3340007 | alpha-Amylase (substance) |
| 3342004 | Copper isotope (substance) |
| 3346001 | Hemoglobin Brest (substance) |
| 3378009 | Imipramine hydrochloride (substance) |
| 3379001 | Thimerosal (substance) |
| 3392003 | Aldehyde dehydrogenase (acceptor) (substance) |
| 3405005 | 2-Hydroxy-3-oxoadipate synthase (substance) |
| 3411008 | bis-(Dimethylthiocarbamyl) disulfide |
| 3437006 | Hydroxymethylglutaryl-coenzyme A hydrolase (substance) |
| 3440006 | Biotin carboxylase (substance) |
| 3455002 | Discontinued pesticide (substance) |
| 3463001 | L-Amino-acid dehydrogenase (substance) |
| 3465008 | Deoxyribonucleic acid topoisomerase (adenosine triphosphate-hydrolysing) (substance) |
| 3466009 | Dimethylamine (substance) |
| 3492002 | Galactinol-sucrose galactosyltransferase (substance) |
| 3493007 | Smegma clitoridis (substance) |
| 3495000 | Cystyl-aminopeptidase (substance) |
| 3501003 | Isoxsuprine hydrochloride (substance) |
| 3523004 | Hemoglobin Q-India (substance) |
| 3532002 | Laryngeal mucus (substance) |
| 3555004 | Blood group antigen Morrison (substance) |
| 3579002 | ^129^Cesium (substance) |
| 3581000 | Glucose-6-phosphatase (substance) |
| 3587001 | Malate dehydrogenase (decarboxylating) (substance) |
| 3588006 | Complement enzyme (substance) |
| 3592004 | Short-acting thyroid stimulator (substance) |
| 3597005 | Acebutolol hydrochloride (substance) |
| 3601005 | Ether (substance) |
| 3602003 | Warm antibody (substance) |
| 3610002 | Epoxide hydrolase (substance) |
| 3617004 | ^79^Selenium (substance) |
| 3648007 | Glucocorticoid receptor (substance) |
| 3655009 | Hemoglobin Constant Springs (substance) |
| 3672002 | Fibrinogen Caracas (substance) |
| 3684000 | Phenylacetic acid (substance) |
| 3689005 | Hemoglobin Mizushi (substance) |
| 3692009 | Sodium sulfite (substance) |
| 3693004 | Fibrinogen Dusard (substance) |
| 3702007 | Cytidine diphosphate glycerol glycerophosphotransferase (substance) |
| 3710008 | Prostaglandin synthase (substance) |
| 3718001 | Cow's milk (substance) |
| 3726009 | Valine-transfer ribonucleic acid ligase (substance) |
| 3727000 | Hemoglobin F-Port Royal (substance) |
| 3730007 | Blood group antigen Tr^a^ (substance) |
| 3737005 | Nitrate reductase (reduced nicotinamide adenine dinucleotide) (substance) |
| 3742002 | Extracellular crystal (substance) |
| 3757009 | Gossypol (substance) |
| 3771001 | Neuromelanin (substance) |
| 3775005 | Choline dehydrogenase (substance) |
| 3776006 | Xanthine dehydrogenase (substance) |
| 3792001 | Arachidonic acid (substance) |
| 3793006 | Soluble barium compound (substance) |
| 3800009 | Acetate kinase (substance) |
| 3807007 | Blood group antigen c (substance) |
| 3811001 | Magnesium-protoporphyrin methyltransferase (substance) |
| 3812008 | Beryllium isotope (substance) |
| 3816006 | Vanadium isotope (substance) |
| 3823007 | Prochlorperazine edisylate (substance) |
| 3829006 | Iron (substance) |
| 3834005 | Cytidine monophosphate-N-acetylneuraminate-(alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetyl-galactosaminide alpha-2,6-sialyltransferase (substance) |
| 3836007 | Glutaminase (substance) |
| 3844007 | Protoaphin-aglucone dehydratase (cyclizing) (substance) |
| 3848005 | Nitrotoluene (substance) |
| 3849002 | Carbon black (substance) |
| 3854006 | bis-Chloro methyl ether (substance) |
| 3874004 | Hydrocodone bitartrate (substance) |
| 3892007 | Thymidine (substance) |
| 3896005 | p-Hydroxybenzoate ester (substance) |
| 3897001 | Blood group antigen 'N' (substance) |
| 3906002 | Rectified birch tar oil (substance) |
| 3920009 | Hemoglobin Atago (substance) |
| 3930000 | Manufactured gas (substance) |
| 3932008 | ^64^Copper (substance) |
| 3941003 | Metronidazole hydrochloride (substance) |
| 3945007 | Tin isotope (substance) |
| 3958008 | ^245^Californium (substance) |
| 3961009 | Blood group antigen Ritherford (substance) |
| 3976001 | Blood group antigen HEMPAS (substance) |
| 3982003 | Oxaloacetate decarboxylase (substance) |
| 3983008 | N,-N-dimethyltryptamine (substance) |
| 3990003 | Alkaline phosphatase isoenzyme, bone fraction (substance) |
| 3994007 | Hemoglobin Tampa (substance) |
| 4014000 | Sulfisomidine (substance) |
| 4024008 | Soft metal (substance) |
| 4025009 | Captodiame |
| 4043008 | Etidocaine hydrochloride (substance) |
| 4047009 | cis-1,2-Dihydrobenzene-1,2-diol dehydrogenase (substance) |
| 4048004 | 1,1,2,2-Tetrachloro-1,2- difluoroethane (substance) |
| 4067000 | Chorismate mutase (substance) |
| 4076007 | Intact parathyroid hormone (substance) |
| 4077003 | Dihydrolipoamide succinyltransferase (substance) |
| 4080002 | Hemoglobin Grady, Dakar |
| 4091009 | Enteropeptidase (substance) |
| 4097008 | Apo-SAA complex (substance) |
| 4104007 | Chondroitin sulfate (substance) |
| 4105008 | Adenylylcyclase |
| 4115002 | Blood group antibody Norlander (substance) |
| 4137009 | sec-Butyl acetate (substance) |
| 4153007 | Long-chain-enoyl-coenzyme A hydratase (substance) |
| 4167003 | Lymphocyte antigen CD31 (substance) |
| 4169000 | Blood group antibody Le^bH^ (substance) |
| 4177001 | Hemoglobin Long Island-Marseille (substance) |
| 4182008 | Cytidine diphosphate diacylglycerol-serine O-phosphatidyl-transferase (substance) |
| 4188007 | Fibrinogen Sydney II (substance) |
| 4200007 | Neriifolin (substance) |
| 4201006 | 6-Aminohexanoate-dimer hydrolase (substance) |
| 4203009 | Imipramine pamoate (substance) |
| 4207005 | Cortisone beta-reductase (substance) |
| 4217000 | Fluorosilicate salt |
| 4218005 | Immunoglobulin, GM>23< allotype (substance) |
| 4231000 | Gallium isotope (substance) |
| 4239003 | Glycerol dehydrogenase (substance) |
| 4255005 | ^241^Americium (substance) |
| 4289006 | Keyhole-limpet hemocyanin (substance) |
| 4290002 | Linamarin synthase (substance) |
| 4314009 | Blood group antibody Allchurch (substance) |
| 4334005 | Tar oil (substance) |
| 4342006 | 2-Aminopyridine (substance) |
| 4353000 | Dibutyl phthalate (substance) |
| 4355007 | Coagulation factor IX San Dimas variant (substance) |
| 4362003 | 4-Coumarate-coenzyme A ligase (substance) |
| 4370008 | Acetone (substance) |
| 4393002 | Blood group antigen Fedor (substance) |
| 4401009 | Blood group antibody H>T< (substance) |
| 4413004 | Benzypyrinium |
| 4422003 | Blood group antigen (substance) |
| 4423008 | Fibrinogen New York II (substance) |
| 4425001 | Blood group antibody Binge (substance) |
| 4435007 | Sulfuryl fluoride (substance) |
| 4437004 | ^127^Cesium (substance) |
| 4471008 | ^244^Californium (substance) |
| 4479005 | Hemoglobin Brockton (substance) |
| 4480008 | Sulfaethidole (substance) |
| 4509009 | Plant phenanthrene toxin (substance) |
| 4518006 | Buthenal (substance) |
| 4534009 | ^208^Bismuth (substance) |
| 4540002 | Adenosine diphosphate deaminase (substance) |
| 4546008 | Myristic acid (substance) |
| 4555006 | Blood group antibody Rils (substance) |
| 4560005 | Hemoglobin Mizuho (substance) |
| 4561009 | Arginine decarboxylase (substance) |
| 4564001 | Blood group antibody Sisson (substance) |
| 4567008 | Galactose-1-phosphate thymidylyltransferase (substance) |
| 4582003 | Blood group antigen N^A^ (substance) |
| 4591004 | Blood group antigen Kam |
| 4610008 | Senile cardiac protein (substance) |
| 4616002 | Triclobisonium chloride (substance) |
| 4629002 | Hypoglycin B (substance) |
| 4635002 | Arterial blood (substance) |
| 4643007 | Calf thymus ribonuclease H (substance) |
| 4656000 | Alcian blue 8GX stain (substance) |
| 4674009 | 2,3-Dihydroxybenzoate serine ligase (substance) |
| 4681002 | Potassium permanganate (substance) |
| 4693006 | Chromium^51^ albumin (substance) |
| 4700006 | Beef insulin (substance) |
| 4706000 | Chlorine monoxide (substance) |
| 4714006 | ^183m^Osmium (substance) |
| 4728000 | Scopulariopsis proteinase (substance) |
| 4731004 | Aluminum pyro powder (substance) |
| 4732006 | Oncogene protein P55, V-MYC (substance) |
| 4746006 | Hemoglobin Mito (substance) |
| 4761007 | Lymphocyte antigen CD30 (substance) |
| 4762000 | Platelet antigen HPA-3b (substance) |
| 4777008 | Fluroxene (substance) |
| 4780009 | Butabarbital sodium (substance) |
| 4786003 | beta-1,4-Mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase (substance) |
| 4789005 | Blood group antibody Bultar (substance) |
| 4793004 | Azobenzene reductase (substance) |
| 4814001 | Valethamate (substance) |
| 4824009 | Amine oxidase (flavin-containing) (substance) |
| 4825005 | Peptidyl-glycinamidase (substance) |
| 4831008 | Arabinose-5-phosphate isomerase (substance) |
| 4832001 | Technetium Tc^99m^ mebrofenin (substance) |
| 4833006 | Glucan endo-1,3-alpha-glucosidase (substance) |
| 4844003 | 3,3' Diiodothyronine (substance) |
| 4864008 | Adenylic acid (substance) |
| 4872005 | Glucosulfone (substance) |
| 4878009 | Human leukocyte antigen Dw3 (substance) |
| 4882006 | Ichthyoallyeinotoxin |
| 4889002 | Xylulokinase (substance) |
| 4901003 | Pyruvate oxidase (coenzyme A-acetylating) (substance) |
| 4925006 | Oncogene protein V-ABC (substance) |
| 4933007 | Lymphocyte antigen CD15 (substance) |
| 4940008 | Tattoo dye (substance) |
| 4955004 | Neoplastic structural gene (substance) |
| 4962008 | Tree bark (substance) |
| 4963003 | Neutral amino acid (substance) |
| 4965005 | Glutathione reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 4968007 | Acumentin (substance) |
| 4986005 | Magnesium borate (substance) |
| 5003005 | Hemoglobin Swan River (substance) |
| 5004004 | Blood group antibody Panzar (substance) |
| 5007006 | Papain (substance) |
| 5024000 | Fresh water (substance) |
| 5031001 | 3-3'Dichlorobenzidine (substance) |
| 5040002 | Cesium (substance) |
| 5043000 | Erythrosin Y stain (substance) |
| 5045007 | Oncogene protein TCL4 (substance) |
| 5059000 | ^97^Technetium (substance) |
| 5060005 | ^132^Cesium (substance) |
| 5061009 | Protein-methionine-S-oxide reductase (substance) |
| 5064001 | Blood group antibody D 1276 (substance) |
| 5081005 | Blood group antigen hr^B^ (substance) |
| 5086000 | Gelsolin (substance) |
| 5094007 | Blood group antigen Rios (substance) |
| 5098005 | Fennel oil |
| 5109006 | Methylated-deoxyribonucleic acid-protein-cysteine methyltransferase (substance) |
| 5142007 | Coagulation factor II Houston variant (substance) |
| 5160007 | Metallic compound (substance) |
| 5163009 | Scombrotoxin (substance) |
| 5167005 | Zinc chloride fumes (substance) |
| 5172001 | Coagulation factor Xa (substance) |
| 5179005 | Connective tissue fiber (substance) |
| 5200001 | trans-Epoxysuccinate hydrolase (substance) |
| 5206007 | Cyanate compound (substance) |
| 5220000 | Bacitracin |
| 5226006 | Flavone O^7^-beta-glucosyltransferase (substance) |
| 5250008 | Thymus-independent antigen (substance) |
| 5252000 | Hafnium radioisotope (substance) |
| 5253005 | Hemoglobin Woodville (substance) |
| 5259009 | Blood group antigen Braden (substance) |
| 5289002 | Scilliroside (substance) |
| 5303002 | Hemoglobin Hoshida (substance) |
| 5305009 | Polynucleotide (substance) |
| 5307001 | Blood group antigen Hamet (substance) |
| 5312000 | ^65^Zinc (substance) |
| 5323001 | Uridine diphosphate glucuronic acid (substance) |
| 5330007 | Actin-binding protein (substance) |
| 5339008 | L-Glycol dehydrogenase (substance) |
| 5340005 | Blood group antigen Swietlik (substance) |
| 5392001 | Propylene glycol monomethyl ether (substance) |
| 5395004 | Pyridoxamine-phosphate oxidase (substance) |
| 5404007 | Lymphocyte antigen CD45RA (substance) |
| 5405008 | ^60^Cobalt (substance) |
| 5406009 | beta-L-Arabinosidase (substance) |
| 5420002 | Accessory sinus mucus (substance) |
| 5439007 | Blood group antibody Do^a^ (substance) |
| 5442001 | Page blue 83 stain (substance) |
| 5453007 | Iridium isotope (substance) |
| 5471000 | Hemoglobin G-Coushatta (substance) |
| 5474008 | Propionate-coenzyme A ligase (substance) |
| 5477001 | Ferric subsulfate (substance) |
| 5483003 | Oxalate coenzyme A-transferase (substance) |
| 5504009 | Blood group antigen Fuerhart (substance) |
| 5511008 | Inosinate nucleosidase (substance) |
| 5513006 | Immunoglobulin A, H chain (substance) |
| 5515004 | Rhodium fumes (substance) |
| 5533005 | Blood group antibody Kp^a^ (substance) |
| 5537006 | Immunoglobulin D, H chain (substance) |
| 5540006 | Calcium (substance) |
| 5547009 | ^233^Plutonium (substance) |
| 5548004 | 2-Dehydro-3-deoxy-D-pentonate aldolase (substance) |
| 5568005 | Hemoglobin Hijiyama (substance) |
| 5573004 | Blood group antigen Oca (substance) |
| 5589001 | Licodione O^2'^-methyltransferase (substance) |
| 5590005 | Beryllium radioisotope (substance) |
| 5628003 | Hemoglobin I-High Wycombe (substance) |
| 5629006 | Cytidylic acid (substance) |
| 5637003 | Human leukocyte antigen DQw6 (substance) |
| 5641004 | Divalproex sodium (substance) |
| 5647000 | Griseofulvin ultramicrosize (substance) |
| 5656008 | ^116m^Antimony (substance) |
| 5657004 | Coal tar topical solution (substance) |
| 5659001 | Hemoglobin J-Tongariki (substance) |
| 5670008 | Gold isotope (substance) |
| 5681006 | Ceftizoxime sodium (substance) |
| 5691000 | Absorbable gelatin sponge (substance) |
| 5692007 | Cyanocobalamin Co^58^ (substance) |
| 5699003 | Somatomedin C |
| 5700002 | Blood group antibody Gomez (substance) |
| 5702005 | ^106m^Silver (substance) |
| 5704006 | Galactokinase (substance) |
| 5705007 | 1,3-Propanediol dehydrogenase (substance) |
| 5739006 | Stramonium (substance) |
| 5746002 | ^118m^Antimony (substance) |
| 5757007 | Human leucocyte antigen Cw8 |
| 5762008 | Heterogeneous nuclear ribonucleic acid (substance) |
| 5764009 | ^242^Plutonium (substance) |
| 5767002 | Sulfamerazine (substance) |
| 5774007 | White petrolatum (substance) |
| 5800007 | Transfer ribonucleic acid (5-methylaminomethyl-2-thiouridylate)-methyltransferase (substance) |
| 5813001 | Malate dehydrogenase (substance) |
| 5826002 | Ethyl-4-bis-(hydroxypropyl)-1-aminobenzoate (substance) |
| 5827006 | Crotonaldehyde (substance) |
| 5829009 | Hemoglobin Vaasa (substance) |
| 5830004 | Hemoglobin Bart (substance) |
| 5840001 | Blood group antibody Wj (substance) |
| 5858007 | ^110m^Indium (substance) |
| 5863006 | Vitexin beta-glucosyltransferase (substance) |
| 5896008 | Hellebrin (substance) |
| 5899001 | Bacterial structural gene (substance) |
| 5907009 | Quinidine polygalacturonate (substance) |
| 5910002 | Oncogene protein PP60, V-SRC (substance) |
| 5915007 | Blood group antigen Gladding (substance) |
| 5927005 | Lactaldehyde dehydrogenase (substance) |
| 5931004 | Technetium Tc^99m^ sulfur colloid (substance) |
| 5932006 | Cysteine (substance) |
| 5950004 | 3',5'-Cyclic-nucleotide phosphodiesterase (substance) |
| 5955009 | Diethylene glycol (substance) |
| 5977008 | Blood group antigen Bullock (substance) |
| 5989005 | Immunoglobulin, GM>17< allotype (substance) |
| 5991002 | D-Fuconate dehydratase (substance) |
| 6021003 | ^88^Yttrium (substance) |
| 6038004 | Oxygen radioisotope (substance) |
| 6043006 | Bone cement (substance) |
| 6044000 | Carbon disulphide |
| 6054001 | Doxylamine succinate (substance) |
| 6056004 | Blood group antibody Wk^a^ (substance) |
| 6068008 | Blood group antigen Mil (substance) |
| 6083003 | Hydroxylysine (substance) |
| 6085005 | Synovial fluid (substance) |
| 6088007 | Benzphetamine hydrochloride (substance) |
| 6089004 | Lochia alba (substance) |
| 6091007 | Blood group antibody L Harris (substance) |
| 6107003 | Asparagusate reductase (reduced nicotinamide adenine dinucleotide) (substance) |
| 6109000 | Aromatic-amino-acid aminotransferase (substance) |
| 6115000 | Blood group antibody Anuszewska (substance) |
| 6135004 | Blood group antigen Duck (substance) |
| 6138002 | Blood group antigen Le Provost (substance) |
| 6162007 | Meclocycline (substance) |
| 6170002 | Heat labile antibody (substance) |
| 6172005 | Fatty-acid methyltransferase (substance) |
| 6178009 | Lymphocyte antigen CD63 (substance) |
| 6179001 | o-Methy-bufotenine (substance) |
| 6182006 | Chloroacetone (substance) |
| 6197009 | Blood group antigen Zd (substance) |
| 6237004 | Bemegride (substance) |
| 6249003 | Potassium metabisulfite (substance) |
| 6256009 | Ribose isomerase (substance) |
| 6257000 | Sodium chloride Na^22^ (substance) |
| 6260007 | Protokylol (substance) |
| 6261006 | Indoklon |
| 6263009 | Plant residue (substance) |
| 6264003 | Diazinon (substance) |
| 6287006 | Methidathion (substance) |
| 6291001 | Lysosomal alpha-N-acetylglucosaminidase |
| 6301006 | ^178^Tantalum (substance) |
| 6310003 | Particulate antigen (substance) |
| 6314007 | Phenol beta-glucosyltransferase (substance) |
| 6333002 | Squill extract (substance) |
| 6338006 | Imidazolonepropionase (substance) |
| 6356006 | Chlorodiallylacetamide (substance) |
| 6360009 | Kallidin II (substance) |
| 6367007 | ^95m^Technetium (substance) |
| 6386004 | N-Acetylneuraminate O^4^-acetyltransferase (substance) |
| 6394006 | Phentermine hydrochloride (substance) |
| 6401007 | Lichenase (substance) |
| 6409009 | Morpholine (substance) |
| 6411000 | Interleukin-12 (substance) |
| 6422001 | Human leukocyte antigen DRw14 (substance) |
| 6451002 | Chlorobenzilate (substance) |
| 6455006 | Chloroprene (substance) |
| 6469006 | delta^1^-Piperideine-2-carboxylate reductase (substance) |
| 6478000 | 6-Phosphofructokinase (substance) |
| 6495008 | Fibrinogen Montreal II (substance) |
| 6507009 | Blood group antigen Lu12 (substance) |
| 6513000 | Flumethiazide (substance) |
| 6516008 | Indium^111^-Fe(OH)>3< (substance) |
| 6524003 | Distilled spirits (substance) |
| 6529008 | Blood group antigen Cl^a^ (substance) |
| 6532006 | Macrophage activating factor (substance) |
| 6590001 | Galactosylceramidase (substance) |
| 6592009 | Human leukocyte antigen Dw12 (substance) |
| 6602005 | Aminacrine (substance) |
| 6611005 | Diethylaminoethanol (substance) |
| 6612003 | Chloramphenicol sodium succinate (substance) |
| 6619007 | Bilirubin Y transport protein (substance) |
| 6642000 | Opsonin (substance) |
| 6644004 | Homoserine dehydrogenase (substance) |
| 6671004 | Blood group antigen Caw (substance) |
| 6672006 | Phosphoadenylate 3'-nucleotidase (substance) |
| 6699008 | Titanium radioisotope (substance) |
| 6701008 | Lissamine fast red B stain (substance) |
| 6702001 | Ethyl mercaptoethyl diethyl thiophosphate (substance) |
| 6709005 | Gentamicin 2''-nucleotidyltransferase (substance) |
| 6710000 | Nitric oxide (substance) |
| 6713003 | ^91^Yttrium (substance) |
| 6717002 | Nifuroxime (substance) |
| 6725000 | Methylene blue stain (substance) |
| 6730001 | ^234^Uranium (substance) |
| 6741004 | Anti deoxyribonucleic acid antibody (substance) |
| 6755007 | Thymus leukemia antigen (substance) |
| 6786001 | Silver difluoride (substance) |
| 6790004 | Aminopterin (substance) |
| 6792007 | Veratrine (substance) |
| 6808006 | Ferrous iron compound (substance) |
| 6809003 | Phomopsin (substance) |
| 6814004 | Discadenine synthase (substance) |
| 6817006 | Oxidized glutathione (substance) |
| 6826009 | Sterol hormone (substance) |
| 6837005 | Propoxyphene napsylate (substance) |
| 6854002 | ^188^Platinum (substance) |
| 6865007 | Theophylline calcium salicylate (substance) |
| 6873003 | Cephapirin sodium (substance) |
| 6879004 | 5,8,11-Eicosatrienoic acid (substance) |
| 6881002 | Magnesium fumes (substance) |
| 6884005 | (S)-3-Amino-2-methylpropionate aminotransferase (substance) |
| 6890009 | 3-Deoxy-manno-octulosonate-8-phosphatase (substance) |
| 6896003 | Thiopurine methyltransferase (substance) |
| 6910009 | Sodium fluoride (substance) |
| 6911008 | Deoxycytidylate methyltransferase (substance) |
| 6916003 | Bowieine (substance) |
| 6924008 | Exopolyphosphatase (substance) |
| 6925009 | Leucine acetyltransferase (substance) |
| 6927001 | ^121^Tin (substance) |
| 6937006 | Thymidylate synthase (substance) |
| 6945001 | Blood group antigen Le^bH^ (substance) |
| 6952004 | ^121m^Tin (substance) |
| 6958000 | Blood group antibody Frando (substance) |
| 6961004 | Lysolecithin acylmutase (substance) |
| 6970001 | 4-Hydroxyproline epimerase (substance) |
| 6973004 | Chromium^51^ chloride (substance) |
| 6983000 | Acrylamide (substance) |
| 6992002 | Triflupromazine hydrochloride (substance) |
| 6993007 | Seminal fluid (substance) |
| 6999006 | Ammonium compound (substance) |
| 7008002 | beta-Carotene 15,15'-dioxygenase (substance) |
| 7018007 | Malate-coenzyme A ligase (substance) |
| 7029006 | Blood group antigen Greenlee (substance) |
| 7030001 | Globoside (substance) |
| 7034005 | Diclofenac (substance) |
| 7045008 | Lycorine (substance) |
| 7047000 | Asphyxiant atmosphere (substance) |
| 7049002 | Pyruvate carboxylase (substance) |
| 7054006 | Hemoglobin Poissy (substance) |
| 7056008 | 3-Propylmalate synthase (substance) |
| 7059001 | N-Acylneuraminate-9-phosphatase (substance) |
| 7061005 | Anthocyanidin O^3^-glucosyltransferase (substance) |
| 7070008 | Convallamarin (substance) |
| 7084003 | Fibrinogen Buenos Aires II (substance) |
| 7110002 | ^69^Germanium (substance) |
| 7120007 | Antigen (substance) |
| 7132006 | ^73^Gallium (substance) |
| 7139002 | Acid-CoA ligase (GDP-forming) |
| 7146006 | Cyclohexene oxide (substance) |
| 7152007 | Chlorthion (substance) |
| 7156005 | Phosphorus isotope (substance) |
| 7158006 | Human leukocyte antigen Dw19 (substance) |
| 7161007 | Complement component C2a (substance) |
| 7179006 | Prekallikrein (substance) |
| 7187007 | Keratoplastic agent (substance) |
| 7191002 | Methenyltetrahydrofolate cyclohydrolase (substance) |
| 7208009 | Thiol oxidase (substance) |
| 7211005 | Blood group antibody Haakestad (substance) |
| 7237008 | Galactonate dehydratase (substance) |
| 7243005 | Methyl isocyanate (substance) |
| 7269004 | Thorium (substance) |
| 7271004 | Mixed dust (substance) |
| 7280004 | Deoxythymidine diphosphate-4-dehydrorhamnose reductase (substance) |
| 7281000 | Technetium Tc^99m^ lidofenin (substance) |
| 7284008 | Mercaptan compound (substance) |
| 7294003 | tert-Butyl acetate (substance) |
| 7302008 | Ambuphylline (substance) |
| 7318002 | Bacteriochlorophyll (substance) |
| 7321000 | Pyrimidine (substance) |
| 7325009 | Lime water |
| 7327001 | Sulfurous acid |
| 7328006 | Red petrolatum (substance) |
| 7330008 | Shellac (substance) |
| 7337006 | Blood group antibody Tr^a^ (substance) |
| 7348004 | Coagulation factor II |
| 7382005 | Aminoalcohol ester (substance) |
| 7401000 | Heme-hemopexin complex (substance) |
| 7411007 | Blood group antibody HLA-B8 (substance) |
| 7427000 | Sepiapterin reductase (substance) |
| 7434003 | Erythrosin B stain (substance) |
| 7446004 | Ruthenium (substance) |
| 7451005 | Tobramycin ophthalmic agent (substance) |
| 7460002 | ^127^Tellurium (substance) |
| 7470000 | p-tert-Butyltoluene (substance) |
| 7489000 | Homocytotropic antibody (substance) |
| 7503004 | ^72^Gallium (substance) |
| 7509000 | Mannitol hexanitrate (substance) |
| 7515000 | Hepatotoxic mycotoxin (substance) |
| 7537007 | Stizolobinate synthase (substance) |
| 7547005 | Hemoglobin Lincoln Park (substance) |
| 7549008 | Fibrinogen Bethesda I (substance) |
| 7588005 | Blood group antibody Sk^a^ (substance) |
| 7608003 | Triethylene glycol (substance) |
| 7616007 | Blood group antibody Pruitt (substance) |
| 7648006 | Human leukocyte antigen Bw70 (substance) |
| 7661006 | Fish bone (substance) |
| 7670009 | Aminobutyraldehyde dehydrogenase (substance) |
| 7675004 | Blood group antigen Towey (substance) |
| 7679005 | Strong oxidizing compound (substance) |
| 7685003 | Blood group antibody Bg^c^ (substance) |
| 7696006 | Ferrovanadium dust (substance) |
| 7716001 | Isovaleryl-coenzyme A dehydrogenase (substance) |
| 7737009 | Chlortetracycline hydrochloride (substance) |
| 7738004 | Human leukocyte antigen B49 (substance) |
| 7761002 | ^111^Silver (substance) |
| 7770004 | ^89^Strontium (substance) |
| 7774008 | Neo-b-vitamin A>1< (substance) |
| 7779003 | ^103^Ruthenium (substance) |
| 7785005 | Sphingomyelin phosphodiesterase D (substance) |
| 7790008 | 1-Monoacylglycerol (substance) |
| 7791007 | Soy protein (substance) |
| 7795003 | Oxalate oxidase (substance) |
| 7801007 | Tetrahydroxypteridine cycloisomerase (substance) |
| 7816005 | Antazoline hydrochloride (substance) |
| 7834009 | Acetyl digitoxin (substance) |
| 7846008 | Sphingomyelin phosphodiesterase (substance) |
| 7848009 | 1-Phosphatidylinositol phosphodiesterase (substance) |
| 7868003 | beta-Cyclopiazonate dehydrogenase (substance) |
| 7879008 | ^218^Radon (substance) |
| 7900007 | Hemoglobin Presbyterian (substance) |
| 7904003 | 2 Dimethylaminoethanol |
| 7909008 | Arginine carboxypeptidase (substance) |
| 7924004 | Diflorasone (substance) |
| 7938006 | D-Arabinitol dehydrogenase (substance) |
| 7945006 | Orsellinate-depside hydrolase (substance) |
| 7948008 | Reed-Sternberg antibody (substance) |
| 7953003 | Thioneb (substance) |
| 7957002 | Phosphatidate cytidylyltransferase (substance) |
| 7961008 | Hemoglobin F-Shanghai |
| 7970006 | Homograft |
| 7974002 | Blood group antibody Dalman (substance) |
| 7975001 | Amiphenazole (substance) |
| 7979007 | 3'-Phosphoadenylylsulfate 3'-phosphatase (substance) |
| 7983007 | Sodium rhodanide (substance) |
| 7985000 | Sulfur isotope (substance) |
| 7997004 | Butyl mercaptan (substance) |
| 8000007 | Cucurbitacin delta^23^-reductase (substance) |
| 8002004 | Blood group antibody Fleming (substance) |
| 8025003 | Blood group antibody Gibson (substance) |
| 8029009 | Allyl glycidyl ether (substance) |
| 8030004 | Polyethylene glycol (substance) |
| 8035009 | Cholestenol delta-isomerase |
| 8048008 | Blood group antigen Th (substance) |
| 8054009 | Orotate reductase (NADPH) |
| 8055005 | Galactoside acetyltransferase (substance) |
| 8105004 | Hemoglobin Leiden (substance) |
| 8108002 | Undecaprenyl-diphosphatase (substance) |
| 8123007 | Blood group antibody Schuppenhauer (substance) |
| 8132009 | Magnesium acetylsalicylate (substance) |
| 8143001 | Diosmin (substance) |
| 8153000 | Homoproline |
| 8156008 | Immunoglobulin, Fd fragment (substance) |
| 8164002 | Lymphocyte antigen CD67 (substance) |
| 8168004 | Uracil-5-carboxylate decarboxylase (substance) |
| 8179009 | Cevadilline (substance) |
| 8184003 | Convallamarogenin (substance) |
| 8190004 | Diaminopimelate epimerase (substance) |
| 8202008 | ^43^Potassium |
| 8203003 | Human menopausal gonadotropin (substance) |
| 8204009 | Polyester |
| 8222007 | Coagulation factor II Padua variant (substance) |
| 8227001 | ^106^Ruthenium (substance) |
| 8230008 | Streptococcal cysteine proteinase (substance) |
| 8237006 | Strobane (substance) |
| 8252004 | Chlorothiazide sodium (substance) |
| 8257005 | Abnormal hemoglobin (substance) |
| 8261004 | Potassium thiosulfate (substance) |
| 8268005 | Blood group antibody Hildebrandt (substance) |
| 8270001 | Transfer ribonucleic acid adenylyltransferase (substance) |
| 8275006 | Methionine-S-oxide reductase (substance) |
| 8295000 | Uromucoid protein (substance) |
| 8300003 | Cyclohexanol (substance) |
| 8310007 | Hemoglobin Madrid (substance) |
| 8313009 | Ribonucleic acid-directed deoxyribonucleic acid polymerase (substance) |
| 8340009 | Procollagen-lysine,2-oxoglutarate 5-dioxygenase (substance) |
| 8342001 | Brilliant cresyl blue stain (substance) |
| 8343006 | Blood group antibody Re^a^ (substance) |
| 8354001 | Manganese ethylene bis-dithiocarbamate (substance) |
| 8355000 | Hafnium isotope (substance) |
| 8362009 | Blood group antibody c (substance) |
| 8365006 | Oil of pennyroyal-European (substance) |
| 8368008 | Xylan 1,44-beta-xylosidase (substance) |
| 8376005 | Antibody to antigen in Duffy blood group system (substance) |
| 8385005 | Glucan 1,4-alpha-glucosidase (substance) |
| 8397006 | Nicotine resin complex (substance) |
| 8406008 | Nitroethane oxidase (substance) |
| 8429000 | Brilliant orange stain (substance) |
| 8450009 | Oil of lemon grass (substance) |
| 8452001 | Blood group antigen Sisson (substance) |
| 8456003 | Methyl ethyl ketone peroxide (substance) |
| 8460000 | Blood group antibody Vg^a^ (substance) |
| 8473001 | Homocysteine methyltransferase |
| 8474007 | Lead oleate (substance) |
| 8484008 | Blood group antigen Mur (substance) |
| 8485009 | Oncogene protein P210, BCR-ABL (substance) |
| 8486005 | Human leukocyte antigen DRw15 (substance) |
| 8487001 | ^48^Vanadium (substance) |
| 8491006 | Complement inhibitor (substance) |
| 8492004 | Allantoicase (substance) |
| 8498000 | Short neurotoxin venom (substance) |
| 8507001 | Cyclohexane (substance) |
| 8514004 | Ornithine (substance) |
| 8520003 | Hemoglobin Machida (substance) |
| 8525008 | ^183^Osmium (substance) |
| 8529002 | Urinary protein of low molecular weight (substance) |
| 8534003 | ^110^Tin (substance) |
| 8537005 | Solution (substance) |
| 8578007 | Potassium cyanate (substance) |
| 8591008 | Dichlorodifluoromethane (substance) |
| 8612007 | Tumor necrosis factor (substance) |
| 8620009 | Oncogene protein TCL6 (substance) |
| 8631001 | Potassium chloride (substance) |
| 8653004 | Rubijervine (substance) |
| 8660005 | Complement component C3c (substance) |
| 8687009 | Gum arabic (substance) |
| 8689007 | Kanamycin sulfate (substance) |
| 8701002 | Sulfachlorpyridazine (substance) |
| 8705006 | 4-Hydroxybenzoate decarboxylase |
| 8731008 | Blood group antibody Austin (substance) |
| 8740007 | C3(H20)Bb (substance) |
| 8761000 | Adenylylsulfate kinase (substance) |
| 8767001 | Santonin (substance) |
| 8785008 | Chlorine dioxide (substance) |
| 8786009 | Blood group antigen Wd^a^ (substance) |
| 8795001 | Hemoglobin F (substance) |
| 8817004 | Luteinizing hormone receptor site (substance) |
| 8818009 | Blood group antibody Tri W (substance) |
| 8822004 | Linoleic acid (substance) |
| 8830003 | Nitrate reductase [NAD(P)H] (substance) |
| 8836009 | Gallocyanine stain (substance) |
| 8844009 | Hydroxybutyrate-dimer hydrolase (substance) |
| 8858006 | Strontium nitrate Sr^85^ (substance) |
| 8865003 | Natural graphite (substance) |
| 8878003 | Blood group antigen Evelyn (substance) |
| 8882001 | 3-Hydroxybenzoate 6-monooxygenase (substance) |
| 8886003 | Flecainide acetate (substance) |
| 8908003 | Blood group antibody I^T^ (substance) |
| 8914005 | Endolymph (substance) |
| 8919000 | Biotin (substance) |
| 8926000 | Azure B stain (substance) |
| 8945009 | Phosphopantothenate-cysteine ligase |
| 8953001 | 2,3-Dihydroxyindole 2,3-dioxygenase (substance) |
| 8963009 | N-Acetylmuramoyl-L-alanine amidase (substance) |
| 8969008 | Bulbourethral secretions (substance) |
| 8977007 | Blood group antibody Tarplee (substance) |
| 8982000 | Oleate hydratase (substance) |
| 8987006 | Cycle-phase specific agent (substance) |
| 8991001 | Ribulokinase |
| 9010006 | Methyl blue stain (substance) |
| 9013008 | Dephospho-coenzyme A kinase (substance) |
| 9021002 | Carbaryl (substance) |
| 9024005 | Glucose-6-phosphate dehydrogenase (substance) |
| 9045003 | Radon radioisotope (substance) |
| 9052001 | Allspice oil (substance) |
| 9054000 | Blood group antigen HLA-B15 (substance) |
| 9103003 | Retinol fatty-acyltransferase (substance) |
| 9110009 | Mercuric compound (substance) |
| 9125009 | Sempervirine (substance) |
| 9159008 | Triacetate-lactonase (substance) |
| 9172009 | Blood group antibody Alda |
| 9174005 | Fibrinogen Poitiers |
| 9183000 | beta-N-Acetylgalactosaminidase (substance) |
| 9189001 | Cytidine monophosphate-N-acetylneuraminate-lactosylceramide alpha-2,3-sialyltransferase (substance) |
| 9195000 | Immunoglobulin gene INV allotype (substance) |
| 9197008 | Apiose reductase (substance) |
| 9205004 | Hemoglobin Tarrant (substance) |
| 9220005 | Plant phenol oil (substance) |
| 9223007 | Borneol dehydrogenase (substance) |
| 9234005 | Chlorobutanol (substance) |
| 9246009 | ^118^Tellurium (substance) |
| 9253000 | HLA-DRw16 antigen |
| 9270008 | Catecholamine receptor (substance) |
| 9271007 | Fibrinogen Pontoise (substance) |
| 9296005 | Gamma interferon (substance) |
| 9301005 | Lens neutral proteinase (substance) |
| 9302003 | Gentisate decarboxylase (substance) |
| 9315007 | Spearmint oil (substance) |
| 9319001 | Blood group antibody Vennera (substance) |
| 9334007 | Isopropyl glycidyl ether (substance) |
| 9349004 | Nitrobenzene (substance) |
| 9351000 | ^103^Palladium (substance) |
| 9355009 | Hemoglobin F-Alexandra (substance) |
| 9392009 | Blood group antibody Pollio (substance) |
| 9396007 | ^60^Iron (substance) |
| 9398008 | Blood group antigen Pillsbury |
| 9410003 | Bromoform (substance) |
| 9422000 | High density lipoprotein (substance) |
| 9457002 | Fibrinogen Almeria (substance) |
| 9471005 | Polypropylene glycol (substance) |
| 9472003 | Blood group antigen Schneider (substance) |
| 9477009 | Adenosine triphoshate pyrophosphatase (substance) |
| 9485000 | Glucuronosyl-disulfoglucosamine glucuronidase (substance) |
| 9493000 | Homologous antigen |
| 9507008 | ^238^Uranium (substance) |
| 9508003 | Hemoglobin F-Kotobuki (substance) |
| 9530002 | Amine hormone (substance) |
| 9532005 | Coagulation factor XIIIa (substance) |
| 9539001 | Chlorprothixene lactate (substance) |
| 9549003 | Hemoglobin F-Albaicin (substance) |
| 9556009 | Cholesterol acyltransferase (substance) |
| 9582000 | Alanine racemase (substance) |
| 9588001 | beta-Phosphoglucomutase (substance) |
| 9608008 | Blood group antigen Noble (substance) |
| 9623003 | 6-Phosphofructo-2-kinase (substance) |
| 9630009 | Poly(ribitol-phosphate) N-acetylglucosaminyltransferase (substance) |
| 9639005 | Bromine compound (substance) |
| 9643009 | Chlorphentermine (substance) |
| 9663002 | Pecazine |
| 9664008 | Di-sec-octyl phthalate (substance) |
| 9672005 | MNS3 (ISBT symbol) |
| 9675007 | Coniferyl-alcohol glucosyltransferase (substance) |
| 9676008 | Fibrinogen New York III (substance) |
| 9680003 | Central depressant (substance) |
| 9695001 | Hemoglobin J-Camaguey (substance) |
| 9701007 | Blood group antibody Pr>3< (substance) |
| 9716005 | Blood group antibody Luke (substance) |
| 9721008 | Phencyclidine (substance) |
| 9765000 | Lithium salt (substance) |
| 9797000 | Phosphorus trichloride |
| 9817005 | Mycoplasma pulmonis antibody test kit (substance) |
| 9821003 | Methylthioadenosine nucleosidase (substance) |
| 9830006 | ^200^Thallium (substance) |
| 9865006 | Deoxyhemoglobin (substance) |
| 9871000 | D-Amino-acid acetyltransferase (substance) |
| 9885005 | Mannitol-1-phosphatase (substance) |
| 9890008 | Microsomal P450 Flavoprotein-linked monooxygenase |
| 9900004 | Phenylalanine (histidine) aminotransferase (substance) |
| 9910008 | Oxymetazoline hydrochloride (substance) |
| 9913005 | Arachidic acid (substance) |
| 9921004 | Blood group antibody 'N' (substance) |
| 9923001 | Phenylalanine 4-monooxygenase (substance) |
| 9928005 | alpha-Dextrin endo-1,6-alpha-glucosidase (substance) |
| 9930007 | Blood group antigen Hartley (substance) |
| 9955001 | Oil of juniper wood (substance) |
| 9969001 | alpha-Glutamyl-glutamate dipeptidase (substance) |
| 9974009 | Angiotensin (substance) |
| 9975005 | Arabinan endo-1,5-alpha-L-arabinosidase (substance) |
| 9980001 | Lymphocyte antigen CDw75 (substance) |
| 9981002 | Lactate-malate transhydrogenase (substance) |
| 9985006 | Desarginisated complement enzyme (substance) |
| 9986007 | Tryptophanase (substance) |
| 9992001 | Molybdenum radioisotope (substance) |
| 10016008 | Bithionol (substance) |
| 10020007 | Biperiden hydrochloride (substance) |
| 10031004 | Vulvar secretions (substance) |
| 10034007 | Formyltetrahydrofolate deformylase (substance) |
| 10039002 | ^210m^Bismuth (substance) |
| 10043003 | D-Alanine-alanyl-poly(glycerolphosphate) ligase (substance) |
| 10063005 | Inorganic pyrophosphatase (substance) |
| 10067006 | Phosphatidylethanolamine methyltransferase (substance) |
| 10097003 | Ribose-5-phosphate-ammonia ligase (substance) |
| 10102000 | Plant enzyme (substance) |
| 10105003 | Active C3bBbC3b (substance) |
| 10109009 | Fibrinogen London III (substance) |
| 10126003 | Awn (substance) |
| 10133003 | Cyclizine lactate (substance) |
| 10150001 | Uraninite (substance) |
| 10158008 | Blood group antigen K13 |
| 10160005 | Formiminotetrahydrofolate cyclodeaminase (substance) |
| 10162002 | 3beta-Hydroxysteroid dehydrogenase (substance) |
| 10168003 | Immunoglobulin kappa light chain gene (substance) |
| 10174003 | Procarbazine hydrochloride (substance) |
| 10189007 | Conglutinin (substance) |
| 10192006 | Prostaglandin PGF2 (substance) |
| 10202007 | Prostaglandin PGE3 (substance) |
| 10228005 | Blood group antibody Mil (substance) |
| 10229002 | Hemoglobin Kenya (substance) |
| 10240005 | Lethanes (substance) |
| 10247008 | Chrysoidine R stain (substance) |
| 10249006 | Agar (substance) |
| 10265007 | Blood group antibody Jobbins (substance) |
| 10270000 | Erythromycin estolate (substance) |
| 10282009 | Betahistidine (substance) |
| 10308009 | ^42^Argon (substance) |
| 10313008 | Phenylmercuric nitrate (substance) |
| 10319007 | Throat anti-inflammatory agent (substance) |
| 10324005 | Demeclocycline hydrochloride (substance) |
| 10329000 | Zinc insulin (substance) |
| 10333007 | Clobenoside (substance) |
| 10336004 | Ribosylnicotinamide kinase (substance) |
| 10342000 | Heparin cofactor II (substance) |
| 10354000 | Somantin (substance) |
| 10357007 | Arsenite compound (substance) |
| 10373001 | beta-1,3-Galactosyl-o-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase (substance) |
| 10377000 | Sodium nitrite (substance) |
| 10393009 | Human leukocyte antigen Dw20 |
| 10397005 | Protein-lysine 6-oxidase (substance) |
| 10398000 | Blood group antibody iH (substance) |
| 10407003 | Hemoglobin F-Xin-Su (substance) |
| 10419006 | Thorium isotope (substance) |
| 10424009 | Maprotiline hydrochloride (substance) |
| 10430009 | Benzpyrene (substance) |
| 10436003 | Blood group antibody Ad (substance) |
| 10440007 | Human leukocyte antigen class II (substance) |
| 10450008 | Glucose-1-phosphate phosphodismutase (substance) |
| 10466005 | Phosphide compound (substance) |
| 10471003 | Fibrinogen Vienna (substance) |
| 10473000 | Complement component C3 (substance) |
| 10488005 | Hemoglobin F-Cobb (substance) |
| 10490006 | Thymidine-triphosphatase (substance) |
| 10500003 | Xanthinol (substance) |
| 10508005 | Tetramine toxin (substance) |
| 10511006 | Monuron (substance) |
| 10534002 | Thyrotropin releasing factor (substance) |
| 10550005 | Dipotassium salt of endothall (substance) |
| 10560001 | Blood group antibody By (substance) |
| 10570004 | Blood group antigen Sf^a^ (substance) |
| 10581001 | Hemoglobin Grange-Blanche (substance) |
| 10595003 | Pseudoephedrine sulfate (substance) |
| 10622000 | Blood group antibody Gilbraith (substance) |
| 10627006 | Gliocladium proteinase (substance) |
| 10641002 | 3-Phosphoshikimate 1-carboxyvinyltransferase (substance) |
| 10644005 | Black phosphorus (substance) |
| 10645006 | ^207m^Lead (substance) |
| 10660009 | Luteoskyrin (substance) |
| 10669005 | Lectin (substance) |
| 10682002 | Fibrinogen Grand Rapids (substance) |
| 10685000 | Type I site-specific deoxyribonuclease (substance) |
| 10691003 | Biliverdin reductase (substance) |
| 10710009 | Anilazine (substance) |
| 10730008 | Azlocillin sodium (substance) |
| 10738001 | ^86^Yttrium (substance) |
| 10740006 | Sudan blue stain (substance) |
| 10750007 | Neurotoxic mycotoxin (substance) |
| 10751006 | Netilmicin sulfate (substance) |
| 10767000 | Calcium phosphate dibasic (substance) |
| 10781003 | Sodium phosphate P^32^ (substance) |
| 10782005 | Pentagastrin (substance) |
| 10790005 | ^53^Manganese (substance) |
| 10796004 | Glucose-6-phosphate (substance) |
| 10827009 | Milk protein (substance) |
| 10838009 | Adenosine diphosphate phosphoglycerate phosphatase (substance) |
| 10843002 | Anterior pituitary hormone (substance) |
| 10862004 | Oncogene protein neu (substance) |
| 10889009 | Blood group antigen Tc^a^ (substance) |
| 10912008 | Blood group antigen Le^a^ (substance) |
| 10914009 | Cyanamide hydratase (substance) |
| 10931002 | Tryptophan 2'-dioxygenase (substance) |
| 10938008 | Thionyl chloride |
| 10944007 | Taurine (substance) |
| 10949002 | alpha-Mannosidase (substance) |
| 10952005 | Antimony compound (substance) |
| 10955007 | Factor X antibody (substance) |
| 10976002 | Dinitrobenzene isomer (substance) |
| 10987005 | Platelet-derived growth factor (substance) |
| 11004008 | Blood group antigen Ge3 (substance) |
| 11022006 | Blood group antibody Cr2 (substance) |
| 11036001 | Alum (substance) |
| 11038000 | Limonene (substance) |
| 11041009 | Blood group antibody Dr^a^ (substance) |
| 11058004 | ^111^Palladium (substance) |
| 11064006 | Blood group antigen Lu^b^ (substance) |
| 11066008 | Sodium ethyl xanthate (substance) |
| 11069001 | Azure C stain (substance) |
| 11085006 | 2-Methylserine hydroxymethyltransferase |
| 11091008 | Blood group antibody Madden (substance) |
| 11111005 | Fructan beta-fructosidase (substance) |
| 11115001 | Thromboxane A>2< (substance) |
| 11121002 | ^135^Iodine (substance) |
| 11123004 | Blood group antigen Simpson (substance) |
| 11136004 | Methoxyflurane (substance) |
| 11137008 | Chymotrypsin (substance) |
| 11151008 | Immunoglobulin D (substance) |
| 11170003 | Vanillin (substance) |
| 11199008 | Phosphatidyl glycerol (substance) |
| 11201005 | Solochrome black 6B stain (substance) |
| 11202003 | Manganese salt (substance) |
| 11203008 | Marsh gas |
| 11206000 | Hemoglobin Hikari (substance) |
| 11220007 | Ileal juice (substance) |
| 11222004 | Blood group antigen Ge1 (substance) |
| 11233001 | Public blood group antigen (substance) |
| 11238005 | Caprolactam (substance) |
| 11239002 | Urate-ribonucleotide phosphorylase (substance) |
| 11252007 | Blood group antigen Sa (substance) |
| 11253002 | Boron trioxide (substance) |
| 11257001 | Nitrogen compound (substance) |
| 11259003 | Cassaine (substance) |
| 11264004 | Sulfated fatty alcohol (substance) |
| 11267006 | IL-10 |
| 11289005 | Cytidine monophosphate-N-acetylneuraminate-monosialoganglioside sialyltransferase (substance) |
| 11298008 | Hemoglobin Riyadh (substance) |
| 11307006 | 2-Acetyl amino fluorine (substance) |
| 11311000 | Pus (substance) |
| 11312007 | Pyruvic-malic carboxylase |
| 11320009 | Sucrose (substance) |
| 11323006 | Methyl mercuric dicyanodiamine (substance) |
| 11330000 | Platelet antibody HPA-4b (substance) |
| 11331001 | ^56^Cobalt (substance) |
| 11345007 | Tribromsalan (substance) |
| 11353004 | Glomerular basement membrane antibody (substance) |
| 11355006 | Hemoglobin Alabama (substance) |
| 11370007 | Carbarsone (substance) |
| 11392006 | Aminoglycoside N^6'^-acetyltransferase (substance) |
| 11416006 | Cypridina-luciferin 2-monooxygenase (substance) |
| 11420005 | Rhubarb agent (substance) |
| 11425000 | Glycopeptide alpha-N-acetylgalactosaminidase (substance) |
| 11427008 | 2-Hydroxy-4-carboxymuconate-6-semialdehyde dehydrogenase (substance) |
| 11439000 | Vas deferens secretions (substance) |
| 11447000 | Antibody to hepatitis B core antigen, immunoglobulin M type (substance) |
| 11453000 | Cerebroventricular fluid (substance) |
| 11462003 | Ostomy appliance adhesive (substance) |
| 11473005 | Trichlormethiazide (substance) |
| 11474004 | Blood group antibody French |
| 11479009 | Blood group antibody Ok^a^ (substance) |
| 11489008 | Blood group antigen Nickolai (substance) |
| 11490004 | Hemoglobin Bari (substance) |
| 11496005 | Mercuric chloride (substance) |
| 11504003 | Edrophonium chloride (substance) |
| 11525003 | Silver citrate (substance) |
| 11526002 | Aspartame (substance) |
| 11555005 | Boron compound (substance) |
| 11566003 | Blood group antibody Braden (substance) |
| 11576000 | Cyclohexylamine (substance) |
| 11587008 | Deoxythymidine diphosphate-4-amino-4,6-dideoxygalactose aminotransferase (substance) |
| 11589006 | Copper acetoarsenite (substance) |
| 11594006 | Blood group antigen hr^s^ (substance) |
| 11600003 | Blood group antibody Terrell (substance) |
| 11605008 | Uridine diphosphate glucose 4-epimerase (substance) |
| 11621003 | Organic metallic compound (substance) |
| 11622005 | Cyclopamine (substance) |
| 11633008 | Flurbiprofen sodium (substance) |
| 11643006 | Phosphoenolpyruvate carboxykinase (adenosine triphosphate) (substance) |
| 11644000 | Piperacillin sodium (substance) |
| 11645004 | Lyon's blue |
| 11652002 | Vasoactive intestinal peptide (substance) |
| 11684009 | Blood group antigen Kennedy (substance) |
| 11699009 | Petroleum (substance) |
| 11702002 | bis-(p-Chlorophenyl) ethanol (substance) |
| 11713004 | Water (substance) |
| 11714005 | Strong silver protein (substance) |
| 11715006 | ^4^Helium (substance) |
| 11725001 | Blood group antigen Gould (substance) |
| 11727009 | Indophenol from naphthol stain (substance) |
| 11734006 | Bis (5'-guanosyl) tetraphosphatase (substance) |
| 11735007 | T>2<-induced deoxynucleotide kinase (substance) |
| 11741000 | 2-Nitro-1,1-bis (p-chlorophenyl) propane (substance) |
| 11742007 | Samarandin toxin (substance) |
| 11744008 | Blood group antigen Knudsen (substance) |
| 11761006 | Hemoglobin Duarte (substance) |
| 11770009 | Blood group antigen Fy^a^ (substance) |
| 11780008 | Durazol red stain (substance) |
| 11799004 | Blood group antibody Donaldson (substance) |
| 11825009 | Endomysial antibody (substance) |
| 11831007 | Dichloroethyl ether (substance) |
| 11863001 | Blood group antigen Ls^a^ (substance) |
| 11869002 | 2,4-Diaminophenol hydrochloride (substance) |
| 11873004 | Carbon monoxide dehydrogenase (substance) |
| 11877003 | Human leukocyte antigen DRw10 (substance) |
| 11880002 | Hemoglobin Andrew-Minneapolis (substance) |
| 11886008 | Blood group antibody Mckeever (substance) |
| 11891009 | Breath (substance) |
| 11894001 | Clostridium botulinum toxin (substance) |
| 11907003 | Ethylamine (substance) |
| 11943009 | Hydroxydione (substance) |
| 11965009 | Difluorodibromomethane (substance) |
| 11966005 | Dimethylaniline (substance) |
| 11968006 | Formate dehydrogenase (cytochrome) (substance) |
| 11984007 | 1, Hydroxy cholecalciferol (substance) |
| 11986009 | Penicillin G potassium (substance) |
| 11989002 | Plant azoxy glycoside (substance) |
| 11996000 | Platinum compound (substance) |
| 12001002 | Thionine stain (substance) |
| 12009000 | Coagulation factor IX Chapel Hill variant (substance) |
| 12015000 | Magnesium carbonate hydroxide (substance) |
| 12016004 | Creatine kinase isoenzyme, MB fraction (substance) |
| 12018003 | Trichophyton extract skin test (substance) |
| 12030009 | Sudan II stain (substance) |
| 12034000 | Coagulation factor II Salatka variant (substance) |
| 12079001 | Hemoglobin J-Meerut (substance) |
| 12085008 | 1,3-beta-Glucan synthase (substance) |
| 12086009 | Hemoglobin G-Hsi-Tsou (substance) |
| 12103002 | Human leukocyte antigen B45 (substance) |
| 12112000 | Neon (substance) |
| 12117006 | 5-Methyltetrahydrofolate-homocysteine methyltransferase (substance) |
| 12119009 | Water soluble nigrosine stain (substance) |
| 12147008 | Serratia marcescans nuclease (substance) |
| 12148003 | Hemoglobin Avicenna (substance) |
| 12160002 | Loganate methyltransferase (substance) |
| 12171001 | Cutting oil (substance) |
| 12177002 | Pseudoephedrine hydrochloride (substance) |
| 12186007 | Radioactive gas (substance) |
| 12190009 | Blood group antibody Lazicki (substance) |
| 12194000 | Leukotriene (substance) |
| 12203005 | Prenyl-pyrophosphatase (substance) |
| 12206002 | Glutamine-fructose-6-phosphate aminotransferase (isomerizing) (substance) |
| 12208001 | Syrosingopine (substance) |
| 12216005 | Hemoglobin F-Malta I (substance) |
| 12218006 | Diltiazem hydrochloride (substance) |
| 12233003 | Diphenylamine (substance) |
| 12235005 | Hemoglobin Zambia (substance) |
| 12290003 | Emetine hydrochloride (substance) |
| 12292006 | Californium (substance) |
| 12315006 | Halazone (substance) |
| 12353001 | Adenosine monophosphate deaminase (substance) |
| 12358005 | Citronella oil (substance) |
| 12366001 | Hemoglobin Hope (substance) |
| 12374000 | Hemoglobin Pasadena (substance) |
| 12375004 | Krypton (substance) |
| 12379005 | Blood group antibody Do^b^ (substance) |
| 12391001 | Dextran 70 |
| 12414006 | Osmium isotope (substance) |
| 12426001 | Methylglutamate dehydrogenase (substance) |
| 12433001 | p-Chlorophenyl-p-chlorobenzyl sulfide (substance) |
| 12438005 | Dilan (substance) |
| 12439002 | Carnosine N-methyltransferase (substance) |
| 12448007 | Whelk poison (substance) |
| 12457001 | Hemoglobin Evanston (substance) |
| 12465003 | Hemoglobin Suan-Dok (substance) |
| 12474001 | Long neurotoxin venom (substance) |
| 12485004 | Glycerol-1,2-cyclic-phosphate 2-phosphodiesterase (substance) |
| 12487007 | Printing ink |
| 12490001 | Potassium hypochlorite (substance) |
| 12498008 | Blood group antibody Kn^b^ (substance) |
| 12499000 | Cord blood (substance) |
| 12502001 | Cedar oil (substance) |
| 12503006 | Aluminum (substance) |
| 12509005 | Galactoside 2-L-fucosyltransferase (substance) |
| 12510000 | Eucalyptus oil (substance) |
| 12525000 | Tybamate (substance) |
| 12542006 | Ethyl butyl ketone (substance) |
| 12564002 | Human leukocyte antigen class III (substance) |
| 12567009 | Fire retardant (substance) |
| 12568004 | Belladonnine (substance) |
| 12577006 | Blood group antibody Ch^a^ (substance) |
| 12578001 | Erythromycin ethylsuccinate (substance) |
| 12597001 | Tin (substance) |
| 12598006 | Arachidonate 5-lipoxygenase (substance) |
| 12614000 | Serine-transfer ribonucleic acid ligase (substance) |
| 12627001 | Macrophage chemotactic factor (substance) |
| 12641005 | Boron tribromide (substance) |
| 12642003 | Artificial antigen (substance) |
| 12648004 | Leukocyte function associated antigen-1 adhesive protein (substance) |
| 12671002 | Clostridium difficile toxin (substance) |
| 12684006 | Glutamate-ammonia ligase (substance) |
| 12685007 | Blood group antigen Wiley (substance) |
| 12689001 | Magnesium radioisotope (substance) |
| 12710003 | Hematoxylin |
| 12714007 | Cysteine dioxygenase (substance) |
| 12716009 | Aluminum carbonate (substance) |
| 12743004 | Thorium oxide (substance) |
| 12750000 | ^182^Hafnium (substance) |
| 12752008 | Blood group antibody HLA-A7 (substance) |
| 12753003 | Blood group antibody Fr^a^ (substance) |
| 12754009 | L-Lactate dehydrogenase (cytochrome) (substance) |
| 12756006 | Sulfur agent (substance) |
| 12788003 | Hemoglobin Sunshine Seth (substance) |
| 12790002 | (S)-6-Hydroxynicotine oxidase (substance) |
| 12798009 | Cicutoxin (substance) |
| 12801003 | Iodamide meglumine (substance) |
| 12821002 | Clemizole (substance) |
| 12823004 | Altronate dehydratase (substance) |
| 12860000 | Hemoglobin Shepherds Bush (substance) |
| 12870003 | Coagulation factor IX Durham variant (substance) |
| 12878005 | Thiophene (substance) |
| 12899008 | Blood group antibody Lu^a^ (substance) |
| 12915002 | Nerve growth factor |
| 12917005 | Steryl-sulfatase (substance) |
| 12930006 | Calcium phosphate dibasic dihydrate (substance) |
| 12934002 | Human leukocyte antigen Cw7 (substance) |
| 12937009 | Glucoside 3-dehydrogenase (substance) |
| 12940009 | ^7^Beryllium (substance) |
| 12950005 | Putrescine methyltransferase (substance) |
| 12970004 | Inositol hexanitrate (substance) |
| 12977001 | Deuterium oxide (substance) |
| 12984009 | Inulin fructotransferase (depolymerizing) |
| 12995003 | Bagasse (substance) |
| 12998001 | Blood group antibody Mineo (substance) |
| 13005000 | Hemoglobin New York (substance) |
| 13006004 | Oil of cajuput (substance) |
| 13012009 | Nucleoside phosphotransferase (substance) |
| 13016007 | Blood group antigen Li^a^ (substance) |
| 13030002 | Piperocaine (substance) |
| 13032005 | Pentanamidase (substance) |
| 13074000 | Acetoin racemase (substance) |
| 13083005 | Eosinophilic chemotactic factor (substance) |
| 13105002 | Hepatitis B surface antigen subtype ayr (substance) |
| 13121007 | gamma-Linolenic acid (substance) |
| 13134008 | trans-1,2-Dihydrobenzene-1,2-diol dehydrogenase (substance) |
| 13143004 | Glycosaminoglycan galactosyltransferase (substance) |
| 13150000 | Animal fat (substance) |
| 13185000 | Pyrogallol 1,2-oxygenase (substance) |
| 13188003 | Tobramycin sulfate (substance) |
| 13195007 | Immunoglobulin IgA2, H chain (substance) |
| 13198009 | Uridine diphosphate (UDP)-N-acetylmuramoylpentapeptide-lysine N^6^-alanyltransferase (substance) |
| 13230006 | Farnesyl-diphosphate farnesyltransferase (substance) |
| 13232003 | Achromobacter proteinase I (substance) |
| 13235001 | Riboflavin |
| 13237009 | ^131^Cesium (substance) |
| 13240009 | Hemoglobin Warwickshire (substance) |
| 13241008 | ^106m^Rhodium (substance) |
| 13245004 | Aspartate kinase (substance) |
| 13251009 | Cardiac depressant agent (substance) |
| 13287002 | Bromoxynil (substance) |
| 13293005 | Galactarate dehydratase (substance) |
| 13294004 | ^242^Americium (substance) |
| 13295003 | Urocanate hydratase (substance) |
| 13304005 | Ribose-phosphate pyrophosphokinase (substance) |
| 13305006 | Perillyl-alcohol dehydrogenase (substance) |
| 13342004 | Diethyl 2-chlorovinyl phosphate (substance) |
| 13373000 | Serine-phosphoethanolamine synthase (substance) |
| 13377004 | Blood group antigen Vw (substance) |
| 13393008 | Antimony trichloride (substance) |
| 13400000 | Human leukocyte antigen Bw65 (substance) |
| 13422007 | ^117^Tellurium (substance) |
| 13435003 | Blood group antibody Cs^a^ (substance) |
| 13477003 | Lysozyme (substance) |
| 13484006 | Blood group antibody NOR (substance) |
| 13489001 | Methoxyethyl mercuriacetate (substance) |
| 13492002 | Blood group antibody Di^b^ (substance) |
| 13494001 | Kynurenine-glyoxylate aminotransferase (substance) |
| 13501003 | Erythritol kinase (substance) |
| 13502005 | Hydroxychloroquine sulphate |
| 13523004 | Protium (substance) |
| 13524005 | Grease (substance) |
| 13531009 | Butyl alcohol (substance) |
| 13539006 | Blood group antibody Sharp (substance) |
| 13541007 | N-Acetylneuraminate lyase (substance) |
| 13571004 | Blood group antibody Stevenson (substance) |
| 13577000 | Nut (substance) |
| 13579002 | 1-Naththylamine (substance) |
| 13585009 | Cefotetan (substance) |
| 13590007 | Blood group antibody Kosis (substance) |
| 13597005 | Dihydroxy-acid dehydratase (substance) |
| 13598000 | Cytidine monophosphate-N-acetylneuraminate-N-acetyllactosaminide alpha-2,3-sialyltransferase (substance) |
| 13602003 | ^209^Thallium (substance) |
| 13618009 | Hemoglobin Twin Peaks (substance) |
| 13625002 | Human leukocyte antigen A24 (substance) |
| 13626001 | Selenium^75^-homocholic acid taurine (substance) |
| 13634007 | Fructose-6-phosphate phosphoketolase (substance) |
| 13652007 | Silicone (substance) |
| 13659003 | Benzquinamide (substance) |
| 13668001 | Propylene glycol (substance) |
| 13676004 | Creolin (substance) |
| 13696007 | Immunoglobulin lambda light chain gene (substance) |
| 13701000 | Blood group antigen E. Amos (substance) |
| 13708006 | Rectified pine tar oil (substance) |
| 13717006 | Blood group antibody McCall (substance) |
| 13718001 | Immunoglobulin, variable region (substance) |
| 13722006 | Cymarin |
| 13723001 | Blood group antigen Man (substance) |
| 13727000 | Human immunodeficiency virus receptor (substance) |
| 13739008 | Gallate decarboxylase (substance) |
| 13744001 | Methyl red stain (substance) |
| 13772008 | Blood group antibody Middel (substance) |
| 13774009 | Ribosomal ribonucleic acid (substance) |
| 13780001 | Sphinganine-1-phosphate aldolase (substance) |
| 13781002 | alpha Amino isobutyric acid (substance) |
| 13784005 | Pyruvic acid (substance) |
| 13786007 | Pyrophosphate-fructose-6-phosphate 1-phosphotransferase (substance) |
| 13787003 | Protein secretory trypsin inhibitor (substance) |
| 13788008 | Dinitrobutyl phenol (substance) |
| 13789000 | Coal tar creosote (substance) |
| 13799005 | Plasmanylethanolamine desaturase (substance) |
| 13804000 | Amidinoaspartase (substance) |
| 13818007 | Cork (substance) |
| 13827008 | Boron trifluoride (substance) |
| 13833004 | Daminozide (substance) |
| 13835006 | Bile-salt sulfotransferase (substance) |
| 13841004 | Leukotriene C (substance) |
| 13858009 | alpha>1x< Glycoprotein (substance) |
| 13863008 | Arabinose (substance) |
| 13864002 | Haemoglobin A>2< Roosevelt |
| 13872000 | Blood group antibody Fuller (substance) |
| 13884003 | Phenyl mercuric acetate (substance) |
| 13887005 | ^190m^Osmium (substance) |
| 13903005 | Pectinesterase (substance) |
| 13919003 | Indole 2,3-dioxygenase (substance) |
| 13925004 | Deoxyribonucleic acid, double stranded (substance) |
| 13931001 | Osmium tetroxide (substance) |
| 13932008 | Undecaprenyl-phosphate mannosyltransferase (substance) |
| 13952009 | Oil of hops (substance) |
| 13961009 | Hemoglobin Wayne (substance) |
| 13967008 | Methylcholanthrene (substance) |
| 13979008 | Bromic acid (substance) |
| 13999002 | Thetin-homocysteine methyltransferase (substance) |
| 14006006 | Ethylene oxide (substance) |
| 14013006 | Guanadrel sulfate (substance) |
| 14057005 | Ficin (substance) |
| 14060003 | Catechol (substance) |
| 14071002 | ^90^Strontium (substance) |
| 14090005 | Blood group antigen N (substance) |
| 14092002 | Tyramine (substance) |
| 14097008 | Halogen compound (substance) |
| 14101004 | Indoleacetylglucose-inositol acyltransferase (substance) |
| 14104007 | Blood group antigen O'Connor |
| 14120002 | Rodenticide (substance) |
| 14125007 | Serine (substance) |
| 14132003 | Silicon carbide (substance) |
| 14139007 | Arginine glutamate (substance) |
| 14146003 | Potassium isotope (substance) |
| 14148002 | L-Pipecolate dehydrogenase (substance) |
| 14172007 | Intrinsic factor concentrate agent (substance) |
| 14190008 | Blood group antibody T (substance) |
| 14193005 | Sulfobromophthalein (substance) |
| 14195003 | Mercury isotope (substance) |
| 14213001 | ^47^Calcium (substance) |
| 14226002 | Blood group antigen Friedberg (substance) |
| 14228001 | Dolichyl-phosphate-mannose-protein mannosyltransferase (substance) |
| 14231000 | Aliphatic unsaturated hydrocarbon (substance) |
| 14263006 | Prepared fish |
| 14271005 | Blood group antigen Gon (substance) |
| 14279007 | Blood group antibody Epi (substance) |
| 14285000 | Coagulation factor XI variant type III (substance) |
| 14306003 | 1L-myo-Inositol-1-phosphatase (substance) |
| 14312008 | Vitamin L>2< |
| 14321009 | Captafol (substance) |
| 14330001 | Gold radioisotope (substance) |
| 14334005 | Transfer ribonucleic acid (uracil-5)-methyltransferase (substance) |
| 14338008 | Peptidoglycan beta-N-acetylmuramidase (substance) |
| 14340003 | Ipoveratril hydrochloride |
| 14349002 | Fibrinogen Seattle II (substance) |
| 14360006 | Trinitroaniline (substance) |
| 14376002 | Adenylylsulfatase (substance) |
| 14388000 | Cyanide hydratase (substance) |
| 14396005 | Blood group antibody Ls^a^ (substance) |
| 14399003 | Iodine radioisotope (substance) |
| 14401009 | Indium (substance) |
| 14402002 | Wood (substance) |
| 14409006 | Neocinchophen (substance) |
| 14436008 | Peripheral myelin (substance) |
| 14438009 | Carbenicillin disodium (substance) |
| 14439001 | Pyrazolylalanine synthase (substance) |
| 14443002 | Aminoglycoside -class of antibiotic- (substance) |
| 14444008 | Blood group antibody Todd (substance) |
| 14458005 | Ketohexokinase (substance) |
| 14461006 | Aluminum phosphate (substance) |
| 14464003 | Human leukocyte antigen HLA-Cw3 antigen (substance) |
| 14472001 | Dehydroacetic acid (substance) |
| 14503005 | Sucrose 1^F^-fructosyltransferase (substance) |
| 14507006 | Arsthinol (substance) |
| 14517001 | Blood group antibody Jordan (substance) |
| 14529005 | ^153^Gadolinium (substance) |
| 14539004 | Dimethylaniline-N-oxide aldolase (substance) |
| 14543000 | Glycosulfatase (substance) |
| 14544006 | Methyl violet 6B stain (substance) |
| 14550001 | ^131^Barium (substance) |
| 14558008 | Malate dehydrogenase oxaloacetate-decarboxylating (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 14564001 | Amylopectin (substance) |
| 14574003 | Blood group antibody Bovet (substance) |
| 14583008 | Oxyuranus scutellotus prothrombin-activating proteinase (substance) |
| 14585001 | Benzquinamide hydrochloride (substance) |
| 14586000 | Phospho-5-dehydro-2-deoxygluconate aldolase (substance) |
| 14602007 | Chlorophyll |
| 14604008 | Blood group antibody Hg^a^ (substance) |
| 14611007 | Hemoglobin Yoshizuka (substance) |
| 14616002 | Heteroglycan alpha-mannosyltransferase (substance) |
| 14620003 | Blood group antibody B 9724 (substance) |
| 14638000 | Thiobarbiturate (substance) |
| 14645000 | Zinc phenolsulphonate |
| 14655001 | Histidinol-phosphatase (substance) |
| 14660002 | Actinidin (substance) |
| 14665007 | Blood group antigen Parra (substance) |
| 14668009 | Hemoglobin Tak (substance) |
| 14674009 | Azinphos-methyl (substance) |
| 14691008 | ^90^Yttrium (substance) |
| 14699005 | Dichloronaphthoquinone (substance) |
| 14702003 | Threonine-transfer ribonucleic acid ligase (substance) |
| 14708004 | Haemoglobin Noko |
| 14711003 | Blood group antigen A (substance) |
| 14715007 | Dextran 75 (substance) |
| 14726001 | Antibody to antigen in Lewis blood group system (substance) |
| 14733001 | 2-Enoate reductase (substance) |
| 14743003 | Cinchonine (substance) |
| 14767006 | alpha>1< Anti-trypsin (substance) |
| 14796007 | Amfecloral (substance) |
| 14802009 | Acetoacetyl-coenzyme A reductase (substance) |
| 14804005 | Creatine (substance) |
| 14805006 | Cucumisin (substance) |
| 14809000 | Dihydroxyacetone (substance) |
| 14813007 | ^177^Tungsten (substance) |
| 14815000 | Phosphorylase (substance) |
| 14819006 | Aspidium (substance) |
| 14827002 | Blood group antigen Di^a^ (substance) |
| 14839005 | Hafnium dust (substance) |
| 14843009 | Adenosine-tetraphosphatase (substance) |
| 14846001 | Glycerol-3-phosphate 1-dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 14849008 | HLA-Bw77 antigen |
| 14860004 | Adenosine diphosphate sugar pyrophosphatase (substance) |
| 14863002 | Arsenic radioisotope (substance) |
| 14873000 | Structural gene (substance) |
| 14898004 | Nicotinate phosphoribosyltransferase (substance) |
| 14903000 | Antimony sodium thioglycolate (substance) |
| 14905007 | Promethazine hydrochloride (substance) |
| 14931009 | Glycine-transfer ribonucleic acid ligase (substance) |
| 14958002 | Naphthol green B stain (substance) |
| 14971004 | Isoleucine (substance) |
| 14976009 | Succinate-semialdehyde dehydrogenase (substance) |
| 14986005 | Blood group antigen Wilson (substance) |
| 14996001 | Glucose dehydrogenase (acceptor) (substance) |
| 15009009 | Meprylcaine (substance) |
| 15011000 | Blood group antibody Ts (substance) |
| 15017001 | Beeswax (substance) |
| 15021008 | Neoantigen |
| 15047004 | ^93^Yttrium (substance) |
| 15052009 | Diphenoxylate (substance) |
| 15061009 | Formate dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 15072004 | Diethylene glycol monobutyl ether (substance) |
| 15073009 | Antigen excess immune complex (substance) |
| 15085001 | (S)-Usnate reductase (substance) |
| 15092006 | Malonyl-CoA decarboxylase (substance) |
| 15093001 | Glutathione-homocystine transhydrogenase (substance) |
| 15098005 | Alseroxylon (substance) |
| 15116007 | Mycodextranase (substance) |
| 15126000 | Ruthenium isotope (substance) |
| 15129007 | Zinc propionate (substance) |
| 15145009 | N-Acetylglucosamine-6-sulfatase (substance) |
| 15150003 | Thallium salt (substance) |
| 15158005 | Air (substance) |
| 15186002 | Hemoglobin A,b (substance) |
| 15217008 | 6-Aminohexanoate-cyclic-dimer hydrolase (substance) |
| 15234000 | Dihydrouracil dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) |
| 15245002 | n-Acetyl galactosamine (substance) |
| 15248000 | Fluoropolymer (substance) |
| 15249008 | Ethylidene diacetate (substance) |
| 15254004 | Thiamin kinase (substance) |
| 15272005 | ^197^Thallium (substance) |
| 15275007 | Blood group antibody FR (substance) |
| 15286009 | Human leukocyte antigen Cw2 (substance) |
| 15287000 | trans-Hexaprenyltranstransferase (substance) |
| 15294002 | Hemoglobin Bushwick (substance) |
| 15297009 | Adenosine triphosphate citrate (pro-3S)-lyase (substance) |
| 15298004 | 1-Phosphatidylinositol-4,5-bisphosphate phosphodiesterase (substance) |
| 15308006 | Dibasic copper sulfate (substance) |
| 15313005 | Blood group antibody Gf (substance) |
| 15322006 | Benzoquinonium (substance) |
| 15327000 | 7beta-Hydroxysteroid dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 15331006 | Glycine (substance) |
| 15352003 | Cyproheptadine hydrochloride (substance) |
| 15369001 | Aquathol |
| 15373003 | Creatinine (substance) |
| 15379004 | Aryl-aldehyde dehydrogenase (substance) |
| 15392001 | Blood group antigen Jo^a^ (substance) |
| 15399005 | 2-Methyleneglutarate mutase (substance) |
| 15416001 | Blood group antigen Pruitt (substance) |
| 15424006 | ^243^Californium (substance) |
| 15450005 | ^244m^Americium (substance) |
| 15451009 | Hemoglobin Geelong (substance) |
| 15455000 | Hemoglobin Lepore-Washington-Boston (substance) |
| 15458003 | Boron isotope (substance) |
| 15469000 | Blood group antibody p (substance) |
| 15472007 | Disaccharide (substance) |
| 15495003 | Cytidine diphosphate diacylglycerol-glycerol-3-phosphate 3-phosphatidyltransferase (substance) |
| 15505005 | Preprodynorphin (substance) |
| 15529003 | Rosolic acid sodium salt stain (substance) |
| 15551006 | Complement component, alternate pathway (substance) |
| 15563001 | Cyclopentanone monooxygenase (substance) |
| 15571002 | Mezlocillin sodium (substance) |
| 15595000 | Amorphous or granular extracellular material (substance) |
| 15612008 | Porphobilinogen synthase (substance) |
| 15620005 | Blood group antigen Yk^a^ |
| 15623007 | Oil of cumin (substance) |
| 15653000 | Lymphocyte antigen CD76 (substance) |
| 15658009 | Cytidine diphosphate (substance) |
| 15660006 | Bleomycin sulfate (substance) |
| 15666000 | Chlorine isotope (substance) |
| 15668004 | 3,4,5-Trihydroxybenzoic acid (substance) |
| 15683009 | Blood group antigen Robert (substance) |
| 15698006 | Lysergic acid diethylamide (substance) |
| 15730005 | Porphyrin (substance) |
| 15735000 | Solanine (substance) |
| 15752001 | Immunoglobulin M, H chain (substance) |
| 15754000 | Interleukin-7 (substance) |
| 15764009 | Cyclohexanone (substance) |
| 15769004 | Aspartate 1-decarboxylase (substance) |
| 15781000 | Blood group antigen K20 (substance) |
| 15785009 | Phenazopyridine (substance) |
| 15790007 | Nicotinamide adenine dinucleotide ^+^ synthase (glutamine-hydrolysing) (substance) |
| 15797005 | Blood group antigen A. Owens (substance) |
| 15798000 | Blood group antibody Bp^a^ (substance) |
| 15800007 | Hemoglobin Mobile (substance) |
| 15810003 | Tuaminoheptane (substance) |
| 15817000 | Phosphomevalonate kinase (substance) |
| 15821007 | Brackish water (substance) |
| 15826002 | Dihydrorotenone (substance) |
| 15833002 | 4-Aminobiphenyl (substance) |
| 15835009 | Hemoglobin Moabit (substance) |
| 15879007 | Autograft (substance) |
| 15882002 | n-Butyric acid (substance) |
| 15895007 | Fibrinogen London I (substance) |
| 15896008 | Methyl violet 2B stain (substance) |
| 15901005 | Fibrinogen Paris III |
| 15909007 | Blood group antibody Yk^a^ (substance) |
| 15917004 | 4-Methyloxaloacetate esterase (substance) |
| 15928000 | Donovan's solution (substance) |
| 15942008 | Blood group antibody Lanthois (substance) |
| 15943003 | Guanylic acid (substance) |
| 15951000 | 2-Methylcitrate dehydratase (substance) |
| 16011006 | Technetium Tc^99m^ albumin colloid (substance) |
| 16017005 | Hemoglobin Syracuse (substance) |
| 16019008 | Blood group antibody Fy^x^ (substance) |
| 16022005 | Abnormal hemoglobin, multiple point mutation (substance) |
| 16024006 | ^204^Thallium (substance) |
| 16025007 | Human leukocyte antigen DQw8 (substance) |
| 16045004 | Catechol 2,3-dioxygenase (substance) |
| 16073002 | Mercurous compound (substance) |
| 16074008 | Immune complex at equivalence (substance) |
| 16082008 | Tritium (substance) |
| 16085005 | 2-Furoyl-coenzyme A dehydrogenase (substance) |
| 16103004 | L-Arabinose dehydrogenase (substance) |
| 16106007 | Sulfameter (substance) |
| 16122008 | Blood group antibody hr^H^ (substance) |
| 16125005 | Styramate (substance) |
| 16128007 | Anionic detergent (substance) |
| 16130009 | Deoxyribonuclease IV (Phage T>4<-induced) (substance) |
| 16133006 | Blood group antigen Kamiya (substance) |
| 16136003 | Sterol (substance) |
| 16138002 | Blood group antigen M' (substance) |
| 16159009 | Tracheal mucus (substance) |
| 16164008 | 4-Oxoproline reductase (substance) |
| 16165009 | Saccharopine dehydrogenase (nicotinamide adenine dinucleotide ^+^,L-glutamate-forming) (substance) |
| 16179001 | Diethanolamine-p-methoxycinnamate (substance) |
| 16202002 | Ribitol-5-phosphate dehydrogenase (substance) |
| 16213004 | Glycine acetyltransferase (substance) |
| 16214005 | Deslanoside (substance) |
| 16229007 | 5-Amino-6-(5-phosphoribosylamino) uracil reductase (substance) |
| 16230002 | Blood group antigen Madden (substance) |
| 16236008 | alpha>2<-H foetoprotein |
| 16243002 | ^166^Ytterbium (substance) |
| 16257000 | Dopamine hydrochloride (substance) |
| 16265002 | ^172^Hafnium (substance) |
| 16267005 | Carrier protein |
| 16270009 | Prephenate dehydrogenase (substance) |
| 16272001 | Succinate-semialdehyde dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 16274000 | Tantalum radioisotope (substance) |
| 16276003 | Coagulation factor IX Eagle Rock variant (substance) |
| 16285003 | Isoamyl salicylate (substance) |
| 16290000 | ^184^Iridium (substance) |
| 16296006 | Prostaglandin receptor (substance) |
| 16303009 | D-Proline reductase (dithiol) (substance) |
| 16309008 | Carboxy-cis,cis-muconate cyclase (substance) |
| 16313001 | Tea (substance) |
| 16318005 | Dibenzothiepin (substance) |
| 16321007 | Ovex (substance) |
| 16355005 | Tetracycline hydrochloride (substance) |
| 16359004 | Phthalylsulfathiazole (substance) |
| 16368002 | Cadmium fumes (substance) |
| 16369005 | Asbestos fibres |
| 16392005 | Hexylcaine (substance) |
| 16395007 | Pituitary gonadotropin (substance) |
| 16405003 | Chlorophenol (substance) |
| 16441003 | N-Acetyllactosamine synthase (substance) |
| 16456007 | Hemoglobin P-Galveston (substance) |
| 16458008 | 2-Isopropylmalate synthase (substance) |
| 16462002 | Alpha neoendorphin (substance) |
| 16469006 | Hemoglobin Edmonton (substance) |
| 16472004 | Deoxyguanylate kinase |
| 16477005 | Diagnostic vaccine (substance) |
| 16480006 | Aminoacyl-histidine dipeptidase (substance) |
| 16482003 | Monobutyl biphenyl sodium monosulfonate (substance) |
| 16492006 | Cloxacillin sodium (substance) |
| 16502003 | Molecular oxygen (substance) |
| 16503008 | Glycine formiminotransferase (substance) |
| 16509007 | Hemoglobin Ankara (substance) |
| 16515007 | ^188^Tungsten (substance) |
| 16519001 | Blood group antibody Ny^a^ (substance) |
| 16520007 | Pyridoxine 4-oxidase (substance) |
| 16522004 | Flurandrenolide (substance) |
| 16526001 | ^173^Tantalum (substance) |
| 16546006 | 9 cis-Hexadecenoic acid |
| 16586003 | ^86^Zirconium (substance) |
| 16605007 | n-Butyl acetate (substance) |
| 16610006 | Cyclohexanone monooxygenase (substance) |
| 16613008 | Prostaglandin PGD2 (substance) |
| 16624005 | Bromide salt (substance) |
| 16628008 | Somatotropin releasing factor (substance) |
| 16633007 | Methyl mercuric cyanoguanidine (substance) |
| 16641007 | Bonellinin (substance) |
| 16642000 | Glutamate-ethylamine ligase (substance) |
| 16660000 | Cholesterol monooxygenase (side-chain cleaving) (substance) |
| 16670003 | Fibrinopeptide B-beta 1-42 (substance) |
| 16683002 | Progesterone (substance) |
| 16693009 | Cesium compound (substance) |
| 16696001 | Plant pigment (substance) |
| 16705004 | Human leukocyte antigen Bw47 (substance) |
| 16712008 | Saccharopine dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^,L-lysine-forming) (substance) |
| 16716006 | Glutamate 5-kinase (substance) |
| 16717002 | Dehydrocorticosterone (substance) |
| 16719004 | Flowers (substance) |
| 16729006 | Phosphogluconate dehydrogenase (decarboxylating) (substance) |
| 16734005 | Blood group antibody S>2< (substance) |
| 16739000 | Ethane (substance) |
| 16744007 | Lactobacillus acidophilus agent (substance) |
| 16745008 | Xenon isotope (substance) |
| 16748005 | Zolamine (substance) |
| 16752005 | Blood group antigen Pearl (substance) |
| 16774004 | Dry cleaning agent (substance) |
| 16778001 | Octachlorocyclohexenone (substance) |
| 16783009 | alpha-Glucosidase (substance) |
| 16788000 | Naphthalene black 12B stain (substance) |
| 16803002 | Thyrotropin receptor (substance) |
| 16808006 | Trichloroethylene (substance) |
| 16826009 | Pentamidine isethionate (substance) |
| 16836001 | Azure A stain (substance) |
| 16840005 | Hemoglobin Hekinan (substance) |
| 16842002 | Acyl-[acyl-carrier-protein]-phospholipid acyltransferase (substance) |
| 16847008 | o-Demethylpuromycin methyltransferase (substance) |
| 16848003 | Hemoglobin Vicksburg (substance) |
| 16850006 | Ribose (substance) |
| 16878007 | Blood group antibody E (substance) |
| 16885006 | Trimellitic acid (substance) |
| 16906006 | Clostridium histolyticum aminopeptidase |
| 16915004 | Streptozocin (substance) |
| 16923002 | Lupus anticoagulant (substance) |
| 16927001 | Sodium-n-methyl dithiocarbamate (substance) |
| 16943008 | Chrysoidine Y stain (substance) |
| 16946000 | Triacetin (substance) |
| 16951006 | Antigen in Rh blood group system (substance) |
| 16968005 | Diethyltoluamide (substance) |
| 16969002 | (R)-2-Hydroxy-fatty-acid dehydrogenase (substance) |
| 16984006 | Phosphocreatine (substance) |
| 16989001 | Polygalacturonate 4-alpha-galacturonosyltransferase (substance) |
| 16995000 | Hemoglobin Osu Christiansborg (substance) |
| 16996004 | Blood group antibody Gd (substance) |
| 17003006 | alpha-1- Acid glycoprotein (substance) |
| 17008002 | Levallorphan (substance) |
| 17023007 | Soluble metallo-endopeptidase |
| 17032009 | Xylosylprotein 4-beta-galactosyltransferase (substance) |
| 17033004 | Lysine 2,3-aminomutase (substance) |
| 17047000 | Aniline (substance) |
| 17053000 | Pterin deaminase (substance) |
| 17058009 | Argemone oil (substance) |
| 17062003 | Nafoxidine hydrochloride (substance) |
| 17069007 | Chromic phosphate P^32^ (substance) |
| 17072000 | Cathepsin D (substance) |
| 17074004 | Blood group antigen Pelletier (substance) |
| 17108004 | Blood group antibody En^a^TS (substance) |
| 17117004 | Androsterone (substance) |
| 17119001 | Blood group antibody Yh^a^ (substance) |
| 17147002 | Cholic acid (substance) |
| 17152007 | Blood group antibody I^D^ (substance) |
| 17165003 | Blood group antigen 754 (substance) |
| 17171009 | Chlorine monofluoride (substance) |
| 17172002 | Dibromofluorescein stain (substance) |
| 17174001 | (R)-3-Amino-2-methylpropionate-pyruvate aminotransferase (substance) |
| 17178003 | Dolichyl-phosphate xylosyltransferase (substance) |
| 17199000 | ^195^Iridium (substance) |
| 17212003 | Bismuth subcarbonate (substance) |
| 17223004 | Insulin receptor (substance) |
| 17224005 | ^177^Ytterbium (substance) |
| 17229000 | Acetonitrile (substance) |
| 17240008 | Oil in water agent (substance) |
| 17243005 | Uracil mustard (substance) |
| 17244004 | Apraclonidine hydrochloride (substance) |
| 17253006 | Hypoderma collagenase (substance) |
| 17255004 | D-threo-Aldose dehydrogenase (substance) |
| 17257007 | Idoxuridine ophthalmic agent (substance) |
| 17265005 | ^191^Osmium (substance) |
| 17270003 | Amino-acid acetyltransferase (substance) |
| 17334004 | Acetate coenzyme A-transferase (substance) |
| 17356001 | Pralidoxime chloride (substance) |
| 17371002 | Hemoglobin Cordele (substance) |
| 17377003 | Glucan 1,3-beta-glucosidase (substance) |
| 17387004 | Pancreatic fluid (substance) |
| 17400004 | ^202m^Lead (substance) |
| 17430007 | Blood group antigen Hey (substance) |
| 17445000 | Trichloronaphthalene (substance) |
| 17455001 | Lipopolysaccharide galactosyltransferase |
| 17462005 | Blood group antigen K12 (substance) |
| 17483004 | Trichlorobenzene (substance) |
| 17485006 | Methoxypsoralen solution (substance) |
| 17486007 | Methyl 2-cyanoacrylate (substance) |
| 17497007 | Pseudomonas cytochrome oxidase (substance) |
| 17503004 | Clocortolone pivalate (substance) |
| 17524009 | Phosphoacetylglucosamine mutase (substance) |
| 17534000 | Chylomicrons (substance) |
| 17546001 | L-Aspartate oxidase |
| 17574006 | Hemoglobin A>2< Melbourne (substance) |
| 17577004 | Exo-poly-alpha-galacturonosidase (substance) |
| 17595001 | Lymphocyte antigen CD32 (substance) |
| 17597009 | Protein-N-pi-phosphohistidine-sugar phosphotransferase (substance) |
| 17598004 | L-Arabinonate dehydratase (substance) |
| 17603007 | Cob(I)alamin adenosyltransferase (substance) |
| 17614005 | Fibrinogen Buenos Aires I (substance) |
| 17626000 | L-Serine dehydratase (substance) |
| 17627009 | Antibody to hepatitis Be antigen (substance) |
| 17628004 | Indole-3-glycerol-phosphate synthase (substance) |
| 17635007 | ^111m^Palladium (substance) |
| 17637004 | Dimethylhistidine methyltransferase (substance) |
| 17640004 | Blood group antibody Savery (substance) |
| 17643002 | Hafnium compound (substance) |
| 17644008 | Enoyl-[acyl-carrier-protein] reductase (reduced nicotinamide adenine dinucleotide) (substance) |
| 17646005 | ^107m^Silver (substance) |
| 17659002 | Blood group antigen R.M. (substance) |
| 17666001 | Calcium thioglycolate (substance) |
| 17676003 | Lactoylglutathione lyase (substance) |
| 17677007 | Hemoglobin F-Columbus-Ga (substance) |
| 17678002 | Zirconium (substance) |
| 17685003 | Urushiol (substance) |
| 17693003 | Acriflavine stain (substance) |
| 17694009 | Anthraquinone dye |
| 17701004 | Brucella protein nucleate (substance) |
| 17707000 | Blood group antibody Ritter (substance) |
| 17708005 | Nitrate reductase (substance) |
| 17728009 | Tellurium dioxide (substance) |
| 17730006 | Mannuronate reductase (substance) |
| 17731005 | Coagulation factor IX London variant |
| 17733008 | Carnitine palmitoyltransferase (substance) |
| 17740009 | Blood group antigen Epi (substance) |
| 17750005 | Naphthalene (substance) |
| 17761002 | ^120^Antimony (substance) |
| 17764005 | Platinum salt (substance) |
| 17768008 | Oxamate carbamoyltransferase (substance) |
| 17773002 | 8-Hydroxyfuranocoumarin O^8^-methyltransferase (substance) |
| 17777001 | Blastomycin (substance) |
| 17784009 | Petroleum distillate (substance) |
| 17798001 | Coagulation factor II Cardeza variant (substance) |
| 17830000 | Hydroxyethylthiazole kinase (substance) |
| 17836006 | Aromatic ammonia spirit (substance) |
| 17838007 | Hemoglobin South Florida (substance) |
| 17848009 | Thioperazine (substance) |
| 17853004 | Antibody excess immune complex (substance) |
| 17870007 | Xylidine (substance) |
| 17874003 | Bergamot oil (substance) |
| 17895008 | Hemoglobin A>2< Manzanares (substance) |
| 17898005 | Succinchlorimide (substance) |
| 17900007 | 4-Carboxymuconolactone decarboxylase (substance) |
| 17903009 | Abnormal hemoglobin, gamma-chain variant (substance) |
| 17906001 | ^92^Yttrium (substance) |
| 17908000 | Betamethasone benzoate (substance) |
| 17909008 | Glucuronate-1-phosphate uridylyltransferase (substance) |
| 17910003 | ^75^Bromine (substance) |
| 17913001 | Allantoic fluid (substance) |
| 17916009 | Propylene glycol dinitrate (substance) |
| 17917000 | Activated attapulgite (substance) |
| 17927006 | Hemoglobin Dallas (substance) |
| 17932007 | Fibrinogen Vicenza (substance) |
| 17936005 | Alkyl phenol polyglycol ether (substance) |
| 17942009 | Fibrinogen Houston (substance) |
| 17948008 | Hematopoietic factor (substance) |
| 17965004 | Dihydroxyphenylalanine aminotransferase (substance) |
| 17990002 | Melarsoprol (substance) |
| 17991003 | Fibrinogen Adelaide (substance) |
| 17997004 | L-Xylose dehydrogenase (substance) |
| 18004003 | Acylcholine acylhydrolase |
| 18015008 | ^128^Antimony (substance) |
| 18017000 | Phenyl glycidyl ether (substance) |
| 18025003 | Binary chemical warfare agent (substance) |
| 18030004 | Blood group antibody Balkin (substance) |
| 18039003 | Alkyl mercuric phosphate (substance) |
| 18082002 | Blood group antigen V (substance) |
| 18093000 | Halogenated hydrocarbon-organic oxygen insecticide (substance) |
| 18094006 | Hemoglobin J-Norfolk (substance) |
| 18124001 | Histamine methyltransferase |
| 18127008 | Bacterial endotoxin (substance) |
| 18128003 | Keratan sulfate (substance) |
| 18143001 | Fibrinogen Quebec II (substance) |
| 18150002 | Blood group antibody A,B (substance) |
| 18164002 | Gentisate 1,2-dioxygenase (substance) |
| 18180007 | Hemoglobin J-Auckland (substance) |
| 18195009 | Human leukocyte antigen DR9 (substance) |
| 18202008 | beta-Mannosidase (substance) |
| 18211008 | Hydroxymethylglutaryl-coenzyme A reductase (substance) |
| 18220004 | Thyroid hormone (substance) |
| 18230008 | Deoxy adenosine triphosphate (substance) |
| 18247009 | Technetium radioisotope (substance) |
| 18287004 | Plastic polymer (substance) |
| 18288009 | von Willebrand factor (substance) |
| 18290005 | 3-Dehydroquinate synthase (substance) |
| 18298003 | Thromboxane B>2< (substance) |
| 18300003 | Thiodimeton (substance) |
| 18303001 | Amidase (substance) |
| 18321003 | Thiethylperazine maleate (substance) |
| 18324006 | D-Arabinonolactonase (substance) |
| 18328009 | Mannose isomerase (substance) |
| 18344000 | 2,4-Dichlorophenoxyacetic acid (substance) |
| 18350005 | Ribonuclease IV (substance) |
| 18359006 | Blood group antibody Fedor (substance) |
| 18368008 | Chyle (substance) |
| 18380000 | Blood group antibody K^w^ (substance) |
| 18394004 | Collagenase agent (substance) |
| 18395003 | Hydroxypyruvate decarboxylase (substance) |
| 18397006 | Sulfatide (substance) |
| 18406008 | Hemoglobin Summer Hill (substance) |
| 18414002 | Vitamin D>3< (substance) |
| 18421002 | 3-Hydroxydecanoyl-[acyl-carrier-protein]-dehydratase (substance) |
| 18426007 | Blood group antibody MZ 443 (substance) |
| 18436004 | Lymphocyte antigen CD58 (substance) |
| 18449009 | Lincomycin hydrochloride (substance) |
| 18454000 | 3-Oxo-5beta-steroid delta^4^-dehydrogenase (substance) |
| 18462008 | Methdilazine (substance) |
| 18468007 | Blood group antibody M^g^ (substance) |
| 18470003 | Genome (substance) |
| 18486005 | Blood group antigen BLe^b^ (substance) |
| 18490007 | Nicotinamide adenine dinucleotide (phosphate) ^+^ nucleosidase (substance) |
| 18501000 | Human leukocyte antigen B51 (substance) |
| 18509003 | Angiogenesis growth factor (substance) |
| 18532004 | Sassafras oil (substance) |
| 18533009 | Blood group antigen Rh34 (substance) |
| 18535002 | Hypothalamic releasing factor (substance) |
| 18550006 | Thioridazine hydrochloride (substance) |
| 18566008 | Dodecarbonium chloride (substance) |
| 18569001 | Potassium chlorate |
| 18574009 | Dichloroethylene |
| 18594000 | Immunoglobulin, GM>16< allotype (substance) |
| 18600008 | Glucurolactone (substance) |
| 18611000 | Blood group antigen Hr (substance) |
| 18616005 | Lithium hydride (substance) |
| 18617001 | Thrombopoietin |
| 18622001 | Pyridoxal dehydrogenase (substance) |
| 18627007 | Blood group antigen iP>1< (substance) |
| 18633003 | Trimethylamine dehydrogenase (substance) |
| 18659000 | Anti fungal antibody (substance) |
| 18667008 | Hemoglobin Indianapolis (substance) |
| 18681005 | Isopropyl-n-(3-chlorophenyl) carbamate (substance) |
| 18712002 | Phenacemide (substance) |
| 18732001 | Trimethylamine-oxide aldolase (substance) |
| 18737007 | Blood group antigen Duclos (substance) |
| 18743009 | ^228^Actinium (substance) |
| 18754004 | Ytterbium radioisotope (substance) |
| 18759009 | Sodium mercaptoacetate |
| 18761000 | Lymphocyte antigen CD69 (substance) |
| 18763002 | Blood group antigen Dropik (substance) |
| 18774006 | Arylamine acetyltransferase (substance) |
| 18786009 | Aspartate carbamoyltransferase (substance) |
| 18800006 | Crotalus atrox metalloproteinase (substance) |
| 18815007 | Diethyl phthalate (substance) |
| 18819001 | Cryoglobulin (substance) |
| 18832006 | Butylphenamide (substance) |
| 18836009 | Bacterial toxin (substance) |
| 18838005 | Pentachloronaphthalene (substance) |
| 18847002 | Tryptamines (substance) |
| 18852007 | Fibrinogen New York IV (substance) |
| 18853002 | Lymphocyte antigen CD2 (substance) |
| 18858006 | Indole (substance) |
| 18916007 | Oxaloacetase (substance) |
| 18924002 | Alkyl dimethyl ethylbenzyl ammonium bromide (substance) |
| 18925001 | Vanadium (substance) |
| 18959002 | Dibenzazepine derivative (substance) |
| 18970009 | Prolactin releasing factor (substance) |
| 18975004 | beta-L-Rhamnosidase (substance) |
| 18989009 | Carbon compound (substance) |
| 18992008 | Triturus species toxin (substance) |
| 19004006 | Dichloro-chloroaniline-triazine (substance) |
| 19007004 | Glycolate dehydrogenase (substance) |
| 19009001 | Lymphocyte antigen CD18 (substance) |
| 19011005 | Blood group antibody N (substance) |
| 19012003 | Fibrinogen Tokyo I (substance) |
| 19013008 | Sulfoacetaldehyde lyase (substance) |
| 19016000 | Copper arsenate (substance) |
| 19022009 | Blood group antigen Jopson (substance) |
| 19023004 | Acetoacetate decarboxylase (substance) |
| 19035000 | Blood group antibody Hall J (substance) |
| 19041007 | Tolazoline hydrochloride |
| 19046002 | Fibrinogen Pamplona (substance) |
| 19064009 | ^110^Indium (substance) |
| 19066006 | Dimethylaniline monooxygenase (N-oxide-forming) (substance) |
| 19089003 | Leukocyte 11 |
| 19097005 | w-Amidase (substance) |
| 19113006 | Cellulose 1,4-beta-cellobiosidase (substance) |
| 19114000 | Mafenide acetate (substance) |
| 19126005 | Merbromin (substance) |
| 19136002 | Blood group antibody S1^a^ (substance) |
| 19142003 | Hyaluronate lyase (substance) |
| 19151006 | 3-Hydroxyanthranilate 3,4-dioxygenase (substance) |
| 19152004 | Biotin-[acetyl-CoA carboxylase]synthetase |
| 19160003 | Xylose (substance) |
| 19163001 | Prohormone (substance) |
| 19173004 | Pyrophosphate-serine phosphotransferase (substance) |
| 19178008 | Blood group antibody U (substance) |
| 19182005 | C>5b67< inhibitor (substance) |
| 19186008 | Krypton isotope (substance) |
| 19205004 | Secretin (substance) |
| 19209005 | Fungicide (substance) |
| 19238008 | Glycolipid (substance) |
| 19277006 | Leukocyte elastase (substance) |
| 19298006 | Calpain (substance) |
| 19299003 | Aminolaevulinate aminotransferase |
| 19323009 | alpha,alpha-Phosphotrehalase (substance) |
| 19331004 | Blood group antigen Rb^a^ (substance) |
| 19395006 | Blood group antigen Pe (substance) |
| 19400007 | Blood group antibody Baumler (substance) |
| 19421007 | Chloroprocaine hydrochloride (substance) |
| 19427006 | ^59^Nickel (substance) |
| 19456006 | Glucosamine-6-phosphate isomerase (substance) |
| 19462001 | Carbon dioxide absorbent (substance) |
| 19495007 | Sodium pertechnetate Tc^99m^ (substance) |
| 19499001 | Carbinoxamine maleate (substance) |
| 19501009 | Hemoglobin Singapore (substance) |
| 19509006 | Bryonidin (substance) |
| 19510001 | Diphenhydramine hydrochloride (substance) |
| 19516007 | ^98^Technetium (substance) |
| 19521005 | Phosphatidylglycerophosphatase (substance) |
| 19524002 | Penthienate (substance) |
| 19530002 | Blood group antibody P>1< (substance) |
| 19543002 | Pantetheine-phosphate adenylyltransferase (substance) |
| 19545009 | ^114m^Indium (substance) |
| 19565002 | Blood group antibody Rios (substance) |
| 19574000 | Immunoglobulin, KM allotype |
| 19595005 | Phenolphthalein (substance) |
| 19622008 | ^48^Chromium (substance) |
| 19635004 | Rhodium isotope (substance) |
| 19638002 | Formylmethionine deformylase (substance) |
| 19677004 | Lymphocyte antigen CD45 (substance) |
| 19710004 | Plant lectin (substance) |
| 19728002 | Lymphocyte antigen CD17 (substance) |
| 19734009 | 4-Trimethylammoniobutyraldehyde dehydrogenase (substance) |
| 19736006 | ^103^Silver (substance) |
| 19737002 | Renilla-luciferin sulfotransferase |
| 19747004 | Chlorine radioisotope (substance) |
| 19751002 | Potassium compound (substance) |
| 19755006 | Blood group antibody Shannon (substance) |
| 19759000 | Dipropyl ketone (substance) |
| 19767008 | ^175^Ytterbium (substance) |
| 19775002 | Oil of cubeb (substance) |
| 19783008 | Blood group antibody Groslouis (substance) |
| 19814003 | Endogalactosaminidase (substance) |
| 19823000 | Glucose-1,6-bisphosphate synthase (substance) |
| 19830006 | Blood group antibody (substance) |
| 19839007 | Sorbitol (substance) |
| 19868008 | Lymphocyte antigen CDw78 |
| 19872007 | Pyocyanin (substance) |
| 19879003 | Di-isobutyl phenoxy ethoxy ethyl dimethyl benzyl ammonium chloride (substance) |
| 19893005 | Potassium dichromate (substance) |
| 19901000 | Pentylenetetrazol (substance) |
| 19917006 | Hydroperoxy eicosatetraenoic acid (substance) |
| 19918001 | Dihydroergocornine (substance) |
| 19945000 | Blood group antigen M (substance) |
| 19950006 | Brevetoxin (substance) |
| 19964006 | Dinitrophenol (substance) |
| 19967004 | Viomycin (substance) |
| 19971001 | Glucuronate isomerase (substance) |
| 19975005 | Phosphoribosyl-adenosine monophosphate cyclohydrolase (substance) |
| 19978007 | Hexafluorenium (substance) |
| 19985006 | N-Acetyl-gamma-glutamyl-phosphate reductase (substance) |
| 19986007 | Urease (substance) |
| 20009008 | Blood group antigen Rg1 (substance) |
| 20024004 | Demeton (substance) |
| 20028001 | Boroethane |
| 20040001 | Blood group antigen Di^b^ (substance) |
| 20056006 | Dibromosalicylaldehyde (substance) |
| 20057002 | Complement component C6 (substance) |
| 20076000 | Phenylethanolamine N-methyltransferase (substance) |
| 20077009 | Streptomycin-6-phosphatase (substance) |
| 20083007 | Di-isobutyl cresolyl ethoxy ethyl dimethyl benzyl ammonium chloride (substance) |
| 20096008 | Trichlorobenzoic acid (substance) |
| 20120005 | ^230^Thorium (substance) |
| 20125000 | Intracellular fluid (substance) |
| 20138008 | Lethal gene (substance) |
| 20150002 | Hemoglobin J-Luhe (substance) |
| 20160006 | Glucose oxidase (substance) |
| 20170008 | Lung surfactant (substance) |
| 20183009 | Nicotinate-nucleotide-dimethylbenz-imidazole phosphoribosyltransferase (substance) |
| 20211008 | Methylglyoxal synthase (substance) |
| 20214000 | N-Acetylglucosamine-6-phosphate deacetylase (substance) |
| 20217007 | Trimethaphan camsylate (substance) |
| 20221000 | Profilin (substance) |
| 20228006 | Blood group antigen Ku (substance) |
| 20229003 | Pyrrobutamine (substance) |
| 20230008 | Vital new red stain (substance) |
| 20231007 | Aminosalicylic sodium (substance) |
| 20238001 | Chlorinated lime (substance) |
| 20265008 | Perchlorate salt (substance) |
| 20296004 | Nitroaniline (substance) |
| 20304007 | Blood group antibody P (substance) |
| 20309002 | Dichloronitroethane (substance) |
| 20327004 | Sodium caprylate |
| 20337009 | Glycerone-phosphate acyltransferase (substance) |
| 20340009 | Methysergide maleate (substance) |
| 20355000 | Granulocyte antibody (substance) |
| 20368008 | Diphenadione (substance) |
| 20371000 | Acetylenecarboxylate hydratase (substance) |
| 20378006 | Methyldimethoxyamphetamine (substance) |
| 20379003 | Neomycin C (substance) |
| 20383003 | Blood group antibody Duclos (substance) |
| 20386006 | Aminoacyl-transfer ribonucleic acid hydrolase (substance) |
| 20413008 | Levopropoxyphene (substance) |
| 20450009 | Ciprofloxacin hydrochloride (substance) |
| 20459005 | Abalone viscera poison (substance) |
| 20468007 | Isopropamide (substance) |
| 20478005 | Diaminopimelate decarboxylase (substance) |
| 20493009 | Human leukocyte antigen Dw24 (substance) |
| 20495002 | Fibrinogen Bergamo II (substance) |
| 20507001 | Oil of garlic (substance) |
| 20515003 | Oncogene protein c-ets (substance) |
| 20524007 | Rhamnulokinase |
| 20527000 | Hemoglobin Willamette (substance) |
| 20532004 | beta-1,3-Galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase (substance) |
| 20539008 | Tyrosine aminotransferase (substance) |
| 20560002 | Cerebroside-sulfatase (substance) |
| 20564006 | Toluene-2-4-diisocyanate (substance) |
| 20569001 | Imidazoleacetate 4-monooxygenase (substance) |
| 20574009 | Prostaglandin-D 15-dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 20576006 | Blood group antigen Santano (substance) |
| 20591008 | Blood group antibody Nielsen (substance) |
| 20611000 | Hemoglobin Hotel-Dieu (substance) |
| 20631001 | Convallarin (substance) |
| 20642005 | Messenger ribonucleic acid guanylyltransferase (substance) |
| 20643000 | 1,2-Dichloropropane (substance) |
| 20645007 | Aspulvinone dimethylallyltransferase (substance) |
| 20651002 | Pyridoxal kinase (substance) |
| 20672004 | Guanine (substance) |
| 20675002 | Inulosucrase (substance) |
| 20685001 | Cholinergic receptor (substance) |
| 20686000 | Fibrinogen Christchurg II (substance) |
| 20732001 | Arthrobacter serine proteinase (substance) |
| 20742004 | Glutaconate coenzyme A-transferase (substance) |
| 20748000 | Blood group antigen VK (substance) |
| 20751007 | Deoxyadenylic acid (substance) |
| 20752000 | Prothrombin antibody (substance) |
| 20761000 | Ketene (substance) |
| 20764008 | Leucocyte 7 |
| 20771003 | Congenital dysfibrinogen (substance) |
| 20777004 | Blood group antibody Margaret (substance) |
| 20792003 | Glucan 1,4-alpha-maltotetraohydrolase (substance) |
| 20807009 | Anti nucleolus antibody (substance) |
| 20821006 | Isopullulanase (substance) |
| 20822004 | Ribosomal ribonucleic acid (adenosine-O^2'^)-methyltransferase (substance) |
| 20823009 | Complement, thermolabile serum protein complex with cytotoxic effect (substance) |
| 20832006 | Farnesyl-diphosphate kinase (substance) |
| 20844009 | Oxyprocaine (substance) |
| 20847002 | Streptokinase agent (substance) |
| 20878003 | Blood group antibody Hut (substance) |
| 20887007 | Triethylenemelamine (substance) |
| 20898008 | Lymphocyte antigen CD44 (substance) |
| 20907008 | Blood group antibody Cipriano (substance) |
| 20914005 | Adenylate kinase (substance) |
| 20918008 | 3-Mercaptopyruvate sulfurtransferase (substance) |
| 20925001 | Calcium glycerophosphate (substance) |
| 20966001 | ^125^Antimony (substance) |
| 20989009 | Cyanide compound (substance) |
| 20993003 | Oncogene protein P53 (substance) |
| 20994009 | Dinitro-o-amyl phenol (substance) |
| 21004009 | ^199^Thallium (substance) |
| 21023002 | Blood group antigen Rh42 (substance) |
| 21028006 | Fibrinogen Bergamo I (substance) |
| 21064007 | Blood group antibody Rm (substance) |
| 21066009 | Buprenorphine hydrochloride (substance) |
| 21074005 | Fucosylgalactose alpha-N-acetylgalactosaminyltransferase (substance) |
| 21075006 | ^61^Cobalt (substance) |
| 21094001 | Coal tar ointment (substance) |
| 21102006 | Blood group antigen McC^d^ (substance) |
| 21140009 | Mannose-6-phosphate isomerase (substance) |
| 21141008 | ^95^Ruthenium (substance) |
| 21145004 | Blood group antibody Hr>o< (substance) |
| 21149005 | Blood group antibody Pr>1h< (substance) |
| 21158003 | Independent high incidence blood group antibody (substance) |
| 21166007 | Lymphocyte antigen CD21 |
| 21168008 | Acetosulfone (substance) |
| 21175009 | Methantheline bromide (substance) |
| 21204003 | Pantetheine kinase (substance) |
| 21209008 | Long-chain-alcohol oxidase (substance) |
| 21231000 | Corticosteroid side-chain-isomerase (substance) |
| 21235009 | Piperoxan (substance) |
| 21239003 | beta-D-fructopyranose (substance) |
| 21246007 | Fibrinogen Detroit (substance) |
| 21256006 | Human leukocyte antigen Dw23 (substance) |
| 21275001 | Plasmalogen synthase (substance) |
| 21289006 | Platelet factor 4 (substance) |
| 21292005 | Mannan endo-1,4-beta-mannosidase (substance) |
| 21302001 | Hemoglobin Denmark Hill (substance) |
| 21303006 | Methoxamine hydrochloride (substance) |
| 21309005 | Estradiol 17beta-dehydrogenase (substance) |
| 21315005 | Blood group antigen St^a^ (substance) |
| 21317002 | Sodium fluoroacetate (substance) |
| 21319004 | Ribulose-phosphate 3-epimerase (substance) |
| 21325000 | beta-Glucosidase (substance) |
| 21373005 | Soap enema (substance) |
| 21378001 | Iodinated I^125^ Rose Bengal (substance) |
| 21380007 | 4-Methoxybenzoate monooxygenase (O-demethylating) (substance) |
| 21383009 | Immunoglobulin, KM>3< allotype (substance) |
| 21394008 | Adiphenine (substance) |
| 21410001 | Protocatechuate decarboxylase (substance) |
| 21416007 | Lead arsenite (substance) |
| 21438009 | Ureidoglycolate dehydrogenase (substance) |
| 21456009 | Glucarate dehydratase (substance) |
| 21458005 | Glucose-6-phosphate isomerase (substance) |
| 21495005 | Glutaryl-coenzyme A dehydrogenase (substance) |
| 21500008 | Dimethoate (substance) |
| 21518006 | Naloxone hydrochloride (substance) |
| 21521008 | Human leukocyte antigen Bw71 (substance) |
| 21533003 | Lyase (substance) |
| 21540002 | Endosulfan (substance) |
| 21541003 | Oncogene protein TCRD (substance) |
| 21556007 | p-Methylaminophenol sulfate (substance) |
| 21559000 | ^69m^Zinc (substance) |
| 21564001 | Thyme oil (substance) |
| 21566004 | Methyldopate hydrochloride (substance) |
| 21568003 | Adrenal cortical hormone (substance) |
| 21572004 | ^123^Iodine (substance) |
| 21576001 | ^13^ Nitrogen (substance) |
| 21585001 | Lysyltransferase (substance) |
| 21592006 | Tartrazine stain (substance) |
| 21607001 | Agmatine kinase (substance) |
| 21609003 | Gastric vomitus (substance) |
| 21611007 | Boric acid (substance) |
| 21614004 | Phenelzine sulfate (substance) |
| 21621004 | Copying ink (substance) |
| 21625008 | Unsaturated fatty acid (substance) |
| 21627000 | Hemoglobin Beirut (substance) |
| 21632004 | Titanium compound (substance) |
| 21642002 | Blood group antigen G (substance) |
| 21660002 | Taxifolin 8-monooxygenase (substance) |
| 21677002 | Colonic contents (substance) |
| 21680001 | Hemoglobin G-Pest (substance) |
| 21697007 | Rectal mucus (substance) |
| 21706000 | Tetrahydrofolic acid (substance) |
| 21712005 | Polyribonucleotide nucleotidyltransferase (substance) |
| 21713000 | Thermomycolin (substance) |
| 21716008 | 1-Chloro-3-bromopropene-1 (substance) |
| 21728000 | Hemoglobin G-Ferrara (substance) |
| 21729008 | Immunoglobulin, GM>15< allotype (substance) |
| 21733001 | Prolyl endopeptidase (substance) |
| 21736009 | Amine dehydrogenase (substance) |
| 21743003 | N-Acetylglucosamine kinase (substance) |
| 21750004 | Metmyoglobin (substance) |
| 21760008 | Radiogold colloid (substance) |
| 21774001 | Complement component, precursor (substance) |
| 21790001 | Operon gene (substance) |
| 21802009 | Blood group antibody HEMPAS (substance) |
| 21803004 | Alkyl aryl ammonium chloride (substance) |
| 21822008 | Hemoglobin A>2<^1^ (B>2<) (substance) |
| 21847005 | Oil (substance) |
| 21873000 | Blood group antibody Griffith (substance) |
| 21876008 | Blood group antigen NOR (substance) |
| 21880003 | Aurothioglucose (substance) |
| 21888005 | Nickel carbonyl (substance) |
| 21891005 | Digestive enzyme (substance) |
| 21899007 | Thiocarbarsone (substance) |
| 21903000 | Bismuth violet (substance) |
| 21907004 | Hemoglobin Pitie-Salpetriere (substance) |
| 21919007 | Opium (substance) |
| 21920001 | Blood group antigen Lu14 (substance) |
| 21936004 | Plutonium radioisotope (substance) |
| 21951008 | Alizarin cyanine green stain (substance) |
| 21961001 | Oil of spruce (substance) |
| 21966006 | Aldose 1-epimerase (substance) |
| 21977000 | ^121m^Tellurium (substance) |
| 21988006 | Bacterial genome (substance) |
| 21990007 | Phospholipase A venom (substance) |
| 21999008 | 3-Hydroxy-3-isohexenylglutaryl-coenzyme A lyase (substance) |
| 22005007 | Ethyl chloride (substance) |
| 22008009 | Fenchlorphos |
| 22018004 | Tropine dehydrogenase (substance) |
| 22021002 | Basic blue 20 |
| 22023004 | Blood group antigen Le^x^ (substance) |
| 22038003 | Selenium (substance) |
| 22065005 | Paraquat (substance) |
| 22078005 | Pterins (substance) |
| 22086005 | Sodium antimonyl gluconate |
| 22088006 | 3-Hydroxyanthranilate oxidase (substance) |
| 22092004 | Endopolyphosphatase (substance) |
| 22100000 | Hemoglobin Zürich (substance) |
| 22105005 | Sucrose-1,6-a-glucan 3(6)-alpha-glucosyltransferase (substance) |
| 22110009 | Carnosine synthase (substance) |
| 22129003 | ^123m^Tellurium (substance) |
| 22141005 | Limonin-D-ring-lactonase |
| 22147009 | Cyclohexylamine oxidase (substance) |
| 22158000 | Sinapine esterase (substance) |
| 22160003 | ^87^Yttrium (substance) |
| 22165008 | Dipyrone (substance) |
| 22175006 | Hemoglobin Natal (substance) |
| 22179000 | Lysophospholipase (substance) |
| 22183000 | ^119^Tellurium (substance) |
| 22185007 | G protein (substance) |
| 22192002 | Salicylamide (substance) |
| 22196004 | Reduced nicotinamide adenine dinucleotide phosphate dehydrogenase (flavin) (substance) |
| 22219004 | Hemoglobin Riverdale-Bronx (substance) |
| 22224001 | Chorismate synthase (substance) |
| 22236007 | Acetarsone (substance) |
| 22242006 | Glutaraldehyde (substance) |
| 22244007 | Low density lipoprotein (substance) |
| 22250002 | Fibrinogen Birmingham (substance) |
| 22269007 | Blood group antibody Sa (substance) |
| 22284003 | Glucosyl-deoxyribonucleic acid beta-glucosyltransferase (substance) |
| 22290004 | Hepatitis B surface antigen (substance) |
| 22308004 | ^116^Tellurium (substance) |
| 22322004 | Steroid receptor (substance) |
| 22332006 | Blood group antibody McC^e^ (substance) |
| 22340000 | Sodium ricinoleate (substance) |
| 22348007 | Human leukocyte antigen DR5 (substance) |
| 22360008 | Dimethoxane (substance) |
| 22362000 | Calcium phosphate dibasic anhydrous (substance) |
| 22377008 | Alkaline phosphatase isoenzyme, intestinal fraction (substance) |
| 22392009 | Diffusely mineralized extracellular matrix (substance) |
| 22403009 | 5-Oxopent-3-ene-1,2,5-tricarboxylate decarboxylase (substance) |
| 22422000 | Maltose phosphorylase (substance) |
| 22424004 | Ochratoxins (substance) |
| 22453003 | Cathepsin G |
| 22463006 | Hemoglobin G-San Jose (substance) |
| 22479007 | ^71^Arsenic (substance) |
| 22492005 | Hemoglobin Alamo |
| 22496008 | Fibrinogen Cleveland I (substance) |
| 22503007 | Human leukocyte antigen Bw50 (substance) |
| 22518008 | Hydrogen telluride (substance) |
| 22538009 | Lead arsenate (substance) |
| 22551004 | Dichlorophenyl dimethyl urea (substance) |
| 22553001 | Mascara (substance) |
| 22555008 | Sorbose (substance) |
| 22559002 | Glycoasparagine (substance) |
| 22568000 | Blood group antigen Hr>o< (substance) |
| 22579005 | Heparan-alpha-glucosaminide acetyltransferase (substance) |
| 22584004 | Hemoglobin Sydney (substance) |
| 22604005 | Uridine triphosphate (substance) |
| 22606007 | Vitamin K>2< (substance) |
| 22627002 | Blood group antibody Barrett (substance) |
| 22635004 | Factor V antibody (substance) |
| 22643009 | Hemoglobin Belfast (substance) |
| 22654004 | Propantheline bromide (substance) |
| 22691005 | Urea carboxylase (hydrolysing) (substance) |
| 22703005 | Brucine (substance) |
| 22712007 | K-Carrageenase (substance) |
| 22723006 | Gamma-amino butyric acid-benzodiazepine receptor (substance) |
| 22726003 | Cyclohexene (substance) |
| 22727007 | Serum amyloid protein (substance) |
| 22732008 | Pseudomonas aeruginosa alkaline proteinase (substance) |
| 22746008 | Perbromate salt (substance) |
| 22749001 | Victoria blue B stain (substance) |
| 22769006 | Penthienate bromide (substance) |
| 22771006 | Cellobiose dehydrogenase (quinone) (substance) |
| 22779008 | Coagulation factor II Habana variant (substance) |
| 22790003 | Physostigmine sulfate (substance) |
| 22792006 | Tripelennamine citrate (substance) |
| 22796009 | Hemoglobin D-Iran (substance) |
| 22804007 | Hemoglobin D-Granada (substance) |
| 22827004 | Prochlorperazine maleate (substance) |
| 22836000 | Vegetable (substance) |
| 22839007 | Blood group antibody Au^a^ (substance) |
| 22840009 | Tetraethyl pyrophosphate (substance) |
| 22842001 | Indene (substance) |
| 22864005 | Phosphorylase phosphatase (substance) |
| 22865006 | Anthophyllite (substance) |
| 22880000 | 3-Hydroxypalmitoyl-[acyl-carrier-protein]-dehydratase (substance) |
| 22882008 | Coagulation factor II Molise variant (substance) |
| 22893005 | Inert matter (substance) |
| 22904008 | Hemoglobin K-Ibadan (substance) |
| 22907001 | Heavy metal (substance) |
| 22908006 | Phorbol-diester hydrolase (substance) |
| 22917006 | Hemoglobin D-Los Angeles (substance) |
| 22931006 | Evans blue stain (substance) |
| 22939008 | Blood group antibody Messenger (substance) |
| 22941009 | 11-Deoxycortisol (substance) |
| 22944001 | ^246^Plutonium (substance) |
| 22947008 | Testosterone 17beta-dehydrogenase (substance) |
| 22951005 | Screening smoke (substance) |
| 22967004 | Drug receptor (substance) |
| 22968009 | FD and C yellow 6 |
| 22971001 | Blood group antibody I (substance) |
| 22976006 | Aluminum acetate (substance) |
| 22979004 | Oleic acid I^125^ (substance) |
| 22987003 | Phosphopantothenoylcysteine decarboxylase (substance) |
| 23003008 | Ribosylpyrimidine nucleosidase (substance) |
| 23005001 | Glucose dehydrogenase (nicotinamide adenine dinucleotide) (substance) |
| 23016008 | Human leukocyte antigen DPw1 (substance) |
| 23038005 | Myosin (substance) |
| 23050004 | Small intestinal juice (substance) |
| 23052007 | Hemoglobin O-Padova (substance) |
| 23053002 | Iophenoxic acid (substance) |
| 23064004 | Blood group antigen Jn^a^ (substance) |
| 23068001 | Caffeine citrate (substance) |
| 23077008 | Barbituric acid (substance) |
| 23095006 | Thevetin (substance) |
| 23101007 | Blood group antigen Dr^a^ (substance) |
| 23103005 | Blood group antigen Niemetz (substance) |
| 23113002 | Glutamine-transfer ribonucleic acid ligase (substance) |
| 23126003 | Hemoglobin G-Georgia (substance) |
| 23134009 | Organic sulfide compound (substance) |
| 23164001 | Sp40/40 (substance) |
| 23165000 | Blood group antigen Terrano (substance) |
| 23169006 | Poly (glycerol-phosphate) alpha-glucosyltransferase (substance) |
| 23172004 | Bismuth (substance) |
| 23176001 | Bacampicillin hydrochloride (substance) |
| 23182003 | Cereal (substance) |
| 23200004 | Blood group antigen Fy3 (substance) |
| 23208006 | N-butyl acetanilide (substance) |
| 23216002 | Suppressor gene (substance) |
| 23217006 | Arsenic compound (substance) |
| 23219009 | Hemoglobin Legnano (substance) |
| 23240005 | Homologous restriction factor (substance) |
| 23243007 | Oligonucleotide (substance) |
| 23254002 | Squalene (substance) |
| 23295004 | Coagulation factor I (substance) |
| 23303000 | Silver isotope (substance) |
| 23307004 | Estrogen receptor (substance) |
| 23308009 | Taurine aminotransferase (substance) |
| 23314002 | Blood group antibody Schwend (substance) |
| 23317009 | Saxitoxin (substance) |
| 23318004 | Anti neutrophilic cytoplasm antibody (substance) |
| 23324005 | trans-Pentaprenyltranstransferase (substance) |
| 23349009 | Cephalin |
| 23367002 | Monofluoroacetate salt (substance) |
| 23369004 | Circulating immune complex |
| 23375008 | Colistin sulfate (substance) |
| 23378005 | Male genital fluid (substance) |
| 23380004 | Blood group antigen Kp^a^ (substance) |
| 23385009 | Blood group antibody ALe^b^ (substance) |
| 23396001 | Blood group antibody Green (substance) |
| 23408008 | ^236^Plutonium (substance) |
| 23423003 | Sodium hydroxide (substance) |
| 23433006 | Vitamin D>2< (substance) |
| 23434000 | Blood group antigen Or (substance) |
| 23459009 | Selenium radioisotope (substance) |
| 23465009 | 2-Dehydro-3-deoxygalactonokinase (substance) |
| 23475007 | ^73m^Germanium (substance) |
| 23504007 | 2-Deoxy-D-gluconate dehydrogenase (substance) |
| 23519008 | ^180m^Tantalum (substance) |
| 23555000 | Dethiobiotin synthase (substance) |
| 23563004 | Very late antigen receptor (substance) |
| 23564005 | Dyclonine (substance) |
| 23570004 | ^219^Radon (substance) |
| 23571000 | ^115^Cadmium (substance) |
| 23573002 | Acetylcholinesterase (substance) |
| 23590008 | Sialoprotein (substance) |
| 23599009 | Allosteric site (substance) |
| 23601006 | Mesityl oxide (substance) |
| 23603009 | Blood group antigen Ge4 (substance) |
| 23609008 | Powdered stomach agent (substance) |
| 23647003 | Hemoglobin Kawachi (substance) |
| 23677009 | 4-Hydroxyglutamate aminotransferase (substance) |
| 23689006 | Platelet antigen HPA-3a (substance) |
| 23692005 | Tribasic calcium phosphate (substance) |
| 23696008 | Catechol oxidase (substance) |
| 23701001 | Trichlorocarbanilide (substance) |
| 23711008 | Alkyl quaternary ammonium chloride |
| 23733005 | Hemoglobin I-Toulouse (substance) |
| 23734004 | D-Ornithine 4,5-aminomutase (substance) |
| 23736002 | Na^+^/K^+^-transporting adenosine triphosphatase (substance) |
| 23760003 | Blood group antibody Wb |
| 23774005 | HLA-Dw9 antigen |
| 23775006 | Blood group antibody Tar (substance) |
| 23783000 | Harmaline (substance) |
| 23788009 | ^97^Ruthenium (substance) |
| 23814005 | Guanethidine monosulfate (substance) |
| 23816007 | Tetrahydrocortisol (substance) |
| 23832005 | Lavender oil (substance) |
| 23841000 | Acid phosphatase isoenzyme, tartrate-sensitive fraction (substance) |
| 23845009 | Phenylalanine acetyltransferase (substance) |
| 23847001 | Uridine diphosphate glucose dehydrogenase (substance) |
| 23861006 | Phenolsulfonphthalein (substance) |
| 23862004 | Fibrinogen Bethesda III (substance) |
| 23866001 | Fluoroacetic acid (substance) |
| 23878002 | Blood group antibody Whittle (substance) |
| 23883005 | Methadone hydrochloride (substance) |
| 23893003 | Blood group antigen La Fave (substance) |
| 23904000 | Xanthopterin (substance) |
| 23921009 | Zirconium silicate (substance) |
| 23923007 | 3-Hydroxy-2-methylpyridinecarboxylate dioxygenase (substance) |
| 23929006 | Haemoglobin Tacoma |
| 23942006 | Hemoglobin Titusville (substance) |
| 23956008 | 2,2-Dialkylglycine decarboxylase (pyruvate) (substance) |
| 23959001 | Thyroglobulin (substance) |
| 23964002 | Pumiliotoxin A (substance) |
| 23969007 | Tryparsamide (substance) |
| 23974004 | Hemoglobin J-Abidjan (substance) |
| 23989008 | Indanol dehydrogenase (substance) |
| 24002009 | Blood group antigen Kn^b^ (substance) |
| 24004005 | Hb 102(G4), Asn-tyr |
| 24008008 | Blood group antibody Laine (substance) |
| 24012002 | Sugar-phosphatase (substance) |
| 24022008 | Bupivacaine hydrochloride (substance) |
| 24023003 | Properdin native (substance) |
| 24032001 | Arginine aminopeptidase (substance) |
| 24037007 | Dihydrocoumarin hydrolase (substance) |
| 24041006 | Immunoglobulin, GM>1< allotype (substance) |
| 24049008 | Uronate dehydrogenase (substance) |
| 24070002 | Phosphorylcholine (substance) |
| 24099007 | Oxygen (substance) |
| 24102007 | Chlorothalonil (substance) |
| 24143007 | Platelet antibody HPA-2a (substance) |
| 24156000 | Organic boron compound (substance) |
| 24161003 | ^171^Hafnium (substance) |
| 24167004 | Fast green FCF stain (substance) |
| 24185006 | Histidine ammonia-lyase (substance) |
| 24186007 | Abnormal pigment (substance) |
| 24189000 | ^189^Platinum (substance) |
| 24202000 | Ranitidine hydrochloride (substance) |
| 24207006 | Blood group antigen Tri W (substance) |
| 24213002 | Lead carbonate (substance) |
| 24215009 | Picric acid (substance) |
| 24237002 | Prostaglandin PGF1 (substance) |
| 24243000 | Mercurous iodide (substance) |
| 24248009 | Complete antibody |
| 24254005 | Cerolipoid (substance) |
| 24261009 | Trimethobenzamide hydrochloride (substance) |
| 24276001 | ^132^Tellurium (substance) |
| 24282003 | Hydroxymethylpyrimidine kinase (substance) |
| 24301009 | ^198^Gold (substance) |
| 24304001 | Blood group antibody K11 (substance) |
| 24307008 | Retinyl-palmitate esterase (substance) |
| 24331003 | ^181^Hafnium (substance) |
| 24336008 | Aminophylline anhydrous (substance) |
| 24352006 | Chondroitin ABC lyase (substance) |
| 24357000 | Colony-stimulating factor, macrophage (substance) |
| 24371008 | Mercuric arsenate (substance) |
| 24375004 | Hemoglobin Ottawa (substance) |
| 24391001 | Platelet antigen HPA-4a (substance) |
| 24404002 | Blood group antigen A,B (substance) |
| 24411003 | Sodium metaborate (substance) |
| 24427005 | Metanephrine (substance) |
| 24434007 | Sodium tartrate (substance) |
| 24435008 | Fibrinogen Versailles (substance) |
| 24479006 | Blood group antibody Kollogo (substance) |
| 24487007 | High incidence antigen (substance) |
| 24492009 | Immunoglobulin, GM>7< allotype (substance) |
| 24503006 | Blood group antibody Vr (substance) |
| 24511001 | Technetium Tc^99m^ succimer (substance) |
| 24515005 | Spice (substance) |
| 24516006 | Meldola blue stain (substance) |
| 24517002 | Rhamnulose-1-phosphate aldolase (substance) |
| 24521009 | Plastic monomer (substance) |
| 24537003 | Laccase (substance) |
| 24539000 | ^115m^Indium (substance) |
| 24540003 | Blood group antibody En^a^KT (substance) |
| 24544007 | L-erythro-3,5-Diaminohexanoate dehydrogenase (substance) |
| 24545008 | 2-Hydroxyglutarate synthase (substance) |
| 24556008 | N-butyl glycidyl ether (substance) |
| 24570008 | Purgative |
| 24574004 | Blood group antigen Fy^b^ (substance) |
| 24583009 | Terbutaline sulfate (substance) |
| 24589008 | Rhodium radioisotope (substance) |
| 24605005 | Mica (substance) |
| 24615004 | Tryptophan aminotransferase (substance) |
| 24634004 | Histone acetyltransferase (substance) |
| 24648004 | Metabolite AND/OR marker of neoplasm (substance) |
| 24650007 | Dihydro-alpha-ergocryptine (substance) |
| 24655002 | Lymphocyte antigen CD4 (substance) |
| 24660003 | Adenosylmethionine cyclotransferase (substance) |
| 24665008 | Cocillana (substance) |
| 24671002 | alpha,alpha-Trehalose-phosphate synthase uridine diphosphate-forming (substance) |
| 24673004 | Human leukocyte antigen Dw11 (substance) |
| 24675006 | Glial fibrillary acidic protein (substance) |
| 24686008 | Acaricide (substance) |
| 24701006 | Aliphatic saturated hydrocarbon (substance) |
| 24710003 | Blood group antibody Pr^a^ (substance) |
| 24721007 | Chlorothymol (substance) |
| 24732007 | Maleylacetate reductase (substance) |
| 24733002 | ^104^Silver (substance) |
| 24751001 | Oxymorphone (substance) |
| 24756006 | Dimetan (substance) |
| 24769005 | Hydroxypyruvate reductase (substance) |
| 24772003 | Sodium citrate and citric acid (substance) |
| 24778004 | ^101m^Rhodium (substance) |
| 24791003 | Citramalate lyase (substance) |
| 24809001 | Spectinomycin hydrochloride (substance) |
| 24821002 | Blood group antibody Tx (substance) |
| 24823004 | Pipobroman (substance) |
| 24824005 | 3-(Imidazol-5-yl)lactate dehydrogenase (substance) |
| 24837008 | Dinitro-o-cresol (substance) |
| 24838003 | Undecylenic acid and zinc undecylenate |
| 24839006 | Polynucleotide 3'-phosphatase (substance) |
| 24851008 | Deoxyribonucleic acid (substance) |
| 24853006 | ^223^Radium (substance) |
| 24857007 | Complement fixing antibody (substance) |
| 24860000 | Blood group antibody Don E. W. (substance) |
| 24862008 | Ureidosuccinase (substance) |
| 24869004 | Nifurtimox (substance) |
| 24873001 | Intramitochondrial cell metabolite (substance) |
| 24877000 | Alkyl aryl ammonium bromide (substance) |
| 24898000 | Independent low incidence blood group antibody (substance) |
| 24900003 | Procion brilliant blue MRS stain (substance) |
| 24903001 | Deoxyribonucleoside (substance) |
| 24908005 | Organic sulfonic acid (substance) |
| 24922005 | Hemoglobin Garden State (substance) |
| 24926008 | Blood group antigen LW>3< |
| 24938004 | Zirconium isotope (substance) |
| 24939007 | Normetanephrine (substance) |
| 24945004 | Acetylpyruvate hydrolase (substance) |
| 24953007 | Arabinogalactan endo-1,3-beta galactosidase (substance) |
| 24972007 | ^240^Plutonium (substance) |
| 24978006 | Blood group antigen Bert (substance) |
| 24995003 | Blood group antigen Bg^c^ (substance) |
| 25001008 | Lead radioisotope (substance) |
| 25002001 | Perazine (substance) |
| 25013003 | Pyrantel pamoate (substance) |
| 25027008 | Glycoprotein hormone (substance) |
| 25059001 | Methyl oxydemeton (substance) |
| 25071007 | Vaccenic acid (substance) |
| 25077006 | Transketolase (substance) |
| 25079009 | Lissamine fast yellow stain (substance) |
| 25089008 | Enolase (substance) |
| 25090004 | Nitramine (substance) |
| 25091000 | Solochrome cyanine R stain (substance) |
| 25095009 | Blood group antigen Ol^a^ (substance) |
| 25108004 | Glutathione synthase (substance) |
| 25111003 | L-Rhamnose dehydrogenase (substance) |
| 25115007 | Hemoglobin Richmond (substance) |
| 25128000 | ^72^Zinc (substance) |
| 25130003 | Methylal (substance) |
| 25141001 | Tubocurarine chloride (substance) |
| 25153002 | Cysteine-transfer ribonucleic acid ligase (substance) |
| 25172002 | p-Nitroaniline (substance) |
| 25175000 | Uridine diphosphate galacturonate decarboxylase (substance) |
| 25176004 | Mumps skin test antigen (substance) |
| 25183006 | Manganese chloride (substance) |
| 25195006 | Endothall (substance) |
| 25204006 | Aluminum soluble salt (substance) |
| 25205007 | Fluorine radioisotope (substance) |
| 25213008 | Bicyclic antidepressant (substance) |
| 25217009 | Pituitary follicle stimulating hormone (substance) |
| 25222009 | Geranylgeranyl-diphosphate geranylgeranyltransferase (substance) |
| 25234001 | Shikimate dehydrogenase (substance) |
| 25249009 | N-Acetylneuraminate O^7^-acetyltransferase (substance) |
| 25254000 | Procainamide hydrochloride (substance) |
| 25282007 | Human leukocyte antigen Bw55 (substance) |
| 25292004 | Hemoglobin Strumica (substance) |
| 25293009 | Fluorine perchlorate (substance) |
| 25305005 | Long-acting insulin (substance) |
| 25307002 | Petrolatum (substance) |
| 25315004 | Human leukocyte antigen Aw34 (substance) |
| 25329003 | Hemoglobin Ty Gard (substance) |
| 25339009 | Inulinase (substance) |
| 25351006 | Fluorescein sodium stain (substance) |
| 25356001 | myo-Inositol 2-dehydrogenase (substance) |
| 25386008 | Alanine-glyoxylate aminotransferase (substance) |
| 25390005 | ACP - Acid phosphatase |
| 25399006 | Glycerol dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 25400004 | Blood group antibody Yt^b^ (substance) |
| 25401000 | Barbiturate analog (substance) |
| 25403002 | ^106^Rhodium (substance) |
| 25414004 | Hemoglobin Handa (substance) |
| 25426009 | Blood group antigen Bridgewater (substance) |
| 25438000 | Hemoglobin Seattle (substance) |
| 25453008 | Antibody to antigen in Kidd blood group system (substance) |
| 25454002 | D-Pinitol dehydrogenase (substance) |
| 25486007 | Sodium thiosalicylate (substance) |
| 25494000 | Glucuronic acid (substance) |
| 25500001 | ^40^Potassium (substance) |
| 25513007 | Blood group antigen Stewart (substance) |
| 25525005 | Protein C (substance) |
| 25531008 | Protoberberine (substance) |
| 25538002 | Thiothixene hydrochloride |
| 25557006 | Blood group antigen Langer (substance) |
| 25571003 | Chlordantoin |
| 25574006 | 1-Aminocyclopropane-1-carboxylate deaminase (substance) |
| 25589002 | Phenylpyruvate decarboxylase (substance) |
| 25597009 | Hemoglobin Shimonoseki |
| 25607008 | D-dimer (substance) |
| 25608003 | Hemoglobin Ann Arbor (substance) |
| 25620006 | Bitter orange oil (substance) |
| 25644008 | Protein kinase (substance) |
| 25650003 | Tryptophan-transfer ribonucleic acid ligase (substance) |
| 25670009 | Fetal fluids (substance) |
| 25701004 | Disodium 3,6-endoxohexahydrophthalate (substance) |
| 25705008 | Cadmium dust (substance) |
| 25709002 | ^170^Hafnium (substance) |
| 25710007 | ^113^Tin (substance) |
| 25717005 | Myeloid-macrophage antibody (substance) |
| 25719008 | 2-Methyl-4-chlorophenoxyacetic acid amine (substance) |
| 25722005 | War gas (substance) |
| 25743006 | Skim milk (substance) |
| 25745004 | Dehydrogluconate dehydrogenase (substance) |
| 25747007 | ^135m^Xenon |
| 25752002 | ^78^Germanium (substance) |
| 25761002 | Glutamine (substance) |
| 25770004 | Octyl alcohol (substance) |
| 25773002 | Blood group antigen Elder (substance) |
| 25780000 | Soap (substance) |
| 25793005 | Poly(A)-specific ribonuclease (substance) |
| 25796002 | Aluminum aspirin (substance) |
| 25818006 | Colloid sulfur (substance) |
| 25826003 | Platelet antibody HPA-5a (substance) |
| 25833003 | Blood group antigen Lu^a^ (substance) |
| 25838007 | 2,3-Dihydro-2,3-dihydroxybenzoate dehydrogenase (substance) |
| 25843000 | Lead ethyl gasoline (substance) |
| 25867008 | Blood group antigen Haven (substance) |
| 25886000 | Fibrinogen Bergamo III (substance) |
| 25911004 | Prostaglandin PGH2 (substance) |
| 25926002 | 3-Oxolaurate decarboxylase (substance) |
| 25931000 | Nitrosamine (substance) |
| 25941002 | Acid orange 7 |
| 25946007 | Dichlorophenyl methyl butyl urea (substance) |
| 25958007 | Cobalt compound (substance) |
| 25964000 | KEL17 (ISBT symbol) |
| 25977009 | Bulan (substance) |
| 25978004 | 3',5'-cyclic-guanosine monophosphate phosphodiesterase (substance) |
| 25981009 | Barrier grease (substance) |
| 25992005 | Propyl acetate (substance) |
| 26005009 | Blood group antigen Tajama (substance) |
| 26012000 | Cholecystokinin receptor (substance) |
| 26021004 | Blood group antibody Sd^a^ (substance) |
| 26024007 | Pituitary hormone receptor (substance) |
| 26066008 | Blood group antigen U (substance) |
| 26069001 | Homoserine succinyltransferase (substance) |
| 26070000 | Halogenated hydrocarbon-organic sulfur insecticide (substance) |
| 26091008 | Aspartate aminotransferase (substance) |
| 26093006 | Platelet antigen HPA-4b (substance) |
| 26095004 | Gallium radioisotope (substance) |
| 26101003 | Glucan endo-1,3-beta-glucosidase (substance) |
| 26104006 | Maleic acid (substance) |
| 26109001 | Piperazine citrate (substance) |
| 26120001 | Desipramine hydrochloride (substance) |
| 26131009 | Lead tetramethyl (substance) |
| 26134001 | L-Lysine 6-aminotransferase (substance) |
| 26148001 | Aryl-alcohol dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 26159005 | Clostridium tetani toxin (substance) |
| 26160000 | Isomerase (substance) |
| 26161001 | Deoxy adenosine triphosphate (deoxy guanosine triphosphate)-deoxyribonucleic acid purinetransferase (substance) |
| 26181000 | Cytosine diphosphate diacylglycerol-inositol 3-phosphatidyltransferase (substance) |
| 26191006 | Bromodiphenhydramine hydrochloride (substance) |
| 26192004 | Hemoglobin Maputo (substance) |
| 26194003 | Tungsten (substance) |
| 26227005 | Mineral dust (substance) |
| 26233001 | Thioredoxin reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 26238005 | Nitrite reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 26240000 | Oil of chamomile, Roman (substance) |
| 26258006 | Sarcosine dehydrogenase (substance) |
| 26261007 | Deoxyribonucleic acid (cytosine-5)-methyltransferase (substance) |
| 26266002 | Arginine deiminase (substance) |
| 26271009 | Glucosaminylgalactosylglucosylceramide beta-galactosyltransferase (substance) |
| 26274001 | Hydroxyeicosatetraenoic acid (substance) |
| 26277008 | Dynorphin (substance) |
| 26282001 | ^231^Thorium (substance) |
| 26288002 | Mitotane (substance) |
| 26304004 | Alliin lyase |
| 26312007 | Phosphatidylcholine (substance) |
| 26327007 | Red phosphorus (substance) |
| 26346008 | Ethambutol hydrochloride (substance) |
| 26351002 | Prostaglandin (substance) |
| 26353004 | Boron radioisotope (substance) |
| 26355006 | Blood group antibody Cameron (substance) |
| 26371006 | Chlorophacinone (substance) |
| 26379008 | Dimethisoquin (substance) |
| 26387009 | Threonine synthase (substance) |
| 26405004 | Hemoglobin Brisbane (substance) |
| 26414009 | Hemoglobin Knossos (substance) |
| 26426004 | Ciguatoxin (substance) |
| 26430001 | Taurocyamine kinase (substance) |
| 26434005 | Indium radioisotope (substance) |
| 26437003 | Oil of mustard (substance) |
| 26441004 | Blood group antigen Bg^a^ (substance) |
| 26469007 | Prepro-opiomelanocortin (substance) |
| 26470008 | Hemoglobin Gun Hill (substance) |
| 26473005 | Sucrose-phosphatase (substance) |
| 26490004 | Glucose-6-phosphate 1-epimerase (substance) |
| 26497001 | Viral genome (substance) |
| 26518005 | Coagulation factor XIa (substance) |
| 26521007 | Glycolipid 3-alpha-mannosyltransferase (substance) |
| 26524004 | Catechol oxidase (dimerizing) (substance) |
| 26539003 | Galactosyltransferase |
| 26557002 | Pentachloroethane (substance) |
| 26567007 | Hemoglobin Port de France (substance) |
| 26569005 | Gonadotropin receptor (substance) |
| 26575001 | Myrcia oil (substance) |
| 26591003 | Kininogen (substance) |
| 26598009 | 8-Amino-7-oxononanoate synthase (substance) |
| 26645004 | Homocystine (substance) |
| 26647007 | Blood group antibody Coates |
| 26651009 | Blood group antigen Rd (substance) |
| 26656004 | Aromatic castor oil (substance) |
| 26663004 | Cigar smoking tobacco (substance) |
| 26674008 | Heptachlorocyclopentadiene (substance) |
| 26709006 | Immunoglobulin monomer (substance) |
| 26712009 | Mannan 1,2-(1,3)-alpha-mannosidase (substance) |
| 26720006 | Blood group antibody McC^c^ (substance) |
| 26721005 | Cellular proto-oncogene MYC (substance) |
| 26740004 | Eosinophilic derived inhibitor (substance) |
| 26749003 | Blood group antibody Kaj (substance) |
| 26753001 | Aryl-alcohol dehydrogenase (substance) |
| 26756009 | ^87^Zirconium (substance) |
| 26766001 | Starch glycerite (substance) |
| 26775004 | Dioxin (substance) |
| 26798007 | Hemoglobin P-Nilotic (substance) |
| 26817007 | Methylated naphthalene |
| 26821000 | Apolipoprotein B (substance) |
| 26822007 | 2-Naphthylamine (substance) |
| 26841005 | Dichlorodiphenyltrichloroethane-dehydrochlorinase (substance) |
| 26855002 | Blood group antigen K14 (substance) |
| 26856001 | Small intestine contents (substance) |
| 26858000 | Spermine (substance) |
| 26859008 | Cervical mucus (substance) |
| 26898003 | Immunoglobulin IgA1 (substance) |
| 26926006 | Alkyl toluyl methyl trimethyl ammonium chloride (substance) |
| 26930009 | Quercetin 2,3-dioxygenase (substance) |
| 26937007 | Blood group antigen Hil (substance) |
| 26945002 | Phendimetrazine tartrate (substance) |
| 26952000 | Formyl-coenzyme A hydrolase |
| 26956002 | Glutamate-1-semialdehyde 2,1-aminomutase (substance) |
| 26959009 | Phosphoribosylformylglycinamidine cyclo-ligase (substance) |
| 26961000 | Benzyl chloride (substance) |
| 26967001 | Sulfate salt (substance) |
| 26979001 | Phenylalanine racemase (adenosine triphosphate-hydrolysing) (substance) |
| 26986009 | Pediculicide (substance) |
| 26992003 | Chlorisondamine (substance) |
| 27013004 | Hemoglobin McKees Rocks (substance) |
| 27014005 | Diacylglycerol acyltransferase (substance) |
| 27016007 | Alizarin yellow GG stain (substance) |
| 27024002 | Blood group antigen Batty |
| 27044008 | Blood group antibody Becker (substance) |
| 27045009 | Uridine diphosphate-N-acetylglucosamine 4-epimerase (substance) |
| 27047001 | Blood group antigen Schwend (substance) |
| 27048006 | Blood group antigen Can (substance) |
| 27054007 | ^57^Cobalt (substance) |
| 27076003 | Blood group antibody Rich (substance) |
| 27079005 | Meclocycline sulfosalicylate (substance) |
| 27081007 | ^127^Xenon (substance) |
| 27082000 | Sulfapyridine (substance) |
| 27089009 | Blood group antibody Ce (substance) |
| 27109008 | ^126^Barium |
| 27119002 | Trimellitic anhydride |
| 27120008 | Malachite green stain (substance) |
| 27122000 | ^56^Nickel (substance) |
| 27127006 | Thymidylate 5'-phosphatase (substance) |
| 27130004 | Lymphocyte antigen CD11b (substance) |
| 27138006 | Saccharin (substance) |
| 27177009 | Steam (substance) |
| 27184001 | 17-Hydroxypregnenolone (substance) |
| 27188003 | Cephalosporin-C deacetylase (substance) |
| 27192005 | Aminosalicylic acid |
| 27200003 | Hemoglobin Doha (substance) |
| 27205008 | Blood group antigen IAB (substance) |
| 27244000 | Lithium isotope (substance) |
| 27247007 | Dioxane (substance) |
| 27248002 | Coagulation factor X R.E.D. variant (substance) |
| 27273002 | Complement component C1s (substance) |
| 27316004 | ^49^Vanadium (substance) |
| 27319006 | Hemoglobin Pierre-Benite (substance) |
| 27332001 | Nicotinamide mononucleotide nucleosidase (substance) |
| 27340007 | Blood group antigen HLA-A10 (substance) |
| 27341006 | Pokeweed mitogen (substance) |
| 27345002 | Hemin (substance) |
| 27347005 | Lymphocyte antigen CD4 receptor (substance) |
| 27349008 | ^135m^Barium (substance) |
| 27361000 | Barium salt (substance) |
| 27363002 | 2-Dehydro-3-deoxy-D-gluconate 6-dehydrogenase (substance) |
| 27370002 | Sulfinoalanine decarboxylase |
| 27378009 | Tyrosine (substance) |
| 27380003 | Nucleic acid (substance) |
| 27384007 | Blood group antigen LKE (substance) |
| 27390006 | Sulphur hydride |
| 27412001 | D-Glutamate cyclase (substance) |
| 27417007 | Blood group antigen Geslin (substance) |
| 27425009 | Platelet antigen HPA-2a (substance) |
| 27430008 | Chlorobenzene (substance) |
| 27432000 | Guanosine phosphorylase (substance) |
| 27440006 | Convalescent phase reactant (substance) |
| 27453009 | Blood group antigen John Smith (substance) |
| 27459008 | Blood group antigen Co^b^ (substance) |
| 27470001 | Butoxypolypropylene glycol (substance) |
| 27487004 | Blood group antigen Talbert (substance) |
| 27488009 | 1-Phosphatidylinositol kinase (substance) |
| 27489001 | Blood group antigen Don |
| 27499006 | Oxyphencyclimine (substance) |
| 27512003 | Hemoglobin J-Paris-I (substance) |
| 27562008 | Superoxide dismutase (substance) |
| 27565005 | D-Xylose dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 27569004 | Hemoglobin Hirosaki (substance) |
| 27586005 | Undecoylium chloride iodine (substance) |
| 27594003 | Ferric pyrophosphate (substance) |
| 27595002 | Hemoglobin Heathrow (substance) |
| 27602003 | Dichloromonofluoromethane (substance) |
| 27607009 | Blood group antigen Ts (substance) |
| 27610002 | Reduced nicotinamide adenine dinucleotide phosphate dehydrogenase (substance) |
| 27626001 | Blood group antibody S (substance) |
| 27631004 | Oligonucleotidase (substance) |
| 27647002 | L-Lysine-lactamase (substance) |
| 27656005 | Gitalin (substance) |
| 27671009 | Rhodamine B stain (substance) |
| 27674001 | Fungal structural gene (substance) |
| 27675000 | Hemoglobin Chesapeake (substance) |
| 27730007 | Merodicein (substance) |
| 27736001 | Bacitracin A |
| 27747008 | Nicotinamide adenine dinucleotide phosphate ^+^ transhydrogenase (substance) |
| 27758004 | delta^24^-Sterol methyltransferase (substance) |
| 27763000 | Hydrochloric acid (substance) |
| 27766008 | Prothipendyl (substance) |
| 27800009 | Blood group antibody BLe^d^ (substance) |
| 27822002 | Phenylpropylmethylamine (substance) |
| 27831002 | Snake venom (substance) |
| 27840003 | Methemoglobin (substance) |
| 27844007 | Benzo fast scarlet stain (substance) |
| 27847000 | Ceroid (substance) |
| 27850002 | Calycanthine (substance) |
| 27862003 | Blocking antibody (substance) |
| 27888000 | Ribonucleic acid (substance) |
| 27894008 | Amino sugar (substance) |
| 27897001 | Jejunal juice (substance) |
| 27899003 | Blood group antibody Ol^a^ |
| 27914008 | Hemoglobin Hasharon (substance) |
| 27928002 | Flurazepam hydrochloride (substance) |
| 27931001 | Dipeptidyl peptidase I (substance) |
| 27961009 | Homoaconitate hydratase (substance) |
| 27963007 | Blood group antibody Toms (substance) |
| 27980006 | Ferri-hemoglobin |
| 27989007 | Coagulation factor II Segovia variant (substance) |
| 27995008 | Hemoglobin Dhofar (substance) |
| 27999002 | Blood group antigen Hands (substance) |
| 28015009 | D-Glutamate (D-aspartate) oxidase (substance) |
| 28021008 | Ethyl acrylate (substance) |
| 28025004 | L-Rhamnose isomerase (substance) |
| 28027007 | Uranium radioisotope (substance) |
| 28029005 | Metescufylline (substance) |
| 28069006 | Refrigerant anesthetic (substance) |
| 28095008 | Hemoglobin Complutense (substance) |
| 28112009 | Meconium stool (substance) |
| 28113004 | Actinolite (substance) |
| 28117003 | Carvone (substance) |
| 28118008 | Transfer ribonucleic acid-queuosine beta-mannosyltransferase (substance) |
| 28121005 | Iophendylate (substance) |
| 28142007 | (S,S)-Butanediol dehydrogenase (substance) |
| 28145009 | Blood group antibody Cr3 (substance) |
| 28162004 | Vinyl bromide (substance) |
| 28176003 | Dipeptidyl peptidase III (substance) |
| 28203004 | 3-Oxoacyl-[acyl-carrier-protein] reductase (substance) |
| 28223003 | Cycloguanil (substance) |
| 28227002 | Halogen (substance) |
| 28230009 | Poultry (substance) |
| 28243009 | ^226^Radium (substance) |
| 28251007 | Phosphatidylcholine desaturase (substance) |
| 28252000 | Glycine N-choloyltransferase (substance) |
| 28262007 | Blood group antibody Robert (substance) |
| 28268006 | Pregnanediol (substance) |
| 28298004 | Pan-leukocyte antibody (substance) |
| 28344001 | Mephenytoin (substance) |
| 28356000 | Sulfite dehydrogenase (substance) |
| 28361003 | Blood group antibody Mathison (substance) |
| 28406009 | Immunoglobulin IgG1 (substance) |
| 28408005 | Blood group antigen LW^b^ (substance) |
| 28421003 | Sorbic acid (substance) |
| 28424006 | Lymphocyte antigen CD62 (substance) |
| 28427004 | Human leukocyte antigen DQw9 (substance) |
| 28430006 | Methylsterol monooxygenase (substance) |
| 28444000 | Hemoglobin J-Iran (substance) |
| 28451009 | 4-Hydroxymandelate oxidase (substance) |
| 28464005 | Dioxyline |
| 28469000 | Intracisternal material, periodic (substance) |
| 28495003 | Blood group antibody El (substance) |
| 28511008 | Biotin-[methylcrotonoyl-coenzyme A-carboxylase] ligase (substance) |
| 28521000 | Coagulation factor II Denver variant (substance) |
| 28525009 | ^193m^Iridium (substance) |
| 28530008 | beta-Galactosidase (substance) |
| 28538001 | Hemoglobin Dagestan (substance) |
| 28539009 | Auxin (substance) |
| 28546000 | Aminopeptidase A (substance) |
| 28549007 | Phosphoketolase (substance) |
| 28564007 | Blood group antibody Reiter (substance) |
| 28577003 | Blood group antibody Chr^a^ (substance) |
| 28580002 | Diprenorphine (substance) |
| 28585007 | Platelet-specific antigen (substance) |
| 28588009 | Cephaloridine (substance) |
| 28589001 | cis-1,2-Dihydro-1,2-dihydroxynaphthalene dehydrogenase (substance) |
| 28598003 | Fructose-1,6-bisphosphate triosephosphate-lyase |
| 28622002 | Alizarin yellow R stain (substance) |
| 28632009 | Focally mineralized extracellular matrix (substance) |
| 28639000 | Dihydroxyacetone agent (substance) |
| 28647000 | Meat (substance) |
| 28648005 | Oncogene protein TAL 1 (substance) |
| 28649002 | Secondary-alcohol oxidase (substance) |
| 28662003 | Hydralazine hydrochloride (substance) |
| 28666000 | Bentazon (substance) |
| 28673005 | Antiribosomal antibody (substance) |
| 28675003 | Uridine diphosphate-N-acetylglucosamine 1-carboxyvinyltransferase (substance) |
| 28679009 | Lymphocyte antigen CD28 (substance) |
| 28702005 | Ambutonium (substance) |
| 28708009 | Blood group antigen Bovet (substance) |
| 28716000 | Lymphocyte antigen CDw65 (substance) |
| 28721002 | ^99^Rhodium (substance) |
| 28731009 | Blood group antibody Morrison (substance) |
| 28747006 | Kinetins (substance) |
| 28752001 | Pectate lyase (substance) |
| 28767002 | Oligogalacturonide lyase (substance) |
| 28779002 | Blood group antibody Savior (substance) |
| 28785009 | Arginyltransferase (substance) |
| 28787001 | Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase (substance) |
| 28793009 | Right bronchial mucus (substance) |
| 28808000 | Blood group antigen Stevenson (substance) |
| 28819002 | Blood group antibody K12 (substance) |
| 28823005 | Terpineol (substance) |
| 28824004 | ^214^Lead |
| 28825003 | Sterigmatocystin (substance) |
| 28829009 | Coal tar naphtha (substance) |
| 28832007 | Phenylalanine-transfer ribonucleic acid ligase (substance) |
| 28848008 | Hemoglobin O-Arab (substance) |
| 28881009 | Blood group antibody B 9208 (substance) |
| 28917004 | Hydroxy-mercurichlorophenol (substance) |
| 28927005 | Diphenylheptane derivative (substance) |
| 28935008 | Transfer ribonucleic acid (substance) |
| 28942008 | Coconut oil (substance) |
| 28954008 | Guanylate cyclase (substance) |
| 28957001 | Polypeptide N-acetylgalactosaminyltransferase (substance) |
| 28963005 | Abnormal hemoglobin, deleted residue (substance) |
| 28973007 | Methyl phenol (substance) |
| 28983006 | 6-Ketoprostaglandin F1 (substance) |
| 28999000 | Fusarin (substance) |
| 29004007 | Huratoxin (substance) |
| 29011006 | Manganese trioxide (substance) |
| 29043006 | Cadmium isotope (substance) |
| 29053007 | Chlorodiethylacetamide (substance) |
| 29091007 | Hemoglobin F-La Grande (substance) |
| 29102009 | Methyl chlorophenoxyacetic acid (substance) |
| 29107003 | Platinum radioisotope (substance) |
| 29109000 | Formamide (substance) |
| 29128007 | Karathane (substance) |
| 29135004 | Flax fiber (substance) |
| 29154004 | 3-(p-Chlorophenyl)-1, 1-dimethyl urea (substance) |
| 29157006 | Thiazolsulfone (substance) |
| 29170002 | Antimony isotope (substance) |
| 29181004 | Haloacetate dehalogenase (substance) |
| 29183001 | Fluorine compound (substance) |
| 29184007 | Diphemanil methylsulfate (substance) |
| 29190006 | Fentanyl citrate (substance) |
| 29204001 | Alkyl trimethyl ammonium bromide (substance) |
| 29218008 | Indium^111^ pentetate (substance) |
| 29229007 | Hemoglobin Rothschild (substance) |
| 29234006 | Arylamine sulfotransferase (substance) |
| 29244008 | Blood group antibody Lu4 (substance) |
| 29246005 | Immunoglobulin G (substance) |
| 29247001 | D-Aspartate oxidase (substance) |
| 29252006 | Acridine orange stain (substance) |
| 29253001 | Nicotinamide phosphoribosyltransferase (substance) |
| 29262004 | Uridine triphosphate-hexose-1-phosphate uridylyltransferase (substance) |
| 29263009 | Coffee (substance) |
| 29266001 | Blood group antigen Sadler (substance) |
| 29275004 | Blood group antibody Tollefsen-Oyen (substance) |
| 29276003 | Chlorine (substance) |
| 29279005 | Glycerophosphocholine phosphodiesterase (substance) |
| 29282000 | 17alpha-Hydroxyprogesterone aldolase (substance) |
| 29285003 | Agarase |
| 29301006 | Isoproterenol hydrochloride (substance) |
| 29308000 | tert-Pentyl alcohol (substance) |
| 29327006 | Chloramphenicol palmitate (substance) |
| 29332007 | Acylmuramoylalaninase |
| 29336005 | Hippuric acid (substance) |
| 29342009 | Kenacid blue R stain (substance) |
| 29348008 | Pentetate calcium trisodium Yb^169^ (substance) |
| 29349000 | Hydroxy-mercurinitrophenol (substance) |
| 29360009 | Varnish (substance) |
| 29363006 | Diethanolamine (substance) |
| 29377009 | 3-Hydroxyisobutyryl coenzyme A hydrolase (substance) |
| 29382002 | ^5^Helium (substance) |
| 29393000 | Extracellular secretion material following exocytosis, interstitial, endocrine (substance) |
| 29398009 | Oncogene protein TCRB (substance) |
| 29403005 | Aryl sulfotransferase (substance) |
| 29406002 | alpha-Amylase agent (substance) |
| 29412007 | Dihydrobunolol dehydrogenase (substance) |
| 29414008 | 1D-1-Guanidino-3-amino-1,3-dideoxy-scyllo-inositol aminotransferase (substance) |
| 29436006 | Hemoglobin A>2< Indonesia (substance) |
| 29455006 | Algicide (substance) |
| 29460005 | Copper^67^ ceruloplasmin (substance) |
| 29461009 | Crotin (substance) |
| 29467008 | Tannase (substance) |
| 29468003 | Blood group antigen ELO (substance) |
| 29496009 | Polyolefin (substance) |
| 29497000 | alpha-N-Acetylglucosaminidase (substance) |
| 29502003 | Blood group antigen IBH (substance) |
| 29516008 | Venerupin shellfish toxin (substance) |
| 29520007 | Protoanemonin (substance) |
| 29522004 | Toluidine blue stain (substance) |
| 29527005 | Benztropine mesylate (substance) |
| 29531004 | Nickel radioisotope (substance) |
| 29552007 | Hydroxymethylglutaryl-coenzyme A reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 29554008 | Glycine amidinotransferase (substance) |
| 29573007 | Blood group antigen Wade (substance) |
| 29579006 | Choline kinase (substance) |
| 29584000 | Diagnostic antigen (substance) |
| 29588002 | Brompheniramine maleate (substance) |
| 29607004 | Transfer ribonucleic acid-uridine aminocarboxypropyltransferase (substance) |
| 29614002 | Glyceryl-p-aminobenzoate (substance) |
| 29622009 | Octyl salicylate (substance) |
| 29649009 | Rhodium compound (substance) |
| 29652001 | Blood group antibody Noble (substance) |
| 29661001 | Immunoglobulin A secretory (substance) |
| 29666006 | Nortriptyline hydrochloride (substance) |
| 29671004 | Lithium bromide (substance) |
| 29676009 | 16-alpha-Hydroxysteroid dehydrogenase (substance) |
| 29677000 | Hemoglobin Pyrgos (substance) |
| 29678005 | ^136^Cesium (substance) |
| 29698000 | Photinus-luciferin 4-monooxygenase (adenosine triphosphate-hydrolysing) (substance) |
| 29705004 | Dimethylaminobenzene (substance) |
| 29706003 | ^102m^Rhodium (substance) |
| 29719004 | Blood group antibody Dav (substance) |
| 29725000 | Heparin calcium (substance) |
| 29735006 | Lymphocyte antigen CD33 (substance) |
| 29750002 | Bacterial exotoxin (substance) |
| 29754006 | Adenosine diphosphate ribose pyrophosphatase (substance) |
| 29763008 | Deoxy guanosine diphosphate (substance) |
| 29765001 | Fumagillin (substance) |
| 29776002 | Complement component C7 (substance) |
| 29783009 | Chromocarb (substance) |
| 29784003 | Hexachloroethane (substance) |
| 29791000 | ^196^Gold (substance) |
| 29794008 | Diisobutyl ketone (substance) |
| 29797001 | Pyroglobulin (substance) |
| 29805009 | Potassium perchlorate (substance) |
| 29817006 | Indican (substance) |
| 29831006 | Blood group antigen Taylor (substance) |
| 29842002 | Nicotine dehydrogenase (substance) |
| 29876006 | ^129m^Xenon (substance) |
| 29890009 | Blue-green algae agent (substance) |
| 29900000 | Pantoate dehydrogenase (substance) |
| 29910009 | Guanosine triphosphate cyclohydrolase II (substance) |
| 29917007 | Phosphorous acid (substance) |
| 29919005 | ^100^Palladium (substance) |
| 29925009 | Antimony radioisotope (substance) |
| 29945001 | Liquid oxygen (substance) |
| 29953009 | Hemoglobin Bourmeds (substance) |
| 29973004 | ^235^Plutonium (substance) |
| 29974005 | (R,R)-Butanediol dehydrogenase (substance) |
| 29985007 | Immunoglobulin, L chain, lambda (substance) |
| 29986008 | Immunoglobulin A>1< proteinase (substance) |
| 29988009 | Blood group antibody McC^f^ (substance) |
| 29991009 | Methyl malonyl-coenzyme A epimerase (substance) |
| 29992002 | Cob(II)alamin reductase (substance) |
| 29998003 | ^31^Silicon (substance) |
| 30022007 | Citrulline (substance) |
| 30030008 | Interleukin-9 (substance) |
| 30034004 | Dimethoxanate (substance) |
| 30040006 | Chloro-o-phenyl phenol (substance) |
| 30053009 | Brefeldin (substance) |
| 30056001 | Aromatic-amino-acid-glyoxylate aminotransferase (substance) |
| 30065008 | Adenosine deaminase (substance) |
| 30094001 | Riboflavin dinucleotide (substance) |
| 30095000 | Cassaidine (substance) |
| 30096004 | Ricin (substance) |
| 30103001 | Butylamine (substance) |
| 30109002 | Phosphogluconate dehydrogenase (substance) |
| 30137009 | Blood group antigen CE (substance) |
| 30145004 | Activin hormone (substance) |
| 30158003 | Deoxyribose-phosphate aldolase (substance) |
| 30159006 | Hemeprotein (substance) |
| 30178006 | Vitamin D (substance) |
| 30179003 | Carbonyl fluoride (substance) |
| 30192000 | Oncogene protein V-FMS (substance) |
| 30203009 | Paromomycin sulfate (substance) |
| 30205002 | Thymic T lymphocyte factor (substance) |
| 30209008 | Blood group antibody Gladding (substance) |
| 30236005 | Tilorone (substance) |
| 30245006 | Blood group antibody Kelly (substance) |
| 30286004 | Acylglycerol palmitoyltransferase (substance) |
| 30302001 | Hydroxylamine sulfate (substance) |
| 30324001 | ^132^Iodine (substance) |
| 30325000 | Chlorfenvinphos (substance) |
| 30326004 | A-type natriuretic peptide |
| 30329006 | Triflupromazine (substance) |
| 30333004 | Mercaptomerin sodium (substance) |
| 30357004 | Blood group antibody Santano (substance) |
| 30363008 | Aldehyde dehydrogenase [NADP+] (substance) |
| 30364002 | Non-mineralised extracellular matrix |
| 30375003 | Clinically relevant isoenzyme (substance) |
| 30395009 | Uridine diphosphate-N-acetylglucosamine dehydrogenase (substance) |
| 30403007 | Glycine acyltransferase (substance) |
| 30411002 | 6-Phosphogluconolactonase (substance) |
| 30413004 | Blood group antigen Cad (substance) |
| 30424002 | Proparacaine hydrochloride (substance) |
| 30443002 | H^+^/K^+^-transporting adenosine triphosphatase (substance) |
| 30485003 | Methylamine glutamate methyltransferase (substance) |
| 30487006 | Formaldehyde dehydrogenase (substance) |
| 30498007 | Blood group antigen Emm (substance) |
| 30499004 | ^83m^Krypton (substance) |
| 30511000 | Gold salt (substance) |
| 30525004 | Leucyltransferase (substance) |
| 30531001 | Calcium oxalate (substance) |
| 30540002 | Blood group antibody Simpson (substance) |
| 30551002 | Thioglycolate salt (substance) |
| 30559000 | Glycerol 2-dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 30563007 | Hemoglobin Lepore-Hollandia (substance) |
| 30589007 | Dibutyl phosphate (substance) |
| 30594007 | Lymphocyte antigen CD5 (substance) |
| 30603002 | Tyrosine 3-monooxygenase (substance) |
| 30604008 | Platelet antigen HPA-2b (substance) |
| 30607001 | Blood group antigen Lu3 (substance) |
| 30609003 | Blood group antibody Terrano (substance) |
| 30616002 | Malonate coenzyme A-transferase (substance) |
| 30621004 | Autoantibody (substance) |
| 30656000 | Glyoxylate oxidase (substance) |
| 30658004 | Turacoporphyrin (substance) |
| 30676006 | Metharbital (substance) |
| 30690009 | Porphobilinogen deaminase (substance) |
| 30702003 | Blood group antibody D^w^ (substance) |
| 30703008 | Metaphosphoric acid (substance) |
| 30708004 | alpha-Galactosidase (substance) |
| 30723009 | Blood group antigen Payer (substance) |
| 30734007 | Proline dehydrogenase (substance) |
| 30745005 | Loxapine succinate (substance) |
| 30749004 | Nitrous acid (substance) |
| 30774001 | Mitogen receptor (substance) |
| 30787007 | ^194^Iridium (substance) |
| 30792009 | Hemoglobin Prato (substance) |
| 30797003 | Blood group antigen Tc^c^ (substance) |
| 30804005 | Coagulation factor VII (substance) |
| 30805006 | Gluconate dehydratase (substance) |
| 30820000 | Phosphorus (substance) |
| 30825005 | Colloidal Indium^111^ (substance) |
| 30827002 | Azapetine (substance) |
| 30841006 | Cytidine diphosphate 4-dehydro-6-deoxyglucose reductase (substance) |
| 30848000 | Fibrinogen Oslo III (substance) |
| 30853005 | ^97^Zirconium (substance) |
| 30861000 | Steroid 11-beta-monooxygenase (substance) |
| 30863002 | Desiccated whole bile (substance) |
| 30906008 | Transcobalamin II (substance) |
| 30907004 | Haemoglobin Tokoname |
| 30932002 | Phylloquinone monooxygenase (2,3-epoxidizing) (substance) |
| 30939006 | ^137m^Barium (substance) |
| 30954000 | Blood group antigen Charles (substance) |
| 30960000 | 1,1,1,2-Tetrachloro-2,2- difluoroethane (substance) |
| 30965005 | Interleukin-6 |
| 30986005 | 2-Ethoxyethanol (substance) |
| 30987001 | Blood group antibody Rh35 (substance) |
| 30990007 | Abnormal fibrinogen (substance) |
| 31001006 | Lymphocyte antigen CD68 (substance) |
| 31008000 | Blood group antibody Talbert (substance) |
| 31011004 | 4-hydroxycoumarin (substance) |
| 31024004 | Blood group antigen Good (substance) |
| 31034008 | Isoleucine-transfer ribonucleic acid ligase (substance) |
| 31036005 | Blood group antigen Mansfield (substance) |
| 31039003 | Cysteamine dioxygenase (substance) |
| 31042009 | Plant structural gene (substance) |
| 31046007 | Cation (substance) |
| 31052008 | Pectin lyase (substance) |
| 31055005 | Gastrointestinal hormone |
| 31086004 | Gasoline (substance) |
| 31088003 | Chlorophyllase (substance) |
| 31109005 | Acylglycerone-phosphate reductase (substance) |
| 31111001 | Apoatropine (substance) |
| 31119004 | Hypoglycin A (substance) |
| 31121009 | gamma Aminoisobutyric acid (substance) |
| 31147000 | Metoclopramide hydrochloride (substance) |
| 31178001 | Bethanechol chloride (substance) |
| 31182004 | Diethylene glycol monoethyl ether (substance) |
| 31192007 | Ferrous chloride Fe^59^ (substance) |
| 31202008 | Pseudomonas serine proteinase (substance) |
| 31212001 | Calcium compound (substance) |
| 31245001 | Blood group antibody Oca (substance) |
| 31252004 | Hemoglobin Nunobiki (substance) |
| 31260003 | Methylene violet stain (Bernthsen) (substance) |
| 31278008 | 1,4-alpha-Glucan 6alpha-glucosyltransferase (substance) |
| 31299006 | Hemoglobin A (substance) |
| 31310007 | Ganglioside (substance) |
| 31317005 | Blood group antigen C^w^ (substance) |
| 31324006 | Colloidal oatmeal powder with oil (substance) |
| 31328009 | L-Threonate dehydrogenase (substance) |
| 31347007 | Glycyrrhiza |
| 31349005 | Aspergillus oryzae aspartic proteinase (substance) |
| 31357008 | Blood group antibody Sc3 (substance) |
| 31369000 | Purine nucleosidase |
| 31370004 | Dopamine-beta-monooxygenase (substance) |
| 31381001 | Vesicating gas (substance) |
| 31395003 | 3,4-Dihydroxy-9,10-secoandrosta-1,3,5(10)-triene-9,17-dione 4,5-dioxygenase (substance) |
| 31400002 | HLA-Bw63 antigen |
| 31405007 | Glutamate dehydrogenase [NAD(P)+] (substance) |
| 31409001 | Valine-3-methyl-2-oxovalerate aminotransferase (substance) |
| 31414002 | Amide (substance) |
| 31422009 | Ox bile extract (substance) |
| 31433007 | Cortisol acetyltransferase (substance) |
| 31444004 | Plant agent insecticide (substance) |
| 31480004 | Chlorpyrifos (substance) |
| 31503002 | Steroid 21-monooxygenase (substance) |
| 31522006 | Mild silver protein (substance) |
| 31527000 | Sodium chloride Na^24^ (substance) |
| 31528005 | Nitrite salt (substance) |
| 31538000 | Coenzyme A-glutathione reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 31539008 | Magnesium compound (substance) |
| 31540005 | Extracellular fiber (substance) |
| 31543007 | 6-Acetylglucose deacetylase (substance) |
| 31555001 | ^234^Plutonium (substance) |
| 31559007 | Ribonuclease P (substance) |
| 31576006 | N-Sulfoglucosamine sulfohydrolase (substance) |
| 31579004 | Oil of champaca (substance) |
| 31603005 | ^190^Iridium (substance) |
| 31617001 | Hydrophilic petrolatum (substance) |
| 31618006 | Difenamide (substance) |
| 31622001 | ^127m^Xenon (substance) |
| 31662002 | Orange flower oil (substance) |
| 31675002 | Capillary blood (substance) |
| 31706007 | Ketamine hydrochloride (substance) |
| 31707003 | Zinc bacitracin (substance) |
| 31714001 | New fuchsin stain (substance) |
| 31720000 | Diacylglycerol kinase (substance) |
| 31731008 | Magnesium phosphate (substance) |
| 31744003 | Orotate phosphoribosyltransferase (substance) |
| 31756002 | Methionine racemase (substance) |
| 31773000 | Gastric juice (substance) |
| 31775007 | Hemoglobin F-Melbourne |
| 31780003 | Preproenkephalin (substance) |
| 31787000 | Coagulation factor IX Alabama variant (substance) |
| 31790006 | Malic acid (substance) |
| 31799007 | Mephentermine sulfate (substance) |
| 31801005 | Benzonatate |
| 31811003 | Carbon dioxide (substance) |
| 31815007 | Oxybutynin chloride (substance) |
| 31818009 | Deoxyribonuclease (pyrimidine dimer) (substance) |
| 31827005 | Ristocetin (substance) |
| 31849004 | Succinate-citramalate coenzyme A-transferase (substance) |
| 31854008 | Blood group antibody Terschurr (substance) |
| 31856005 | Dimethyl-1,1-dibromo-2-2-dichloroethyl phosphate (substance) |
| 31857001 | (2-Aminoethyl) phosphonate-pyruvate aminotransferase (substance) |
| 31862000 | Galactonolactone dehydrogenase (substance) |
| 31876004 | 6-Methylsalicylate decarboxylase (substance) |
| 31880009 | ^6^Helium (substance) |
| 31895006 | Gonadotropin (substance) |
| 31896007 | Barium radioisotope (substance) |
| 31897003 | Blood group antigen Hop (substance) |
| 31936008 | Sodium isotope (substance) |
| 31947001 | Carbon isotope (substance) |
| 31953001 | Strontium nitrate Sr^87^ (substance) |
| 31960007 | Anti SS-B antibody (substance) |
| 31963009 | beta-Butoxy beta-thiocyano-diethyl ether (substance) |
| 31979005 | Fatty acid (substance) |
| 31990000 | Fibrinogen Cleveland II (substance) |
| 32027009 | Hemoglobin A>2< Flatbush (substance) |
| 32030002 | Diphenidol hydrochloride (substance) |
| 32039001 | Glass (substance) |
| 32040004 | Putrescine acetyltransferase (substance) |
| 32049003 | Rhodium dust (substance) |
| 32050003 | Pine oil (substance) |
| 32059002 | ^225^Actinium (substance) |
| 32068000 | Serine-glyoxylate aminotransferase (substance) |
| 32072001 | Dalapon (substance) |
| 32073006 | HLA-Bw60 antigen |
| 32079005 | Blood group antigen Ramskin |
| 32083005 | Oxanamide (substance) |
| 32089009 | Blood group antibody VS (substance) |
| 32100007 | Haptoglobin 2-1 (substance) |
| 32103009 | Thyroid hormone receptor (substance) |
| 32120008 | Camphorated oil (substance) |
| 32131000 | Carboxymethylhydantoinase |
| 32133002 | Microarazide nitrate (substance) |
| 32138006 | Bile pigment (substance) |
| 32147003 | Blood group antigen Suhany (substance) |
| 32154009 | Inulin (substance) |
| 32157002 | Cathepsin B (substance) |
| 32165004 | N-Acetylneuraminate synthase (substance) |
| 32167007 | Blood group antibody Nickolai (substance) |
| 32180005 | Nicotinic receptor (substance) |
| 32197004 | Clobetasol propionate (substance) |
| 32216001 | Acylamino-acid-releasing enzyme (substance) |
| 32228009 | Butadiene (substance) |
| 32233008 | Blood group antibody Kasamatsuo (substance) |
| 32235001 | Blood group antibody A 8306 (substance) |
| 32237009 | Blood group antibody IBH (substance) |
| 32241008 | Blood group antigen Wr^b^ (substance) |
| 32245004 | Cystathionine gamma-lyase (substance) |
| 32261002 | Blood group antibody Lu6 (substance) |
| 32269000 | Uranium compound |
| 32277001 | Soluble immune complex (substance) |
| 32281001 | Fibrinogen Oslo IV (substance) |
| 32291007 | Steryl-beta-glucosidase (substance) |
| 32302009 | Ornithine decarboxylase (substance) |
| 32305006 | Blood group antibody Rd^a^ (substance) |
| 32314001 | Blood group antibody Marriott (substance) |
| 32317008 | Hemoglobin J-Bangkok (substance) |
| 32324009 | Blood group antibody BR 726750 (substance) |
| 32329004 | Blood group antigen I^F^ (substance) |
| 32335004 | Sodium fluoroacetamide (substance) |
| 32338002 | Systemic poison chemical warfare agent (substance) |
| 32340007 | Piperonyl butoxide (substance) |
| 32351007 | Thymus-dependent antigen (substance) |
| 32364008 | Blood group antigen Tm (substance) |
| 32370002 | Dyphylline (substance) |
| 32378009 | ^147^Gadolinium (substance) |
| 32396000 | Blood group antibody Lu5 (substance) |
| 32403003 | Blood group antibody Pr>a< (substance) |
| 32431007 | ^193m^Platinum (substance) |
| 32436002 | Phentolamine mesylate (substance) |
| 32437006 | Triphenyl phosphate (substance) |
| 32445001 | Calcium glubionate (substance) |
| 32457005 | Body fluid (substance) |
| 32459008 | Hemoglobin Nigeria (substance) |
| 32467000 | ^204m^Lead (substance) |
| 32481003 | Blood group antibody Mackin (substance) |
| 32498003 | Cortisone (substance) |
| 32500002 | Shellfish toxin (substance) |
| 32505007 | Phosphorus 32 |
| 32519007 | Charcoal activated |
| 32533007 | Endrin (substance) |
| 32536004 | Glutamate-ammonia-ligase adenylyltransferase (substance) |
| 32601005 | alpha-Chloroacetophenone (substance) |
| 32609007 | Antibody to hepatitis A virus (substance) |
| 32616008 | Blood group antibody Zim (substance) |
| 32627005 | Eburnetoxin (substance) |
| 32633001 | Phosphatidate phosphatase (substance) |
| 32657001 | D-Malate dehydrogenase (decarboxylating) (substance) |
| 32663005 | Allyl alcohol (substance) |
| 32668001 | Viral oncogene protein (substance) |
| 32669009 | Tryptophan dimethylallyltransferase (substance) |
| 32685004 | Lactose synthase (substance) |
| 32699000 | Blood group antigen R>2<R>2<-202 (substance) |
| 32707001 | Deoxyribonuclease I (substance) |
| 32714004 | Magnesium dust (substance) |
| 32717006 | Hemoglobin J-Lens (substance) |
| 32725008 | Glycolipid 2-alpha-mannosyltransferase (substance) |
| 32741009 | d-Xylulose (substance) |
| 32757009 | Dibenzepin (substance) |
| 32759007 | Agmatine deiminase (substance) |
| 32770000 | Deoxyuridine phosphorylase (substance) |
| 32784005 | N-Acetyl-beta-alanine deacetylase (substance) |
| 32789000 | Ferritin (substance) |
| 32800009 | Ethionamide (substance) |
| 32824001 | Ergot alkaloid (substance) |
| 32826004 | L-Aminoadipate-semialdehyde dehydrogenase (substance) |
| 32830001 | trans-Acenaphthene-1,2-diol dehydrogenase (substance) |
| 32832009 | ^110m^Silver |
| 32836007 | Sodium acetrizoate (substance) |
| 32842006 | Blood group antibody Rh42 (substance) |
| 32852005 | beta-Melanocyte stimulating hormone (substance) |
| 32860006 | Blood group antigen HLA-A9 (substance) |
| 32863008 | Methylamine (substance) |
| 32882004 | Coriander oil (substance) |
| 32898006 | Fibrinogen San Francisco (substance) |
| 32901007 | Prostaglandin PGA2 (substance) |
| 32922001 | ^227^Actinium (substance) |
| 32926003 | Iridium (substance) |
| 32932008 | Extracorporeal blood (substance) |
| 32943000 | Lymphocyte antigen CD24 |
| 32946008 | Fallopian tube secretions (substance) |
| 32948009 | Radical (substance) |
| 32954005 | Iron carbonyl (substance) |
| 32969006 | Ubiquitin (substance) |
| 32974003 | Blood group antigen Banks (substance) |
| 32990003 | Factor H (substance) |
| 33008008 | Dust (substance) |
| 33019006 | Pancreatic amylase (substance) |
| 33029004 | Blood group antibody Bowyer (substance) |
| 33034000 | Oncogene protein sis (substance) |
| 33037007 | Blood group antigen Austin (substance) |
| 33053005 | Blood group antigen Bruno (substance) |
| 33055003 | Trichlorotrifluoroethane (substance) |
| 33057006 | Macrophage antibody (substance) |
| 33063002 | Blood group antigen Lu13 (substance) |
| 33073000 | Gluconate 5-dehydrogenase (substance) |
| 33082006 | Nitroethane (substance) |
| 33119009 | Sugar-1-phosphate adenylyltransferase (substance) |
| 33137005 | Calcium radioisotope (substance) |
| 33161003 | alpha,alpha-Trehalose-phosphate synthase (guanosine diphosphate-forming) (substance) |
| 33166008 | Intramitochondrial lipid (substance) |
| 33174009 | ^175^Hafnium (substance) |
| 33188008 | Blood group antigen Chr^a^ (substance) |
| 33190009 | Hydroxylamine (substance) |
| 33193006 | Physarum polycephalum ribonuclease (substance) |
| 33201007 | Long-chain-fatty-acid-coenzyme A ligase (substance) |
| 33204004 | alpha Sitosterol (substance) |
| 33206002 | Hemoglobin F-Beech Island (substance) |
| 33210004 | Blood group antibody P^k^ (substance) |
| 33218006 | Arsenic isotope |
| 33238007 | Mesangial matrix (substance) |
| 33239004 | Iridium radioisotope (substance) |
| 33263007 | Trichophyton mentagrophytes keratinase (substance) |
| 33271006 | Iodohippurate I^131^ sodium (substance) |
| 33273009 | Cytosine triphosphate synthase (substance) |
| 33278000 | Insecticide (substance) |
| 33280006 | Medicinal zinc peroxide |
| 33291004 | trans-Octaprenyltranstransferase (substance) |
| 33307008 | Sodium meralein (substance) |
| 33309006 | Human leucocyte antigen DQw5 |
| 33324002 | Glutamine acyltransferase (substance) |
| 33355008 | Blood group antibody Banks (substance) |
| 33362004 | Cinoxate (substance) |
| 33373006 | Cyclopentane (substance) |
| 33395005 | Monomethyl mercury (substance) |
| 33396006 | Nickel (substance) |
| 33404002 | Endo-1,3(4)-beta-glucanase (substance) |
| 33414006 | Isopropyl-n-phenylcarbamate (substance) |
| 33417004 | Citrate(pro-3S)-lyase (substance) |
| 33418009 | Hemoglobin Cocody (substance) |
| 33435008 | Capillary active agent (substance) |
| 33440000 | Ceftriaxone sodium (substance) |
| 33443003 | Polynucleotide 5'-phosphatase (substance) |
| 33447002 | Bephenium hydroxynaphthoate (substance) |
| 33463005 | Liquid substance (substance) |
| 33465003 | Acridine dye (substance) |
| 33492009 | Heparitin sulfotransferase (substance) |
| 33509005 | Blood group antibody Mur (substance) |
| 33519004 | Animal structural gene (substance) |
| 33524001 | 5-Methyldeoxycytidine-5'-phosphate kinase (substance) |
| 33535006 | Renal hormone (substance) |
| 33545008 | Procollagen glucosyltransferase (substance) |
| 33550002 | Blood group antigen Kirkpatrick (substance) |
| 33566000 | Phosphoglycerate dehydrogenase (substance) |
| 33601001 | Glycosylated hemoglobin A (substance) |
| 33604009 | Blood group antigen Burrett (substance) |
| 33619005 | Plasminogen activator (substance) |
| 33635003 | Serotonin (substance) |
| 33638001 | Isotope (substance) |
| 33642003 | Fibrinogen Sydney I (substance) |
| 33643008 | Nucleoside deoxyribosyltransferase (substance) |
| 33667000 | Mercumatilin (substance) |
| 33680002 | Blood group antigen HLA-B12 (substance) |
| 33691009 | Blood group antibody Co^b^ (substance) |
| 33695000 | Camphor 1,2-monooxygenase (substance) |
| 33709008 | Aryl-alcohol oxidase (substance) |
| 33752008 | Motilin (substance) |
| 33780005 | Dimethyl carbamate (substance) |
| 33785000 | Iodinated I^125^ liothyronine (substance) |
| 33791003 | ^199^Lead (substance) |
| 33797004 | 3-Carboxy-2-hydroxyadipate dehydrogenase (substance) |
| 33817009 | Infusorial earth (substance) |
| 33825006 | Blood group antigen Jk^b^ (substance) |
| 33837008 | Aluminum glycinate (substance) |
| 33844004 | Alginate lyase (substance) |
| 33865005 | Blood group antibody Baltzer (substance) |
| 33922005 | Vitamin L |
| 33936000 | Toad toxin (substance) |
| 33963004 | Angiotensin III (substance) |
| 33977001 | Microbial aspartic proteinases (substance) |
| 33984009 | Dihydropteroate synthase (substance) |
| 33987002 | Public blood group antibody (substance) |
| 34003008 | Phospho-2-dehydro-3-deoxyoctonate aldolase (substance) |
| 34007009 | Cholelitholytic agent (substance) |
| 34011003 | Acetoarsenite (substance) |
| 34027005 | Inorganic sulfide compound (substance) |
| 34049004 | Blood group antibody Lu9 (substance) |
| 34053002 | Diphenyl (substance) |
| 34057001 | Acetyl-coenzyme A hydrolase (substance) |
| 34060008 | ^84^Rubidium (substance) |
| 34070005 | Fibrinogen Nagoya (substance) |
| 34074001 | Borate salt (substance) |
| 34086003 | Antithrombin III (substance) |
| 34101007 | Phycoerythrin (substance) |
| 34113002 | Acrisorcin (substance) |
| 34119003 | Delphinine (substance) |
| 34120009 | Fibrinogen Amsterdam (substance) |
| 34127007 | ^85^Krypton (substance) |
| 34128002 | Chrome azurol S stain (substance) |
| 34143000 | Immunoglobulin, GM>10< allotype (substance) |
| 34156007 | Hemoglobin Savaria (substance) |
| 34158008 | Bromine isotope (substance) |
| 34161009 | Blood group antibody Ku (substance) |
| 34174003 | ^224^Actinium (substance) |
| 34180006 | Blood group antibody Min (substance) |
| 34198005 | Folescutol (substance) |
| 34204008 | Blood group antibody Warren (substance) |
| 34208006 | Oxalate salt (substance) |
| 34211007 | ^83^Strontium (substance) |
| 34219009 | Terbufos (substance) |
| 34221004 | Hemoglobin A>2< Yokoshima (substance) |
| 34239008 | Castor oil (substance) |
| 34261003 | Potassium oxalate (substance) |
| 34274009 | Iodine pentafluoride (substance) |
| 34302005 | Uracil dehydrogenase (substance) |
| 34316000 | Blood group antibody Ge1 (substance) |
| 34323004 | Coal (substance) |
| 34329000 | Immunoglobulin, GM>14< allotype (substance) |
| 34330005 | Calcium oxide (substance) |
| 34332002 | Nitrophenol (substance) |
| 34354000 | Octachloronaphthalene (substance) |
| 34355004 | Inactivated complement enzyme (substance) |
| 34358002 | ^228^Thorium (substance) |
| 34370003 | Glucocerebroside (substance) |
| 34388006 | Blood group antibody Fuerhart (substance) |
| 34392004 | Haemoglobin F-Pordenone |
| 34400001 | Blood group antibody Teremok (substance) |
| 34410005 | Camphor 5-monooxygenase (substance) |
| 34425005 | Amolanone (substance) |
| 34428007 | Cyclopentadiene (substance) |
| 34429004 | Pericardial fluid (substance) |
| 34443009 | Hemoglobin F-Baskent (substance) |
| 34453005 | Human leukocyte antigen B27 (substance) |
| 34465009 | Human leukocyte antigen DQw7 (substance) |
| 34471003 | ^121^Iodine (substance) |
| 34505008 | Dental adhesive (substance) |
| 34510007 | Clonal inhibitory factor (substance) |
| 34548002 | Toxaphene (substance) |
| 34549005 | Hemoglobin Palmerston North (substance) |
| 34569000 | Blood group antibody Jn^a^ (substance) |
| 34575009 | Guanidinodeoxy-scyllo-inositol-4-phosphatase (substance) |
| 34582008 | Catecholamine (substance) |
| 34641002 | Hydrazine (substance) |
| 34654009 | Iodine solution (substance) |
| 34657002 | Isopropamide iodide (substance) |
| 34658007 | Met-enkephalin (substance) |
| 34659004 | Lysine dehydrogenase (substance) |
| 34690002 | 3-Hydroxybenzyl-alcohol dehydrogenase (substance) |
| 34692005 | Hemoglobin Miyada (substance) |
| 34700000 | Fast blue B salt |
| 34722007 | Hemoglobin K-Woolwich (substance) |
| 34737006 | C1 esterase inhibitor (substance) |
| 34744002 | Plant asparagine (substance) |
| 34745001 | Slow reacting substance-A of anaphylaxis (substance) |
| 34750007 | Blood group antigen Panzar (substance) |
| 34754003 | Myxobacter b-lytic proteinase (substance) |
| 34757005 | beta-Cystathionase |
| 34763001 | Potassium hydroxide (substance) |
| 34768005 | Cholestanetetraol 26-dehydrogenase (substance) |
| 34771002 | Hemoglobin Quin-Hai (substance) |
| 34788009 | Tartrate epimerase (substance) |
| 34792002 | Coniine (substance) |
| 34793007 | Octanol dehydrogenase (substance) |
| 34800005 | beta-Nitroacrylate reductase (substance) |
| 34820006 | Kynurenate 7,8-hydroxylase (substance) |
| 34829007 | Complement component (substance) |
| 34832005 | Blood group antibody I^s^ (substance) |
| 34848006 | Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase (substance) |
| 34856009 | Uridine diphosphate glucuronate 4-epimerase (substance) |
| 34862004 | Aromatic hydrocarbon (substance) |
| 34864003 | Benzoyl formate decarboxylase (substance) |
| 34865002 | Chromium compound (substance) |
| 34868000 | Human leukocyte antigen DQw3 (substance) |
| 34888001 | Aspartate-ammonia ligase (adenosine diphosphate-forming) (substance) |
| 34895005 | Basic cupric sulfate (substance) |
| 34900009 | Blood group antigen B (substance) |
| 34904000 | Beryllium compound (substance) |
| 34912008 | Blood group antibody Ramskin (substance) |
| 34914009 | Serine-pyruvate aminotransferase (substance) |
| 34915005 | Pyridostigmine bromide (substance) |
| 34919004 | Potassium tartrate (substance) |
| 34940003 | Phosphoserine aminotransferase (substance) |
| 34946009 | Calcium sulfide (substance) |
| 34953000 | Colocynth (substance) |
| 34957004 | Acid (substance) |
| 34968004 | Blood group antigen Lee (substance) |
| 34970008 | Blood group antigen JAL (substance) |
| 34978001 | Perchloromethyl mercaptan (substance) |
| 34982004 | Uroporphyrinogen III decarboxylase |
| 34983009 | Epicillin (substance) |
| 34999003 | Transfer ribonucleic acid (guanine-N^2^)-methyltransferase (substance) |
| 35000003 | Hurain (substance) |
| 35003001 | Maleate isomerase (substance) |
| 35012004 | Blood group antibody HLA-A9 (substance) |
| 35016001 | Argon radioisotope (substance) |
| 35027004 | Pyrophosphoric acid |
| 35040009 | Blood group antibody Rh29 (substance) |
| 35059006 | Nicotinate-nucleotide pyrophosphorylase (carboxylating) (substance) |
| 35060001 | Testicular hormone (substance) |
| 35068008 | Blood group antibody C (substance) |
| 35069000 | Neurotransmitter (substance) |
| 35072007 | Human leukocyte antigen B16 (substance) |
| 35077001 | Nerve gas (substance) |
| 35079003 | Volatile oil (substance) |
| 35092000 | Lymphocyte antigen CD70 (substance) |
| 35094004 | Tropaeolin O stain (substance) |
| 35098001 | Imidazole (substance) |
| 35118003 | Blood group antibody Fy5 (substance) |
| 35124009 | Clupeotoxin (substance) |
| 35131008 | Histidine decarboxylase (substance) |
| 35133006 | Immunoglobulin IgG4, H chain (substance) |
| 35135004 | Aglycone (substance) |
| 35148000 | Protein-glutamine glutaminase (substance) |
| 35150008 | Glucocorticoid hormone (substance) |
| 35151007 | Ruthenium radioisotope (substance) |
| 35181004 | Maleate hydratase (substance) |
| 35190006 | Depilatory (substance) |
| 35192003 | 2,3-Diaminopropionate oxalyltransferase (substance) |
| 35196000 | Ethyl iodide (substance) |
| 35206004 | ^242m^Americium (substance) |
| 35213004 | Blood group antibody Wallin (substance) |
| 35215006 | Scarlet fever streptococcus toxin (substance) |
| 35231003 | Sphingosine acyltransferase (substance) |
| 35233000 | Polyvinyl chloride (substance) |
| 35234006 | Ethylene chlorobromide (substance) |
| 35236008 | Thenyldiamine (substance) |
| 35251004 | Chlordecone (substance) |
| 35257000 | Entsulfon (substance) |
| 35281007 | Acetophenazine (substance) |
| 35292008 | Lipoxygenase (substance) |
| 35293003 | 3-Carboxyethylcatechol 2,3-dioxygenase (substance) |
| 35296006 | S-Alkylcysteine lyase (substance) |
| 35297002 | Alkyl hydroxyethyl imidazolinium chloride (substance) |
| 35310003 | Polyclonal antibody (substance) |
| 35312006 | Gluconokinase (substance) |
| 35318005 | Esmolol hydrochloride (substance) |
| 35321007 | Fluorodeoxyglucose F^18^ (substance) |
| 35331000 | Toxic substance (substance) |
| 35337001 | ^68^Gallium (substance) |
| 35342009 | 1-Acylglycerophosphocholine acyltransferase (substance) |
| 35343004 | Cefonicid sodium (substance) |
| 35344005 | Ribulose (substance) |
| 35352008 | Fluorescent stain (substance) |
| 35353003 | Zygacine (substance) |
| 35355005 | Throat antiviral (substance) |
| 35367007 | Blood group antigen McC^e^ (substance) |
| 35406002 | Clocortolone (substance) |
| 35410004 | Blood group antibody Kp^c^ (substance) |
| 35415009 | Homocysteine desulfhydrase (substance) |
| 35416005 | Sex-linked gene (substance) |
| 35422001 | Hemoglobin Bundury (substance) |
| 35431001 | Adenosine (substance) |
| 35432008 | ^87^Rubidium (substance) |
| 35457003 | Narcotic agent receptor (substance) |
| 35464001 | Trioxsalen (substance) |
| 35466004 | Relaxin (substance) |
| 35467008 | Pseudouridylate synthase (substance) |
| 35473009 | Fibrinogen St. Louis (substance) |
| 35477005 | Phenol methyltransferase (substance) |
| 35479008 | Hemoglobin Mozhaisk (substance) |
| 35488004 | Abnormal hemoglobin, alpha-chain variant (substance) |
| 35499002 | 3-Hydroxypropionate dehydrogenase (substance) |
| 35503008 | Cationic detergent (substance) |
| 35527005 | Sanquinarine (substance) |
| 35530003 | Hemoglobin J-Lome (substance) |
| 35556005 | Sessile antibody (substance) |
| 35573007 | Hemoglobin Las Palmas (substance) |
| 35584000 | Sodium bitartrate (substance) |
| 35589005 | Gadolinium isotope (substance) |
| 35605007 | Anhydrous lanolin (substance) |
| 35609001 | Azogeranin B |
| 35614002 | Blood group antigen Lu17 (substance) |
| 35617009 | Isotomin (substance) |
| 35628008 | Animal gene (substance) |
| 35645003 | Blood group antigen French (substance) |
| 35651008 | Cholest-5ene-3beta,7alpha-diol 3beta dehydrogenase (substance) |
| 35659005 | Dinitrocresol (substance) |
| 35663003 | Asphalt (substance) |
| 35668007 | Endometrial secretions (substance) |
| 35677000 | Heat stable bacterial toxin (substance) |
| 35684008 | Tetranitromethane (substance) |
| 35690007 | Hypochlorous acid (substance) |
| 35724001 | Lacmoid stain (substance) |
| 35733004 | Fat-soluble vitamin (substance) |
| 35740003 | Stable isotope (substance) |
| 35747000 | Osmium compound (substance) |
| 35748005 | Wine (substance) |
| 35760006 | Myeloid antibody (substance) |
| 35765001 | Sincalide (substance) |
| 35780007 | Isochorismatase (substance) |
| 35798006 | Elastic fiber (substance) |
| 35808006 | Ornithine cyclodeaminase (substance) |
| 35815003 | Cadmium sulfide (substance) |
| 35825008 | Cat scratch disease antigen (substance) |
| 35834003 | Analgesic AND antipyretic (substance) |
| 35841009 | Macrophage inhibitory factor (substance) |
| 35864006 | Pyrathiazine (substance) |
| 35866008 | Acyl-coenzyme A desaturase (substance) |
| 35867004 | Cytochrome-c>3< hydrogenase (substance) |
| 35871001 | Oleandrin (substance) |
| 35878007 | Thyroid-hormone aminotransferase (substance) |
| 35883004 | Fluorine (substance) |
| 35884005 | Iodine^131^ polyvinylpyrrolidone (substance) |
| 35891008 | Liquid cyanamide (substance) |
| 35895004 | Aspartyltransferase (substance) |
| 35903003 | Potassium bromide (substance) |
| 35906006 | Blood group antibody MPD (substance) |
| 35922007 | Blood group antibody Black (substance) |
| 35946000 | Pentolinium (substance) |
| 35952004 | Blood group antibody Block (substance) |
| 35954003 | Coagulation factor II variant (substance) |
| 35960003 | Arachidonate-coenzyme A ligase (substance) |
| 35966009 | Ouabain (substance) |
| 35976007 | Pancreatic peptide (substance) |
| 35978008 | ^252^Californium (substance) |
| 35997008 | Metacresylacetate (substance) |
| 36005003 | Blood group antibody Tofts (substance) |
| 36012007 | Nitrogen (substance) |
| 36016005 | Blood group antibody Haase (substance) |
| 36020009 | Factor IX antibody (substance) |
| 36021008 | Cefadroxil monohydrate (substance) |
| 36022001 | Fibrinogen Freiberg (substance) |
| 36028002 | Polyol dehydrogenase (NADP^+^) |
| 36058008 | Oil of myrtle (substance) |
| 36062002 | Xanthurenic acid (substance) |
| 36065000 | Oxine benzoate (substance) |
| 36066004 | Coumarate reductase (substance) |
| 36085001 | Pantoate-beta-alanine ligase (substance) |
| 36093001 | Crotonic acid |
| 36095008 | Glycine aminotransferase (substance) |
| 36098005 | Malate synthase (substance) |
| 36100005 | Blood group antigen Do^b^ (substance) |
| 36130002 | Deoxythymidine diphosphate-4-dehydrorhamnose 3,5-epimerase (substance) |
| 36136008 | Penitrem-A (substance) |
| 36137004 | Triacylglycerol-sterol acyltransferase (substance) |
| 36156009 | Oxynervonic acid (substance) |
| 36167005 | Fibrinogen Torino (substance) |
| 36173006 | Tetraiodothyroacetic acid (substance) |
| 36176003 | Thrombin (substance) |
| 36178002 | Chromate salt (substance) |
| 36197002 | Ecdysone 20-monooxygenase (substance) |
| 36212002 | Myxobacter-a-lytic proteinase (substance) |
| 36220000 | Chloric acid (substance) |
| 36231008 | Proteinglutamine gamma-glutamyltransferase (substance) |
| 36232001 | Mucinaminylserine mucinaminidase (substance) |
| 36235004 | Pine needle oil (substance) |
| 36238002 | Chlorobromomethane (substance) |
| 36240007 | Alkyl sodium n-methyltaurate (substance) |
| 36260004 | Blood group antibody Raison (substance) |
| 36264008 | Lupinine (substance) |
| 36270002 | Arylformamidase (substance) |
| 36301000 | ^198m^Thallium (substance) |
| 36312000 | Xylan 1,3-beta-xylosidase (substance) |
| 36322006 | Acetylindoxyl oxidase (substance) |
| 36326009 | Pteridine (substance) |
| 36343007 | beta>2B< Glycoprotein (substance) |
| 36345000 | 1-Phosphatidylinositol-4-phosphate kinase (substance) |
| 36372008 | Guanosine diphosphate-6-deoxy-D-talose dehydrogenase (substance) |
| 36377002 | Isomaltulose synthase (substance) |
| 36378007 | Lithium compound (substance) |
| 36380001 | Oxyphencyclimine hydrochloride (substance) |
| 36381002 | Hemoglobin P-Congo (substance) |
| 36385006 | Synaptic receptor (substance) |
| 36387003 | Deoxyribonucleic acid-directed deoxyribonucleic acid polymerase |
| 36393006 | Nonionic detergent (substance) |
| 36396003 | Blood group antigen Van Buggenhout (substance) |
| 36397007 | Muramic acid (substance) |
| 36403001 | Blood group antibody ELO (substance) |
| 36410007 | Lactone dye (substance) |
| 36413009 | Cytidine diphosphate ribitol ribitolphosphotransferase (substance) |
| 36418000 | Blood group antigen McC^b^ (substance) |
| 36434002 | 1-Methyl histidine (substance) |
| 36443006 | Hemoglobin E-Saskatoon (substance) |
| 36445004 | Spectrin (substance) |
| 36461002 | Oncogene protein TAL (substance) |
| 36466007 | Furocoumarin (substance) |
| 36494004 | Galactose dehydrogenase (substance) |
| 36513006 | Boron carbide (substance) |
| 36516003 | Pyrilamine maleate (substance) |
| 36541005 | Mercuric iodide (substance) |
| 36562006 | Hemolysin (substance) |
| 36567000 | Prostaglandin-H>2< E-isomerase (substance) |
| 36569002 | Isocyanide compound |
| 36572009 | Sudan black B stain (substance) |
| 36613003 | Blood group antigen Pr>1h< (substance) |
| 36632009 | Mannokinase (substance) |
| 36636007 | Thiamine-triphosphatase (substance) |
| 36641004 | Potassium chloride K^42^ (substance) |
| 36651003 | Bismuth salt (substance) |
| 36652005 | Blood group antigen H>T< (substance) |
| 36661005 | Tyrothricin (substance) |
| 36663008 | ^121^Tellurium (substance) |
| 36671007 | Nitrogen pentoxide (substance) |
| 36677006 | Phenylalanine decarboxylase (substance) |
| 36687005 | Uronolactonase (substance) |
| 36690004 | Nitrate reductase [NADPH] (substance) |
| 36694008 | Hemoglobin Bologna |
| 36704006 | 5' Acylphosphoadenosine hydrolase (substance) |
| 36707004 | DNA repair enzyme (NAD^+^) |
| 36712003 | Factor XII antibody (substance) |
| 36713008 | Blood group antibody McC^d^ (substance) |
| 36726007 | Nicotinate methyltransferase (substance) |
| 36744004 | Blood group antigen E (substance) |
| 36747006 | Psychosine sulfotransferase (substance) |
| 36757007 | Blood group antigen Raison (substance) |
| 36759005 | Human leukocyte antigen Bw6 (substance) |
| 36766006 | Succinyldiaminopimelate desuccinylase (substance) |
| 36774007 | Cadmium compound (substance) |
| 36801006 | Tagatose kinase (substance) |
| 36804003 | Blood group antigen Tasich (substance) |
| 36806001 | Bhilawanol oil |
| 36816009 | Glucose-1-phosphate (substance) |
| 36824004 | Dauricine (substance) |
| 36842009 | Human leukocyte antigen Dw16 (substance) |
| 36848008 | Citrate dehydratase (substance) |
| 36853003 | Blood group antigen Vienna (substance) |
| 36856006 | Flavanone 3-dioxygenase (substance) |
| 36863006 | 2-Dehydro-3-deoxy-D-gluconate 5-dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 36864000 | Paint (substance) |
| 36872003 | Tridihexethyl (substance) |
| 36879007 | Water soluble eosin stain (substance) |
| 36887008 | Mineralocorticoid hormone (substance) |
| 36888003 | Exodeoxyribonuclease VII (substance) |
| 36900006 | Iodohippurate I^125^ sodium (substance) |
| 36907009 | Blood group antibody Kennedy (substance) |
| 36933001 | Antibody to antigen in Rh blood group system (substance) |
| 36934007 | Alkylglycerol kinase (substance) |
| 36953002 | Fibrinogen Nancy (substance) |
| 36993004 | Fucokinase (substance) |
| 36998008 | Glycogen (substance) |
| 37000002 | ^35^Sulfur (substance) |
| 37004006 | Immunoglobulin, Fc' fragment (substance) |
| 37006008 | Cyclothiazide (substance) |
| 37010006 | Tetraphylline (substance) |
| 37013008 | Dipivefrin hydrochloride (substance) |
| 37015001 | Uridine diphosphate-N-acetyl muramoylalanine-D-glutamate ligase (substance) |
| 37023004 | Deoxyribodipyrimidine photo-lyase (substance) |
| 37052001 | Tellurium hexafluoride (substance) |
| 37067002 | Blood group antibody Shier (substance) |
| 37077000 | ^122^Xenon (substance) |
| 37078005 | Nitromersol (substance) |
| 37080004 | Phoabol (substance) |
| 37086005 | Oil of pennyroyal-American (substance) |
| 37094003 | Chlorotoluene (substance) |
| 37100000 | Blood group antigen Bradford (substance) |
| 37112001 | Ceramide (substance) |
| 37123002 | Copper dust and mist (substance) |
| 37148004 | Hemoglobin F-Malaysia (substance) |
| 37150007 | Streptomycin 3''-adenylyltransferase (substance) |
| 37162006 | Receptor for polypeptide (substance) |
| 37177003 | Deoxyribonucleic acid, single stranded (substance) |
| 37196004 | L-Glutamate oxidase (substance) |
| 37202001 | Plant fiber (substance) |
| 37225000 | ^52^Manganese |
| 37237003 | Vitamin E (substance) |
| 37241004 | Corticosterone 18-monooxygenase (substance) |
| 37243001 | Hemoglobin A>2< Coburg (substance) |
| 37262003 | Phenyl p-aminosalicylate (substance) |
| 37264002 | Glucomannan 4-beta-mannosyltransferase (substance) |
| 37276002 | Polypeptide hormone (substance) |
| 37282004 | Blood group antibody B 7358 (substance) |
| 37287005 | Human leukocyte antigen A1 (substance) |
| 37300006 | Blood group antibody h (substance) |
| 37315007 | n-Acetyl mannosamine (substance) |
| 37318009 | Ethylene chlorohydrin (substance) |
| 37329008 | Hemoglobin J-Taichung (substance) |
| 37334007 | Thyroxine deiodinase (substance) |
| 37346006 | Adenylosuccinate synthase (substance) |
| 37352007 | Fungus antigenic agent (substance) |
| 37357001 | L-Arabinonolactonase (substance) |
| 37365003 | Fibrinogen Rouen |
| 37375000 | L-Arabinitol dehydrogenase (ribulose-forming) (substance) |
| 37379006 | ^191m^Osmium (substance) |
| 37411004 | Tissue plasminogen activator (substance) |
| 37433002 | Polycarbophil (substance) |
| 37437001 | Iodinated I^125^ sealed source (substance) |
| 37451001 | Laudanum (substance) |
| 37462001 | Oncogene protein c-fes (substance) |
| 37484001 | Dopamine receptor (substance) |
| 37489006 | Fructokinase (substance) |
| 37513004 | Hemoglobin Lepore-Baltimore (substance) |
| 37526000 | Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6N-acetylglucosaminyltransferase (substance) |
| 37527009 | Sufentanil citrate (substance) |
| 37536008 | Dehydrobufotenine (substance) |
| 37566001 | Dinitrochlorobenzene (substance) |
| 37569008 | Galactose-6-sulfurylase (substance) |
| 37575004 | Carmoisine |
| 37583005 | Blood group antigen Buckalew (substance) |
| 37588001 | Immunoglobulin polymer (substance) |
| 37595005 | Suspension (substance) |
| 37620000 | Lipopolysaccharide glucosyltransferase I (substance) |
| 37624009 | Cyclomaltodextrin glucanotransferase (substance) |
| 37648000 | Clindamycin phosphate (substance) |
| 37654004 | Blood group antigen K19 (substance) |
| 37656002 | Methimazole (substance) |
| 37662007 | 5,10-Methylenetetrahydrofolate reductase (reduced flavin adenine dinucleotide) (substance) |
| 37663002 | Venom (substance) |
| 37681004 | S-Formylglutathione hydrolase (substance) |
| 37683001 | Tanghin extract (substance) |
| 37691005 | Hetacillin (substance) |
| 37704004 | Perichromatin granule (substance) |
| 37713002 | Blood group antigen Dautriche (substance) |
| 37716005 | White ointment (substance) |
| 37751002 | Beta 2 blocking agent (substance) |
| 37756007 | Gastric inhibitory polypeptide (substance) |
| 37758008 | Drug-induced coagulation inhibitor (substance) |
| 37765000 | Diethylpropion hydrochloride (substance) |
| 37784002 | Striatoxin (substance) |
| 37838004 | Haemoglobin F-Minoo |
| 37841008 | Menstrual fluid (substance) |
| 37850005 | 2-Acetolactate mutase (substance) |
| 37852002 | Indirect reacting bilirubin (substance) |
| 37861002 | Blood group antigen Js^b^ (substance) |
| 37863004 | Pyruvate,orthophosphate dikinase (substance) |
| 37881001 | Dolichyl-diphosphooligosaccharide-protein glycotransferase (substance) |
| 37889004 | Gonadoliberin receptor (substance) |
| 37892000 | Exodeoxyribonuclease (Phage SP>3<-induced) (substance) |
| 37902007 | Blood group antigen A.M. |
| 37905009 | Copper 3-phenyl salicylate (substance) |
| 37912000 | Heterotricyclic dye (substance) |
| 37915003 | Protein-tyrosine-phosphatase (substance) |
| 37927000 | Cystine (substance) |
| 37930007 | Neon isotope (substance) |
| 37932004 | Low density lipoprotein receptor (substance) |
| 37938000 | Carbonic acid (substance) |
| 37947008 | Colloidal gold Au^198^ (substance) |
| 37950006 | sn-Glycerol-3-phosphate 1-galactosyltransferase (substance) |
| 37951005 | Fibrinogen Paris I (substance) |
| 37957009 | Pentoxyverine (substance) |
| 37959007 | Prealbumin (substance) |
| 37969001 | ^119^Antimony (substance) |
| 37970000 | Phosphogluconate dehydratase (substance) |
| 37978007 | Nitrofurantoin sodium (substance) |
| 37984005 | Blood group antibody Don (substance) |
| 37986007 | Tremorgen (substance) |
| 37994000 | Fibrinogen Hanover (substance) |
| 38000004 | Lymph (substance) |
| 38011007 | Otic antiviral (substance) |
| 38019009 | Plastic object (substance) |
| 38044001 | Paromomycin (substance) |
| 38065007 | Hemoglobin G-Copenhagen (substance) |
| 38082009 | Hemoglobin (substance) |
| 38088008 | 2-Dehydro-3-deoxygluconokinase (substance) |
| 38100002 | Isopropyl acetone (substance) |
| 38120001 | Progesterone 5alpha-reductase (substance) |
| 38122009 | Anisindione (substance) |
| 38123004 | Trichlorofluoromethane (substance) |
| 38132002 | (+)-Neomenthol dehydrogenase (substance) |
| 38148001 | Ribosylhomocysteinase (substance) |
| 38154000 | ^239^Americium (substance) |
| 38156003 | Haemoglobin Tottori |
| 38167002 | Aquacobalamin reductase (substance) |
| 38174007 | ^237^Americium (substance) |
| 38182007 | Galactose (substance) |
| 38207009 | Hemoglobin Regina (substance) |
| 38218009 | Hyaluronic acid (substance) |
| 38227005 | Blood group antigen He (substance) |
| 38229008 | Uridine diphosphate-N-acetylgalactosamine-4-sulfate sulfotransferase (substance) |
| 38245005 | Thymic hormone (substance) |
| 38262000 | Active C5b678 (substance) |
| 38263005 | N-ethylmercuri-p-toluene sulfonanilide (substance) |
| 38269009 | Lymphocyte antigen CD1c (substance) |
| 38271009 | Saffron stain (substance) |
| 38289005 | ^200^Lead (substance) |
| 38319003 | Mercuric sulfide (substance) |
| 38327007 | Plutonium (substance) |
| 38344006 | Sodium iodomethamate (substance) |
| 38347004 | 2,5-Diaminovalerate aminotransferase (substance) |
| 38348009 | Body water (substance) |
| 38367008 | Blood group antigen Hoalzel (substance) |
| 38373009 | Glutathione-CoA-glutathione transhydrogenase (substance) |
| 38379008 | Alcohol sulfotransferase (substance) |
| 38399002 | ^135^Xenon (substance) |
| 38401008 | Crocidolite (substance) |
| 38408002 | Paregoric (substance) |
| 38410000 | Acyl-coenzyme A dehydrogenase (substance) |
| 38415005 | ^44^Titanium |
| 38424001 | Strontium chloride Sr^87^ (substance) |
| 38445008 | Blood group antigen Rils (substance) |
| 38446009 | Diflorasone diacetate (substance) |
| 38457004 | Kerasin (substance) |
| 38476002 | Interleukin (substance) |
| 38482004 | Apocrine sweat (substance) |
| 38496005 | Phenyl dimethyl urea (substance) |
| 38499003 | Blood group antibody Naz (substance) |
| 38519002 | Blood group antigen Donaldson (substance) |
| 38543004 | Lissamine green B stain (substance) |
| 38553003 | Blood group antigen Schuppenhauer (substance) |
| 38554009 | Human leukocyte antigen B5 (substance) |
| 38558007 | Blood group antibody Ghawiler (substance) |
| 38588003 | bis-(Dimethylamino)-phosphorous anhydride (substance) |
| 38595007 | Trimethyl phosphite |
| 38612004 | Chitin synthase (substance) |
| 38622005 | Aluminum oxide ore (substance) |
| 38623000 | ^69^Zinc |
| 38647007 | Ribonucleoside-diphosphate reductase (substance) |
| 38648002 | Mephentermine (substance) |
| 38649005 | Dichloroethane (substance) |
| 38652002 | Acylglycerol lipase (substance) |
| 38684009 | Alclometasone dipropionate (substance) |
| 38686006 | Colistimethate sodium (substance) |
| 38705000 | Acetaldehyde (substance) |
| 38707008 | Celestine blue B stain (substance) |
| 38710001 | Procollagen N-proteinase (substance) |
| 38714005 | Somatomedin A (substance) |
| 38726000 | Haemoglobin G-Taiwan Ami |
| 38730002 | p-Methylaminophenol hydrochloride (substance) |
| 38733000 | ^207^Bismuth (substance) |
| 38744008 | Progesterone binding protein (substance) |
| 38747001 | Penicillium notatum extracellular proteinase (substance) |
| 38758005 | ^229^Actinium (substance) |
| 38765002 | Hemoglobin Nottingham (substance) |
| 38771008 | Human leukocyte antigen DPw6 (substance) |
| 38778002 | Deacetyl-[citrate-(pro-3S)-lyase] acetyltransferase (substance) |
| 38779005 | Blood group antibody Ht^a^ (substance) |
| 38794009 | Molybdenum isotope (substance) |
| 38808007 | Glutathione S-aralkyltransferase |
| 38810009 | Hemoglobin Olympia (substance) |
| 38833005 | Vinyl chloride (substance) |
| 38834004 | Glutamate 1-kinase (substance) |
| 38839009 | Glycerol teichoic acid (substance) |
| 38854003 | Adenosinetriphosphatase (substance) |
| 38874005 | Blood group antigen V.G. (substance) |
| 38899006 | Hemoglobin North Shore (substance) |
| 38902009 | Solochrome dark blue stain (substance) |
| 38908008 | Blood group antigen Lu6 (substance) |
| 38909000 | Glutamic acid hydrochloride (substance) |
| 38914001 | Thymol iodide (substance) |
| 38922008 | Urinary tract fluid (substance) |
| 38932001 | Hemoglobin J-Nayanza (substance) |
| 38937007 | Water in oil agent (substance) |
| 38947005 | Pyrithiamin deaminase (substance) |
| 38957006 | Hemoglobin Kofu (substance) |
| 38990006 | Hydrogen-sulfide acetyltransferase (substance) |
| 39004000 | Hemoglobin Ypsilanti (substance) |
| 39006003 | 3alpha,7alpha,12alpha-Trihydroxycholestan-26-al 26-dehydrogenase (substance) |
| 39012008 | Tetramethylthiuram disulphide |
| 39013003 | Galactocerebroside (substance) |
| 39022002 | Deoxycytidine diphosphate (substance) |
| 39024001 | Blood group antibody Yt^a^ (substance) |
| 39044007 | Aluminum alkyl (substance) |
| 39049002 | Nasopharyngeal mucus (substance) |
| 39053000 | Complement factor D (substance) |
| 39069007 | Aphrodisiac (substance) |
| 39081006 | Iron ore (substance) |
| 39082004 | Hepatitis B core antigen (substance) |
| 39102003 | Food particle (substance) |
| 39110002 | Protein-arginine deiminase (substance) |
| 39118009 | High incidence antibody (substance) |
| 39123009 | Cephaloglycin (substance) |
| 39135008 | Phosphoribosylaminoimidazole-succinocarboxamide synthase (substance) |
| 39138005 | Blood group antibody Milano (substance) |
| 39152007 | Erythromycin stearate (substance) |
| 39162000 | Bronsted-Lowry acid (substance) |
| 39173007 | Estradiol 6beta-monooxygenase (substance) |
| 39192009 | ^235m^Uranium (substance) |
| 39200002 | Iodinated I^131^ albumin (substance) |
| 39203000 | Conanine (substance) |
| 39212003 | Acylpyruvate hydrolase (substance) |
| 39223004 | Stipitatonate decarboxylase (substance) |
| 39240008 | Hemoglobin Sherwood Forest (substance) |
| 39241007 | Human leukocyte antigen Dw1 (substance) |
| 39254000 | S-Succinylglutathione hydrolase (substance) |
| 39263003 | Amisometradine (substance) |
| 39265005 | Free radical (substance) |
| 39276009 | Aldehyde dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) |
| 39290007 | Barium (substance) |
| 39292004 | Iodine trichloride (substance) |
| 39294003 | Iron carbohydrate complex (substance) |
| 39313006 | Phosphonoacetaldehyde hydrolase (substance) |
| 39318002 | Hemoglobin Yokohama (substance) |
| 39327001 | Blood group antibody Craw (substance) |
| 39331007 | Hemoglobin Djelfa (substance) |
| 39337006 | Blood group antibody Es^a^ (substance) |
| 39339009 | Oil of linaloe (substance) |
| 39340006 | Cycloate (substance) |
| 39360003 | Starch (substance) |
| 39368005 | Arsenate compound (substance) |
| 39378008 | Hydrastinine (substance) |
| 39383000 | Dihydrolipoamide dehydrogenase (substance) |
| 39385007 | Riboflavin kinase (substance) |
| 39411007 | Glycocyaminase (substance) |
| 39428005 | Deuteroporphyrin (substance) |
| 39442002 | Antibody binding site (substance) |
| 39467004 | ^124^Antimony (substance) |
| 39469001 | beta-Phenylisopropylamine (substance) |
| 39477002 | Feces (substance) |
| 39494000 | Indole-3-acetaldehyde reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 39505006 | Hemoglobin Chongqing (substance) |
| 39514001 | Decamethonium (substance) |
| 39515000 | Blood group antigen Ht^a^ (substance) |
| 39522008 | ^253^Californium (substance) |
| 39525005 | Tumor necrosis factor alpha (substance) |
| 39529004 | Chromous sulfate (substance) |
| 39546001 | Manganese isotope (substance) |
| 39552000 | Scabicide (substance) |
| 39554004 | Propane (substance) |
| 39560004 | Hemoglobin Bicetre (substance) |
| 39576008 | Galactose dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 39580003 | Benzoate 4-monooxygenase (substance) |
| 39581004 | Trimethyl benzene (substance) |
| 39588005 | Lipstick (substance) |
| 39605000 | Hemoglobin Niteroi (substance) |
| 39635007 | ^195m^Platinum (substance) |
| 39650003 | Human leukocyte antigen HLA-Bw54 antigen (substance) |
| 39665002 | Blood group antigen Pr>2< (substance) |
| 39669008 | ^202^Bismuth (substance) |
| 39678002 | Blood group antigen Kominarek (substance) |
| 39694009 | Kynurenic acid (substance) |
| 39701004 | Metabolite AND/OR marker of carcinogen (substance) |
| 39705008 | ^238^Americium (substance) |
| 39736000 | Sodium sulfide (substance) |
| 39757008 | Cinnamoyl-coenzyme A reductase (substance) |
| 39765006 | Uroporphyrinogen-III synthase (substance) |
| 39769000 | Inert gas (substance) |
| 39777001 | Sudan III stain (substance) |
| 39789004 | Snuff tobacco (substance) |
| 39805003 | Hemoglobin Aztec |
| 39806002 | Oil of niaouli (substance) |
| 39808001 | Dibucaine hydrochloride (substance) |
| 39815009 | Clorazepate (substance) |
| 39817001 | Prothrombin fragment 1.2 (substance) |
| 39830000 | N-Sulfoglucosamine-6-sulfatase (substance) |
| 39840002 | Blood group antibody Di^a^ (substance) |
| 39862002 | Imino acid (substance) |
| 39867008 | Hemoglobin F-Xinjiang (substance) |
| 39909008 | dGTPase (substance) |
| 39932007 | ^117^Cadmium (substance) |
| 39933002 | Pancreatic hormone (substance) |
| 39953003 | Tobacco (substance) |
| 39954009 | Cellobiose phosphorylase (substance) |
| 39962001 | Coagulation factor II Barcelona variant (substance) |
| 39972003 | Sodium (substance) |
| 39973008 | C peptide (substance) |
| 39979007 | T-2 fungal toxin (substance) |
| 39985000 | Beryllium oxide (substance) |
| 39988003 | Skin reactive factor (substance) |
| 39989006 | Serotonin receptor (substance) |
| 39999001 | Blood group antigen C^G^ (substance) |
| 40012004 | Methionine adenosyltransferase (substance) |
| 40018000 | Blood group antibody Oliver (substance) |
| 40030006 | Blood group antigen M^c^ (substance) |
| 40034002 | Hemoglobin Minneapolis-Laos (substance) |
| 40036000 | Sulfamethazine (substance) |
| 40044000 | Human leukocyte antigen DRw11 (substance) |
| 40048002 | Blood group antigen Englund (substance) |
| 40057008 | Ozone (substance) |
| 40065006 | Human leukocyte antigen Bw73 (substance) |
| 40076005 | Erie garnet stain (substance) |
| 40078006 | Quercitrinase (substance) |
| 40082008 | Prostaglandin-A>1< delta-isomerase (substance) |
| 40112002 | Ichthyotoxin (substance) |
| 40115000 | Aluminum hydroxychloride (substance) |
| 40140007 | Blood group antibody Kirkpatrick (substance) |
| 40147005 | Diphenylmethane dye (substance) |
| 40154004 | Blood group antibody Singleton (substance) |
| 40164008 | CDPglycerol pyrophosphorylase |
| 40179001 | Tremolite (substance) |
| 40185008 | Serum amyloid A protein (substance) |
| 40200005 | Cytochrome-c peroxidase (substance) |
| 40205000 | Hemoglobin Cheverly (substance) |
| 40217003 | Glucan 1,4-alpha-maltohexaosidase (substance) |
| 40235007 | Hydroxymalonate dehydrogenase (substance) |
| 40239001 | Esophageal mucus (substance) |
| 40256009 | Indole-3-acetaldehyde oxidase (substance) |
| 40263009 | ^231^Uranium (substance) |
| 40270009 | Blood group antibody Truax (substance) |
| 40327006 | Hemoglobin Petah Tikva (substance) |
| 40342009 | Thiamylal sodium (substance) |
| 40346007 | ^207^Thallium |
| 40351001 | Isocyanate compound (substance) |
| 40352008 | Ryanodine (substance) |
| 40356006 | beta Fetoprotein (substance) |
| 40364000 | Blood group antigen A>1< Le^b^ (substance) |
| 40404004 | Papaverine hydrochloride (substance) |
| 40414008 | Hemoglobin Peterborough (substance) |
| 40424000 | Deoxyuridine triphosphate pyrophosphatase (substance) |
| 40426003 | Sucrose phosphate synthase (substance) |
| 40431001 | Tears (substance) |
| 40438007 | Antimony sodium tartrate (substance) |
| 40447004 | Blood group antibody Hy (substance) |
| 40456007 | Blood group antigen IB (substance) |
| 40469006 | Parathion (substance) |
| 40471006 | Magnesium stearate (substance) |
| 40479008 | Fructose-1-phosphate (substance) |
| 40534007 | Aflatrem (substance) |
| 40545005 | Amphotericin A (substance) |
| 40558006 | Blood group antigen VA (substance) |
| 40565003 | ^11^Carbon (substance) |
| 40569009 | Aminomethyltransferase (substance) |
| 40581008 | Alanylphosphatidylglycerol synthase (substance) |
| 40584000 | Uranium (substance) |
| 40588002 | Hexadecanal dehydrogenase (acylating) (substance) |
| 40601003 | Chlordiazepoxide hydrochloride (substance) |
| 40621002 | Blood group antigen Vr (substance) |
| 40647006 | Hexane (substance) |
| 40660000 | Organic silicon compound (substance) |
| 40699008 | Barium fluorosilicate (substance) |
| 40706003 | Blood group antigen Toms (substance) |
| 40710000 | Iodopyracet (substance) |
| 40718007 | Fast red B salt stain (substance) |
| 40728003 | ^201m^Lead (substance) |
| 40730001 | Hemoglobin Kariya (substance) |
| 40734005 | Rhus toxin (substance) |
| 40744007 | Alanine carboxypeptidase (substance) |
| 40755007 | Hemoglobin J-Kurosh (substance) |
| 40756008 | Membrane lipid (substance) |
| 40763008 | Oil of petitgrain (substance) |
| 40776002 | Strictosidine beta-glucosidase (substance) |
| 40783009 | Sec-hexyl acetate (substance) |
| 40789008 | Adrenocorticotropic hormone (substance) |
| 40808006 | Oil red O stain (substance) |
| 40813005 | Cardamom oil (substance) |
| 40817006 | Rubidium compound (substance) |
| 40830007 | Abnormal hemoglobin, beta-chain variant (substance) |
| 40840005 | Glycerol-1-phosphatase (substance) |
| 40848003 | Malate dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 40856000 | Leukotriene A (substance) |
| 40879004 | Reduced nicotinamide adenine dinucleotide dehydrogenase (ubiquinon) (substance) |
| 40922007 | Nylon 46 (substance) |
| 40924008 | Water-soluble vitamin (substance) |
| 40937006 | ^124^Iodine (substance) |
| 40940006 | Human chorionic gonadotrophin, beta subunit |
| 40942003 | Taurine dehydrogenase (substance) |
| 40955002 | Hemoglobin Wien (substance) |
| 40968005 | Silver nitrate ophthalmic agent (substance) |
| 40971002 | Adenylyl-[glutamate-ammonia ligase] hydrolase (substance) |
| 40991009 | alpha-L-Arabinofuranosidase (substance) |
| 40992002 | Lymphocyte antigen (substance) |
| 40996004 | Glutamin-(asparagin-)ase (substance) |
| 41043002 | Chemical solution (substance) |
| 41044008 | Blood group antigen Woit (substance) |
| 41062004 | Methoxsalen (substance) |
| 41067005 | ACN 6349 |
| 41091001 | Mebutamate (substance) |
| 41093003 | Blood group antibody E^w^ (substance) |
| 41094009 | Cyanidin-3-rhamnosylglucoside O^5^-glucosyltransferase (substance) |
| 41096006 | Blood group antibody Y. Bern (substance) |
| 41097002 | Hemoglobin F-Kingston (substance) |
| 41105002 | Halogenated hydrocarbon (substance) |
| 41126002 | Glycerate dehydrogenase (substance) |
| 41143004 | Ursodiol (substance) |
| 41153003 | Amyl nitrate (substance) |
| 41175001 | Organic compound (substance) |
| 41198009 | ^117^Antimony (substance) |
| 41199001 | Melatonin (substance) |
| 41220002 | Dugaldin (substance) |
| 41233008 | Chlorophenyl dimethyl urea trichloroacetate (substance) |
| 41247007 | Dephospho-[reductase kinase] kinase (substance) |
| 41255000 | Dihydrolipoamide acetyltransferase (substance) |
| 41261002 | Quinethazone (substance) |
| 41268008 | Pyruvate,water dikinase (substance) |
| 41282008 | Hemoglobin Boras |
| 41285005 | Blood group antigen Jones (substance) |
| 41301002 | H-2 locus (substance) |
| 41311009 | Hemoglobin F-Auckland (substance) |
| 41317008 | Asterosaponin (substance) |
| 41318003 | Blood group antibody Js^b^ (substance) |
| 41322008 | Hemoglobin Shenyang (substance) |
| 41332001 | Oleandomycin |
| 41343009 | ^222^Radium (substance) |
| 41372005 | Anthranilate phosphoribosyltransferase (substance) |
| 41383001 | Hemoglobin York (substance) |
| 41389002 | Ethyl hexanediol (substance) |
| 41395001 | Tamoxifen citrate (substance) |
| 41401001 | 1,2-alpha-L-Fucosidase (substance) |
| 41403003 | Blood group antigen Mt^a^ |
| 41410009 | Intrinsic factor (substance) |
| 41412001 | Tannic acid (substance) |
| 41414000 | Methylmalonyl-coenzyme A decarboxylase (substance) |
| 41420004 | Content of exocytic membrane invagination (substance) |
| 41433005 | Aluminum compound (substance) |
| 41441005 | Erythrose (substance) |
| 41459008 | Sodium bisulfite (substance) |
| 41464007 | ^90^Molybdenum (substance) |
| 41465008 | Glutamate decarboxylase (substance) |
| 41469002 | Oncogene protein (substance) |
| 41485007 | Leuc-enkephalin (substance) |
| 41492002 | Satratoxins |
| 41499006 | 3-Hydroxybenzoate 2-monooxygenase (substance) |
| 41503000 | Zinc compound (substance) |
| 41504006 | Lauric acid (substance) |
| 41508009 | Cerumen (substance) |
| 41509001 | Potassium warfarin (substance) |
| 41528008 | 2-Hydroxyacylsphingosine 1-beta-galactosyltransferase (substance) |
| 41540008 | Ribonucleoside-triphosphate reductase (substance) |
| 41548001 | Protochlorophyllide reductase (substance) |
| 41551008 | Right lower lobe mucus (substance) |
| 41558002 | Immunoglobulin, GM>8< allotype (substance) |
| 41562008 | Blood group antibody Tm (substance) |
| 41568007 | Arabinonate dehydratase (substance) |
| 41573001 | Linseed oil (substance) |
| 41576009 | Blood group antigen Rh26 (substance) |
| 41577000 | Tellurium (substance) |
| 41579002 | beta-N-acetylhexosaminidase (substance) |
| 41583002 | ^32^Silicon (substance) |
| 41592004 | ^82^Strontium (substance) |
| 41598000 | Estrogen (substance) |
| 41606000 | Tetrahydrofuran (substance) |
| 41612005 | 3-Chloro-D-alanine dehydrochlorinase (substance) |
| 41613000 | Adenylosuccinate lyase (substance) |
| 41623009 | Syntenic gene (substance) |
| 41641001 | ^196^Thallium (substance) |
| 41644009 | Blood group antigen Baltzer (substance) |
| 41646006 | Corticotropin binding globulin (substance) |
| 41649004 | Calmodulin (substance) |
| 41667006 | Blood group antigen Begovitch (substance) |
| 41691002 | ^210^Radon (substance) |
| 41692009 | Hemoglobin Ube-4 (substance) |
| 41711007 | Thymidine phosphorylase (substance) |
| 41718001 | N-(5'-Phospho-D-ribosylformimino)-5-amino-1-(5''-phosphoribosyl)-4-imidazole-carboxamide isomerase (substance) |
| 41722006 | Cefotaxime sodium (substance) |
| 41748003 | Organic tin compound (substance) |
| 41750006 | Brazilin stain (substance) |
| 41758004 | ^169^Ytterbium (substance) |
| 41759007 | Trimetaphosphatase (substance) |
| 41761003 | Blood group antibody Stewart (substance) |
| 41771001 | Blood group antigen Gallner (substance) |
| 41773003 | Formiminoglutamate deiminase (substance) |
| 41793006 | Calcium cyanamide (substance) |
| 41805004 | Diglyceride lipase |
| 41810000 | beta Aminoisobutyric acid (substance) |
| 41830001 | Aromatic-L-amino-acid decarboxylase (substance) |
| 41834005 | Olive oil (substance) |
| 41856008 | Dioxotetrahydropyrimidine-ribonucleotide pyro-phosphorylase |
| 41858009 | Blood group antigen Wetz (substance) |
| 41861005 | 2-Hydroxy-3-oxopropionate reductase (substance) |
| 41875003 | Glutathione-cystine transhydrogenase (substance) |
| 41886001 | Blood group antigen Kenneddy (substance) |
| 41896005 | Hemoglobin Toyama (substance) |
| 41903005 | Hexapradol (substance) |
| 41917001 | Hemoglobin Potomac (substance) |
| 41924000 | Nicotinamide adenine dinucleotide ^+^ kinase (substance) |
| 41926003 | Cholesterol 7alpha-monooxygenase (substance) |
| 41930000 | Blood group antigen McDermott (substance) |
| 41937002 | Hb epsilon>4< |
| 41940002 | Mannosyl-oligosaccharide glucosidase (substance) |
| 41945007 | Alkylpiperidine derivative of phenothiazine (substance) |
| 41956007 | Propylene imide (substance) |
| 41967008 | Silver (substance) |
| 41978000 | Blood group antibody V.G. (substance) |
| 41989007 | Lolitrem (substance) |
| 41990003 | Mannosyl-glycoprotein endo-beta-N-acetyl-glucosaminidase (substance) |
| 41994007 | Animal alkaloid (substance) |
| 41999002 | Blood group antibody Joslin (substance) |
| 42001007 | Polychlorinated biphenyl (substance) |
| 42013002 | Banisterine (substance) |
| 42027007 | Alcohol radical (substance) |
| 42033003 | Sterculia gum (substance) |
| 42038007 | Human leukocyte antigen Bw62 (substance) |
| 42048009 | Blood group antibody Terry (substance) |
| 42053004 | Plant teratogen (substance) |
| 42056007 | Placental hormone (substance) |
| 42076001 | Crystallin (substance) |
| 42078000 | Blood group antigen Kursteiner (substance) |
| 42092006 | Blood group antigen Allchurch (substance) |
| 42104001 | L-Fuculokinase (substance) |
| 42107008 | Human leukocyte antigen Cw (substance) |
| 42121005 | Hemopexin (substance) |
| 42122003 | Blood group antibody Armstrong |
| 42124002 | Glutamate-transfer ribonucleic acid ligase (substance) |
| 42130002 | Prephenate dehydratase (substance) |
| 42133000 | Sulfur pentafluoride (substance) |
| 42144008 | Bisulfate salt (substance) |
| 42145009 | Fibrinogen Copenhagen (substance) |
| 42146005 | Iodide salt (substance) |
| 42151004 | ^73^Arsenic |
| 42159002 | Mushroom poison (substance) |
| 42163009 | Methylphenidate hydrochloride (substance) |
| 42165002 | Immunoglobulin gene (substance) |
| 42166001 | Blood group antigen Kx (substance) |
| 42172001 | Uca pugilator collagenolytic proteinase (substance) |
| 42180008 | Vitamin D>2<, phosphate ester (substance) |
| 42184004 | Hemoglobin G-Norfolk (substance) |
| 42193003 | Stannous fluoride (substance) |
| 42204005 | Cyclic guanosine monophosphate (substance) |
| 42210005 | Leukocyte-membrane neutral endopeptidase (substance) |
| 42212002 | Sodium pentachlorophenate (substance) |
| 42230009 | Bentonite (substance) |
| 42231008 | Bilirubin diglucuronide (substance) |
| 42240007 | Duplicating ink (substance) |
| 42242004 | Aminomuconate-semialdehyde dehydrogenase (substance) |
| 42244003 | Debromoaplysiatoxin (substance) |
| 42248000 | Methyl orange stain (substance) |
| 42255003 | Blood group antibody Zaw (substance) |
| 42257006 | ^183^Iridium (substance) |
| 42281004 | Cellobiose dehydrogenase (acceptor) (substance) |
| 42303002 | Phytolaccigenin (substance) |
| 42319009 | Lipotropin (substance) |
| 42325008 | Lacrimator gas (substance) |
| 42328005 | o-Chlorobenzylidenemalononitrile (substance) |
| 42333009 | Blood group antibody LW^b^ (substance) |
| 42342002 | Aspartate-semialdehyde dehydrogenase (substance) |
| 42363000 | Ethyl mercury chloride (substance) |
| 42370000 | Mannitol dehydrogenase (cytochrome) (substance) |
| 42371001 | Heterocytotropic antibody (substance) |
| 42382009 | 4-Ipomeanol (substance) |
| 42416001 | Wool grease |
| 42417005 | Carbon^14^ triolein (substance) |
| 42428009 | Hemoglobin N-Baltimore (substance) |
| 42435001 | Hemoglobin Saint Jacques (substance) |
| 42449005 | Antimony (substance) |
| 42464005 | p-Phenylenediamine (substance) |
| 42465006 | 3-Dehydroquinate dehydratase (substance) |
| 42473002 | Blood group antibody Cross (substance) |
| 42489004 | Cysteine aminotransferase (substance) |
| 42490008 | Blood group antibody Tn (substance) |
| 42503003 | Adenosine monophosphate thymidine kinase (substance) |
| 42507002 | Calmodulin-lysine methyltransferase (substance) |
| 42520004 | Bulrush millet ergot alkaloid (substance) |
| 42549007 | alpha 2 macroglobulin (substance) |
| 42558000 | Californium radioisotope (substance) |
| 42564007 | Bensulfide (substance) |
| 42566009 | Toluidine (substance) |
| 42580002 | Hemoglobin Etobicoke (substance) |
| 42589001 | ^176^Tantalum (substance) |
| 42605004 | Aldosterone (substance) |
| 42607007 | Carbamoyl-phosphate synthase (ammonia) (substance) |
| 42634005 | Guanosine triphosphate cyclohydrolase I (substance) |
| 42657004 | Cyclamate sulfohydrolase (substance) |
| 42664002 | Human leukocyte antigen Dw17 (substance) |
| 42671007 | Rye ergot alkaloid (substance) |
| 42674004 | Sucrose synthase (substance) |
| 42692007 | Naproxen sodium (substance) |
| 42702005 | ^237^Plutonium (substance) |
| 42710006 | Coagulation factor XI variant type II (substance) |
| 42722009 | Hydrogenase (substance) |
| 42728008 | Indium^113^ pentetate (substance) |
| 42730005 | Periodate salt (substance) |
| 42732002 | Lymphocyte antigen CD1a (substance) |
| 42735000 | Carbamoyl-phosphate synthase (glutamine-hydrolysing) (substance) |
| 42753006 | Dextrin dextranase (substance) |
| 42757007 | Hydrofluoric acid (substance) |
| 42761001 | Pyrocatechol (substance) |
| 42768007 | Blood group antigen En^a^TS (substance) |
| 42784008 | Blood group antibody Wd^a^ (substance) |
| 42789003 | ^95^Technetium (substance) |
| 42799008 | Immunoglobulin idiotype (substance) |
| 42804003 | Microsomal aminopeptidase (substance) |
| 42830004 | Blood group antibody Wilson (substance) |
| 42831000 | ^87m^Yttrium (substance) |
| 42832007 | 2-Keto-3-deoxyglucarate aldolase |
| 42841002 | Zinc oxide (substance) |
| 42848008 | Blood group antigen MPD (substance) |
| 42850000 | Fluorinated hydrocarbon (substance) |
| 42860009 | Hemoglobin Mexico (substance) |
| 42877009 | Anhydrous borate (substance) |
| 42884001 | Neuraminic acid (substance) |
| 42885000 | Deoxythymidine diphosphate-6-deoxy-L-talose dehydrogenase (substance) |
| 42888003 | Blood group antigen Cipriano (substance) |
| 42891003 | Lymphocyte antigen CD56 (substance) |
| 42897004 | Blood group antigen Donati (substance) |
| 42907009 | Carboxylic acid (substance) |
| 42918009 | Arginine 2-monooxygenase (substance) |
| 42922004 | Methemalbumin (substance) |
| 42926001 | Blood group antigen Seymour (substance) |
| 42934007 | Hydroxy phenylpyruvic acid, ortho (substance) |
| 42938005 | alpha-Adrenergic receptor (substance) |
| 42951000 | Methomyl (substance) |
| 42958006 | 5-methyl-3-heptanone (substance) |
| 43004008 | Glucagon-like peptide 1 (substance) |
| 43013005 | Hemoglobin Fannin-Lubbock (substance) |
| 43024007 | Iron salt (substance) |
| 43032004 | Anabasine (substance) |
| 43034003 | Nasal antiviral (substance) |
| 43041009 | Acetate-coenzyme A ligase (adenosine diphoshate-forming) (substance) |
| 43042002 | Platelet antibody HPA-5b (substance) |
| 43048003 | Amphomycin (substance) |
| 43076006 | Blood group antibody Evans (substance) |
| 43095004 | Complement receptor CRI (substance) |
| 43097007 | Pantothenoylcysteine decarboxylase (substance) |
| 43106008 | Pyronine G stain (substance) |
| 43117009 | Imidazoleglycerol-phosphate dehydratase (substance) |
| 43136004 | Strontium (substance) |
| 43161001 | Fluoroacetate salt (substance) |
| 43169004 | N-Methyl-2-oxoglutaramate hydrolase (substance) |
| 43171004 | Ovarian hormone (substance) |
| 43181000 | Blood group antibody Cl^a^ (substance) |
| 43201005 | Amine (substance) |
| 43211003 | n-Acetyl neuraminic acid (substance) |
| 43212005 | Concanavalin A (substance) |
| 43215007 | Glucan 1,3-alpha-glucosidase (substance) |
| 43230003 | Rubber (substance) |
| 43237000 | Succinyldiaminopimelate aminotransferase (substance) |
| 43239002 | ^75^Selenium (substance) |
| 43241001 | Blood group antibody Pelletier (substance) |
| 43268001 | Copper compound (substance) |
| 43278003 | Platelet activating factor (substance) |
| 43289005 | Dihydrofolic acid (substance) |
| 43290001 | Sedoheptulose-bisphosphatase (substance) |
| 43305003 | Protein-tyrosine kinase (substance) |
| 43314008 | Extracellular material (substance) |
| 43328002 | Oxalate-coenzyme A ligase (substance) |
| 43332008 | Coagulation factor IX Lake Elsinor variant (substance) |
| 43342005 | Decanoate |
| 43347004 | Blood group antigen A>1< Le^d^ (substance) |
| 43356007 | Betaine (substance) |
| 43357003 | Hemoglobin Baylor (substance) |
| 43360005 | Aconitine (substance) |
| 43365000 | L-Threonine 3-dehydrogenase (substance) |
| 43374003 | [Pyruvate dehydrogenase (lipoamide)] kinase (substance) |
| 43397000 | Idiotope (substance) |
| 43417002 | Blood group antibody IH (substance) |
| 43419004 | Bitter almond oil |
| 43425000 | Blood group antigen Dahl (substance) |
| 43431002 | Maltose (substance) |
| 43436007 | Chromic salt (substance) |
| 43440003 | Melanocyte stimulating hormone releasing factor (substance) |
| 43461005 | Bryonal (substance) |
| 43462003 | Para-aminohippuric acid (substance) |
| 43494008 | Acetoacetyl-CoA hydrolase |
| 43506001 | Tephrosin (substance) |
| 43514007 | Disodium ethylene bis-(dithiocarbonate) (substance) |
| 43538006 | Non radiopaque medium (substance) |
| 43541002 | Pentapiperide (substance) |
| 43549000 | Solochrome azurine (BS) stain (substance) |
| 43564000 | Hematite (substance) |
| 43576000 | Blood group antibody N^A^ (substance) |
| 43585000 | Sulfonamide diuretic (substance) |
| 43588003 | Immunoglobulin, GM>9< allotype (substance) |
| 43592005 | Cactinomycin (substance) |
| 43596008 | Human leukocyte antigen Bw64 (substance) |
| 43597004 | Chymodenin (substance) |
| 43605008 | Hemoglobin C-Makassar |
| 43613009 | Phosphorous pentachloride (substance) |
| 43621003 | Coagulation factor IX Oxford 2 variant (substance) |
| 43625007 | Cholesterol oxidase (substance) |
| 43632003 | Blood group antibody K14 |
| 43677001 | ^148^Gadolinium (substance) |
| 43678006 | Blood group antigen Pr>3< (substance) |
| 43687002 | Hemoglobin Quong Sze (substance) |
| 43688007 | Testosterone (substance) |
| 43698001 | Hydroxystilbamidine isethionate (substance) |
| 43706004 | Vitamin C |
| 43708003 | Animal feed additive (substance) |
| 43709006 | Phosphatidyl 3-0-alanylglycerol (substance) |
| 43710001 | Butylidene chloride (substance) |
| 43713004 | Nicotinamide adenine dinucleotide ^+^ synthase |
| 43723008 | Tributyl phosphate (substance) |
| 43728004 | beta-D-fructofuranose (substance) |
| 43735007 | Sulfur (substance) |
| 43740004 | ^210^Lead (substance) |
| 43743002 | Polyvinyl acetate (substance) |
| 43751004 | Ribonucleic acid-directed ribonucleic acid polymerase (substance) |
| 43775004 | Cytidine monophosphate-N-acetylneuraminate-alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase (substance) |
| 43784004 | Thymic lymphopoietin suppressing factor (substance) |
| 43788001 | Blood group antibody Davis (substance) |
| 43803003 | 2-(Acetamidomethylene) succinate hydrolase (substance) |
| 43804009 | Ethyl silicate (substance) |
| 43807002 | Blood group antigen In^b^ (substance) |
| 43812001 | Nasal sulfonamide agent (substance) |
| 43813006 | Phosphoribosylglycinamide formyltransferase (substance) |
| 43819005 | Haemoglobin Kansas |
| 43821000 | Alcohol dehydrogenase (acceptor) (substance) |
| 43827001 | Blood group antigen Mineo (substance) |
| 43835003 | Zinc gelatin (substance) |
| 43839009 | Aminocarboxymuconate-semialdehyde decarboxylase (substance) |
| 43848004 | Agkistrodon serine proteinase (substance) |
| 43850007 | ^105^Rhodium (substance) |
| 43862006 | Isovitexin beta-glucosyltransferase (substance) |
| 43864007 | Blood group antigen Ull (substance) |
| 43866009 | Uridine diphosphate-N-acetylglucosamine-lysosomal-enzyme-N-acetylglucosaminephosphotransferase (substance) |
| 43871002 | Human leukocyte antigen Dw7 (substance) |
| 43880002 | Chloroacetamide (substance) |
| 43886008 | Boron oxide (substance) |
| 43896004 | Para-dichlorobenzene |
| 43897008 | ^56^Manganese (substance) |
| 43909000 | Thiamine triphosphate (substance) |
| 43920000 | Hemoglobin A,a (substance) |
| 43921001 | Nickel compound (substance) |
| 43936003 | Oncogene protein fins (substance) |
| 43953005 | Ammonia (substance) |
| 43965009 | Phenothioxin (substance) |
| 43974006 | Alkyl sodium sulfates (substance) |
| 43984007 | Alpha amino acid (substance) |
| 43987000 | Acacia (substance) |
| 43989002 | 3,4-Methylenedioxybenzyl methyl ketone (substance) |
| 44007007 | Padimate O (substance) |
| 44027008 | Seafood (substance) |
| 44033004 | Anthracene (substance) |
| 44035006 | Nitromethane (substance) |
| 44040003 | Human leukocyte antigen Bw57 (substance) |
| 44044007 | Calcium phosphate (substance) |
| 44045008 | Blood group antibody Tasich (substance) |
| 44046009 | Blood group antibody Paular |
| 44048005 | Geranoyl-CoA carboxylase (substance) |
| 44049002 | Blood group antigen Lindsay (substance) |
| 44059001 | Gamboge (substance) |
| 44063008 | Blood group antigen Pt^a^ (substance) |
| 44068004 | Doxylamine (substance) |
| 44079009 | Urobilinogen (substance) |
| 44090004 | Hemoglobin Handsworth (substance) |
| 44093002 | Blood group antibody KL (substance) |
| 44112005 | Blood group antigen Lu11 (substance) |
| 44120007 | 2,5-Diokovalerate dehydrogenase (substance) |
| 44121006 | Transferase (substance) |
| 44125002 | Aconitate delta-isomerase (substance) |
| 44127005 | alpha, alpha-Trehalase (substance) |
| 44139002 | Blood group antigen Don E. W. (substance) |
| 44142008 | Hemoglobin Ocho Rios (substance) |
| 44153002 | Cytokinin 7-beta-glucosyltransferase |
| 44158006 | Lymphocyte antigen CD64 (substance) |
| 44159003 | Barium oxide (substance) |
| 44179006 | Renilla-luciferin 2-monooxygenase (substance) |
| 44205007 | Grayanotoxin (substance) |
| 44207004 | Methylaspartate ammonia-lyase (substance) |
| 44212003 | Anti SS-A antibody (substance) |
| 44220001 | Formate acetyltransferase (substance) |
| 44225006 | Oncogene protein N-RAS (substance) |
| 44234001 | Strontium isotope (substance) |
| 44239006 | Platelet antibody HPA-1 (substance) |
| 44262008 | Oxidized cellulose |
| 44293009 | Phenoxybenzamine hydrochloride (substance) |
| 44302008 | Peptidyl-glutaminase (substance) |
| 44320004 | 1-Naphthol |
| 44330008 | Pyrvinium pamoate (substance) |
| 44331007 | Blood group antibody In^b^ (substance) |
| 44344002 | Abscisic acid (substance) |
| 44347009 | Lergotrile (substance) |
| 44368005 | Oncogene protein HER-2/neu (substance) |
| 44369002 | Anaphylatoxin (substance) |
| 44370001 | Oncogene protein c-fos (substance) |
| 44394001 | Copper naphthenate (substance) |
| 44404008 | Sulfoxide (substance) |
| 44406005 | Polyethylene glycol alkyl ether (substance) |
| 44407001 | [Acyl-carrier-protein] malonyltransferase (substance) |
| 44411007 | GC globulin (substance) |
| 44413005 | beta-Thiocyanoethyl fatty acid ester (substance) |
| 44417006 | Monoterpenol beta-glucosyltransferase |
| 44439008 | Blood group antigen Smith (substance) |
| 44446004 | Petroleum agent (substance) |
| 44447008 | Blood group antigen Fleming (substance) |
| 44459007 | Interleukin-8 (substance) |
| 44461003 | Homoserine acetyltransferase (substance) |
| 44469001 | Fibrinogen Petoskey (substance) |
| 44472008 | Blood group antibody Begovitch (substance) |
| 44475005 | Fucoidanase (substance) |
| 44488008 | Bismark brown R stain (substance) |
| 44495004 | ^126^Antimony |
| 44506007 | ^112^Silver (substance) |
| 44508008 | Hydromorphone (substance) |
| 44510005 | Uridine diphosphate glucose-hexose-1-phosphate uridylyltransferase (substance) |
| 44517008 | Glycerol-3-phosphate dehydrogenase (substance) |
| 44520000 | Nylidrin hydrochloride (substance) |
| 44533006 | Benzaldehyde dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) |
| 44555003 | Methylenedioxyamphetamine (substance) |
| 44556002 | Pyruvate decarboxylase (substance) |
| 44581004 | 1-1-Dichloro-1-nitroethane (substance) |
| 44588005 | Iodine (substance) |
| 44590006 | Callistin toxin (substance) |
| 44603007 | Iodinated glycerol (substance) |
| 44609006 | Calcitonin gene-related peptide (substance) |
| 44611002 | Nitrosyl chloride (substance) |
| 44624002 | Fibrinogen New Orleans I (substance) |
| 44632005 | 4,7,10,13,16,19-Docosahexaenoic acid (substance) |
| 44639001 | Solid carbon dioxide (substance) |
| 44644008 | Mycotoxin (substance) |
| 44675004 | Blood group antibody Nou (substance) |
| 44680008 | Factor VIII antigen (substance) |
| 44681007 | Hypothalamic inhibiting factor (substance) |
| 44686002 | Blood group antigen Lud (substance) |
| 44706009 | Lymphocyte antigen CD3 (substance) |
| 44711006 | Gastrin II (substance) |
| 44719008 | Mediator of immune response (substance) |
| 44728009 | Complement component C1 (substance) |
| 44740009 | Choline oxidase (substance) |
| 44742001 | Hemoglobin Louisville (substance) |
| 44746003 | Bufotalin (substance) |
| 44753007 | Thymine,2-oxoglutarate dioxygenase (substance) |
| 44770004 | Intracisternal granule of endoplasmic reticulum (substance) |
| 44776005 | Xenon radioisotope (substance) |
| 44822001 | Ethyl bromide (substance) |
| 44824000 | Blood group antibody Pearl (substance) |
| 44837002 | Cyclopropane (substance) |
| 44839004 | Armillaria mellea neutral proteinase (substance) |
| 44858008 | Hemoglobin Q-Iran (substance) |
| 44896009 | Hemoglobin Hamilton (substance) |
| 44908000 | Chlorzoxozone (substance) |
| 44924004 | Endorphin receptor (substance) |
| 44931000 | Adenosylhomocysteinase (substance) |
| 44937001 | beta-Ureidopropionase (substance) |
| 44954009 | Oncogene protein TCRG (substance) |
| 44970006 | Aspartic acid (substance) |
| 44971005 | Thromboxane synthase (substance) |
| 44973008 | ^182^Tantalum (substance) |
| 44976000 | Hydroxy-mercuricresol (substance) |
| 45001002 | Bone matrix (substance) |
| 45003004 | Virus receptor (substance) |
| 45011009 | Tyramine N-methyltransferase (substance) |
| 45018003 | Steroid N-acetylglucosaminyltransferase (substance) |
| 45025005 | Permanganic acid (substance) |
| 45026006 | Blood group antigen M^v^ (substance) |
| 45032001 | Hemoglobin D-Ibadan (substance) |
| 45041006 | Dicycloxylamine (substance) |
| 45044003 | Blood group antibody Lud (substance) |
| 45047005 | Lymphokine (substance) |
| 45060004 | Yttrium compound (substance) |
| 45065009 | myo-Inosose-2 dehydratase (substance) |
| 45068006 | 3-Hydroxybutyryl-coenzyme A epimerase (substance) |
| 45084007 | Fibrin degradation agent, D fragment (substance) |
| 45087000 | Oleoyl-[acyl-carrier-protein] hydrolase (substance) |
| 45095001 | Blood group antigen K18 (substance) |
| 45106005 | Congo red stain (substance) |
| 45108006 | Lysosomal carboxypeptidase B (substance) |
| 45119009 | Glycine salt of bile acid (substance) |
| 45120003 | Ester |
| 45137005 | Hemoglobin Suresnes (substance) |
| 45141009 | Ornithine carbamoyltransferase (substance) |
| 45158004 | Fluorine isotope (substance) |
| 45159007 | Azatadine maleate (substance) |
| 45160002 | Oxazine dye (substance) |
| 45174009 | Alkylglycerophosphoethanolamine phosphodiesterase (substance) |
| 45193006 | Blood group antibody Horw (substance) |
| 45199005 | Oil of geranium (substance) |
| 45207006 | Dextroamphetamine sulfate (substance) |
| 45209009 | Epsilon-chain hemoglobin (substance) |
| 45215009 | Tantalum (substance) |
| 45219003 | Sodium monofluoroacetate (substance) |
| 45246008 | C4bp complement protein (substance) |
| 45262002 | Mercury (substance) |
| 45266004 | Antiplasmin (substance) |
| 45273009 | Blood group antigen hr^H^ (substance) |
| 45285001 | Hemoglobin Arya (substance) |
| 45321005 | Blood group antibody M (substance) |
| 45333000 | Blood group antigen Sl^a^ (substance) |
| 45345009 | Hemoglobin A>2< Victoria (substance) |
| 45367005 | Tungsten radioisotope (substance) |
| 45373006 | Reduced nicotinamide adenine dinucleotide peroxidase (substance) |
| 45375004 | Hemoglobin F-Carlton (substance) |
| 45380008 | ^134m^Cesium (substance) |
| 45386002 | Purine (substance) |
| 45388001 | Blood group antigen Laine (substance) |
| 45389009 | Tissue stain |
| 45394009 | Monophenol monooxygenase (substance) |
| 45396006 | Cardiolipin antibody (substance) |
| 45397002 | Hemoglobin Matsue-Oki (substance) |
| 45407009 | Blood group antigen Ghawiler (substance) |
| 45425002 | Tellurium compound (substance) |
| 45428000 | Blood group antibody Perry (substance) |
| 45436009 | Tenebrio alpha-proteinase (substance) |
| 45441001 | Blood group antigen Tk (substance) |
| 45442008 | Phenyl mercuric chloride |
| 45454008 | Cerebrin (substance) |
| 45457001 | Lipopolysaccharide N-acetylglucosaminyltransferase (substance) |
| 45470005 | Bromacil (substance) |
| 45475000 | Indigo carmine stain (substance) |
| 45483006 | Psilocin (substance) |
| 45487007 | Trifluridine ophthalmic agent (substance) |
| 45510000 | Blood group antibody Jopson (substance) |
| 45524001 | Dextranomer (substance) |
| 45528003 | Blood group antibody Dugstad (substance) |
| 45530001 | Antinuclear antibody (substance) |
| 45537003 | Farnesyltranstransferase (substance) |
| 45539000 | Succinate dehydrogenase (ubiquinone) (substance) |
| 45542006 | Thiosulfate salt (substance) |
| 45555007 | Norepinephrine (substance) |
| 45570008 | Mevaldate reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 45585002 | beta-1 Adrenergic receptor (substance) |
| 45601001 | Blood group antibody A.M. (substance) |
| 45604009 | Tranquilizer (substance) |
| 45609004 | Hemoglobin F-Pendergrass (substance) |
| 45620004 | Pyrethrin (substance) |
| 45622007 | 3-Deoxy-D-manno-octulosonate aldolase (substance) |
| 45627001 | ^41^Argon |
| 45637006 | Blood group antibody Bonde (substance) |
| 45641005 | Hemoglobin Atlanta (substance) |
| 45648004 | Angiotensin receptor (substance) |
| 45656001 | Human leukocyte antigen Bw22 (substance) |
| 45668005 | Blood group antigen Bouteille (substance) |
| 45672009 | Blood group antibody Lu11 (substance) |
| 45695000 | Plant alkaloid (substance) |
| 45698003 | Putrescine (substance) |
| 45710003 | Sputum |
| 45717000 | Coniferyl-alcohol dehydrogenase (substance) |
| 45729009 | Glucosamine-phosphate acetyltransferase (substance) |
| 45733002 | Magnesium chloride (substance) |
| 45737001 | Glycolic acid (substance) |
| 45754009 | Alpha interferon (substance) |
| 45784001 | Xanthine oxidase (substance) |
| 45791003 | GDPmannose phosphorylase |
| 45799001 | Tissue-endopeptidase degrading collagenase-synthetic-substrate (substance) |
| 45800002 | L-Arabinose isomerase (substance) |
| 45807004 | Coagulation factor IX variant (substance) |
| 45849009 | Technetium Tc^99m^ sodium glucoheptonate (substance) |
| 45857007 | Antilysosomal antibody (substance) |
| 45867002 | Glyoxylate dehydrogenase (acylating) (substance) |
| 45878005 | Immunologic receptor (substance) |
| 45883002 | Mitochondrial ribonucleic acid (substance) |
| 45922005 | Amphibole asbestos (substance) |
| 45932003 | Anti Jo-1 antibody (substance) |
| 45934002 | Blood group antigen Os^a^ (substance) |
| 45940009 | Theophylline anhydrous (substance) |
| 45946003 | Proglucagon (substance) |
| 45947007 | Amylo-1,6-glucosidase (substance) |
| 45952002 | 1-Acylglycerol-3-phosphate acyltransferase (substance) |
| 45954001 | Arginine racemase (substance) |
| 45957008 | Vinyl acetate |
| 45960001 | Naepaine (substance) |
| 45962009 | Collodion (substance) |
| 45969000 | Blood group antibody i (substance) |
| 45986006 | Teratogenic substance (substance) |
| 45992000 | Blood group antigen s (substance) |
| 45996002 | Cytidine diphosphate acylglycerol arachidonyltransferase (substance) |
| 45997006 | Omega amino acid (substance) |
| 46015007 | Melanocyte stimulating hormone (substance) |
| 46016008 | Mancozeb (substance) |
| 46021006 | ^91^Strontium (substance) |
| 46031004 | Salt water (substance) |
| 46046006 | Immunoglobulin A (substance) |
| 46058006 | Prostaglandin PGG2 (substance) |
| 46064004 | Asparagine-oxo-acid aminotransferase (substance) |
| 46066002 | Deoxythymidine diphosphate-glucose 4,6 dehydratase (substance) |
| 46075000 | Oligosaccharide (substance) |
| 46084000 | 2-Aminoadipate aminotransferase (substance) |
| 46096007 | Blood group antibody Knudsen (substance) |
| 46097003 | Lactated Ringer's solution (substance) |
| 46120009 | 17-Ketosteroid (substance) |
| 46122001 | Antitreponemal agent (substance) |
| 46134009 | Prostaglandin A>1< |
| 46137002 | Borneol (substance) |
| 46139004 | Martius yellow stain (substance) |
| 46146008 | Cefotetan disodium (substance) |
| 46150001 | Human leucocyte antigen Bw4 |
| 46158008 | HLA - Human leucocyte antigen Dw14 |
| 46164001 | ^109^Indium (substance) |
| 46187009 | Abequosyltransferase (substance) |
| 46188004 | D-Glutamyltransferase (substance) |
| 46191004 | Cataglykin (substance) |
| 46195008 | Blood group antibody Smith (substance) |
| 46201000 | Piperidolate (substance) |
| 46225008 | Cholecystokinin (substance) |
| 46234003 | Blood group antigen Nob (substance) |
| 46242002 | Body secretion (substance) |
| 46243007 | Methyl sulfate difenzoquat (substance) |
| 46245000 | Hemoglobin Korle-Bu (substance) |
| 46250006 | Slaframine |
| 46257009 | Triiodomethane (substance) |
| 46261003 | Blood group antigen C^x^ (substance) |
| 46281002 | Caffeate o-methyltransferase (substance) |
| 46290009 | Bisphosphoglycerate phosphatase (substance) |
| 46293006 | Bromocriptine mesylate (substance) |
| 46310006 | Glycine dehydrogenase (decarboxylating) (substance) |
| 46320001 | N-Acylsphingosine galactosyltransferase (substance) |
| 46321002 | Asterotoxin (substance) |
| 46329000 | Chocolate milk (substance) |
| 46331009 | Blood group antibody K13 (substance) |
| 46335000 | Sulisobenzone (substance) |
| 46336004 | Complement component C2b (substance) |
| 46338003 | Cysteine-S-conjugate N-acetyltransferase (substance) |
| 46344004 | Alginate synthase (substance) |
| 46346002 | Tabernamontanain (substance) |
| 46358002 | ^118^Antimony (substance) |
| 46384008 | Ink (substance) |
| 46407003 | Guanosine diphosphate mannose 4,6 dehydratase (substance) |
| 46409000 | Bilirubin monoglucuronide transglucuronidase |
| 46417008 | Chlorate salt (substance) |
| 46425005 | Intestinal vomitus (substance) |
| 46445002 | 11beta-Hydroxysteroid dehydrogenase (substance) |
| 46461000 | Fucose-1-phosphate guanylyltransferase (substance) |
| 46469003 | Properdin convertase, complement component (substance) |
| 46484007 | Bleaching powder (substance) |
| 46491005 | Menthyl anthranilate (substance) |
| 46492003 | Nivalenol (substance) |
| 46509002 | 1-Phosphofructokinase (substance) |
| 46512004 | Tertiary butyl chromate (substance) |
| 46514003 | Calcium mandelate (substance) |
| 46519008 | Blood group antibody ILe^bH^ (substance) |
| 46520002 | Immunoglobulin, GM>2< allotype (substance) |
| 46539007 | Complement component C1r (substance) |
| 46543006 | ^107^Palladium (substance) |
| 46548002 | Leukotriene B (substance) |
| 46558003 | N-F-thienamycin |
| 46566007 | Arylamine N-methyltransferase (substance) |
| 46572007 | Coagulation factor XI (substance) |
| 46583003 | Actin (substance) |
| 46591007 | Superfatted soap (substance) |
| 46601006 | Diazomethane (substance) |
| 46602004 | Electron (substance) |
| 46610003 | 3-Dehydrosphinganine reductase (substance) |
| 46613001 | Human leukocyte antigen Bw58 (substance) |
| 46654009 | Tetrahydrocortisone (substance) |
| 46663006 | Blood group antibody Lee (substance) |
| 46668002 | Homatropine methylbromide (substance) |
| 46682002 | Ribonuclease T>2< |
| 46684001 | Hemoglobin N-Seattle (substance) |
| 46685000 | Serine-ethanolaminephosphate phosphodiesterase (substance) |
| 46691003 | Organoalkyl mercury (substance) |
| 46711008 | Diglycol hydroiodide (substance) |
| 46730008 | Blood group antigen Bio-5 (substance) |
| 46736002 | Glutamate racemase (substance) |
| 46743008 | Nucleotide pyrophosphatase (substance) |
| 46749007 | Medicinal iodine (substance) |
| 46755002 | Blood group antigen Schor (substance) |
| 46757005 | Hemoglobin St. Antoine (substance) |
| 46769002 | Immune suppressor gene (substance) |
| 46810001 | Flint (substance) |
| 46815006 | Connective tissue matrix (substance) |
| 46840004 | Animal oil (substance) |
| 46841000 | Blood group antigen BOW (substance) |
| 46843002 | Xanthine (substance) |
| 46845009 | Tyrosine phenol-lyase (substance) |
| 46859002 | Septicine (substance) |
| 46861006 | Deoxynivalenol (substance) |
| 46864003 | Thiocyanate isomerase (substance) |
| 46887006 | Ambenonium chloride (substance) |
| 46921009 | Quinoline dye (substance) |
| 46932009 | Thyroid colloid (substance) |
| 46942006 | Oxamic acid (substance) |
| 46943001 | Cortolone (substance) |
| 46950002 | Protriptyline hydrochloride (substance) |
| 46959001 | Lymphocyte antigen CD11c (substance) |
| 46961005 | Hydroxypyruvate isomerase (substance) |
| 46974004 | Hemoglobin Oleander (substance) |
| 46978001 | Cyclopentanol dehydrogenase (substance) |
| 46985002 | 1,2-Dichloroethylene |
| 47019005 | Blood group antigen Hildebrandt (substance) |
| 47023002 | Lymphocyte antigen CD66 (substance) |
| 47026005 | Thymol oxide (substance) |
| 47030008 | Insoluble berlin blue stain (substance) |
| 47038001 | Human leukocyte antigen (substance) |
| 47052004 | Chemical suspension (substance) |
| 47053009 | ^193^Gold (substance) |
| 47068005 | Blood group antibody Jr^a^ (substance) |
| 47088009 | Carboxymethylenebutenolidase (substance) |
| 47097008 | Oxaloacetic acid (substance) |
| 47104007 | Blood group antigen Co3 (substance) |
| 47121003 | Bismuth isotope (substance) |
| 47136000 | Blood group antigen Manley (substance) |
| 47151009 | Blood group antibody Win (substance) |
| 47167003 | Glyceraldehyde-3-phosphate (substance) |
| 47169000 | Aminoacyl-methylhistidine dipeptidase (substance) |
| 47172007 | Sulfuric acid (substance) |
| 47174008 | Glutamine-pyruvate aminotransferase (substance) |
| 47176005 | Methdilazine hydrochloride (substance) |
| 47180000 | Methisazone (substance) |
| 47184009 | Silver compound (substance) |
| 47189004 | ^195^Thallium (substance) |
| 47192000 | Meglumine diatrizoate (substance) |
| 47201006 | 5-Hydroperoxy-6,8,11,14-eicosatetraenoic acid (substance) |
| 47204003 | Ferbam (substance) |
| 47205002 | Cobalt blue (substance) |
| 47215008 | Blood group antigen Sc2 (substance) |
| 47218005 | Fibrinogen Giessen II (substance) |
| 47232007 | Alkyl quaternary ammonium bromide (substance) |
| 47245006 | Dolichyl-phosphate alpha-N-acetylglucosaminyltransferase (substance) |
| 47247003 | Fibrinogen Kyoto (substance) |
| 47280005 | Macrocyclic trichothecenes (substance) |
| 47291003 | Mucor pusillus aspartic proteinase (substance) |
| 47310000 | Exoribonuclease II (substance) |
| 47313003 | Hemoglobin A>2< Adria (substance) |
| 47336007 | Fibrinogen Manchester (substance) |
| 47341004 | Blood group antigen Driver (substance) |
| 47343001 | N-Formyl methionylaminoacyl-transfer ribonucleic acid deformylase (substance) |
| 47349002 | beta Neoendorphin (substance) |
| 47350002 | Pregnenolone (substance) |
| 47355007 | Benzodiazepine nucleus (substance) |
| 47358009 | Polystyrene (substance) |
| 47364002 | Blood group antigen Ryan (substance) |
| 47368004 | Nucleoside (substance) |
| 47379009 | Technetium compound (substance) |
| 47380007 | ^210^Bismuth (substance) |
| 47383009 | Cephaeline (substance) |
| 47389008 | Methyl tert-butyl ether (substance) |
| 47407008 | Sphingolipid (substance) |
| 47408003 | Naftifine hydrochloride (substance) |
| 47413004 | Fat emulsion (substance) |
| 47414005 | Trimethidinium (substance) |
| 47419000 | Long-chain-alcohol fatty-acyltransferase (substance) |
| 47425001 | ^187^Iridium (substance) |
| 47431003 | Dichlorobenzene (substance) |
| 47448006 | Hot water (substance) |
| 47463009 | ^209^Lead (substance) |
| 47464003 | Blood group antibody Woit (substance) |
| 47469008 | Blood group antibody Seymour (substance) |
| 47472001 | 4-Hydroxy-3-methoxy mandelic acid (substance) |
| 47486002 | Fast red ITR stain (substance) |
| 47500008 | Borate pentahydrate (substance) |
| 47521008 | ^109^Palladium (substance) |
| 47543000 | Exodeoxyribonuclease I (substance) |
| 47553004 | Blood group antibody Sul (substance) |
| 47562002 | 4-Hydroxybutyrate dehydrogenase (substance) |
| 47565000 | I region, major histocompatibility complex (substance) |
| 47581005 | Type 1 chain precursor structure (lacto-N-tetraosylceramide) (substance) |
| 47588004 | ^203^Lead (substance) |
| 47601000 | Blood group antigen Savery (substance) |
| 47603002 | Blood group antibody Pillsbury (substance) |
| 47617006 | Basic amino acid (substance) |
| 47618001 | (R)-Aminopropanol dehydrogenase (substance) |
| 47619009 | Phosphoramidate-hexose phosphotransferase |
| 47626009 | Blood group antibody Kemma (substance) |
| 47635002 | Lauryl isoquinolinium bromide (substance) |
| 47646004 | Antiarin (substance) |
| 47662005 | Blood group antigen h (substance) |
| 47663000 | Clindamycin palmitate hydrochloride (substance) |
| 47670000 | Colonic mucus (substance) |
| 47674009 | Blood group antigen Pr>1d< (substance) |
| 47676006 | ^39^Chlorine (substance) |
| 47677002 | Orange oil (substance) |
| 47691008 | Fibrin degradation agent, first derivative (substance) |
| 47692001 | Blood group antigen Rm (substance) |
| 47702003 | Carboxylesterase (substance) |
| 47703008 | Lactose (substance) |
| 47707009 | Anion (substance) |
| 47711003 | Allyl chloride |
| 47714006 | Fibrinogen Troyes (substance) |
| 47716008 | Nucleotide pyrophosphokinase (substance) |
| 47729008 | Potassium chloride K^43^ (substance) |
| 47733001 | Blood group antibody Bradford (substance) |
| 47735008 | Chalcone isomerase (substance) |
| 47737000 | Valine dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 47769009 | Platelet antibody HPA-5 (substance) |
| 47773007 | D-Nopaline dehydrogenase (substance) |
| 47784000 | Blood group antibody IP (substance) |
| 47786003 | Hemoglobin Austin (substance) |
| 47788002 | Hemoglobin J-Medellin (substance) |
| 47799000 | ^126^Cesium (substance) |
| 47809000 | Arsenic (substance) |
| 47826006 | Thiourea (substance) |
| 47832001 | Alkaline phosphatase isoenzyme (substance) |
| 47834000 | Oxophenarsine hydrochloride (substance) |
| 47845002 | Glycoprotein 4-beta-galactosyltransferase (substance) |
| 47851007 | Human leucocyte antigen Aw69 |
| 47853005 | Parachlorophenol (substance) |
| 47857006 | Quinine sulfate (substance) |
| 47860004 | Human leukocyte antigen HLA-A3 antigen (substance) |
| 47862007 | Schizozygine (substance) |
| 47888005 | Propionyl-coenzyme A carboxylase (substance) |
| 47894002 | Tumor necrosis factor beta (substance) |
| 47899007 | Oxyhemoglobin F (substance) |
| 47900002 | Adenylylsulfate reductase (substance) |
| 47901003 | 5-Trimethoxyamphetamine (substance) |
| 47910006 | Neurophysin (substance) |
| 47929000 | Hemoglobin M-Milwaukee-I (substance) |
| 47937008 | Ipecac syrup (substance) |
| 47946002 | Hemoglobin F-Heather (substance) |
| 47950009 | Taurocholic acid (substance) |
| 47974007 | Blood group antibody Tg^a^ (substance) |
| 47994003 | Immunoglobulin, GM>25< allotype (substance) |
| 47995002 | Alcohol soluble nigrosine stain (substance) |
| 47998000 | Hemoglobin Connecticut (substance) |
| 48006008 | Ion (substance) |
| 48041007 | Benomyl (substance) |
| 48050009 | Glycosylceramidase (substance) |
| 48051008 | Carnitine acetyltransferase (substance) |
| 48052001 | Enalaprilat (substance) |
| 48060000 | Blood group antigen Ritter (substance) |
| 48070003 | Phenylpiperidine derivative (substance) |
| 48078005 | Butyl aminobenzoate (substance) |
| 48095002 | Nicotinate dehydrogenase (substance) |
| 48102008 | 3alpha-Hydroxysteroid dehydrogenase (substance) |
| 48109004 | Blood group antigen Js^a^ (substance) |
| 48110009 | 4-Hydroxyphenylacetate 1-monooxygenase (substance) |
| 48111008 | Immunoglobulin, J piece (substance) |
| 48116003 | Blood group antigen Paris (substance) |
| 48131007 | Blood group antibody Neut (substance) |
| 48132000 | Fibrinogen New York I (substance) |
| 48140006 | Blood group antibody Whittaker (substance) |
| 48154003 | Blood group antibody Zwal (substance) |
| 48161004 | Galactosylgalactosylglucosylceramidase (substance) |
| 48170001 | Human leukocyte antigen Cw1 (substance) |
| 48172009 | Cefamandole nafate (substance) |
| 48175006 | Sea-urchin-hatching proteinase (substance) |
| 48179000 | Hemoglobin T-Cambodia (substance) |
| 48181003 | Trimethylamine (substance) |
| 48184006 | Tropomyosin (substance) |
| 48199006 | Diamthazole (substance) |
| 48207007 | Methylcytisine (substance) |
| 48209005 | ^232^Thorium (substance) |
| 48212008 | Hemoglobin Chemilly (substance) |
| 48214009 | Oncogene protein TCL5 (substance) |
| 48217002 | Complement regulator (substance) |
| 48244007 | L-Xylulose reductase (substance) |
| 48265001 | 1,3-Dichloro-5,5- dimethylhydantoin (substance) |
| 48270008 | Lymphocyte antigen CDw49f (substance) |
| 48271007 | ^105^Silver (substance) |
| 48282004 | Sorbose dehydrogenase (substance) |
| 48284003 | Antigen in Kell (KEL) blood group system (substance) |
| 48302003 | Methylcyclohexanone (substance) |
| 48323009 | Blood group antibody Schneider (substance) |
| 48324003 | Vinyl cyclohexene dioxide (substance) |
| 48332006 | Plant cyanogenic glycoside (substance) |
| 48341001 | ^192^Iridium (substance) |
| 48358006 | Heme oxygenase (decyclizing) (substance) |
| 48366002 | Blood group antigen Rh39 |
| 48369009 | ^183^Tantalum (substance) |
| 48384000 | Amitriptyline hydrochloride (substance) |
| 48401006 | Blood group antigen I (substance) |
| 48416009 | Blood group antigen Green (substance) |
| 48417000 | Human leukocyte antigen Dw26 (substance) |
| 48444005 | Freund's adjuvant (substance) |
| 48464000 | Blood group antibody Sw^a^ (substance) |
| 48474002 | Albuterol sulfate (substance) |
| 48478004 | Aminoglycoside N^3'^-acetyltransferase (substance) |
| 48486004 | Immunoglobulin IgG4 (substance) |
| 48494006 | N-Acetylgalactosamine-4-sulfatase (substance) |
| 48517003 | Pepsin A (substance) |
| 48540004 | Patent blue V sodium salt stain (substance) |
| 48551004 | Fusion oncogene protein (substance) |
| 48562004 | Monobutyl phenyl phenol sodium monosulfonate (substance) |
| 48581007 | Plastic reagent (substance) |
| 48583005 | Immunoglobulin E (substance) |
| 48590000 | 1,2-Cyclic-inositol-phosphate phospho-diesterase (substance) |
| 48593003 | Safrol (substance) |
| 48605006 | Glycolaldehyde dehydrogenase (substance) |
| 48618003 | Sodium para-aminohippurate (substance) |
| 48650008 | Procollagen galactosyltransferase (substance) |
| 48663002 | Alkylhalidase (substance) |
| 48682006 | Metridium proteinase A (substance) |
| 48686009 | Aluminum radioisotope (substance) |
| 48693008 | Phenaglycodol (substance) |
| 48699007 | Blood group antigen Carson (substance) |
| 48714008 | Palladium (substance) |
| 48727007 | Interleukin-4 (substance) |
| 48736006 | Ribitol teichoic acid (substance) |
| 48741003 | Toothpaste (substance) |
| 48751002 | Blood group antibody Can (substance) |
| 48753004 | Cefuroxime sodium (substance) |
| 48766004 | Glycerate kinase (substance) |
| 48779008 | Blood group antibody Hamet (substance) |
| 48798005 | Antigen in Lutheran (LU) blood group system (substance) |
| 48802006 | Chlorogenate hydrolase (substance) |
| 48815002 | Blood group antigen Shannon (substance) |
| 48821003 | Lymphocyte antigen CD19 (substance) |
| 48824006 | Aminoimidazolase (substance) |
| 48830006 | 2-Acylglycerol-3-phosphate acyltransferase (substance) |
| 48847007 | Hemolysin venom (substance) |
| 48861002 | ^99^Molybdenum (substance) |
| 48869000 | Blood group antigen Jordan (substance) |
| 48885005 | Vanadium pentoxide dust (substance) |
| 48893005 | Sodium dinitro-ortho-cresylate (substance) |
| 48895003 | ^113m^Indium (substance) |
| 48898001 | Hemoglobin Buenos Aires (substance) |
| 48910008 | ^21^Neon (substance) |
| 48915003 | Chitinase (substance) |
| 48919009 | Blood group antigen Block (substance) |
| 48931006 | Enoyl-[acyl-carrier-protein] reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 48940005 | Methoxypromazine (substance) |
| 48945000 | Oxalate decarboxylase (substance) |
| 48949006 | Hb 75(EF4), Asp-ala |
| 48968009 | Histidine aminotransferase (substance) |
| 48978007 | Cesium hydroxide (substance) |
| 48988008 | Prostaglandin PGE1 (substance) |
| 49003009 | Osmium radioisotope (substance) |
| 49009008 | NAPH cytochrome-c>2< reductase (substance) |
| 49010003 | Paraprotein (substance) |
| 49022000 | Merethoxylline procaine |
| 49028001 | Blood group antibody K16 (substance) |
| 49046007 | Human structural gene (substance) |
| 49053003 | Tuftsin (substance) |
| 49056006 | Sucrose alpha-glucosidase (substance) |
| 49060009 | Messenger ribonucleic acid (guanine-N^7^)-methyltransferase (substance) |
| 49067007 | Thymic neuromuscular function blocking agent (substance) |
| 49069005 | Lead isotope (substance) |
| 49106003 | Human leukocyte antigen DR1 (substance) |
| 49115005 | Polyphosphate-glucose phosphotransferase (substance) |
| 49119004 | Blood group antigen Bryant (substance) |
| 49143001 | ^201m^Bismuth (substance) |
| 49145008 | Demecarium bromide (substance) |
| 49146009 | Cutaneous fluid (substance) |
| 49148005 | Human leukocyte antigen Cw11 (substance) |
| 49163008 | Blood group antigen Sd^a^ |
| 49173005 | Oil of spike (substance) |
| 49174004 | ^85^Yttrium (substance) |
| 49185002 | Germanium radioisotope (substance) |
| 49193002 | Pyranose oxidase (substance) |
| 49208007 | Cinerin (substance) |
| 49212001 | Blood group antigen D 1276 (substance) |
| 49214000 | Concanavalin receptor (substance) |
| 49251006 | scyllo-Inosamine kinase (substance) |
| 49254003 | ^201^Bismuth (substance) |
| 49291009 | Glycine dehydrogenase (cytochrome) |
| 49313009 | Nialamide (substance) |
| 49314003 | Flavonol O^3^-glucosyltransferase (substance) |
| 49318000 | ^173^Hafnium (substance) |
| 49322005 | Hemoglobin F-Sardinia (substance) |
| 49327004 | Interferon |
| 49328009 | myo-Inositol 1-methyltransferase (substance) |
| 49344000 | Blood group antibody VK (substance) |
| 49352002 | Mediator of inflammation (substance) |
| 49354001 | Acetolactate synthase (substance) |
| 49358003 | Linoleate isomerase (substance) |
| 49371000 | Methscopolamine bromide (substance) |
| 49377001 | Blood group antigen Davis (substance) |
| 49378006 | Eccrine sweat (substance) |
| 49382008 | Oil of cherry laurel (substance) |
| 49383003 | Maltose acetyltransferase (substance) |
| 49389004 | Protoporphyrinogen III (substance) |
| 49399009 | Magnesium salicylate (substance) |
| 49419007 | Active C4b (substance) |
| 49426007 | Lewis acid (substance) |
| 49427003 | 3,5 Diiodothyronine (substance) |
| 49444004 | Maleic hydrazide (substance) |
| 49449009 | Blood group antibody Wimberly |
| 49451008 | Ethaverine (substance) |
| 49461001 | Hemoglobin Hobart |
| 49469004 | Phosphoribokinase (substance) |
| 49471004 | Diacetoxyscirpenol (substance) |
| 49477000 | Phosalone (substance) |
| 49478005 | ^195m^Mercury (substance) |
| 49495002 | Human leukocyte antigen A (substance) |
| 49506005 | Gluconic acid (substance) |
| 49508006 | Heparin-sulfate eliminase |
| 49519009 | Immunoglobulin, F(ab')>2< fragment (substance) |
| 49529002 | Uridine diphosphate glucose 4,6-dehydratase (substance) |
| 49543007 | Succinate dehydrogenase (substance) |
| 49551005 | Oil of organum (substance) |
| 49559007 | Zinc pelargonate (substance) |
| 49560002 | Heptachloro-camphene (substance) |
| 49565007 | Disopyramide phosphate (substance) |
| 49568009 | Blood group antigen Terrell (substance) |
| 49576006 | 1,1,1-Trichloroethane (substance) |
| 49582009 | Blood group antigen Dantu (substance) |
| 49599005 | Private blood group antibody (substance) |
| 49602000 | Isoproterenol sulfate (substance) |
| 49613002 | Hemoglobin Malmo (substance) |
| 49616005 | Monoclonal antibody (substance) |
| 49633003 | Prolyl dipeptidase (substance) |
| 49636006 | Lochia (substance) |
| 49643000 | Oil of cypress (substance) |
| 49653004 | Blood group antigen Taur (substance) |
| 49660005 | Methylmalonyl-coenzyme A carboxyltransferase (substance) |
| 49677005 | Human leukocyte antigen Dw22 (substance) |
| 49686000 | Propanediol dehydratase (substance) |
| 49687009 | Coriphosphine stain (substance) |
| 49695008 | Lead sulfide (substance) |
| 49702009 | Phenylacetaldehyde dehydrogenase (substance) |
| 49722008 | Somatostatin (substance) |
| 49724009 | Pyrvinium chloride (substance) |
| 49733006 | 2-Oxopent-4-enoate hydratase (substance) |
| 49739005 | n-1-Naphthyl-phthalamic acid (substance) |
| 49743009 | ^241^Californium (substance) |
| 49744003 | Blood group antibody M1^a^ (substance) |
| 49745002 | Adenosine diphosphate (substance) |
| 49772005 | Blood group antigen Simon (substance) |
| 49775007 | 15-Hydroxyprostaglandin dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 49777004 | bis-(Isopropylamido) fluorophosphate (substance) |
| 49797009 | ^193^Osmium (substance) |
| 49821006 | Immunoglobulin, KM>1< allotype (substance) |
| 49837000 | Blood group antigen Horn (substance) |
| 49839002 | Hexamethonium (substance) |
| 49846006 | Carboxymethyloxysuccinate lyase (substance) |
| 49849004 | Trichlorfon (substance) |
| 49858006 | Lymphocyte antigen CDw52 (substance) |
| 49867006 | Leucine 2,3-aminomutase (substance) |
| 49869009 | Gonadotropin releasing factor (substance) |
| 49873007 | Tetrahymena aspartic proteinase (substance) |
| 49884000 | Barium isotope (substance) |
| 49889005 | Formiminoglutamic acid (substance) |
| 49893004 | Polyamine methylene resin (substance) |
| 49902002 | Hemoglobin Himeji (substance) |
| 49909006 | Mucus (substance) |
| 49912009 | Blood group antigen D^w^ (substance) |
| 49944008 | alpha Fetoprotein (substance) |
| 49952006 | 4-Dimethylaminoazobenzene (substance) |
| 49977007 | Lead compound (substance) |
| 49991001 | Blood group antigen Mateja |
| 49997002 | Human leukocyte antigen Bw59 (substance) |
| 49998007 | Sufentanil (substance) |
| 50010001 | 4-Nitrobiphenyl (substance) |
| 50028004 | Blood group antibody Boston (substance) |
| 50045009 | Heparin sodium (substance) |
| 50062004 | Fuchsin basic stain (substance) |
| 50068000 | Phytochrome (substance) |
| 50073006 | Dimethylglycine dehydrogenase (substance) |
| 50095005 | Hemoglobin S (substance) |
| 50096006 | 3-Isopropylmalate dehydrogenase (substance) |
| 50100007 | Chrysotile (substance) |
| 50106001 | Formate dehydrogenase (cytochrome-c-553) (substance) |
| 50107005 | Immunoglobulin, GM>5< allotype (substance) |
| 50129009 | Hemoglobin St. Louis (substance) |
| 50139003 | Glycoprotein 6-alpha-L-fucosyltransferase (substance) |
| 50140001 | Choline acetyltransferase (substance) |
| 50142009 | Reduced nicotinamide adenine dinucleotide phosphate-ferrihemoprotein reductase (substance) |
| 50151001 | Flavoprotein (substance) |
| 50156006 | Blood group antigen Le^b^ (substance) |
| 50191003 | Uridine diphosphate-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase (substance) |
| 50195007 | O-Acetylserine (thiol)-lyase (substance) |
| 50213009 | Chloride salt (substance) |
| 50218000 | Melarsonyl (substance) |
| 50221003 | Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase (substance) |
| 50233008 | gamma-Ketovaleric acid (substance) |
| 50254001 | Viral gene (substance) |
| 50272007 | Blood group antibody hr^s^ (substance) |
| 50298001 | ^235^Uranium (substance) |
| 50306007 | Sodium tetraborate (substance) |
| 50309000 | Sodium oxalate (substance) |
| 50352000 | Organic phosphorus compound (substance) |
| 50358001 | Heparin lyase (substance) |
| 50359009 | ^45^Calcium (substance) |
| 50371003 | Carnosine (substance) |
| 50374006 | ^120^Iodine (substance) |
| 50383001 | Human leukocyte antigen Bw76 (substance) |
| 50418002 | Hexose oxidase (substance) |
| 50423002 | Formamidase |
| 50425009 | ^114^Indium (substance) |
| 50431007 | Cortisone alpha-reductase (substance) |
| 50456001 | Urine protein (substance) |
| 50470001 | Human genome (substance) |
| 50473004 | Female genital fluid (substance) |
| 50479000 | Soy protein-iron complex (substance) |
| 50480002 | Blood group antigen Ri^a^ (substance) |
| 50491009 | Yttrium isotope (substance) |
| 50502005 | ^194^Gold (substance) |
| 50507004 | N-phenylacetamide (substance) |
| 50512003 | Phospholipase A>1< (substance) |
| 50526007 | Blood group antibody S^D^ (substance) |
| 50533007 | Adenosine nucleosidase (substance) |
| 50550009 | 6-Phospho-2-keto-3-deoxygalactonate aldolase |
| 50580004 | Sulthiamine (substance) |
| 50593009 | Casein (substance) |
| 50605001 | L-Amino-acid oxidase (substance) |
| 50622004 | Cholesterol esterase (substance) |
| 50627005 | Labetalol hydrochloride (substance) |
| 50641001 | Hemoglobin G-Taichung (substance) |
| 50656005 | Creatininase (substance) |
| 50661007 | Bismuth subgallate (substance) |
| 50665003 | Hydrocortisone butyrate (substance) |
| 50668001 | Oncogene protein TCRA (substance) |
| 50672002 | Hafnium (substance) |
| 50685004 | Epinephrine hydrochloride (substance) |
| 50700004 | Blood group antigen Heibel (substance) |
| 50706005 | Fibrinogen Malmoe (substance) |
| 50716002 | ^122^Antimony (substance) |
| 50735002 | Coagulation factor X Melbourne variant (substance) |
| 50750006 | Hexachlorobenzene (substance) |
| 50752003 | Blood group antibody Wiley (substance) |
| 50754002 | Trifluoperazine hydrochloride (substance) |
| 50762005 | Interleukin-1 (substance) |
| 50767004 | 5-Methylthioribose kinase (substance) |
| 50778007 | Hemoglobin J-Wenchang-Wuming (substance) |
| 50784005 | Intracisternal material, amorphous (substance) |
| 50791008 | Tetramethyl succinonitrile (substance) |
| 50825000 | Food coloring (substance) |
| 50848005 | Sulfamoxole (substance) |
| 50852005 | Seminal vesicle fluid (substance) |
| 50854006 | alpha-Amino-acid esterase (substance) |
| 50863008 | Plasma (substance) |
| 50864002 | Blood group antibody CE (substance) |
| 50898006 | Uridine diphosphateglucosamine 4-epimerase (substance) |
| 50899003 | Blood group antibody Je^a^ (substance) |
| 50912007 | Oncogene protein trk (substance) |
| 50914008 | Adamsite (substance) |
| 50925004 | Amidophosphoribosyltransferase (substance) |
| 50948009 | Ribosomal ribonucleic acid (guanine-N^1^)-methyltransferase (substance) |
| 50951002 | Neuropeptide Y (substance) |
| 50957003 | Leukopterin (substance) |
| 50969006 | Tetrahydrozoline hydrochloride |
| 50973009 | Methacycline hydrochloride |
| 50981005 | Hemoglobin Takamatsu (substance) |
| 50988004 | Lymphocyte antigen CD10 (substance) |
| 51034002 | Phosphoglycerate kinase (substance) |
| 51076005 | Fibrinogen Argenteuil (substance) |
| 51079003 | Pelargonic acid (substance) |
| 51090008 | Reduced nicotinamide adenine dinucleotide kinase (substance) |
| 51125005 | Diacetylaminoazotoluene (substance) |
| 51137007 | Sodium arsenate (substance) |
| 51139005 | Tetrabromo-o-cresol (substance) |
| 51148000 | Dicamba (substance) |
| 51161000 | Coagulation factor XIII (substance) |
| 51162007 | Holo-[acyl-carrier-protein] synthase (substance) |
| 51163002 | Lanosterol synthase (substance) |
| 51172005 | Cryofibrinogen (substance) |
| 51173000 | Muconolactone delta-isomerase (substance) |
| 51177004 | Citreoviridin (substance) |
| 51179001 | Alkyl dimethyl benzyl ammonium bromide (substance) |
| 51200005 | Strychnine (substance) |
| 51202002 | Sepiapterin deaminase (substance) |
| 51222003 | Blood group antigen IP>1< (substance) |
| 51224002 | Carboxymethylcellulose sodium (substance) |
| 51238009 | Lymphocyte antigen CD2R (substance) |
| 51242007 | Blood group antigen Riv (substance) |
| 51245009 | Barium propionate (substance) |
| 51248006 | Dihydroneopterin aldolase (substance) |
| 51250003 | Hemoglobin J-Buda (substance) |
| 51256009 | Cystathionine beta-synthase (substance) |
| 51260007 | Metabutoxycaine (substance) |
| 51262004 | Blood group antibody Donati (substance) |
| 51263009 | 3alpha-Hydroxy-5beta-androstane-17-one 3alpha-dehydrogenase (substance) |
| 51276003 | Blood group antibody Bothrops (substance) |
| 51280008 | Sebum (substance) |
| 51285003 | Hemoglobin J-Toronto (substance) |
| 51293003 | Blood group antigen rr-35 (substance) |
| 51303009 | (-)-Menthol dehydrogenase (substance) |
| 51304003 | Rubidium (substance) |
| 51305002 | Thymosin (substance) |
| 51311004 | Blood group antigen B 9208 (substance) |
| 51314007 | Hyponitrite reductase (substance) |
| 51321007 | Propylhexedrine (substance) |
| 51364000 | 2-Dehydro-3-deoxy-L-pentonate aldolase (substance) |
| 51366003 | Ammonium chloride (substance) |
| 51369005 | Phosmet (substance) |
| 51372003 | Blood group antibody An^a^ (substance) |
| 51379007 | Fibrinogen Alba/Geneva (substance) |
| 51386004 | Food preservative (substance) |
| 51389006 | Histidinol dehydrogenase (substance) |
| 51390002 | Hemoglobin F-Clarke (substance) |
| 51397004 | Hemoglobin Guizhou (substance) |
| 51405003 | Ammonia kinase (substance) |
| 51414008 | Human leukocyte antigen DR2 (substance) |
| 51415009 | Blood group antibody Kn^a^ (substance) |
| 51419003 | Mucoprotein (substance) |
| 51420009 | Silicon (substance) |
| 51426003 | Vanadium radioisotope (substance) |
| 51437002 | 3-Deoxy-manno-octulosonate cytidylyltransferase (substance) |
| 51441003 | Reiterated gene (substance) |
| 51447004 | Blood group antibody Kam (substance) |
| 51462002 | Hematoporphyrin (substance) |
| 51466004 | Retinal isomerase (substance) |
| 51468003 | Blood group antibody Tajama (substance) |
| 51483008 | Naringenin-chalcone synthase (substance) |
| 51503008 | Rose oil (substance) |
| 51511003 | Blood group antigen Kosis (substance) |
| 51515007 | Human leukocyte antigen DRw (substance) |
| 51542008 | Appendiceal contents (substance) |
| 51562000 | 2-Bromo-4-phenyl phenol (substance) |
| 51567006 | Sirius red F3B stain (substance) |
| 51569009 | Sulfaphenazole (substance) |
| 51598008 | Coproporphyrin (substance) |
| 51610006 | Quercetin O^3^methyltransferase (substance) |
| 51612003 | Hydrocortisone valerate (substance) |
| 51622009 | Adenine deaminase (substance) |
| 51644004 | Electrolytic agent (substance) |
| 51645003 | Blood group antibody Good (substance) |
| 51663003 | Plant mutagen (substance) |
| 51664009 | Metallic amalgam (substance) |
| 51674007 | ^241^Plutonium (substance) |
| 51704000 | Phospholipase C (substance) |
| 51708002 | Hemoglobin Rainier (substance) |
| 51718007 | Human leukocyte antigen Bw46 (substance) |
| 51739000 | Ethyl biscoumacetate (substance) |
| 51765001 | Carbon monoxide (substance) |
| 51769007 | Pyrimidine-5'-nucleotide nucleosidase (substance) |
| 51770008 | Cyclic adenosine monophosphate receptor (substance) |
| 51774004 | ^123^Tin (substance) |
| 51775003 | Estrone (substance) |
| 51776002 | Singlet oxygen (substance) |
| 51800004 | ^222^Radon (substance) |
| 51803002 | Fibrinogen Chapel Hill II (substance) |
| 51809003 | Blood group antibody Pantaysh (substance) |
| 51810008 | Proliferative inhibitory factor (substance) |
| 51824007 | Reduced nicotinamide adenine dinucleotide dehydrogenase (substance) |
| 51844001 | Tetracaine hydrochloride (substance) |
| 51856000 | Haemoglobin J-Sardegna |
| 51859007 | Organic thiocyanate insecticide (substance) |
| 51866008 | Protoporphyrin (substance) |
| 51873003 | Blood group antibody Lagay (substance) |
| 51874009 | Proline iminopeptidase (substance) |
| 51876006 | [Hydroxymethylglutaryl-coenzyme A reductase (reduced nicotinamide adenine dinucleotide phosphate)] kinase (substance) |
| 51880001 | Isohexenylglutaconyl-coenzyme A hydratase (substance) |
| 51888008 | Calcium salt (substance) |
| 51889000 | Oxaloglycolate reductase (decarboxylating) (substance) |
| 51905005 | Mustard (substance) |
| 51910009 | N-ethylmorpholine (substance) |
| 51913006 | Sorbose dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 51918002 | Hemoglobin Milledgeville (substance) |
| 51922007 | Magnetite (substance) |
| 51927001 | Dipropylene glycol methyl ether (substance) |
| 51931007 | Nail polish remover (substance) |
| 51934004 | Hemocyanin (substance) |
| 51941005 | Blood group antibody B (substance) |
| 51950007 | Antimitochondrial antibody (substance) |
| 51955002 | Asclepain (substance) |
| 51961004 | ^101^Palladium (substance) |
| 51963001 | Sulfite salt (substance) |
| 51964007 | Deoxydenylate kinase (substance) |
| 51965008 | Amsinckine (substance) |
| 51967000 | Sulfite reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 51974005 | Geranyl-diphosphate cyclase (substance) |
| 51990005 | Ganglioside galactosyltransferase (substance) |
| 52021000 | Tetrachlorobenzoquinone (substance) |
| 52024008 | Upper respiratory tract mucus (substance) |
| 52027001 | Crimidine (substance) |
| 52053009 | Epididymal fluid (substance) |
| 52062006 | Oxythioquinox (substance) |
| 52078008 | Epitope |
| 52081003 | Blood group antigen Griffith (substance) |
| 52086008 | Glycol (substance) |
| 52094001 | ^117m^Indium (substance) |
| 52104007 | Right upper lobe mucus (substance) |
| 52119008 | beta Endorphin agent (substance) |
| 52126008 | Cortol (substance) |
| 52129001 | Protamine kinase (substance) |
| 52130006 | Quercetin (substance) |
| 52140009 | Benoxinate |
| 52141008 | Coal dust (substance) |
| 52160001 | Lymphocyte antigen CD9 (substance) |
| 52162009 | 2-Oxobutyrate synthase (substance) |
| 52169000 | Platelet antibody HPA-2 (substance) |
| 52193005 | Blood group antibody Lindsay (substance) |
| 52209008 | Calcium citrate (substance) |
| 52210003 | Blood group antibody Manley (substance) |
| 52227006 | Platelet antibody HPA-3b (substance) |
| 52243004 | 1,3-Dichloro-2-propanol (substance) |
| 52258007 | Blood group antibody C^x^ (substance) |
| 52261008 | Hemoglobin Vanderbilt (substance) |
| 52264000 | Hemoglobin Yakima (substance) |
| 52269005 | Muramoyl-pentapeptide carboxypeptidase (substance) |
| 52275001 | Benactyzine (substance) |
| 52282002 | Histamine receptor (substance) |
| 52283007 | Peppermint oil (substance) |
| 52293000 | Abnormal hemoglobin, fusion defect (substance) |
| 52310000 | Blood group antibody Dp (substance) |
| 52313003 | Complement component C8 (substance) |
| 52315005 | o-Dichlorobenzene (substance) |
| 52326004 | Indoleacetaldoxime dehydratase (substance) |
| 52339000 | Nitrogen chloride (substance) |
| 52354006 | Zirconium compound (substance) |
| 52358009 | D-Serine dehydratase (substance) |
| 52360006 | Estrone sulfotransferase (substance) |
| 52370008 | Psyllium (substance) |
| 52371007 | Hemoglobin Westmead (substance) |
| 52380007 | Glycine dehydrogenase (substance) |
| 52394008 | Potassium acetate (substance) |
| 52398006 | Phospho-2-dehydro-3-deoxyheptonate aldolase (substance) |
| 52401009 | Thrombin-antithrombin complex (substance) |
| 52408003 | Iodinated I^131^ gamma globulin (substance) |
| 52418008 | Chondroitin sulfotransferase (substance) |
| 52419000 | Human leukocyte antigen Bw72 |
| 52422003 | 20-Hydroxyprogesterone (substance) |
| 52442007 | Betaine-homocysteine methyltransferase (substance) |
| 52454007 | Albumin (substance) |
| 52458005 | Hemoglobin J-Kaohslung (substance) |
| 52467005 | Blood group antigen Krog (substance) |
| 52470009 | Nickel salt (substance) |
| 52480008 | Alkenylglycerophosphoethanolamine hydrolase (substance) |
| 52493003 | ^129^Antimony (substance) |
| 52502000 | bis-(Trichlorohydroxy ethyl) urea (substance) |
| 52503005 | Argon (substance) |
| 52513002 | Hemoglobin Ferndown (substance) |
| 52518006 | Amino acid (substance) |
| 52525004 | Pyrimidine-nucleoside phosphorylase (substance) |
| 52541003 | Proline (substance) |
| 52546008 | Perilymph (substance) |
| 52555006 | Blood group antigen Shier (substance) |
| 52560005 | Norleucine (substance) |
| 52573009 | Blood group antibody Tj^a^ (substance) |
| 52574003 | Amiodarone hydrochloride (substance) |
| 52587009 | ^113^ Silver (substance) |
| 52596009 | Inosamine-phosphate amidinotransferase (substance) |
| 52601000 | Deproteinated pancreatic extract (substance) |
| 52609003 | Hemoglobin Pontoise (substance) |
| 52610008 | Glucuronolactone reductase (substance) |
| 52625008 | Arginine (substance) |
| 52642002 | Peptide (substance) |
| 52646004 | Actinium isotope (substance) |
| 52679004 | Submandibular proteinase A (substance) |
| 52680001 | Hepatitis B surface antigen subtype adr (substance) |
| 52690009 | ^133m^Xenon (substance) |
| 52701005 | ^210^Thallium (substance) |
| 52717004 | Iodate salt (substance) |
| 52720007 | Bismuth compound (substance) |
| 52722004 | Biotinidase (substance) |
| 52733001 | Overlapping gene (substance) |
| 52736009 | Threonine (substance) |
| 52740000 | meso-Tartrate dehydrogenase (substance) |
| 52745005 | ^51^Chromium (substance) |
| 52752007 | ^85m^Strontium (substance) |
| 52764004 | Blood group antibody Cad (substance) |
| 52770005 | Diacetic acid |
| 52786003 | Immunoglobulin, hinge region (substance) |
| 52793004 | Liquid nitrogen (substance) |
| 52797003 | Non structural gene (substance) |
| 52800001 | Marine toxin (substance) |
| 52803004 | Trimeprazine tartrate (substance) |
| 52804005 | o-Nitro-p-phenylenediamine (substance) |
| 52806007 | Chenopodium oil (substance) |
| 52830009 | Glyceryl-ether monooxygenase (substance) |
| 52834000 | Hemoglobin A>2< Canada (substance) |
| 52836003 | Paraformaldehyde (substance) |
| 52841006 | Methyl malonic acid (substance) |
| 52850008 | Ethopropazine (substance) |
| 52854004 | Stilbene dye (substance) |
| 52860004 | Manganese radioisotope (substance) |
| 52881004 | Glucosaminate ammonia-lyase (substance) |
| 52885008 | Alphaprodine (substance) |
| 52886009 | Minocycline hydrochloride (substance) |
| 52905007 | L-Arabinokinase (substance) |
| 52912003 | Blood group antibody Marks (substance) |
| 52935000 | Human leukocyte antigen Bw42 (substance) |
| 52959005 | ^108m^Silver (substance) |
| 52973001 | 3-Methyleneoxindole reductase (substance) |
| 52978005 | Coagulation factor II Brussels variant (substance) |
| 52991006 | Blood group antibody Bryant (substance) |
| 53005004 | Cerebroside (substance) |
| 53008002 | Acetic anhydride (substance) |
| 53022002 | Chaulmoogra oil (substance) |
| 53023007 | Leukotriene D (substance) |
| 53027008 | Dinitrotoluene (substance) |
| 53034005 | Coal tar (substance) |
| 53041004 | Alcohol (substance) |
| 53047000 | Human leukocyte antigen DR3 (substance) |
| 53048005 | Hematin (substance) |
| 53052005 | Methazolamide (substance) |
| 53072000 | Leukotriene E (substance) |
| 53082004 | Blood group antibody Le^c^ (substance) |
| 53090004 | Sulfacytidine (substance) |
| 53117004 | Hepatitis delta virus antibody (substance) |
| 53130003 | Venous blood (substance) |
| 53136009 | Chloroquine phosphate (substance) |
| 53149004 | Hydrophilic ointment (substance) |
| 53158006 | Luteolin methyltransferase (substance) |
| 53164004 | Perchloryl fluoride (substance) |
| 53166002 | trans-Cinnamate 2-monooxygenase (substance) |
| 53171009 | Lead-free gasoline (substance) |
| 53172002 | Protein-glucosylgalactosylhydroxylysine glucosidase (substance) |
| 53175000 | Oil of celery (substance) |
| 53207004 | Diiodofluorescein I^131^ (substance) |
| 53211005 | Cyanogen chloride (substance) |
| 53235000 | Protamine zinc insulin (substance) |
| 53246002 | Ethylene (substance) |
| 53252001 | Mullerian regression factor |
| 53268007 | Ipomea (substance) |
| 53278005 | Hemoglobin Mississippi (substance) |
| 53287001 | Human leukocyte antigen A32 (substance) |
| 53289003 | Oil of savin (substance) |
| 53302008 | Platelet antibody HPA-1a (substance) |
| 53306006 | Glutamate synthase (reduced nicotinamide adenine dinucleotide) (substance) |
| 53307002 | Blood group antigen Hu (substance) |
| 53315004 | ^68^Germanium (substance) |
| 53323002 | Histidine acetyltransferase (substance) |
| 53327001 | Blood group antibody Caw (substance) |
| 53331007 | Platelet antibody HPA-1b (substance) |
| 53353009 | Stibophen (substance) |
| 53368005 | Phosphatidylserine decarboxylase (substance) |
| 53382005 | B-cell antigen receptor (substance) |
| 53393007 | Bromine radioisotope (substance) |
| 53398003 | Staphylococcus toxin (substance) |
| 53404008 | Thyroid aspartic proteinase (substance) |
| 53405009 | Tripelennamine hydrochloride (substance) |
| 53409003 | Blood group antigen Sieb (substance) |
| 53410008 | Beer (substance) |
| 53415003 | Plant anthraquinone glycoside (substance) |
| 53426009 | Phosphoribosylamine-glycine ligase (substance) |
| 53468009 | Acetylenedicarboxylate hydratase (substance) |
| 53473003 | Apolipoprotein C (substance) |
| 53475005 | beta-Glucoside kinase (substance) |
| 53491008 | Aspergillus saitoi aspartic proteinase (substance) |
| 53493006 | Dimethyl chlorthal (substance) |
| 53499005 | Riboflavin mononucleotide (substance) |
| 53511009 | Tropaeolin OO stain (substance) |
| 53513007 | Psilocybin (substance) |
| 53517008 | ^249^Californium (substance) |
| 53519006 | Dichlorotetrafluoromethane (substance) |
| 53527002 | Alcoholic beverage (substance) |
| 53532001 | Cesium isotope (substance) |
| 53545002 | Blood group antibody Cr1 (substance) |
| 53553005 | Human leukocyte antigen DPw5 (substance) |
| 53557006 | Blood group antibody Starcher (substance) |
| 53560004 | Zinc isotope (substance) |
| 53563002 | Bismuth telluride (substance) |
| 53577004 | Phthalylsulfacetamide (substance) |
| 53588005 | Elaterin (substance) |
| 53594002 | Abnormal hemoglobin, delta-chain variant (substance) |
| 53598004 | Blood group antibody Ge3 (substance) |
| 53606004 | Inosine monophosphate cyclohydrolase (substance) |
| 53609006 | Thiaminase (substance) |
| 53646005 | Fructose-6-phosphate (substance) |
| 53673006 | Captan (substance) |
| 53681007 | Colony-stimulating factor, granulocyte-macrophage (substance) |
| 53682000 | Endorphin (substance) |
| 53689009 | Transfer ribonucleic acid (adenine-N^1^)-methyltransferase (substance) |
| 53692008 | ^150^Gadolinium (substance) |
| 53699004 | Hemoglobin Alberta (substance) |
| 53700003 | ^67^Copper (substance) |
| 53716001 | Blood group antibody Kursteiner (substance) |
| 53749005 | Glutathione thiolesterase (substance) |
| 53777001 | Ethoxyquin (substance) |
| 53784009 | Low incidence antibody (substance) |
| 53794004 | Immunoglobulin, heavy chain fragment (substance) |
| 53806002 | ^205^Bismuth (substance) |
| 53817001 | Alkyl trimethyl ammonium chloride (substance) |
| 53831001 | 3-Carboxy-cis,cis-muconate cycloisomerase (substance) |
| 53834009 | Hemicellulose (substance) |
| 53845007 | Bromisovalum (substance) |
| 53856007 | Single chain urokinase-like plasminogen activator (substance) |
| 53859000 | Methyl lomustine (substance) |
| 53871006 | KEL4 (ISBT symbol) |
| 53875002 | Colostrum (substance) |
| 53876001 | Blood group antibody Suhany (substance) |
| 53878000 | Diacetone alcohol (substance) |
| 53882003 | Blood group antigen McC^a^ (substance) |
| 53902004 | Uridine diphosphate-N-acetylglucosamine 2-epimerase (substance) |
| 53914007 | Acetyl-coenzyme A acetyltransferase (substance) |
| 53934008 | Hemoglobin St. Lukes (substance) |
| 53946007 | Butene (substance) |
| 53951001 | Technetium Tc^99m^ oxidronate (substance) |
| 53962001 | beta 1C/A globulin (substance) |
| 53971005 | Blood group antibody Kuhn (substance) |
| 53990002 | 4-alpha-Glucanotransferase (substance) |
| 54005009 | Yeast ribonuclease (substance) |
| 54024007 | Duodenal juice |
| 54028005 | Transfer ribonucleic acid (cytosine-5)-methyltransferase (substance) |
| 54041009 | Safflower oil (substance) |
| 54045000 | Glyceraldehyde (substance) |
| 54062005 | Cephalexin hydrochloride (substance) |
| 54083004 | Iodic acid (substance) |
| 54086007 | Hexylresorcinol (substance) |
| 54103000 | Immunoglobulin, GM>18< allotype (substance) |
| 54107004 | Sandalwood oil (substance) |
| 54108009 | Sodium silicate (substance) |
| 54112003 | Hemoglobin Gainesville (substance) |
| 54140008 | Hemoglobin F-Dickinson (substance) |
| 54141007 | Psyllium seed (substance) |
| 54144004 | Factor IX complex agent (substance) |
| 54152001 | Nitrite reductase (substance) |
| 54158002 | Procollagen-proline,2-oxoglutarate 3-dioxygenase (substance) |
| 54159005 | Blood group antigen Es^a^ (substance) |
| 54163003 | Diaminopimelate dehydrogenase (substance) |
| 54167002 | Hemoglobin Sabine (substance) |
| 54168007 | Plant quinolizidine alkaloid (substance) |
| 54170003 | ^74^Arsenic (substance) |
| 54172006 | Metaproterenol sulfate (substance) |
| 54175008 | Hemoglobin St. Claude (substance) |
| 54179002 | Strontium radioisotope (substance) |
| 54180004 | S protein complement component (substance) |
| 54188006 | Human placental lactogen (substance) |
| 54195002 | Tissue factor antibody (substance) |
| 54197005 | Cyclomethycaine (substance) |
| 54202003 | Oil of ginger (substance) |
| 54221006 | Orange G stain (substance) |
| 54223009 | Glycerol-3-phosphate acyltransferase (substance) |
| 54228000 | Fibrinogen Montreal I (substance) |
| 54235008 | Histamine (substance) |
| 54237000 | Lymphocyte antigen CD8 (substance) |
| 54239002 | Aconitate hydratase (substance) |
| 54245005 | Lithocholic acid (substance) |
| 54248007 | Formate kinase (substance) |
| 54252007 | Minor histocompatibility loci (substance) |
| 54256005 | Aluminum isotope (substance) |
| 54313002 | ^184^Tantalum (substance) |
| 54323006 | Glycogen (starch) synthase (substance) |
| 54331001 | Isooctyl alcohol (substance) |
| 54338007 | Type 1 H substance (substance) |
| 54340002 | Antimony potassium tartrate (substance) |
| 54343000 | Blood group antibody Ryan (substance) |
| 54346008 | D-Arginase (substance) |
| 54351002 | Glutamine phenylacetyltransferase (substance) |
| 54352009 | Histoplasmin (substance) |
| 54353004 | Blood group antigen Hall J (substance) |
| 54370007 | Coagulation factor IX Long Beach variant |
| 54371006 | Alkyl mercuric chloride |
| 54375002 | Oncogene protein LYL (substance) |
| 54378000 | Coagulation factor IX (substance) |
| 54390003 | Exodeoxyribonuclease V (substance) |
| 54396009 | Leptodactylin (substance) |
| 54401008 | Adenosylmethionine-8-amino-7-oxononanoate aminotransferase (substance) |
| 54413003 | Blood group antibody Heibel (substance) |
| 54416006 | von Willebrand receptor (substance) |
| 54423007 | Testosterone 17beta-dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 54428003 | Peptide-tryptophan 2,3-dioxygenase (substance) |
| 54432009 | Alizarin blue S stain (substance) |
| 54434005 | Hemoglobin Russ (substance) |
| 54442006 | Right pleural fluid (substance) |
| 54446009 | Lysolecithin (substance) |
| 54456008 | Ribonuclease F (substance) |
| 54462003 | Direct reacting bilirubin (substance) |
| 54465001 | Lymphocyte antigen CD45RB (substance) |
| 54475003 | Blood group antibody Lu16 (substance) |
| 54481006 | Human leukocyte antigen B antigen (substance) |
| 54506001 | Galactitol dehydrogenase (substance) |
| 54508000 | Ferrocholinate (substance) |
| 54517000 | Selenium hydride |
| 54524004 | Blood group antigen Er^a^ (substance) |
| 54526002 | Acetate (substance) |
| 54534008 | 1-Chloro-1-nitropropane (substance) |
| 54543004 | Plant triterpene (substance) |
| 54546007 | Blood group antibody Jk^b^ (substance) |
| 54548008 | Dichlobenil (substance) |
| 54557002 | Blood group antigen Lagay (substance) |
| 54563006 | Dental cement (substance) |
| 54579007 | Deoxy adenosine diphosphate (substance) |
| 54588003 | Croton oil (substance) |
| 54592005 | Angiotensinogen (substance) |
| 54600003 | Hemoglobin F-Hull (substance) |
| 54628009 | D-Xylulose reductase (substance) |
| 54633008 | ^232^Uranium (substance) |
| 54643006 | Thiosulfate-thiol sulfurtransferase (substance) |
| 54651009 | Maneb (substance) |
| 54661002 | Alkyl sodium sulfonates (substance) |
| 54663004 | Active C3b (substance) |
| 54669000 | Dihydropteridine reductase (substance) |
| 54673002 | Perchloric acid (substance) |
| 54681001 | Blood group antigen Fy4 (substance) |
| 54708003 | Extended zinc insulin (substance) |
| 54717003 | Ethinamate (substance) |
| 54724002 | Bile acid AND/OR bile salt (substance) |
| 54729007 | Oxytetracycline hydrochloride (substance) |
| 54732005 | Persic oil (substance) |
| 54751004 | Chloroacetic acid (substance) |
| 54753001 | Secondary amyl acetate (substance) |
| 54760007 | Bryonin (substance) |
| 54769008 | Serine acetyltransferase (substance) |
| 54774000 | O-Succinyl homoserine (thiol)-lyase (substance) |
| 54788001 | Haemoglobin F-Texas-II |
| 54791001 | Metanil yellow stain (substance) |
| 54800000 | Guanidinoacetate kinase (substance) |
| 54804009 | ^181^Tungsten (substance) |
| 54808007 | Cobalt (substance) |
| 54813006 | Blood group antigen Jr^a^ (substance) |
| 54821000 | Tryptophan (substance) |
| 54832000 | Fructose-bisphosphatase (substance) |
| 54835003 | Lithium chloride (substance) |
| 54841005 | Hydrocyanic acid (substance) |
| 54843008 | Plant terpene (substance) |
| 54850007 | Blood group antibody Doughty |
| 54855002 | Blood group antigen Gomez (substance) |
| 54871002 | Acyl-lysine deacylase (substance) |
| 54894001 | ^228^Radium (substance) |
| 54901002 | Acetylesterase (substance) |
| 54911009 | Guanosine diphosphate glucosidase (substance) |
| 54918003 | Dialkyl sodium sulfosuccinate (substance) |
| 54932001 | Thymol (substance) |
| 54939005 | Dimethylmalate dehydrogenase (substance) |
| 54941006 | Adenosine phosphate (substance) |
| 54965009 | Hemoglobin Porto Alegre (substance) |
| 54966005 | Phenyl ether-biphenyl vapor mixture (substance) |
| 54968006 | Tetraethyl dithiopyrophosphate (substance) |
| 54976008 | Phenyl ether (substance) |
| 54994002 | 1,3-beta-Oligoglucan phosphorylase (substance) |
| 55035009 | Blood group antibody Kopman (substance) |
| 55036005 | Human leukocyte antigen Aw66 (substance) |
| 55049000 | Carbon trichloride (substance) |
| 55090002 | Chondro-4-sulfatase (substance) |
| 55092005 | Blood group antigen Sw^a^ (substance) |
| 55100009 | Blood group antigen M>1< (substance) |
| 55110000 | Pentasodium tripolyphosphate (substance) |
| 55117002 | ^137^Cesium (substance) |
| 55119004 | Immunoglobulin IgA1, H chain (substance) |
| 55122002 | Blood group antigen Tg^a^ (substance) |
| 55123007 | Diphtheria toxin (substance) |
| 55124001 | Molindone hydrochloride (substance) |
| 55128003 | Allyl cinerins (substance) |
| 55138008 | Permanganate salt (substance) |
| 55159001 | Blood group antigen Binge (substance) |
| 55170008 | Uroporphyrin (substance) |
| 55201001 | Amine receptor (substance) |
| 55202008 | Methoxychlor (substance) |
| 55203003 | Loliine (substance) |
| 55224008 | Trichloropropane (substance) |
| 55261004 | Fumonisin (substance) |
| 55291009 | Pholcoline (substance) |
| 55302006 | Phosphoribosyl-adenosine triphosphate pyrophosphatase (substance) |
| 55316001 | Colestipol hydrochloride (substance) |
| 55324006 | Helium isotope (substance) |
| 55325007 | Homoisocitrate dehydrogenase (substance) |
| 55328009 | ^28^Magnesium (substance) |
| 55330006 | Subtilisin (substance) |
| 55354001 | Fructose-2,6-bisphosphatase (substance) |
| 55358003 | Thiouracil (substance) |
| 55368008 | Vanadium compound (substance) |
| 55386006 | Ricinine nitrilase (substance) |
| 55403000 | Sulfate adenylyltransferase (substance) |
| 55435000 | Nafcillin sodium (substance) |
| 55443005 | Hydroxycyclohexanecarboxylate dehydrogenase (substance) |
| 55450009 | Extracellular fluid (substance) |
| 55451008 | Blood group antigen Nou (substance) |
| 55452001 | Oxycodone (substance) |
| 55477000 | Glutathione (substance) |
| 55486005 | Antipyrine (substance) |
| 55491006 | Strophanthin (substance) |
| 55494003 | Technetium Tc^99m^ albumin microspheres (substance) |
| 55495002 | Acidulated phosphate fluoride (substance) |
| 55500004 | Hemoglobin Perth (substance) |
| 55503002 | GBG |
| 55507001 | Iron oxide fumes (substance) |
| 55508006 | Bufogenin (substance) |
| 55515003 | Hemoglobin Köln (substance) |
| 55521004 | Phosphatidyl inositol (substance) |
| 55522006 | Fc receptor (substance) |
| 55527000 | Geraniol (substance) |
| 55535002 | ^113m^Cadmium (substance) |
| 55540005 | Ferrous carbonate (substance) |
| 55549006 | Blood group antigen Ridd (substance) |
| 55559007 | ^36^Chlorine (substance) |
| 55579004 | Coagulation factor II San Juan 2 variant (substance) |
| 55582009 | Arginase (substance) |
| 55583004 | Lathyrus poison (substance) |
| 55624000 | Inosine nucleosidase (substance) |
| 55633003 | Unstable hemoglobin (substance) |
| 55636006 | Octyl cresol (substance) |
| 55657003 | Estradiol 17alpha-dehydrogenase (substance) |
| 55660005 | Blood group antigen f (substance) |
| 55667008 | Uridine diphosphate-N-acetylmuramoylalanyl-D-glutamyl-lysine-D-alamyl-D-alanine ligase (substance) |
| 55683008 | Hemoglobin Kokura (substance) |
| 55691004 | Dibenzocycloheptane derivative (substance) |
| 55695008 | Blood group antigen Kemma (substance) |
| 55700001 | Nylon material |
| 55706007 | Fibrinogen Wiesbaden (substance) |
| 55723003 | Fibrin degradation agent, intermediate derivative (substance) |
| 55724009 | Potassium salt (substance) |
| 55727002 | Barium dust (substance) |
| 55729004 | Blood group antibody At^a^ (substance) |
| 55741006 | Methenamine hippurate (substance) |
| 55753005 | Furfuraldehyde (substance) |
| 55755003 | Blood group antigen Pollio (substance) |
| 55762007 | Acrylic acid (substance) |
| 55763002 | Micrococcal nuclease (substance) |
| 55789002 | Porphobilinogen (substance) |
| 55792003 | Rotenone (substance) |
| 55793008 | Anileridine (substance) |
| 55795001 | Human leukocyte antigen abnormal (substance) |
| 55808004 | Malonate-semialdehyde dehydrogenase (acetylating) (substance) |
| 55813000 | 4-Enoyl-coenzyme A reductase (NADPH) |
| 55814006 | Iodinated I^131^ aggregated albumin (substance) |
| 55816008 | Amino alcohol (substance) |
| 55831004 | Xylene cyanol FF stain (substance) |
| 55835008 | Blood group antibody Wu (substance) |
| 55840000 | Cytidine monophosphate-N-acetylneuraminate-alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase (substance) |
| 55848007 | Blood group antibody Gon (substance) |
| 55877008 | Hemoglobin Fort Gordon (substance) |
| 55880009 | p-Toluenediamine (substance) |
| 55882001 | White wax (substance) |
| 55884000 | ^189m^Osmium (substance) |
| 55886003 | Cytosol aminopeptidase (substance) |
| 55895006 | Soft coal (substance) |
| 55900005 | Fatty-acid peroxidase (substance) |
| 55902002 | Benzyl alcohol (substance) |
| 55917003 | Glucosamine kinase (substance) |
| 55922003 | Blood group antigen Ge2 (substance) |
| 55939001 | Dihydrosphingosine (substance) |
| 55944008 | Niridazole (substance) |
| 55946005 | Pectin (substance) |
| 55951004 | ^38^Chlorine (substance) |
| 55972001 | Silicate salt (substance) |
| 56003000 | Glycerol-3-phosphate dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 56006008 | Indium^113^ oxoquinoline platelet label (substance) |
| 56022009 | Right middle lobe mucus (substance) |
| 56024005 | Methylmalonyl-coenzyme A mutase (substance) |
| 56025006 | D-Lactaldehyde dehydrogenase (substance) |
| 56065005 | Spermaceti (substance) |
| 56066006 | Turacin (substance) |
| 56071004 | Blood group antigen Thompson (substance) |
| 56085009 | Hyoscyamine sulfate (substance) |
| 56104009 | D-Lysine 5,6-aminomutase (substance) |
| 56114000 | Human leukocyte antigen Dw6 (substance) |
| 56117007 | Air bubble (substance) |
| 56139009 | Glutaminyl-transfer ribonucleic acid cyclotransferase (substance) |
| 56146000 | Androstenedione (substance) |
| 56147009 | Bufotenine (substance) |
| 56150007 | ^243^Plutonium (substance) |
| 56156001 | DOCA |
| 56158000 | ^58m^Cobalt |
| 56163001 | Burr (substance) |
| 56167000 | Potassium radioisotope (substance) |
| 56181003 | Chlorinated hydrocarbon (substance) |
| 56227008 | Trolnitrate phosphate (substance) |
| 56232009 | Human leukocyte antigen Dw10 (substance) |
| 56248005 | Blood group antigen Kp^c^ (substance) |
| 56261005 | Hydroxy phenylpyruvic acid, para (substance) |
| 56282004 | 2,3-Dihydroxybenzoate 2,3-dioxygenase (substance) |
| 56286001 | Blood group antibody Bouteille (substance) |
| 56297001 | Propoxyphene hydrochloride (substance) |
| 56312005 | Human leukocyte antigen Cw10 (substance) |
| 56314006 | Silver fluoride (substance) |
| 56325002 | Carbromal (substance) |
| 56328000 | Fibrinogen Homberg III |
| 56339002 | Saprol (substance) |
| 56352007 | Fibrinogen Giessen I (substance) |
| 56355009 | Clostridium histolyticum collagenase (substance) |
| 56362000 | L-Gulonolactone oxidase (substance) |
| 56363005 | Adenosine kinase (substance) |
| 56374001 | Plasminogen activator inhibitor-2 (substance) |
| 56382001 | Hemoglobin G-Galveston (substance) |
| 56383006 | Leucocyanidin (substance) |
| 56389005 | Etafedrine (substance) |
| 56410003 | Heterophil antibody (substance) |
| 56412006 | Hydrogen arsenide |
| 56414007 | Galactolipase (substance) |
| 56427006 | Metallic alloy (substance) |
| 56436005 | Sulfanilamide (substance) |
| 56448008 | Kallidin I (substance) |
| 56455005 | Anthranilate synthase (substance) |
| 56471005 | Colonic vomitus (substance) |
| 56473008 | Ethyl dipropylthiocarbamate (substance) |
| 56475001 | Disodium indium^111^ (substance) |
| 56489006 | Blood group substance (substance) |
| 56499001 | Blood group antigen Ul^a^ (substance) |
| 56516007 | Very low density lipoprotein (substance) |
| 56521005 | Lymphocyte antigen CDw49b (substance) |
| 56523008 | Sequoyitol dehydrogenase (substance) |
| 56534006 | Hemoglobin Chico (substance) |
| 56564003 | Fusion protein BCR-ABL (substance) |
| 56566001 | ^88^Krypton (substance) |
| 56567005 | Lymphocyte antigen CD39 (substance) |
| 56586002 | 3MI |
| 56590000 | Methylene biphenyl isocyanate (substance) |
| 56592008 | Hemoglobin C-Ziguinchor (substance) |
| 56594009 | di-trans,poly-cis-Decaprenylcistransferase (substance) |
| 56609000 | ^111^Indium (substance) |
| 56613007 | Bretylium tosylate (substance) |
| 56617008 | Blood group antibody Gerhany (substance) |
| 56634000 | Methyl formate (substance) |
| 56695001 | Guanosine-triphosphate guanylyltransferase (substance) |
| 56702000 | Pyruvate dehydrogenase (lipoamide) (substance) |
| 56714008 | Bombesin (substance) |
| 56715009 | Chlorcyclizine (substance) |
| 56723006 | Penicillin V potassium (substance) |
| 56735005 | Blood group antibody Dropik (substance) |
| 56736006 | Methionine-transfer ribonucleic acid ligase (substance) |
| 56740002 | Triiodotyrosine (substance) |
| 56747004 | gp50 - Glycoprotein 50 |
| 56750001 | Blood group antibody In^a^ (substance) |
| 56755006 | Actinium compound (substance) |
| 56762002 | Stimulant laxative (substance) |
| 56773009 | Ichthyocrinotoxin (substance) |
| 56774003 | 4,5-Dihydroxyphthalate decarboxylase (substance) |
| 56781005 | Rhodotorula aspartic proteinase (substance) |
| 56796009 | Alloxan (substance) |
| 56822005 | Quaternary ammonium salt (substance) |
| 56838004 | Reduced nicotinamide adenine dinucleotide dehydrogenase (quinone) (substance) |
| 56846003 | N-Acetylglucosamine deacetylase (substance) |
| 56866007 | Blood group antibody Ri^a^ (substance) |
| 56867003 | Indium^113^ oxoquinoline red blood cell label (substance) |
| 56877001 | Kanamycin kinase (substance) |
| 56885005 | Blood group antibody Carson (substance) |
| 56886006 | Strontium compound (substance) |
| 56891007 | Independent high incidence blood group antigen (substance) |
| 56898001 | Protein S (substance) |
| 56899009 | ^125^Xenon (substance) |
| 56902007 | Methylitaconate delta-isomerase (substance) |
| 56904008 | Tungsten isotope (substance) |
| 56926009 | Hemoglobin J-Daloa (substance) |
| 56933009 | Blood group antibody Nijhuis (substance) |
| 56935002 | Alanine aminotransferase (substance) |
| 56942002 | Free fatty acid-albumin complex (substance) |
| 56945000 | Blood group antibody Fy3 (substance) |
| 56958004 | Barium compound (substance) |
| 56980001 | Haemoglobin Rahere |
| 57031001 | 1,1,-Dichloropropane (substance) |
| 57037002 | Fibrin degradation agent, small peptide (substance) |
| 57040002 | Dibutyl adipate (substance) |
| 57051002 | Hemoglobin C-Harlem (substance) |
| 57056007 | Alkaline phosphatase (substance) |
| 57064001 | Fibrinogen Quebec I (substance) |
| 57076001 | Active C3bBb (substance) |
| 57078000 | Mitochondrial ATPase |
| 57082003 | Arylesterase (substance) |
| 57090003 | Collagen type III (substance) |
| 57091004 | Methylisocitrate lyase (substance) |
| 57126000 | Glue (substance) |
| 57133000 | Human leukocyte antigen absent (substance) |
| 57150003 | Blood group antibody Eggenberger (substance) |
| 57155008 | Pyruvate dehydrogenase lipoamide-phosphatase (substance) |
| 57164003 | Dyclonine hydrochloride (substance) |
| 57178002 | Hemoglobin Henri Mondor (substance) |
| 57198007 | Lemon oil (substance) |
| 57199004 | Plasminogen activator inhibitor-1 (substance) |
| 57228007 | Blood group antibody Knoebnchild (substance) |
| 57244003 | 11-Ketoandrosterone (substance) |
| 57251007 | 2,6-beta-Fructan 6-levan biohydrolase (substance) |
| 57259009 | Gallbladder bile (substance) |
| 57268006 | Blood group antigen Oliver (substance) |
| 57272005 | Iodine compound (substance) |
| 57273000 | Zinc radioisotope (substance) |
| 57279001 | ^57^Nickel (substance) |
| 57281004 | Blood group antigen Re^a^ (substance) |
| 57294002 | Z line material (substance) |
| 57308006 | Acetylcholine (substance) |
| 57318001 | Blood group antibody Ga |
| 57362005 | 3-Oxoadipate enol-lactonase (substance) |
| 57377002 | Blood group antigen Lu9 (substance) |
| 57400003 | Phenol 2-monooxygenase (substance) |
| 57439007 | Blood group antigen JMH (substance) |
| 57440009 | Glycine hydroxymethyltransferase (substance) |
| 57442001 | Acylphosphatase (substance) |
| 57452002 | Homocitrate synthase (substance) |
| 57454001 | Metalloporphyrin (substance) |
| 57466007 | Phenyl cyclohexanol (substance) |
| 57471000 | Methyl flamprop (substance) |
| 57479003 | Air contaminant (substance) |
| 57519005 | Inorganic tin compound (substance) |
| 57528006 | Furylfuramide isomerase (substance) |
| 57529003 | Blood group antibody Marcus (substance) |
| 57533005 | Thioglucosidase (substance) |
| 57542003 | Glycerol dehydratase (substance) |
| 57562006 | Deoxythymidine diphosphate-dihydrostreptose-streptidine-6-phosphate dihydrostreptosyltransferase (substance) |
| 57573004 | Hemoglobin Beijing (substance) |
| 57574005 | Loperamide hydrochloride (substance) |
| 57575006 | Alkali-resistant hemoglobin (substance) |
| 57583000 | Naphazoline hydrochloride (substance) |
| 57595000 | Blood group antibody Kowanski (substance) |
| 57601008 | ^238^Plutonium (substance) |
| 57634005 | Iodophenol methyltransferase (substance) |
| 57635006 | N-butyl lactate (substance) |
| 57641004 | Human leukocyte antigen Dw2 (substance) |
| 57649002 | Rhodopsin (substance) |
| 57678001 | Blood group antibody Jones (substance) |
| 57679009 | Ethanolamine-phosphate phospho-lyase (substance) |
| 57707004 | 2-Haloacid dehalogenase (substance) |
| 57720001 | Anise oil (substance) |
| 57743005 | Butyrate-coenzyme A ligase (substance) |
| 57753006 | Brilliant yellow stain (substance) |
| 57763003 | Uridine (substance) |
| 57765005 | Aminopeptidase (substance) |
| 57795002 | Chemical element (substance) |
| 57808000 | beta-Thromboglobulin (substance) |
| 57813001 | Heme |
| 57818005 | Scillaren B (substance) |
| 57827006 | Dihydroxyfumarate decarboxylase (substance) |
| 57830004 | Immunoglobulin, joining region (substance) |
| 57837001 | Blood group antibody Ridd (substance) |
| 57842009 | Coagulation factor X Friuli variant (substance) |
| 57843004 | Hemoglobin Okayama (substance) |
| 57851001 | Propyl nitrate (substance) |
| 57858007 | Guanosine diphosphate (substance) |
| 57859004 | Cyclohexamide (substance) |
| 57860009 | Hemoglobin Genova (substance) |
| 57868002 | Dichlorvos (substance) |
| 57880005 | Ascorbate 2,3-dioxygenase (substance) |
| 57894006 | Hemoglobin Lille (substance) |
| 57899001 | Zineb (substance) |
| 57911003 | Methotrimeprazine hydrochloride (substance) |
| 57912005 | Blood group antigen Enriquez (substance) |
| 57913000 | Anisotropine (substance) |
| 57915007 | Propylene oxide (substance) |
| 57916008 | Pyruvate oxidase (substance) |
| 57939002 | Benzene (substance) |
| 57959003 | ^205^Lead (substance) |
| 57960008 | Ferrochelatase (substance) |
| 57969009 | Deoxyadenosine kinase (substance) |
| 57979006 | Picrotoxin (substance) |
| 57986003 | Semisynthetic alkaloid (substance) |
| 58014006 | Diphosphomevalonate decarboxylase (substance) |
| 58017004 | Blood group antigen P1 (substance) |
| 58018009 | Cevadine (substance) |
| 58019001 | Throat antibiotic (substance) |
| 58035008 | Blood group antibody Arun (substance) |
| 58043003 | Nicotinamide adenine dinucleotide (phosphate) ^+^ arginine adenosine diphosphate -ribosyltransferase (substance) |
| 58046006 | gamma-Butyrobetaine, 2-oxoglutarate dioxygenase (substance) |
| 58049004 | Glutamate synthase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 58072002 | Monokine |
| 58089005 | Messenger ribonucleic acid (nucleoside-O^2^)'-methyltransferase (substance) |
| 58131001 | Alpha particle (substance) |
| 58132008 | Monodehydroascorbate reductase (reduced nicotinamide adenine dinucleotide) (substance) |
| 58138007 | Thiamin pyrophosphokinase (substance) |
| 58139004 | Zirconium oxide (substance) |
| 58151002 | Human leukocyte antigen DPw4 (substance) |
| 58152009 | Bacitracin C (substance) |
| 58163007 | Lactic dehydrogenase isoenzyme |
| 58165000 | Hemoglobin Gavello (substance) |
| 58173009 | Prostaglandin PGF2 alpha tromethamine (substance) |
| 58182003 | Blasticidin-S deaminase (substance) |
| 58186000 | Methyl phenyl ethyl hydantoin (substance) |
| 58187009 | Phosphoenolpyruvate carboxykinase (pyrophosphate) (substance) |
| 58195008 | Genetic code (substance) |
| 58202007 | Fructose (substance) |
| 58232004 | Blood group antibody Ven (substance) |
| 58233009 | Meclofenamate sodium (substance) |
| 58254002 | Blood group antigen Hg^a^ (substance) |
| 58257009 | D-Lactate dehydrogenase (cytochrome) (substance) |
| 58272008 | n-Acetyl muramic acid (substance) |
| 58279004 | Selenium hexafluoride (substance) |
| 58281002 | Gadolinium (substance) |
| 58292001 | Selenium sulfide (substance) |
| 58295004 | Inorganic chemical (substance) |
| 58305007 | Blood group antibody McC^a^ (substance) |
| 58313008 | Succinate-coenzyme A ligase (guanosine diphosphate-forming) (substance) |
| 58319007 | Blood group antigen Kollogo (substance) |
| 58325006 | Methsuximide (substance) |
| 58339006 | Saccharopine dehydrogenase (NAD^+^,L-lysine-forming) (substance) |
| 58343005 | Cefonicid (substance) |
| 58345003 | Phosphoric acid (substance) |
| 58348001 | Sex chromatin (substance) |
| 58364009 | Blood group antibody HLA-A10 (substance) |
| 58368007 | Blood group antibody Englund (substance) |
| 58369004 | Pyrroline-5-carboxylate reductase (substance) |
| 58370003 | Coproporphyrinogen oxidase (substance) |
| 58376009 | Anisidine (substance) |
| 58397005 | Alkanal monooxygenase (flavin mononucleotide-linked) (substance) |
| 58402009 | Human leukocyte antigen A11 (substance) |
| 58414001 | Hemoglobin Yusa |
| 58416004 | Kanamycin 6'-acetyltransferase (substance) |
| 58422008 | Methyl acrylate (substance) |
| 58441006 | Mannitol dehydrogenase (substance) |
| 58447005 | Tetrachlorodibenzofuran (substance) |
| 58449008 | Industrial smog (substance) |
| 58453005 | Blood group antigen Duvall (substance) |
| 58461000 | Metaraminol bitartrate (substance) |
| 58466005 | Propionate coenzyme A-transferase (substance) |
| 58505008 | Plant isoquinoline alkaloid (substance) |
| 58520002 | Collagen type I (substance) |
| 58529001 | Hydroxylamine reductase (reduced nicotinamide adenine dinucleotide) (substance) |
| 58536000 | Antimony dimercaptosuccinate (substance) |
| 58541008 | ^24^Sodium (substance) |
| 58560001 | Blood group antigen Teremok (substance) |
| 58573002 | 2-Ethoxyethyl acetate (substance) |
| 58578006 | Uridine diphosphate galacturonosyltransferase (substance) |
| 58591007 | Nucleoside-triphosphate-adenylate kinase (substance) |
| 58594004 | Blood group antigen Zwal (substance) |
| 58595003 | Carboxylic salt (substance) |
| 58597006 | Deoxyribonucleic acid-deoxyinosine glycosidase (substance) |
| 58607005 | Neutron (substance) |
| 58613001 | Interleukin-3 (substance) |
| 58616009 | Githagenin (substance) |
| 58620008 | Sporidesmin (substance) |
| 58624004 | Fibrinogen Philadelphia (substance) |
| 58630004 | Protein-disulfide reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 58631000 | Eriochrome blue black SE stain (substance) |
| 58644005 | Dolichol kinase (substance) |
| 58649000 | Cosmetic cream (substance) |
| 58652008 | N^4^(beta-N-Acetylglucosaminyl)-L-asparaginase (substance) |
| 58656006 | Ferredoxin-nitrite reductase (substance) |
| 58674002 | Naphthol (substance) |
| 58679007 | Blood group antibody Peacock (substance) |
| 58680005 | Glutamate acetyltransferase (substance) |
| 58687008 | p-tert-Butylphenol (substance) |
| 58693000 | Sodium bromide (substance) |
| 58721000 | Limonite (substance) |
| 58730008 | Factor VIII antibody (substance) |
| 58732000 | Red wine (substance) |
| 58739009 | Valine-pyruvate aminotransferase (substance) |
| 58745001 | ^195^Gold (substance) |
| 58753009 | Alanine (substance) |
| 58755002 | Water soluble anthracene brown stain (substance) |
| 58765008 | Uroporphyrin I (substance) |
| 58775006 | Phosphatidylinositol deacylase (substance) |
| 58782005 | ^85m^Yttrium (substance) |
| 58783000 | Amylase isoenzyme (substance) |
| 58787004 | Aspartate-transfer ribonucleic acid ligase (substance) |
| 58789001 | Nicotinamidase (substance) |
| 58792002 | ^149^Gadolinium (substance) |
| 58793007 | Pinene hydrochloride (substance) |
| 58794001 | Monoterpenol acetyltransferase (substance) |
| 58796004 | ^211^Bismuth (substance) |
| 58799006 | Cucurbitacin (substance) |
| 58804001 | Fibrinogen Bern II (substance) |
| 58831003 | Hemoglobin Sawara (substance) |
| 58847001 | Thiamin-diphosphate kinase (substance) |
| 58876003 | ^186^Platinum (substance) |
| 58891001 | Salivary amylase (substance) |
| 58900009 | Properdin (substance) |
| 58907007 | Succinylcholine chloride (substance) |
| 58910000 | Fibrinogen Genova I (substance) |
| 58927008 | Beryllium fumes (substance) |
| 58955007 | Adenylate isopentenyltransferase (substance) |
| 58956008 | Trazodone hydrochloride (substance) |
| 58962003 | Chrysarobin (substance) |
| 58971007 | Petroleum sulfonate (substance) |
| 58975003 | Blood group antigen Dh^a^ (substance) |
| 58977006 | Magnesium salt (substance) |
| 58995009 | Pseudomonas aeruginosa neutral proteinase (substance) |
| 58996005 | Dieldrin (substance) |
| 59001002 | ^197m^Platinum (substance) |
| 59015000 | Guanosine 3',5'-bis(diphosphate) 3'-pyrophosphatase (substance) |
| 59025005 | Iridium compound (substance) |
| 59027002 | Peroxidase (substance) |
| 59031008 | Liquefied phenol (substance) |
| 59034000 | Tromethamine (substance) |
| 59036003 | Silver radioisotope (substance) |
| 59040007 | Sarcina neutral proteinase (substance) |
| 59045002 | Hemoglobin Winnipeg (substance) |
| 59071003 | Vinyl ether (substance) |
| 59072005 | 3-Hydroxy-2-methylbutyryl-coenzyme A dehydrogenase (substance) |
| 59074006 | Butyrate-acetoacetate coenzyme A-transferase (substance) |
| 59075007 | Blood group antibody Paris (substance) |
| 59082006 | Urokinase (substance) |
| 59087000 | Coagulation factor XI variant type I (substance) |
| 59094002 | Melanin (substance) |
| 59111007 | Blood group antigen K22 (substance) |
| 59119009 | Ichthyosarcotoxin (substance) |
| 59134003 | Lymphogranuloma venereum antigen (substance) |
| 59147008 | Active C5b6 (substance) |
| 59149006 | Tetrodotoxin (substance) |
| 59161003 | Thymic erythropoietin suppression factor (substance) |
| 59162005 | Lysophosphatide (substance) |
| 59163000 | Fibrinogen Valencia (substance) |
| 59170000 | Dextrothyroxine (substance) |
| 59195004 | Site-specific methyltransferase (adenine-specific) (substance) |
| 59202000 | Actinium radioisotope (substance) |
| 59203005 | Thiol sulfotransferase (substance) |
| 59205003 | Blood group antibody Ge2 (substance) |
| 59208001 | Adrenergic receptor (substance) |
| 59224000 | Ethyl nitrophenyl thiobenzene (substance) |
| 59226003 | 4-2,4-Dichlorophenoxybutanoic acid (substance) |
| 59231001 | 5-Hydroxyfuranocoumarin O^5^-methyltransferase (substance) |
| 59241003 | 5-Oxoprolinase (adenosine triphosphate-hydrolysing) (substance) |
| 59243000 | Nucleotidase (substance) |
| 59259000 | ^191^Mercury |
| 59267008 | L-Fuconate dehydratase (substance) |
| 59268003 | Tubulin (substance) |
| 59271006 | C6 inactivator (substance) |
| 59287009 | ^180m^Hafnium (substance) |
| 59308003 | Dimethylsulfate (substance) |
| 59312009 | Blood group antigen Pr>a< (substance) |
| 59314005 | Pipradrol (substance) |
| 59318008 | Arsenic pentoxide (substance) |
| 59334006 | Cement, industrial (substance) |
| 59338009 | Methapyrilene (substance) |
| 59339001 | Hemoglobin Albany-Suma (substance) |
| 59347001 | Blood group antigen A 8306 (substance) |
| 59351004 | Citrate (substance) |
| 59353001 | ^187^Tungsten (substance) |
| 59365002 | Caraway oil (substance) |
| 59375004 | Lymphocyte antigen CD53 (substance) |
| 59386002 | Fetuin (substance) |
| 59406000 | Blood group antibody Krog (substance) |
| 59414006 | Stercobilin (substance) |
| 59431004 | Ketone (substance) |
| 59433001 | Human chorionic gonadotropin (substance) |
| 59435008 | Creatine kinase isoenzyme (substance) |
| 59439002 | Conglutinogen (substance) |
| 59440000 | Diglycidyl ether (substance) |
| 59442008 | Nitric acid (substance) |
| 59485004 | Hemoglobin Koya Dora (substance) |
| 59488002 | Phenprocoumon (substance) |
| 59489005 | Calusterone (substance) |
| 59497003 | Choline sulfotransferase (substance) |
| 59501008 | Actinomycin lactonase (substance) |
| 59525000 | Hb 92(FG4), Arg-gln |
| 59526004 | Florantyrone (substance) |
| 59533004 | Food additive (substance) |
| 59541004 | ^175^Tantalum (substance) |
| 59542006 | Blood group antibody IB (substance) |
| 59545008 | Pesticide (substance) |
| 59549002 | Fibrinogen Milano II (substance) |
| 59560006 | Mepivacaine (substance) |
| 59570008 | Transferrin (substance) |
| 59584003 | Mercurous sulfate (substance) |
| 59595009 | Verdochromogen (substance) |
| 59605005 | Blood group antigen Whittaker (substance) |
| 59610009 | Left lower lobe mucus (substance) |
| 59718005 | N-Acylneuraminate-9-phosphate synthase (substance) |
| 59723005 | Human leukocyte antigen A31 (substance) |
| 59732007 | Hemoglobin Perspolis (substance) |
| 59737001 | Blood group antibody Co^a^ (substance) |
| 59755005 | Muscarine (substance) |
| 59759004 | Bacitracin B (substance) |
| 59776000 | Calcium cyanide (substance) |
| 59779007 | Human chorionic gonadotropin, alpha subunit (substance) |
| 59787008 | Hemoglobin Creteil (substance) |
| 59788003 | Gargle (substance) |
| 59801003 | Rhodium (substance) |
| 59804006 | Glycoprotein (substance) |
| 59808009 | Blood group antibody Man |
| 59815001 | Azoxybenzene (substance) |
| 59822009 | Histamine H2 receptor (substance) |
| 59835000 | Lymphocyte antigen CDw50 (substance) |
| 59840008 | Blood group antibody Zt^a^ (substance) |
| 59842000 | Nicotinate-nucleotide adenylyltransferase (substance) |
| 59844004 | ^42^Potassium (substance) |
| 59865005 | Complement component C1q (substance) |
| 59872006 | ^198^Thallium (substance) |
| 59880004 | Hemoglobin J-Calabria (substance) |
| 59882007 | Aminocaproic acid (substance) |
| 59888006 | Carnitine (substance) |
| 59895002 | Blood group antibody Tichmeyer (substance) |
| 59905008 | Isoantibody (substance) |
| 59906009 | Glucose dehydrogenase (pyrroloquinolinequinone) (substance) |
| 59924006 | Polynucleotide adenylyltransferase (substance) |
| 59937009 | Cephalothin sodium (substance) |
| 59938004 | ^208^Thallium (substance) |
| 59951009 | 4-Pyridoxolactonase (substance) |
| 59954001 | Oxaloacetate tautomerase (substance) |
| 59961002 | Eye liner (substance) |
| 59964005 | ^192^Gold (substance) |
| 59987002 | Polyoxyethelene 4 sorbitan monostearate (substance) |
| 60018006 | Amrinone lactate (substance) |
| 60047004 | Oncogene protein c-fms (substance) |
| 60052009 | Venom exonuclease (substance) |
| 60057003 | ^201^Thallium (substance) |
| 60061009 | Protein N-acetylglucosaminyltransferase (substance) |
| 60069006 | Plutonium compound (substance) |
| 60085001 | Chromatin (substance) |
| 60135007 | Homosalate (substance) |
| 60141000 | Ribonuclease P4 (substance) |
| 60153001 | Gamma-glutamyl transferase |
| 60175004 | Formate-tetrahydrofolate ligase (substance) |
| 60187006 | Reduced nicotinamide adenine dinucleotide phosphate peroxidase (substance) |
| 60200001 | Glyoxylate reductase (substance) |
| 60208008 | Coagulation factor V (substance) |
| 60215000 | Human leukocyte antigen A2 (substance) |
| 60244003 | 3-Dehydroretinol (substance) |
| 60245002 | ^240^Californium (substance) |
| 60253005 | Aminoacylase (substance) |
| 60260004 | Histidine (substance) |
| 60266005 | Chloroquine hydrochloride (substance) |
| 60273000 | ^220^Radon (substance) |
| 60289002 | Mepenzolate bromide (substance) |
| 60292003 | Blood group antigen I^D^ (substance) |
| 60300004 | Blood group antibody C^G^ (substance) |
| 60303002 | Dinitrobenzene (substance) |
| 60310008 | Mytilidase (substance) |
| 60323001 | Mercuric oxycyanide (substance) |
| 60343007 | D-Lyxose ketol-isomerase (substance) |
| 60344001 | Malonate-semialdehyde dehydrogenase (substance) |
| 60345000 | Cobalt hydrocarbonyl (substance) |
| 60349006 | Uridylic acid (substance) |
| 60351005 | Salicylate 1-monooxygenase (substance) |
| 60352003 | Anthocyanin (substance) |
| 60355001 | Hemoglobin Philly (substance) |
| 60364006 | Blood group antibody McC^b^ (substance) |
| 60373003 | Cathepsin H (substance) |
| 60376006 | Succinic acid (substance) |
| 60381002 | Nickel fluoride (substance) |
| 60403001 | beta-Amylase (substance) |
| 60407000 | Lymphocyte antigen CD46 (substance) |
| 60418000 | Serine dehydrogenase (substance) |
| 60424006 | Acetylserotonin methyltransferase (substance) |
| 60430006 | Follicle-stimulating hormone receptor (substance) |
| 60441008 | Trypan blue stain (substance) |
| 60444000 | Transfer ribonucleic acid (guanosine-O^2'^)-methyltransferase (substance) |
| 60449005 | Putrescine oxidase (substance) |
| 60455000 | Racephedrine (substance) |
| 60457008 | Proprionic acid (substance) |
| 60459006 | Iron Fe^59^ labeled dextran (substance) |
| 60469000 | C>5b678< inhibitor (substance) |
| 60470004 | Blood group antigen Marcus (substance) |
| 60471000 | Sodium compound (substance) |
| 60489004 | Hemoglobin J-Habana (substance) |
| 60491007 | Blood group antigen Bothrops (substance) |
| 60500000 | Cysteine lyase (substance) |
| 60516003 | Blood group antibody McDermott (substance) |
| 60526005 | Acetyl salicylate (substance) |
| 60530008 | Aldehyde (substance) |
| 60543008 | ^78^Arsenic (substance) |
| 60544002 | Aminoamide (substance) |
| 60556001 | Glutamate-methylamine ligase (substance) |
| 60575006 | Blood group antibody Wiggins (substance) |
| 60577003 | Glucan 1,4-beta-glucosidase (substance) |
| 60596004 | Hemoglobin Providence |
| 60598003 | Operator gene (substance) |
| 60605004 | Hepatitis B e antigen (substance) |
| 60617002 | Nitrogenase (flavodoxin) (substance) |
| 60663008 | Phosphatidyl-N-methylethanolamine methyltransferase (substance) |
| 60702005 | Myelin protein (substance) |
| 60714002 | Fibrin degradation agent, E fragment (substance) |
| 60717009 | Blood group antibody John Smith (substance) |
| 60722009 | Serine-sulfate ammonia-lyase (substance) |
| 60727003 | Miconazole nitrate (substance) |
| 60739006 | Waxoline blue stain (substance) |
| 60740008 | Dolichyl-phosphatase (substance) |
| 60746002 | Mucous membrane antiviral agent (substance) |
| 60760000 | Reverse T>3< (substance) |
| 60762008 | Cysteine-conjugate beta-lyase (substance) |
| 60764009 | Neovitamin A (substance) |
| 60769004 | Hard metal (substance) |
| 60772006 | Blood group antibody Rasmussen (substance) |
| 60792004 | Human leukocyte antigen Cw4 (substance) |
| 60793009 | Smegma (substance) |
| 60803009 | Protocollagen (substance) |
| 60808000 | Fibrinogen Marburg (substance) |
| 60838006 | Blood group antigen Holmes (substance) |
| 60840001 | Blood group antigen Horw (substance) |
| 60842009 | Hemoglobin Agenogi |
| 60848008 | Blood group antibody Lu17 (substance) |
| 60860009 | Hemoglobin F-Caltech (substance) |
| 60868002 | Blood group antigen MZ 443 (substance) |
| 60872003 | Acetic naphthalene (substance) |
| 60874002 | Blood group antigen Au^a^ (substance) |
| 60884001 | Procollagen (substance) |
| 60885000 | Trisulfapyrimidines (substance) |
| 60886004 | Morphine sulfate (substance) |
| 60889006 | Hemoglobin Guangzhou-Hangzhou (substance) |
| 60904002 | Human leukocyte antigen Cw6 (substance) |
| 60905001 | Salicylanilide (substance) |
| 60908004 | ^125^Tin (substance) |
| 60917004 | Cholinesulfatase (substance) |
| 60920007 | Fuchsin acid stain (substance) |
| 60924003 | Fibrinogen Paris II (substance) |
| 60925002 | Hemoglobin Tübingen (substance) |
| 60943003 | Glutamate-5-semialdehyde dehydrogenase (substance) |
| 60976004 | w-Hydroxydecanoate dehydrogenase (substance) |
| 60988002 | Tolmetin sodium (substance) |
| 61004005 | Blood group antigen Wiggins (substance) |
| 61010005 | Solvent (substance) |
| 61015000 | Blood group antibody Craig (substance) |
| 61024009 | Blood group antibody Bruno (substance) |
| 61025005 | Colloidal iodine (substance) |
| 61029004 | Hemoglobin Arlington Park (substance) |
| 61044003 | Acipenserin (substance) |
| 61045002 | Sedoheptulose (substance) |
| 61068006 | Thioflavine T stain (substance) |
| 61076008 | Hemoglobin Beth Israel (substance) |
| 61078009 | Progesterone receptor (substance) |
| 61088005 | Plastic (substance) |
| 61103002 | Choline-phosphate cytidylyltransferase (substance) |
| 61114004 | Chymase (substance) |
| 61116002 | Immunoglobulin, GM allotype (substance) |
| 61133009 | Cytochrome-c-lysine methyltransferase (substance) |
| 61149006 | 4-Acetamidobutyryl-coenzyme A deacetylase (substance) |
| 61171001 | Maleylpyruvate isomerase (substance) |
| 61177002 | Arachidonate 15-lipoxygenase (substance) |
| 61178007 | Neamine (substance) |
| 61188008 | Extracellular fibril (substance) |
| 61190009 | Blood group antibody Payer (substance) |
| 61195004 | D-Glutaminase (substance) |
| 61201007 | Pheophytin (substance) |
| 61205003 | Molten metal (substance) |
| 61224000 | Deoxyribonuclease V (substance) |
| 61226003 | ^201^Lead (substance) |
| 61238007 | Creatine kinase isoenzyme, MM fraction (substance) |
| 61243000 | Orotidine-5'-phosphate decarboxylase (substance) |
| 61244006 | Monobasic potassium phosphate (substance) |
| 61245007 | Haemoglobin Cochin-Port Royal |
| 61268003 | Gastrointestinal contents (substance) |
| 61271006 | Blood group antibody s (substance) |
| 61275002 | Triiodothyronine (substance) |
| 61298005 | Acyl-coenzyme A dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 61299002 | Enkephalin (substance) |
| 61306004 | Methylrosaniline (substance) |
| 61308003 | Putrescine carbamoyltransferase (substance) |
| 61321005 | Cancer-related substance (substance) |
| 61348006 | Lombricine kinase (substance) |
| 61357000 | Paramethadione (substance) |
| 61359002 | Thiosulfuric acid (substance) |
| 61360007 | Polymyxin B sulfate (substance) |
| 61384004 | Camphene (substance) |
| 61391001 | Temuline (substance) |
| 61398007 | Chlophedianol (substance) |
| 61418009 | Nitroquinoline-N-oxide reductase (substance) |
| 61425002 | C reactive protein (substance) |
| 61429008 | Bismuth radioisotope |
| 61450004 | Dibromochloropropane (substance) |
| 61453002 | Glutarate-coenzyme A ligase (substance) |
| 61454008 | Immune response gene (substance) |
| 61466002 | Uridine nucleosidase (substance) |
| 61467006 | Ribitol dehydrogenase (substance) |
| 61471009 | Chloride trifluoride (substance) |
| 61472002 | Collagen (substance) |
| 61479006 | Galactosylxylosylprotein 3-beta-galactosyltransferase (substance) |
| 61481008 | Amanitine (substance) |
| 61483006 | Azaribine (substance) |
| 61489005 | 1-Aminocyclopropane-1-carboxylate synthase (substance) |
| 61497003 | Latia-luciferin monooxygenase (demethylating) (substance) |
| 61505004 | Plant mitogen (substance) |
| 61527008 | Radium radioisotope (substance) |
| 61529006 | 4-Cresol dehydrogenase (hydroxylating) (substance) |
| 61540003 | Oil of hyssop (substance) |
| 61541004 | Dichlorophenoxy ethyl sulfate (substance) |
| 61566000 | Benzene 1,2-dioxygenase (substance) |
| 61573005 | Dehydro-L-gulonate decarboxylase (substance) |
| 61580007 | Red cell neutral endopeptidase (substance) |
| 61581006 | Carbendazim (substance) |
| 61588000 | Thymidine kinase (substance) |
| 61595009 | Octane (substance) |
| 61615004 | Aspergillus nuclease S>1< (substance) |
| 61617007 | 7alpha-Hydroxysteroid dehydrogenase (substance) |
| 61630008 | Chondroitin AC lyase (substance) |
| 61643008 | Isocitrate lyase (substance) |
| 61644002 | Solanain (substance) |
| 61655002 | Blood group antigen Kasamatsuo (substance) |
| 61664007 | Ribonuclease V (substance) |
| 61678008 | Fluphenazine hydrochloride (substance) |
| 61684006 | ^211^Radon (substance) |
| 61692002 | Chromoprotein (substance) |
| 61694001 | Ribonucleoside (substance) |
| 61709008 | Cinchophen (substance) |
| 61716009 | ^81m^Krypton (substance) |
| 61730004 | Ketotetrose-phosphate aldolase (substance) |
| 61731000 | Methyl isobutyl carbinol (substance) |
| 61736005 | Heavy metal compound |
| 61742009 | Biperiden lactate (substance) |
| 61765004 | Hemoglobin Altdorf (substance) |
| 61773008 | Lidocaine hydrochloride (substance) |
| 61789006 | Dye (substance) |
| 61795007 | Corticotropin-like intermediate lobe peptide (substance) |
| 61813008 | Fibrinogen Chapel Hill I (substance) |
| 61833007 | Blood group antibody Li^a^ (substance) |
| 61841007 | Complement activator (substance) |
| 61849009 | Disperse orange (substance) |
| 61863003 | Barium sulfide (substance) |
| 61864009 | Vinca alkaloid (substance) |
| 61871004 | Alanine-oxo-acid aminotransferase (substance) |
| 61872006 | Lactaldehyde reductase (substance) |
| 61899008 | Dextrothyroxine sodium (substance) |
| 61904007 | Phensuximide (substance) |
| 61905008 | Methylcyclohexanol (substance) |
| 61915002 | Blood group antigen Walin (substance) |
| 61925007 | Rubratoxin (substance) |
| 61936000 | Nicotinamide methyltransferase (substance) |
| 61944000 | Collagen type II (substance) |
| 61967003 | Hemoglobin C (substance) |
| 61971000 | Butyrate kinase |
| 61978006 | Blood group antibody Burrett (substance) |
| 61980000 | Demulcent (substance) |
| 61993005 | Allergoid (substance) |
| 61994004 | Haptoglobin 2-2 (substance) |
| 62003001 | Blood group antigen Boldog (substance) |
| 62004007 | Blood group antigen Lu8 (substance) |
| 62007000 | Blood group antigen Kowanski (substance) |
| 62027004 | Hexadecanol dehydrogenase (substance) |
| 62032003 | Dextransucrase (substance) |
| 62036000 | Titanium dioxide (substance) |
| 62038004 | Human leukocyte antigen DR (substance) |
| 62039007 | Diclofenac sodium (substance) |
| 62044000 | Isopentenyl-diphosphate delta-isomerase (substance) |
| 62046003 | Pyrophosphate-protein phosphotransferase (substance) |
| 62053007 | Nylon 6 (substance) |
| 62059006 | Gastric contents (substance) |
| 62070004 | Dibromsalicylanilide (substance) |
| 62077001 | 2-Methoxyethanol acetate (substance) |
| 62097006 | Chlorate reductase (substance) |
| 62128007 | Kerosene (substance) |
| 62135004 | Protein xylosyltransferase (substance) |
| 62145002 | Fibrinogen Aarhus (substance) |
| 62150008 | Hemoglobin Sendagi (substance) |
| 62162007 | ^90m^Zirconium (substance) |
| 62167001 | Quinate dehydrogenase (substance) |
| 62168006 | Fibrinogen antibody (substance) |
| 62174006 | Fructose-1-6-phosphate (substance) |
| 62177004 | Tantalum compound (substance) |
| 62183001 | Collagen fiber (substance) |
| 62184007 | Hemoglobin Collingwood (substance) |
| 62194002 | Lung irritant chemical warfare agent (substance) |
| 62197009 | Nucleoside-diphosphate kinase (substance) |
| 62214005 | Phosphatidic acid (substance) |
| 62237004 | Mesoporphyrin (substance) |
| 62249003 | Human leukocyte antigen Cw5 (substance) |
| 62252006 | Plasminogen (substance) |
| 62256009 | Bilirubin monoglucuronide (substance) |
| 62265002 | Acylagmatine amidase (substance) |
| 62267005 | Capsular-polysaccharide endo-1,3-alpha-galactosidase (substance) |
| 62298007 | Melanocyte hormone inhibiting factor (substance) |
| 62301006 | Thiamin oxidase (substance) |
| 62304003 | Mercuric sulfate (substance) |
| 62346007 | Phloretin hydrolase (substance) |
| 62352008 | 6-beta Hydroxycortisol (substance) |
| 62358007 | Blood group antibody Bio-5 (substance) |
| 62364000 | Monomethyl aniline (substance) |
| 62368002 | Erythrityl tetranitrate (substance) |
| 62384001 | Fibrinogen Oslo I (substance) |
| 62387008 | ^109m^Silver (substance) |
| 62412007 | Dipeptidyl peptidase IV (substance) |
| 62416005 | Formaldehyde transketolase (substance) |
| 62417001 | trans-Cinnamate 4-monooxygenase (substance) |
| 62421008 | Blood group antibody Henry (substance) |
| 62442005 | Chloriodized oil (substance) |
| 62443000 | Hemoglobin Christchurch (substance) |
| 62444006 | Cyclopentamine (substance) |
| 62451002 | Alcohol acetyltransferase (substance) |
| 62483008 | Hydroxycinnamate 4-beta-glucosyltransferase (substance) |
| 62486000 | ^10^Beryllium (substance) |
| 62492006 | Frangula (substance) |
| 62504002 | Antigen recognition site (substance) |
| 62506000 | Agavain (substance) |
| 62515007 | Heterophil antigen (substance) |
| 62517004 | Sodium chromate Cr^51^ (substance) |
| 62523009 | Blood group antibody e (substance) |
| 62543003 | Gallium (substance) |
| 62544009 | ^87^Krypton (substance) |
| 62545005 | Ammonium carbonate (substance) |
| 62547002 | ^251^Californium (substance) |
| 62563005 | Blood group antigen Anuszewska (substance) |
| 62569009 | CD71 - Cluster of differentiation antigen 71 |
| 62576004 | Carboxyhemoglobin |
| 62600002 | Blood group antibody Bert (substance) |
| 62601003 | 3-Phosphoglycerate phosphatase (substance) |
| 62613008 | Blood group antigen Balkin (substance) |
| 62632002 | Blood group antibody Kx (substance) |
| 62649009 | Butyl fluazifop (substance) |
| 62652001 | beta-Aspartyldipeptidase (substance) |
| 62661001 | ^80m^Bromine (substance) |
| 62666006 | Histamine phosphate (substance) |
| 62673001 | Platelet antibody HPA-3a (substance) |
| 62680004 | Glycerophosphoinositol inositolphosphodiesterase (substance) |
| 62694003 | Aflatoxin (substance) |
| 62699008 | Complement component C5 (substance) |
| 62707007 | ^110^Silver (substance) |
| 62721009 | Fibrinopeptide A (substance) |
| 62741004 | Alkaline phosphatase isoenzyme, liver fraction (substance) |
| 62754006 | Sodium iodide (substance) |
| 62763008 | Teichoic acid (substance) |
| 62775003 | Fusion protein GAG-ONC (substance) |
| 62776002 | Fatty-acid synthase (substance) |
| 62797001 | Arginine kinase (substance) |
| 62800004 | Blood group antigen En^a^FS (substance) |
| 62812000 | Pharyngeal contents (substance) |
| 62817006 | Verruculogen (substance) |
| 62821004 | Hydroxybutyric acid (substance) |
| 62832004 | Blood group antigen Tollefsen-Oyen (substance) |
| 62841009 | Blood group antibody Stairwalt (substance) |
| 62848003 | Amphibian venom (substance) |
| 62854002 | Gastrin (substance) |
| 62873003 | Plant agent (substance) |
| 62874009 | Bisalbumin (substance) |
| 62882009 | Hemoglobin A>2< Sphakia (substance) |
| 62885006 | Blood group antigen Ok^a^ (substance) |
| 62902008 | Oncogene protein L-MYC |
| 62915004 | Acrylonitrile (substance) |
| 62916003 | Polyvinylidene chloride (substance) |
| 62929003 | Blood group antibody Le^bL^ (substance) |
| 62934004 | Myxobacter AL-1 proteinase II (substance) |
| 62948004 | Hemoglobin J-Rajappen (substance) |
| 62957005 | ^237^Uranium (substance) |
| 62959008 | Immunoglobulin IgG1, H chain (substance) |
| 62963001 | Blood group antibody Rh41 (substance) |
| 62975006 | Methyl acetylene-propadiene mixture (substance) |
| 62998003 | Lymphocyte antigen CD74 (substance) |
| 63004003 | Phenylalanine (substance) |
| 63006001 | 3-Oxoacid coenzyme A-transferase (substance) |
| 63026002 | Anti lymphocyte antibody (substance) |
| 63028001 | Indolelactate dehydrogenase (substance) |
| 63037001 | Phytotoxin (substance) |
| 63045006 | Berry (substance) |
| 63047003 | Blood group antigen K11 (substance) |
| 63083007 | Cyclobenzaprine hydrochloride (substance) |
| 63084001 | Clindamycin hydrochloride (substance) |
| 63089006 | Mannose (substance) |
| 63096008 | Decapase |
| 63108002 | Dimethylallyltranstransferase (substance) |
| 63123007 | Estrogen binding protein (substance) |
| 63133004 | Phenylhydrazine (substance) |
| 63134005 | 2,5-Dihydroxypyridine 5,6-dioxygenase (substance) |
| 63146009 | Blood group antigen Covas (substance) |
| 63155007 | Blood group antibody Rh33 (substance) |
| 63167009 | Warfarin sodium (substance) |
| 63169007 | Blood group antibody Fy^a^ (substance) |
| 63188000 | Carbenicillin indanyl sodium (substance) |
| 63203003 | Ethoxyzolamide (substance) |
| 63222007 | 2,4-Diaminopentanoate dehydrogenase (substance) |
| 63229003 | Blood group antigen Win (substance) |
| 63261004 | Chloroxuron (substance) |
| 63266009 | Blood group antibody Anton (substance) |
| 63271002 | Hemoglobin Lufkin (substance) |
| 63281003 | Enterobacter ribonuclease (substance) |
| 63282005 | Thiphenamyl (substance) |
| 63306009 | Immunoglobulin IgG2 (substance) |
| 63307000 | Lactoyl-coenzyme A dehydratase (substance) |
| 63326008 | Inhibin hormone (substance) |
| 63330006 | Nonessential amino acid (substance) |
| 63341008 | Mevinphos (substance) |
| 63349005 | Zinc cyanide (substance) |
| 63350005 | Hepatitis B surface antigen subtype adw (substance) |
| 63360001 | ^89^Zirconium (substance) |
| 63366007 | Immune reactive locus (substance) |
| 63374008 | Hemoglobin Castilla (substance) |
| 63379003 | Coal tar pitch volatiles (substance) |
| 63383003 | Zinc stearate (substance) |
| 63399009 | Reduced glutathione (substance) |
| 63408009 | Cysteinyl-glycine dipeptidase (substance) |
| 63441007 | Isobutyl alcohol (substance) |
| 63447006 | Ribokinase (substance) |
| 63461001 | Cumene |
| 63478005 | Blood group antibody M^c^ (substance) |
| 63482007 | Gentamicin 3'-acetyltransferase (substance) |
| 63494003 | Inosine kinase (substance) |
| 63497005 | Dibutoline (substance) |
| 63522006 | Plant gene (substance) |
| 63527000 | Methionine decarboxylase (substance) |
| 63538000 | Blood group antigen Ny^a^ (substance) |
| 63545000 | Halazepam (substance) |
| 63559007 | Doxycycline calcium (substance) |
| 63591008 | Chromic sulfate (substance) |
| 63595004 | Blood group antigen Bultar (substance) |
| 63598002 | Blood group antigen Mi^a^ (substance) |
| 63606002 | Tin oxide (substance) |
| 63615009 | Bromdimethoxyamphetamine (substance) |
| 63621008 | Lymphocyte antigen CD47 (substance) |
| 63635005 | Blood group antigen Cross (substance) |
| 63652009 | Oncogene protein C-ABL (substance) |
| 63658008 | Methylenetetrahydrofolate-transfer ribonucleic acid-(uracil-5)-methyltransferase (reduced flavin adenine dinucleotide-oxidizing) (substance) |
| 63664001 | Glycine methyltransferase (substance) |
| 63676001 | Arginine hydrochloride (substance) |
| 63679008 | 2-Amino-4-hydroxy-6-hydroxymethyl-dihydropteridine pyrophosphokinase (substance) |
| 63689007 | Jatropham (substance) |
| 63704005 | Thermophilic aminopeptidase (substance) |
| 63707003 | Hemoglobin F-Texas-I (substance) |
| 63718003 | Folic acid (substance) |
| 63730009 | Calcitonin (substance) |
| 63735004 | Immunoglobulin, KM>2< allotype (substance) |
| 63754004 | Yttrium (substance) |
| 63759009 | Trehalose-phosphatase (substance) |
| 63760004 | ^135^Cesium (substance) |
| 63766005 | Flour (substance) |
| 63768006 | Type II site-specific deoxyribonuclease (substance) |
| 63770002 | Hemoglobin Dunn (substance) |
| 63779001 | Diphenidol (substance) |
| 63788005 | Blood group antibody Davis J (substance) |
| 63789002 | Carbamyl phosphate (substance) |
| 63793008 | Phosphorus compound (substance) |
| 63798004 | Hemoglobin Caribbean (substance) |
| 63809007 | Sphingosine beta-galactosyltransferase (substance) |
| 63813000 | Alkali (substance) |
| 63842008 | Dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase (substance) |
| 63852007 | Catkin (substance) |
| 63854008 | Isopropylmethylpyrimidyl diethyl thiophosphate |
| 63856005 | Coagulation factor IXa |
| 63857001 | Candida skin test antigen (substance) |
| 63862000 | 1, 2-Diacylglycerol (substance) |
| 63865003 | Blood group antigen Margaret (substance) |
| 63867006 | Blood group antigen Dav (substance) |
| 63868001 | ^193m^Mercury (substance) |
| 63869009 | Khellin (substance) |
| 63882001 | Aromatic solvent naphtha (substance) |
| 63889005 | Dichromate salt (substance) |
| 63896007 | Taurine salt of bile acid (substance) |
| 63920006 | Platelet antibody HPA-4 (substance) |
| 63927009 | Bromate salt (substance) |
| 63929007 | Alkali blue 6B stain (substance) |
| 63950003 | Immunoglobulin IgA2 (substance) |
| 63969008 | Regulator gene (substance) |
| 63984004 | Fibrinogen Awaji (substance) |
| 63999004 | Testolactone (substance) |
| 64011005 | Cyhalothrin |
| 64020001 | Blood group antibody A. Owens (substance) |
| 64026007 | Thiamin-phosphate kinase (substance) |
| 64029000 | Ticrynafen (substance) |
| 64032002 | Blood group antigen Tn (substance) |
| 64037008 | Blood group antibody Bregi (substance) |
| 64039006 | Copper oxide |
| 64053006 | Triokinase (substance) |
| 64055004 | 21-Hydroxysteroid dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) |
| 64070003 | Blood group antibody Schor (substance) |
| 64082007 | Plant toxalbumin (substance) |
| 64086005 | Formic acid (substance) |
| 64093009 | Blood group antigen Bx^a^ (substance) |
| 64095002 | Quinone oxime benzoyl hydrazine (substance) |
| 64096001 | Blood group antibody Giaigue (substance) |
| 64099008 | Oligo-1,6-glucosidase (substance) |
| 64105005 | Blood group antibody LW^a^ (substance) |
| 64112001 | Fast blue RR salt stain (substance) |
| 64128006 | Phosphoglycerate mutase (substance) |
| 64130008 | Troleandomycin (substance) |
| 64142003 | Spermine synthase (substance) |
| 64147009 | Nephrotoxic mycotoxin (substance) |
| 64170001 | Blood group antigen Whittle (substance) |
| 64179000 | Zinc chloride (substance) |
| 64182005 | Pituitary luteinizing hormone (substance) |
| 64187004 | Cellulase (substance) |
| 64191009 | Naltrexone hydrochloride (substance) |
| 64197008 | Smoke (substance) |
| 64221009 | Tropinesterase (substance) |
| 64238008 | Blood group antigen Ce (substance) |
| 64242006 | Aerosol |
| 64244007 | Plant genome (substance) |
| 64257004 | D-Ribitol-5-phosphate cytidylyltransferase (substance) |
| 64259001 | Blood group antigen e (substance) |
| 64263008 | 3-Oxoadipate coenzyme A-transferase (substance) |
| 64267009 | Hemoglobin Saki (substance) |
| 64273005 | Human leukocyte antigen A25 (substance) |
| 64276002 | Calcium antacid (substance) |
| 64279009 | Human leukocyte antigen B13 (substance) |
| 64288000 | Oncogene protein TCL1 (substance) |
| 64291000 | Blood group antibody Kamiya (substance) |
| 64365003 | Granulopoietin (substance) |
| 64385004 | Pyridoxal oxidase (substance) |
| 64416009 | Ganglioside GM>1< (substance) |
| 64426002 | Ribonuclease alpha (substance) |
| 64436005 | Fibrinogen Giessen III (substance) |
| 64437001 | Phycocyanin (substance) |
| 64447003 | Dihydroergocristine (substance) |
| 64449000 | Dhurrin (substance) |
| 64463006 | Ethotoin (substance) |
| 64471005 | Blood group antibody Lucy (substance) |
| 64472003 | Immunoreactive parathormone (substance) |
| 64488003 | Iodinated I^125^ human serum albumin (substance) |
| 64493000 | Immunoglobulin, GM>22< allotype (substance) |
| 64494006 | Dinoseb (substance) |
| 64499001 | Blood group antibody Lu8 (substance) |
| 64505000 | Uracil phosphoribosyltransferase (substance) |
| 64507008 | Amantadine hydrochloride (substance) |
| 64511002 | Cholestanetriol 26-monooxygenase (substance) |
| 64517003 | Yersinia pestis V antigen (substance) |
| 64520006 | Protamine sulfate (substance) |
| 64527009 | Orsellinate decarboxylase (substance) |
| 64530002 | Amyl acetate (substance) |
| 64535007 | Padimate A (substance) |
| 64538009 | Iodine heptafluoride (substance) |
| 64543002 | ^178^Tungsten (substance) |
| 64547001 | Naphthalene acetamide (substance) |
| 64563009 | Oncogene protein P190, BCR-ABL (substance) |
| 64566001 | HLA-Aw19 antigen |
| 64570009 | Human leukocyte antigen B44 (substance) |
| 64601002 | Wood dust (substance) |
| 64602009 | Blood group antibody Kominarek (substance) |
| 64618003 | 2-Chloroethyl 2-(4-1,1-dimethylethyl) phenoxy-1 methylethyl ester (substance) |
| 64629004 | Antibody to hepatitis E virus (substance) |
| 64648000 | Herbicide oil (substance) |
| 64652000 | Horseradish peroxidase (substance) |
| 64659009 | Microbial metalloproteinases (substance) |
| 64669003 | Succinylsulfathiazole (substance) |
| 64686009 | Benzalkonium chloride (substance) |
| 64687000 | Halogenated hydrocarbon insecticide (substance) |
| 64699007 | Ferredoxin-nicotinamide adenine dinucleotide ^+^ reductase (substance) |
| 64709009 | Dead space air (substance) |
| 64734009 | Starch (bacterial glycogen) synthase (substance) |
| 64763007 | 2-Dehydropantoyl-lactone reductase (substance) |
| 64769006 | Hemoglobin F-Marietta (substance) |
| 64778000 | Mammary fluid (substance) |
| 64780006 | Glycerophosphoinositol glycerophosphodiesterase (substance) |
| 64783008 | Chlormequat chloride (substance) |
| 64788004 | Blood group antigen Pr^a^ (substance) |
| 64790003 | Vertebrate collagenase (substance) |
| 64796009 | Malt soup extract (substance) |
| 64797000 | Blood group antibody Emma (substance) |
| 64806009 | Retinol dehydrogenase (substance) |
| 64813009 | Aminopentamide (substance) |
| 64821003 | Isobornyl thiocyanoacetate (substance) |
| 64823000 | Blood group antibody IP>1< (substance) |
| 64827004 | Quartz (substance) |
| 64843006 | Tungsten compound (substance) |
| 64845004 | Freund antigen (substance) |
| 64846003 | i antigen |
| 64856004 | Digestive system fluid (substance) |
| 64868008 | ^115m^Cadmium |
| 64869000 | Conotoxin |
| 64871000 | Insoluble immune complex |
| 64881001 | Phosphatidyl serine (substance) |
| 64888007 | Methicillin sodium (substance) |
| 64891007 | Urea cream (substance) |
| 64893005 | Immunoglobulin, L chain, kappa (substance) |
| 64895003 | Blood group antibody R.M. (substance) |
| 64896002 | Allergenic extract (substance) |
| 64901000 | Rubidium isotope (substance) |
| 64903002 | Methylguanidinase (substance) |
| 64918001 | Human leukocyte antigen Aw43 (substance) |
| 64940005 | Ethoheptazine (substance) |
| 64974009 | Calcium isotope (substance) |
| 64991008 | Soluble berlin blue stain (substance) |
| 64993006 | Placental fluid (substance) |
| 65016007 | Tetrabromobenzoquinone (substance) |
| 65025001 | Pyridine (substance) |
| 65054007 | ^62^Zinc (substance) |
| 65070009 | L-Ascorbate peroxidase (substance) |
| 65081007 | Blood group antibody Tk (substance) |
| 65086002 | ^240^Americium (substance) |
| 65088001 | Propranolol hydrochloride (substance) |
| 65097002 | Immunoglobulin, GM>3< allotype (substance) |
| 65104003 | Furfuryl alcohol (substance) |
| 65114007 | Blood group antigen Boil (substance) |
| 65115008 | Sepia proteinase (substance) |
| 65123005 | Choline (substance) |
| 65125003 | Immunoglobulin, GM>20< allotype (substance) |
| 65134008 | Hemoglobin Athens-Ga (substance) |
| 65148008 | Xanthosine (substance) |
| 65149000 | Exhaled air (substance) |
| 65150000 | Autoantigen (substance) |
| 65151001 | Blood group antibody Bridgewater (substance) |
| 65156006 | Technetium Tc^99m^ pyrophosphate and polyphosphate (substance) |
| 65170006 | Arginine-transfer ribonucleic acid ligase (substance) |
| 65183007 | Vitamin K (substance) |
| 65216001 | Cerebrospinal fluid (substance) |
| 65222005 | Calcium aminosalicylate (substance) |
| 65227004 | Blood group antigen Gilbraith (substance) |
| 65236000 | Blood group antigen Tx (substance) |
| 65246003 | Aldicarb (substance) |
| 65248002 | Blood group antigen HLA-A8 (substance) |
| 65249005 | Terphenyl (substance) |
| 65257008 | Phosphate butyryltransferase (substance) |
| 65269000 | Blood group antibody K20 (substance) |
| 65270004 | Hydroxyacylglutathione hydrolase (substance) |
| 65282008 | Cytidine monophosphate-N-acetylneuraminate-galactosyldiacyl-glycerol alpha-2,3-sialyltransferase (substance) |
| 65283003 | Tryptophan 2-monooxygenase (substance) |
| 65285005 | Aflatoxin G (substance) |
| 65288007 | Hemoglobin Boyle Heights (substance) |
| 65302009 | Choline salicylate (substance) |
| 65311009 | ^196m^Thallium (substance) |
| 65345002 | Epoxy resin (substance) |
| 65386009 | Bocillus thermoproteolyticus neutral proteinase (substance) |
| 65395001 | Phosphoglucomutase (substance) |
| 65403003 | Novobiocin sodium (substance) |
| 65407002 | Androgen receptor (substance) |
| 65414000 | Hemoglobin Hamadan (substance) |
| 65418002 | Glucose-1-phosphate guanylyltransferase (substance) |
| 65423002 | Isosparteine (substance) |
| 65426005 | Benzaldehyde (substance) |
| 65428006 | Thyroid stimulating hormone (substance) |
| 65436002 | Light metal (substance) |
| 65445001 | Ethyl violet stain (substance) |
| 65449007 | Blood group antibody R>2<R>2<-202 (substance) |
| 65456001 | Blood group antibody Donavieski (substance) |
| 65458000 | Aminopyrine (substance) |
| 65459008 | Blood group antibody U^x^ (substance) |
| 65465008 | Fibrinogen Munich II (substance) |
| 65479000 | Inseparable antibody (substance) |
| 65480002 | Dihydroorotate dehydrogenase (substance) |
| 65485007 | Immunoglobulin, switch region (substance) |
| 65488009 | Citramalate coenzyme A-transferase (substance) |
| 65494001 | Throat sulfonamide agent (substance) |
| 65495000 | Butopyronoxyl (substance) |
| 65509001 | Fibrinogen Stony Brook (substance) |
| 65512003 | Blood group antibody Thompson (substance) |
| 65527003 | ^190m>1<^Iridium (substance) |
| 65530005 | Oil of basil (substance) |
| 65543005 | Blood group antibody Haven (substance) |
| 65555004 | 11-beta Hydroxyandrostenedione (substance) |
| 65557007 | Graphite dust (substance) |
| 65580004 | Alizarin red S stain (substance) |
| 65586005 | Phosphorus oxychloride (substance) |
| 65589003 | Blood group antibody Fy^b^ (substance) |
| 65592004 | Nutmeg oil (substance) |
| 65601005 | Hemoglobin Kempsey (substance) |
| 65639002 | UDP |
| 65640000 | SulfHb |
| 65644009 | Coke oven emission (substance) |
| 65665003 | Acylneuraminate cytidylyltransferase (substance) |
| 65669009 | Strong acid (substance) |
| 65674001 | ^190^Platinum (substance) |
| 65682001 | Proline dipeptidase (substance) |
| 65699000 | beta globulin (substance) |
| 65716002 | Blood group antigen Terry (substance) |
| 65730007 | Ponceau 3R |
| 65738000 | Coagulation factor VIIIa (substance) |
| 65741009 | Mepivacaine hydrochloride (substance) |
| 65746004 | Blood group antigen Lu5 (substance) |
| 65757009 | Non-protein nitrogen (substance) |
| 65773003 | Chloropicrin (substance) |
| 65777002 | Blood group antigen Joslin (substance) |
| 65799005 | Epiglottic mucus (substance) |
| 65802001 | Complement enzyme, active (substance) |
| 65806003 | Blood group antibody Much (substance) |
| 65826004 | Oil of rue (substance) |
| 65863008 | Pigment (substance) |
| 65868004 | Propiomazine hydrochloride (substance) |
| 65874004 | Hemoglobin Le Lamentin (substance) |
| 65887005 | Blood group antigen Jk^a^ (substance) |
| 65889008 | Hypoxanthine phosphoribosyltransferase (substance) |
| 65898006 | Bothrops atrox serine proteinase (substance) |
| 65903005 | Hemoglobin Ohio (substance) |
| 65914008 | Glyceric acid (substance) |
| 65919003 | D-Ribulokinase |
| 65923006 | Pumice (substance) |
| 65925004 | Hemoglobin F-Bonaire-GA (substance) |
| 65932008 | Carbolineum (substance) |
| 65945007 | ^88^Zirconium (substance) |
| 65948009 | Aluminum ammonium sulfate (substance) |
| 65951002 | L-Ribulose-phosphate 4-epimerase (substance) |
| 65955006 | Dihydroxyphenylalanine (substance) |
| 65972004 | Daunorubicin hydrochloride (substance) |
| 65973009 | Hemoglobin Fort Worth (substance) |
| 65982003 | Triprolidine hydrochloride (substance) |
| 65988004 | [Acyl-carrier-protein] phosphodiesterase (substance) |
| 65992006 | Streptomycin 3''-kinase (substance) |
| 66004009 | Isoetharine (substance) |
| 66015004 | Transplantation antigen (substance) |
| 66037006 | Hydroxymethylglutaryl-coenzyme A synthase (substance) |
| 66043008 | Pyruvate dehydrogenase (cytochrome) (substance) |
| 66044002 | Skin antiviral agent (substance) |
| 66086008 | Lepromin (substance) |
| 66103001 | Malyl-coenzyme A lyase (substance) |
| 66124006 | Trypsin (substance) |
| 66128009 | Creatine kinase isoenzyme, BB fraction (substance) |
| 66143006 | alpha-Methyl styrene (substance) |
| 66147007 | Lymphocyte antigen CD14 (substance) |
| 66148002 | Sabadilla (substance) |
| 66153007 | 1-Alkylglycerophosphocholine acetyltransferase (substance) |
| 66178006 | ^117m^Cadmium (substance) |
| 66194004 | myo-Inositol oxygenase (substance) |
| 66196002 | Inositol 1-alpha-galactosyltransferase (substance) |
| 66202004 | Alkenylglycerophosphocholine hydrolase (substance) |
| 66203009 | Branched-chain-amino-acid aminotransferase (substance) |
| 66209008 | Hemoglobin Montgomery (substance) |
| 66228001 | Actinocongestin (substance) |
| 66234008 | Alanine-oxomalonate aminotransferase (substance) |
| 66235009 | Oncogene protein bcl-1 (substance) |
| 66240001 | Blood group antibody Parra (substance) |
| 66263006 | Lysine racemase (substance) |
| 66290002 | Benzthiazide (substance) |
| 66296008 | Hemoglobin J-Altgeld Gardens (substance) |
| 66322002 | Dextran 40 (substance) |
| 66365001 | N-m-tolyl phthalamic acid (substance) |
| 66384003 | Isophane insulin (substance) |
| 66389008 | Magnesium oxide (substance) |
| 66395009 | Blood group antigen Mitch (substance) |
| 66396005 | Fibrinogen Zürich II (substance) |
| 66404001 | Lochia rubra (substance) |
| 66428004 | Blood group antigen Wu (substance) |
| 66431003 | Alkyl dimethyl 3,4-dichlorobenzene ammonium chloride (substance) |
| 66440004 | Human leukocyte antigen DRw8 (substance) |
| 66458005 | Thiol methyltransferase (substance) |
| 66460007 | Single stranded anti-deoxyribonucleic acid antibody (substance) |
| 66461006 | Diamine aminotransferase (substance) |
| 66465002 | Silicon isotope (substance) |
| 66472001 | Fibrinogen Parma (substance) |
| 66481007 | Semisynthetic human insulin (substance) |
| 66497002 | Blood group antibody Weeks (substance) |
| 66506002 | Peptidoglycan endopeptidase (substance) |
| 66508001 | Quinine hydrochloride (substance) |
| 66509009 | Vancomycin hydrochloride (substance) |
| 66511000 | Blood group antigen Gf (substance) |
| 66524000 | Sphingomyelin (substance) |
| 66533003 | gamma-Glutamyl hydrolase (substance) |
| 66538007 | Glucan endo-1,2-beta-glucosidase (substance) |
| 66560005 | Rubredoxin-nicotinamide adenine dinucleotide ^+^ reductase (substance) |
| 66562002 | Cigarette smoking tobacco (substance) |
| 66565000 | ^209^Bismuth (substance) |
| 66566004 | Gastrointestinal hormone receptor (substance) |
| 66573009 | Bordeaux mixture (substance) |
| 66586000 | Cadmium (substance) |
| 66587009 | Kallikrein (substance) |
| 66594007 | Phosphopentomutase (substance) |
| 66603002 | Glucagon (substance) |
| 66632004 | Lymphocyte antigen CD6 (substance) |
| 66639008 | Secobarbital sodium (substance) |
| 66644001 | Blood group antibody Sieb (substance) |
| 66653008 | Oxolinic acid (substance) |
| 66656000 | Vitamin K>1< (substance) |
| 66676006 | Vinyl carbazole (substance) |
| 66684005 | Sulfur dye (substance) |
| 66685006 | Pion (substance) |
| 66686007 | D-Arabinose dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 66687003 | Tetrahydronaphthalene (substance) |
| 66716008 | ^234^Thorium (substance) |
| 66726001 | Acetaldehyde dehydrogenase (acetylating) (substance) |
| 66733001 | Hachimycin (substance) |
| 66734007 | Nicotinamide-nucleotide amidase (substance) |
| 66741001 | Fibrinogen Marseille (substance) |
| 66753002 | Heat labile bacterial toxin (substance) |
| 66756005 | ^115^Antimony (substance) |
| 66766002 | Dimethyl acetamide (substance) |
| 66770005 | Acid phosphatase isoenzyme, prostatic fraction (substance) |
| 66781008 | Cobalt dust (substance) |
| 66796007 | Oligoclonal protein (substance) |
| 66805006 | Hemoglobin J-Antakya (substance) |
| 66811009 | Plant aldehyde oil (substance) |
| 66815000 | Blood group antigen Baumler (substance) |
| 66817008 | Vasoprotectant (substance) |
| 66820000 | Hemoglobin J-Amiens (substance) |
| 66831008 | Blood group antibody Lu3 (substance) |
| 66832001 | Blood group antibody Vw (substance) |
| 66833006 | Coagulation factor II Clamart variant (substance) |
| 66843009 | Pentobarbital sodium (substance) |
| 66849008 | Cytotoxin venom (substance) |
| 66850008 | ^96^Technetium (substance) |
| 66875007 | Surface immunoglobulin (substance) |
| 66891005 | Cytotoxic antibody (substance) |
| 66901003 | Chloroacetaldehyde (substance) |
| 66906008 | Blood group antigen VS (substance) |
| 66925006 | Copper (substance) |
| 66945003 | Phosphite salt (substance) |
| 66956003 | ^122^Iodine (substance) |
| 67007009 | Blood group antigen McCall (substance) |
| 67008004 | Roridin (substance) |
| 67011003 | Cyanohydrin beta-glucosyltransferase (substance) |
| 67014006 | Glycerol kinase (substance) |
| 67025002 | Methionyl dipeptidase (substance) |
| 67029008 | Acetophenazine maleate (substance) |
| 67036009 | Plant growth regulator (substance) |
| 67054008 | Zinc phosphide (substance) |
| 67060008 | Vitamin D>3<, phosphate ester (substance) |
| 67064004 | Human leukocyte antigen Dw4 (substance) |
| 67065003 | Serratia marcescens extracellular proteinase (substance) |
| 67079006 | Glucose (substance) |
| 67080009 | Glucuronate reductase (substance) |
| 67098008 | ^226^Actinium (substance) |
| 67100008 | Guanosine diphosphate-4-dehydro-D-rhamnose reductase (substance) |
| 67127007 | Methyl benzene (substance) |
| 67131001 | Amino-acid racemase (substance) |
| 67152009 | Hemoglobin Torino (substance) |
| 67154005 | ^66^Nickel (substance) |
| 67164001 | Lymphocyte antigen CD54 (substance) |
| 67174003 | Bronchial mucus (substance) |
| 67194007 | Syngraft (substance) |
| 67200004 | Pyrophosphate-glycerol phosphotransferase (substance) |
| 67215003 | Isoflavone O^4'^-methyltransferase (substance) |
| 67216002 | Pipazethate (substance) |
| 67218001 | Complement component C4b (substance) |
| 67221004 | Azathioprine sodium (substance) |
| 67246004 | Carcinoembryonic antigen (substance) |
| 67250006 | Blood group antibody Inaba (substance) |
| 67258004 | Anesthetic antiarrhythmic agent (substance) |
| 67265007 | Fumigant (substance) |
| 67266008 | Chromium isotope (substance) |
| 67271001 | Gene (substance) |
| 67273003 | Blood group antigen HLA-A7 (substance) |
| 67296003 | Pork insulin (substance) |
| 67324005 | Rice (substance) |
| 67339006 | Levansucrase (substance) |
| 67340008 | Hemoglobin Hiroshima (substance) |
| 67342000 | Blood group antibody Jo^a^ (substance) |
| 67345003 | Blood group antibody He (substance) |
| 67347006 | Levorphanol tartrate (substance) |
| 67355004 | Hemoglobin M-Saskatoon (substance) |
| 67366006 | Hair spray (substance) |
| 67368007 | Glycine carboxypeptidase (substance) |
| 67377000 | Pangamic acid (substance) |
| 67379002 | 2-Hexadecenal reductase (substance) |
| 67384008 | Uridine triphosphate-xylose-1-phosphate uridylyltransferase (substance) |
| 67386005 | Blood group antibody Rx (substance) |
| 67404005 | 1,2-beta-fructan 1^F^-fructosyltransferase (substance) |
| 67412002 | Phosphopyruvate carboxylase (GTP) |
| 67428007 | Benzphetamine (substance) |
| 67436003 | Blood group antibody Lu^b^ (substance) |
| 67449008 | Pyruvate synthase (substance) |
| 67451007 | Hemoglobin J-Rovigo (substance) |
| 67471003 | Jasmolin (substance) |
| 67473000 | Lithium hydroxide (substance) |
| 67485008 | Isoamylase (substance) |
| 67517005 | 25-Hydroxy ergocalciferol (substance) |
| 67518000 | ^195^Mercury (substance) |
| 67535001 | Thiamine monophosphate (substance) |
| 67538004 | Citrinin (substance) |
| 67552002 | Inorganic polysulfide compound (substance) |
| 67560001 | Polypyrrole (substance) |
| 67568008 | D-Lactate dehydrogenase (substance) |
| 67575009 | ^125m^Tellurium (substance) |
| 67584009 | Glutamate dehydrogenase (NADP+) (substance) |
| 67586006 | Nonylphenoxy P.H. ethanol (substance) |
| 67594004 | 4-Hydroxy-4-methyl-2-oxoglutarate aldolase (substance) |
| 67609008 | 8,11,14-Eicosatrienoic acid (substance) |
| 67610003 | Leukoagglutinin (substance) |
| 67618005 | Isopropyl ether (substance) |
| 67620008 | Quinoline (substance) |
| 67634008 | Hydrogenated terphenyls (substance) |
| 67636005 | Guaiacol (substance) |
| 67639003 | Sulfonmethane (substance) |
| 67650000 | Xenograft (substance) |
| 67652008 | 1-Alkyl-2-acetylglycerol cholinephospho-transferase (substance) |
| 67658007 | Transfer ribonucleic acid sulfurtransferase (substance) |
| 67659004 | Sequestered antigen (substance) |
| 67675001 | Eosinophilic chemotactic factor-anaphylaxis (substance) |
| 67686004 | Tripalmitin (substance) |
| 67687008 | 16-Hydroxysteroid epimerase (substance) |
| 67690002 | Sodium iodide I^123^ (substance) |
| 67695007 | Cytidylate kinase (substance) |
| 67713006 | Blood group antibody Le^x^ (substance) |
| 67719005 | Iodine isotope (substance) |
| 67771002 | Deoxyribonuclease II (substance) |
| 67774005 | Blood group antibody Le^a^ (substance) |
| 67785007 | Transfer ribonucleic acid (guanine-N^7^)-methyltransferase (substance) |
| 67803007 | Thiamin pyridinylase (substance) |
| 67812009 | [Pyruvate kinase] phosphatase (substance) |
| 67831003 | Hemoglobin J-Singapore (substance) |
| 67836008 | Chelidonine (substance) |
| 67844008 | 1-Methyladenosine nucleosidase (substance) |
| 67846005 | Scopoletin glucosyltransferase (substance) |
| 67866001 | Insulin (substance) |
| 67899004 | Complement component, classic pathway (substance) |
| 67903006 | D-Iditol dehydrogenase (substance) |
| 67906003 | Etiocholanolone (substance) |
| 67910000 | Hydroxylamine reductase (substance) |
| 67921009 | ^203^Bismuth (substance) |
| 67922002 | Serum (substance) |
| 67927008 | Human leukocyte antigen A29 (substance) |
| 67928003 | Suramin sodium (substance) |
| 67938008 | Amnesic shellfish poison (substance) |
| 67956008 | Neutral red stain (substance) |
| 67957004 | Vinyl toluene (substance) |
| 67958009 | Blood group antibody Towey (substance) |
| 67980007 | Amcinonide (substance) |
| 67990004 | White wine (substance) |
| 67994008 | Kynurenate-7,8-dihydrodiol dehydrogenase (substance) |
| 68005004 | Chlorflurecol (substance) |
| 68020005 | deoxy cytidine triphosphate pyrophosphatase |
| 68024001 | Cellulose acetate |
| 68039000 | beta-Naphthol (substance) |
| 68051003 | Dichloropropene (substance) |
| 68077006 | Rutin (substance) |
| 68101005 | Oxidoreductase (substance) |
| 68105001 | Decahydronaphthalene (substance) |
| 68110002 | Sphinganine kinase (substance) |
| 68117004 | Yttrium radioisotope (substance) |
| 68120007 | Adenosine monophosphate nucleosidase (substance) |
| 68132006 | N-b-bis (2-chloroethyl)-2-naphthylamine (substance) |
| 68134007 | Cytidine diphosphate diacylglycerol pyrophosphatase (substance) |
| 68144009 | Formyltetrahydrofolate dehydrogenase (substance) |
| 68149004 | Blood group antigen Tofts (substance) |
| 68153002 | ^123^Xenon (substance) |
| 68174001 | Pyrroline-2-carboxylate reductase (substance) |
| 68175000 | Complement component C3a (substance) |
| 68185004 | Hemoglobin Abruzzo (substance) |
| 68198008 | Extracellular metabolic agent (substance) |
| 68224005 | Ammonium sulfamate (substance) |
| 68238003 | ^186^Iridium (substance) |
| 68249009 | Blood group antigen Kn^a^ (substance) |
| 68263003 | Janus green B stain (substance) |
| 68277000 | Phorate (substance) |
| 68283002 | beta-Fructofuranosidase (substance) |
| 68293009 | Methenamine mandelate (substance) |
| 68296001 | 1,6-Dihydroxycyclohexa-2,4-diene-1-carboxylate dehydrogenase (substance) |
| 68310009 | Lucanthone (substance) |
| 68321000 | Perthane (substance) |
| 68326005 | Central myelin (substance) |
| 68329003 | Fuller's earth (substance) |
| 68332000 | Digoxin immune fab (substance) |
| 68334004 | Pyrophosphate salt (substance) |
| 68356001 | Chlorine compound (substance) |
| 68357005 | Sodium hexafluorosilicate (substance) |
| 68374005 | Blood group antibody Rg^a^ (substance) |
| 68379000 | Cinnamon oil (substance) |
| 68396004 | Ethyl butyl propanediol (substance) |
| 68399006 | Fibrinogen Bondy (substance) |
| 68420003 | Human leukocyte antigen Dw13 (substance) |
| 68429002 | Alanine-transfer ribonucleic acid ligase (substance) |
| 68430007 | 21-Hydroxysteroid dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 68459007 | Crystal ponceau stain (substance) |
| 68475005 | Intermediate-acting insulin (substance) |
| 68484005 | Glyceraldehyde-3-phosphate dehydrogenase (substance) |
| 68498002 | Antibody (substance) |
| 68522008 | Blood group antigen Lucy |
| 68524009 | Tragacanth (substance) |
| 68527002 | Blood group antibody S1^b^ (substance) |
| 68537007 | Anti-deoxyribonucleic acid histone antibody (substance) |
| 68540007 | Nicotine (substance) |
| 68561000 | Hemoglobin Hirose (substance) |
| 68580003 | ^59^Iron (substance) |
| 68593008 | Cytidine diphosphate abequose epimerase (substance) |
| 68615006 | Bicarbonate (substance) |
| 68617003 | N-Acetyllactosamine 3-alpha-galactosyltransferase (substance) |
| 68620006 | Phosphorylase kinase (substance) |
| 68630002 | ^125^Iodine (substance) |
| 68639001 | Blood group antibody Wade (substance) |
| 68657000 | Cytidine diphosphate glucose 4,6-dehydratase (substance) |
| 68669008 | Cyclobarbital (substance) |
| 68674000 | Folpet (substance) |
| 68680008 | Dexchlorpheniramine maleate (substance) |
| 68691001 | Sabadine |
| 68692008 | Complement component C3g |
| 68699004 | Phenylephrine bitartrate (substance) |
| 68715002 | Hexaethyl tetraphosphate (substance) |
| 68725007 | Nicotinamide adenine dinucleotide ^+^ nucleosidase (substance) |
| 68753007 | Amosite (substance) |
| 68762009 | Blood group antigen In^a^ (substance) |
| 68767003 | Blood group antibody Kp^b^ (substance) |
| 68783003 | HLA-DRw13 antigen |
| 68794004 | Uracil (substance) |
| 68803005 | 1-Pyrroline-5-carboxylate dehydrogenase (substance) |
| 68810004 | Methane monooxygenase (substance) |
| 68826003 | Allyl-alcohol dehydrogenase (substance) |
| 68831001 | Carbathiin (substance) |
| 68836006 | Phosphoadenylylsulfatase (substance) |
| 68837002 | Cadaverine (substance) |
| 68839004 | 2',3'-Cyclic-nucleotide 2'-phosphodiesterase (substance) |
| 68851002 | Lymphocyte antigen CD7 (substance) |
| 68868003 | Clostripain (substance) |
| 68871006 | Technetium isotope (substance) |
| 68909008 | Hemoglobin Nagasaki (substance) |
| 68929009 | Cadmium radioisotope (substance) |
| 68941002 | Blood group antigen Vil (substance) |
| 68945006 | TSF |
| 68967007 | Iodocholesterol I^131^ (substance) |
| 68970006 | Glycerol-3-phosphate oxidase (substance) |
| 68971005 | Coproantibody (substance) |
| 68975001 | Blood group antibody Hey (substance) |
| 68990002 | Blood group antibody Taylor (substance) |
| 68991003 | Chromous salt (substance) |
| 68992005 | Cellulose (substance) |
| 69038000 | Biliverdin (substance) |
| 69042002 | Immunoconglutinin (substance) |
| 69049006 | Blood group antibody Meteja (substance) |
| 69050006 | Physostigmine salicylate (substance) |
| 69055001 | Acetate kinase (pyrophosphate) (substance) |
| 69059007 | Cone (substance) |
| 69076006 | Strontium chloride Sr^85^ (substance) |
| 69084005 | Butilate (substance) |
| 69088008 | Hemoglobin S-Antilles (substance) |
| 69089000 | ^52^Iron (substance) |
| 69091008 | Hemoglobin Rush (substance) |
| 69095004 | Cinnamyl-alcohol dehydrogenase (substance) |
| 69108009 | Hemoglobin Parchman |
| 69118004 | Blood group antibody Greenlee (substance) |
| 69122009 | Methyl dichlorfop (substance) |
| 69133007 | Sudan IV stain (substance) |
| 69136004 | Prostaglandin PGE3 alpha (substance) |
| 69149009 | Blood group antigen Be^a^ (substance) |
| 69151008 | Glutamate formiminotransferase (substance) |
| 69169004 | Vitamin K>3< (substance) |
| 69172006 | Cyclonite (substance) |
| 69180004 | Threonine deaminase |
| 69184008 | Blood group antigen M^e^ (substance) |
| 69187001 | Pseudouridine kinase (substance) |
| 69211003 | Blood group antibody BOA 3150 (substance) |
| 69225002 | Nail polish (substance) |
| 69241001 | Butorphanol tartrate (substance) |
| 69268001 | ^131m^Tellurium (substance) |
| 69296007 | 2-Ethylhexyl-2-cyano-3,3-diphenylacrylate (substance) |
| 69298008 | Phospholipase A>2< (substance) |
| 69306002 | 6-Phytase (substance) |
| 69307006 | Heterochromatin (substance) |
| 69308001 | Vinylacetyl-CoA delta-isomerase (substance) |
| 69311000 | Immunoglobulin, Fc fragment (substance) |
| 69313002 | Fibronectin (substance) |
| 69314008 | Benzophenone (substance) |
| 69324000 | Phosphorus pentasulfide (substance) |
| 69340002 | Napropamide (substance) |
| 69342005 | Lymphocyte antigen CD27 (substance) |
| 69351002 | Methoxyphenamine (substance) |
| 69373009 | Blood group antigen Alda (substance) |
| 69411001 | Lymphocyte antigen CD11a (substance) |
| 69418007 | Platelet antigen HPA-5b (substance) |
| 69419004 | 3-Oxoacyl-acyl-carrier-protein synthase (substance) |
| 69433004 | Blood group antigen Lu7 (substance) |
| 69435006 | Blood group antibody Go^a^ (substance) |
| 69440003 | Cardiotonic agent (substance) |
| 69451003 | beta-D-Fucosidase (substance) |
| 69453000 | Hemoglobin Burke (substance) |
| 69457004 | Candida albicans aspartic proteinase (substance) |
| 69459001 | Thiamin-phosphate pyrophosphorylase (substance) |
| 69467009 | Formylaspartate deformylase (substance) |
| 69469007 | Lymphocyte antigen CD77 (substance) |
| 69473005 | Kveim-Silzbach antigen (substance) |
| 69504003 | beta-(9-Cytokinin)-alanine synthase (substance) |
| 69506001 | Oxyphenonium (substance) |
| 69507005 | Phthalic acid ester (substance) |
| 69513001 | 5-Dehydro-4-deoxyglucarate dehydratase (substance) |
| 69519002 | Ethylenediamine tetra-acetate (substance) |
| 69522000 | Pine tar (substance) |
| 69526002 | Noxious fumes (substance) |
| 69542009 | Blood group antigen Gibson (substance) |
| 69544005 | Hemoglobin Tours (substance) |
| 69553003 | Geraniol dehydrogenase (substance) |
| 69557002 | sn-Glycerol-3-phosphate 2-alpha-galactosyltransferase (substance) |
| 69563006 | Heat labile alpha>1< glycoprotein (substance) |
| 69583007 | Plant goitrogen (substance) |
| 69594006 | Dinitro-o-cyclohexyl phenol (substance) |
| 69606009 | Trimethyllysine,2-oxoglutarate dioxygenase (substance) |
| 69612004 | Fetal antigen (substance) |
| 69613009 | ^244^Plutonium (substance) |
| 69637009 | Waxes (substance) |
| 69644000 | Calcium arsenite (substance) |
| 69654001 | 3-Hydroxyaspartate aldolase (substance) |
| 69662009 | alpha Actinin |
| 69674008 | Agmatinase (substance) |
| 69680000 | Blood group antigen Co^a^ (substance) |
| 69700005 | Transfer ribonucleic acid (adenine-N^6^)-methyltransferase (substance) |
| 69703007 | Cesium radioisotope (substance) |
| 69705000 | Fibrinogen Bicêtre (substance) |
| 69719000 | Blood group antibody Le^b^ (substance) |
| 69750003 | ^63^Nickel |
| 69751004 | Galactinol-raffinose galactosyltransferase |
| 69755008 | Blood group antigen Mathison (substance) |
| 69756009 | Hemoglobin Vancouver (substance) |
| 69760007 | Imidazo pyruvic acid (substance) |
| 69764003 | (R)-3-Amino-2-methylpropionate aminotransferase (substance) |
| 69770009 | Iron radioisotope (substance) |
| 69780008 | Polynucleotide 5'-hydroxyl-kinase (substance) |
| 69783005 | Meglumine iodipamide (substance) |
| 69813006 | N-Acylglucosamine-6-phosphate 2-epimerase (substance) |
| 69814000 | Methylenetetrahydrofolate dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 69832000 | Leucocyte 17 |
| 69839009 | Iodinated I^125^ povidone (substance) |
| 69844002 | 1-Chloro-1-nitroethane (substance) |
| 69870001 | Thallium isotope (substance) |
| 69871002 | Methylchlormethyl ether (substance) |
| 69893007 | Cyanazine (substance) |
| 69899006 | Oxymorphone hydrochloride (substance) |
| 69900001 | Blood group antigen Haase (substance) |
| 69901002 | Platelet-specific antibody (substance) |
| 69904005 | 2,6-Dihydroxypyridine 3-monooxygenase (substance) |
| 69908008 | Messenger ribonucleic acid (substance) |
| 69932001 | Potassium chromate (substance) |
| 69936003 | Hemoglobin Tunis (substance) |
| 69940007 | Blood group antigen Mit (substance) |
| 69941006 | Blood group antibody Enriquez (substance) |
| 69958001 | Sodium sulfate (substance) |
| 69979001 | Blood group antibody Simon (substance) |
| 69992003 | Blood group antigen T (substance) |
| 69993008 | Mevaldate reductase (substance) |
| 69995001 | 3-Hydroxyoctanoyl-[acyl-carrier-protein]-dehydratase (substance) |
| 70001008 | Piperacetazine |
| 70012008 | L-Lactate dehydrogenase (substance) |
| 70016006 | Complementary deoxyribonucleic acid (substance) |
| 70032009 | Phosphoribosylaminoimidazole carboxylase (substance) |
| 70050002 | Hemoglobin H (substance) |
| 70059001 | Blood group antigen At^a^ (substance) |
| 70069007 | Patulin (substance) |
| 70077006 | Colony-stimulating factor, granulocyte-monocyte (substance) |
| 70078001 | Aromatic-hydroxylamine acetyltransferase (substance) |
| 70084003 | Methyl (n-amyl) ketone (substance) |
| 70086001 | Cholyl-carbon^14^ glycine (substance) |
| 70088000 | Tyrosine 2,3-aminomutase |
| 70095009 | Immunoglobulin isotype (substance) |
| 70106000 | Lipid (substance) |
| 70113000 | Branched-chain amino acid (substance) |
| 70150004 | Bile (substance) |
| 70154008 | Iodinated I^125^ sodium iodine (substance) |
| 70155009 | Immunoglobulin dimer (substance) |
| 70161007 | 3-Hydroxybutyryl-coenzyme A dehydratase (substance) |
| 70168001 | Copper sulfate |
| 70169009 | Ciclopiroxolamin |
| 70170005 | Acetylornithine deacetylase |
| 70184000 | Deoxycytidine monophosphate deaminase (substance) |
| 70198008 | Mannitol-1-phosphate dehydrogenase (substance) |
| 70203000 | Adenine (substance) |
| 70213008 | Tryptophan synthase (substance) |
| 70214002 | Hemoglobin Moskva (substance) |
| 70221002 | Phosgene (substance) |
| 70237008 | Glucosamine (substance) |
| 70251008 | Ethyl di-(p-chlorophenyl) glycolate |
| 70265005 | Lathosterol oxidase (substance) |
| 70269004 | beta-Lysine 5,6-aminomutase (substance) |
| 70271004 | Coagulation factor X Stuart variant (substance) |
| 70276009 | Dimethylpropiothetin dethiomethylase (substance) |
| 70282007 | Acetylspermidine deacetylase (substance) |
| 70288006 | Methionine (substance) |
| 70290007 | Indium compound (substance) |
| 70304009 | Blood group antigen Crawford (substance) |
| 70309004 | Calcidiol 1-monooxygenase (substance) |
| 70319005 | Cobalt fumes (substance) |
| 70335003 | Blood group antigen Bi |
| 70338001 | Nepenthes aspartic proteinase (substance) |
| 70352004 | Blood group antibody Gill (substance) |
| 70354003 | Polypeptide (substance) |
| 70365008 | ^239^Uranium (substance) |
| 70367000 | Valine decarboxylase (substance) |
| 70368005 | Guanidinoacetate methyltransferase (substance) |
| 70391009 | UDP - Uridyl diphosphate glucose |
| 70392002 | Prolactin inhibiting factor (substance) |
| 70400004 | Immunoglobulin, GM>4< allotype (substance) |
| 70403002 | Ribonucleotide (substance) |
| 70430007 | Blood group antigen Black (substance) |
| 70434003 | Complement factor Ba (substance) |
| 70438000 | ^88^Rubidium (substance) |
| 70440005 | Coagulation factor XII (substance) |
| 70444001 | Recessive gene (substance) |
| 70454002 | Prolactin (substance) |
| 70469001 | Blood group antigen L Harris (substance) |
| 70487003 | Hexosamine (substance) |
| 70489000 | Algal toxin (substance) |
| 70496003 | Lipoic acid (substance) |
| 70508008 | beta-Aspartyl-N-acetylglucosaminidase (substance) |
| 70519006 | Hemoglobin G-Philadelphia (substance) |
| 70520000 | Ponceau xylidine stain (substance) |
| 70524009 | Chloroallyl diethyldithiocarbamate (substance) |
| 70535004 | Arylamine glucosyltransferase (substance) |
| 70544003 | ^199^Gold (substance) |
| 70561000 | 2-Pivalyl-1,3- indandione (substance) |
| 70562007 | Leuprolide acetate (substance) |
| 70563002 | Blood group antibody Walin (substance) |
| 70564008 | Allantoate deiminase (substance) |
| 70565009 | Sulfur dioxygenase (substance) |
| 70566005 | Glycine-oxaloacetate aminotransferase (substance) |
| 70570002 | Sulfadoxine (substance) |
| 70584007 | Blood group antigen Cr^a^ (substance) |
| 70587000 | beta Alanine |
| 70588005 | Diacetyl reductase |
| 70592003 | 2-Nitropropane dioxygenase (substance) |
| 70597009 | Boron (substance) |
| 70608003 | Uridine diphosphate glucuronate decarboxylase (substance) |
| 70613004 | Zirconyl hydroxychloride (substance) |
| 70620006 | Plant glycoside (substance) |
| 70623008 | Fusion protein GAG-POL (substance) |
| 70643002 | Lead tetroxide (substance) |
| 70672001 | Glycerophosphocholine cholinephosphodiesterase (substance) |
| 70675004 | Lipopolysaccharide glucosyltransferase II |
| 70684004 | Oxybenzone and dioxybenzone (substance) |
| 70695005 | Dihydropyrimidinase (substance) |
| 70699004 | ^185^Tungsten (substance) |
| 70706009 | Troxerutin (substance) |
| 70724006 | Streptomycin 6-kinase (substance) |
| 70725007 | Paecilomyces varioti aspartic proteinase (substance) |
| 70726008 | Selenium compound (substance) |
| 70732003 | Trimethadione (substance) |
| 70734002 | alpha-L-Fucosidase (substance) |
| 70741008 | Blood group antigen K16 (substance) |
| 70744000 | Hemoglobin F-Jamaica (substance) |
| 70748002 | Hemosiderin (substance) |
| 70750005 | 3-Cyanoalanine hydratase (substance) |
| 70773002 | Dimethylallylcistransferase (substance) |
| 70785005 | Tryptophan-phenylpyruvate aminotransferase (substance) |
| 70787002 | Alcohol dehydrogenase (NADP+) (substance) |
| 70799009 | Pumiliotoxin B (substance) |
| 70800008 | Ecdysone oxidase (substance) |
| 70807006 | 1,2-Diacylglycerol 3-beta-galactosyltransferase (substance) |
| 70813002 | Milk (substance) |
| 70825004 | Somatomedin (substance) |
| 70828002 | Major histocompatibility complex (substance) |
| 70832008 | Immunoglobulin, GM>6< allotype (substance) |
| 70844006 | Hemoglobin Necker Enfants-Malades (substance) |
| 70846008 | Sarin (substance) |
| 70863007 | Alkylamidase (substance) |
| 70869006 | Blood group antigen Milne (substance) |
| 70886000 | Dicloxacillin sodium (substance) |
| 70888004 | Diethyl ketone (substance) |
| 70906001 | bis-(Diethylthiocarbamyl) disulfide (substance) |
| 70941002 | Chrome green (substance) |
| 70961008 | Neomycin sulfate (substance) |
| 70963006 | Antigen receptor (substance) |
| 70972003 | Active C5b6789 (substance) |
| 70990002 | Quinone (substance) |
| 71006008 | Blood group antigen Sia-b1 (substance) |
| 71012003 | Uridine diphosphate arabinose 4-epimerase (substance) |
| 71017009 | Blood group antigen Todd (substance) |
| 71024005 | Blood group antigen Rh41 (substance) |
| 71027003 | Xylose isomerase (substance) |
| 71032002 | Uridine diphosphate-N-acetylmuramate dehydrogenase (substance) |
| 71043005 | Dicyclomine hydrochloride (substance) |
| 71058002 | Myxobacter AL-l proteinase I (substance) |
| 71076009 | Strontium iodide (substance) |
| 71079002 | Blood group antigen IA (substance) |
| 71082007 | Hemoglobin O-Indonesia (substance) |
| 71108007 | Cycrimine (substance) |
| 71128006 | Molybdenum (substance) |
| 71138001 | Sulfacytine (substance) |
| 71146000 | Blood group antibody Pr>2< (substance) |
| 71152004 | ^20^Neon (substance) |
| 71159008 | Pregnanetriol (substance) |
| 71165008 | Cycloheximide (substance) |
| 71168005 | alpha,alpha-Trehalose phosphorylase (substance) |
| 71183000 | Indomethacin sodium trihydrate (substance) |
| 71185007 | Nucleoprotein (substance) |
| 71211001 | Nucleotide (substance) |
| 71227008 | Siderite (substance) |
| 71230001 | Hemoglobin Mequon (substance) |
| 71242006 | Prephenate dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 71250002 | Butethamine (substance) |
| 71251003 | ^192^Platinum (substance) |
| 71263008 | Thioethanolamine acetyltransferase (substance) |
| 71281006 | Coagulation factor X Padua 1 variant (substance) |
| 71283009 | Reduced nicotinamide adenine dinucleotide phosphate (NADPH) dehydrogenase (quinone) (substance) |
| 71288000 | Oncogene protein GP120, V-FMS (substance) |
| 71291000 | Superbine (substance) |
| 71334007 | Ethyl mercaptan (substance) |
| 71342008 | Mannan endo-1,6-beta-mannosidase (substance) |
| 71348007 | Deblocking antibody (substance) |
| 71365003 | B endorphin |
| 71368001 | Complement component C3d (substance) |
| 71370005 | Human leukocyte antigen DP (substance) |
| 71374001 | Sodium hypochlorite (substance) |
| 71380009 | Benzarone (substance) |
| 71391002 | Ethanolamine ammonia-lyase (substance) |
| 71396007 | Human leukocyte antigen B17 (substance) |
| 71411004 | Blood group antibody Dahl (substance) |
| 71415008 | Blood group antigen Wallin (substance) |
| 71417000 | Doxycycline hyclate (substance) |
| 71422000 | Clostridium perfringens toxin (substance) |
| 71423005 | Hemoglobin Queens (substance) |
| 71425003 | ^61^Copper (substance) |
| 71428001 | Oil of copaiba (substance) |
| 71430004 | Oil of pepper (substance) |
| 71437001 | Histone-lysine methyltransferase (substance) |
| 71454009 | Dimethylformamide (substance) |
| 71459004 | Fibrinogen Bern I (substance) |
| 71463006 | Polyethylene (substance) |
| 71470006 | N-Methyl-L-amino-acid oxidase (substance) |
| 71474002 | Immunoglobulin IgG3, H chain (substance) |
| 71482002 | Iron compound (substance) |
| 71494006 | Aspartate acetyltransferase (substance) |
| 71499001 | Dioscin (substance) |
| 71500005 | Hemoglobin S-Travis (substance) |
| 71522003 | ^192^Mercury (substance) |
| 71532005 | Indoleacetic acid (substance) |
| 71533000 | Pentazocine lactate (substance) |
| 71544008 | Polysaccharide (substance) |
| 71549003 | Interchromatin granule (substance) |
| 71560007 | ^129^Tellurium (substance) |
| 71561006 | Chelonitoxin (substance) |
| 71562004 | Mexicanain (substance) |
| 71563009 | Diphenoxylate hydrochloride (substance) |
| 71589009 | Benzidine (substance) |
| 71611009 | Lactate 2-monooxygenase (substance) |
| 71630009 | Coagulation factor IX Leyden variant (substance) |
| 71633006 | ^22^Sodium (substance) |
| 71636003 | Fibrinogen I^123^ (substance) |
| 71640007 | Acid phosphatase isoenzyme (substance) |
| 71647005 | ^14^Carbon (substance) |
| 71656002 | Hemoglobin Iwata (substance) |
| 71668006 | Chloroprocaine (substance) |
| 71669003 | Alkyl aryl polyether sulfonate (substance) |
| 71681004 | Blood group antigen Dugstad (substance) |
| 71686009 | Matrix of fibrocartilage (substance) |
| 71700008 | Hemoglobin J-Singa (substance) |
| 71714008 | Calcium gluceptate (substance) |
| 71726003 | Aflatoxin M (substance) |
| 71730000 | 5alpha-Hydroxysteroid dehydratase (substance) |
| 71756007 | Veratridine (substance) |
| 71763007 | Thallium (substance) |
| 71774003 | Gibberellin (substance) |
| 71789007 | Technetium (substance) |
| 71797000 | Lymphocyte antigen CD22 (substance) |
| 71805008 | Isocitrate epimerase (substance) |
| 71813009 | Methaqualone (substance) |
| 71818000 | Herbicide (substance) |
| 71823000 | Monomethyl hydrazine (substance) |
| 71845004 | Epithelial antibody (substance) |
| 71862009 | Antitoxin (substance) |
| 71916002 | Hydrastine (substance) |
| 71921004 | Hemoglobin G-Szuhu (substance) |
| 71935002 | Haemoglobin A>2< |
| 71957009 | Phloxin B stain (substance) |
| 71971001 | Corticotropin releasing factor |
| 71972008 | Blood group antibody Jc^a^ (substance) |
| 71975005 | Pyruvate kinase (substance) |
| 71976006 | Blood group antibody Lu14 (substance) |
| 71992001 | Amine ethoxylate (substance) |
| 72003002 | Biphenamine (substance) |
| 72015003 | Iodinated I^125^ albumin (substance) |
| 72024007 | Tetrahydrocannabinol (substance) |
| 72025008 | Crotamine venom (substance) |
| 72034003 | Deoxyribonucleic acid beta-glucosyltransferase (substance) |
| 72036001 | Blood group antigen Bell |
| 72069001 | Cytosine (substance) |
| 72081002 | Divinyl benzene (substance) |
| 72084005 | GMP synthase |
| 72088008 | Human leukocyte antigen Bw41 (substance) |
| 72113008 | Transcobalamin I (substance) |
| 72131009 | Silver iodide (substance) |
| 72134001 | Ankyrin (substance) |
| 72138003 | Lysine acetyltransferase (substance) |
| 72156003 | Protein-D-aspartate methyltransferase (substance) |
| 72159005 | Cyanocobalamin Co^60^ (substance) |
| 72164009 | Inositol (substance) |
| 72165005 | Antibody to hepatitis C virus (substance) |
| 72170003 | Blood group antigen Starcher (substance) |
| 72179002 | Oxybenzone (substance) |
| 72186005 | Flavin-adenine dinucleotide pyrophosphatase (substance) |
| 72192004 | (Deoxy)nucleoside phosphate kinase (substance) |
| 72233001 | Galacturonokinase (substance) |
| 72251000 | Arsenic trioxide (substance) |
| 72271009 | Blood group antigen Fuller (substance) |
| 72305003 | ^107^Cadmium (substance) |
| 72309009 | Bioflavonoid (substance) |
| 72322001 | Para-aminobenzoic acid esters in alcohol (substance) |
| 72340002 | Plotolysin toxin (substance) |
| 72341003 | Blood urea nitrogen (substance) |
| 72344006 | Sodium psylliate (substance) |
| 72358008 | Agglutinogen (substance) |
| 72359000 | Gonyautoxin (substance) |
| 72361009 | Blood group antigen Wimberly (substance) |
| 72368003 | Citrullinase (substance) |
| 72371006 | Fast violet B salt stain (substance) |
| 72380006 | Blood group antigen Vel (substance) |
| 72384002 | Alkylglycerone-phosphate synthase (substance) |
| 72387009 | Acyclovir sodium (substance) |
| 72393001 | Butyl acrylate (substance) |
| 72400009 | Blood group antibody Swietlik (substance) |
| 72433004 | 3beta-Hydroxy-4alpha-methylcholestenecarboxylate dehydrogenase (decarboxylating) (substance) |
| 72444007 | Iron-cytochrome-c reductase (substance) |
| 72453000 | Trimethylamine-N-oxide reductase (substance) |
| 72454006 | ^99m^Technetium (substance) |
| 72455007 | ^83^Rubidium (substance) |
| 72460006 | 7,8-Dihydroxykynurenate 8,8a-dioxygenase (substance) |
| 72464002 | Pantothenase (substance) |
| 72469007 | Acetazolamide sodium (substance) |
| 72499003 | Rubidium chloride (substance) |
| 72507005 | 2-Ethylmalate synthase (substance) |
| 72511004 | Fruit (substance) |
| 72520008 | p-Aminophenol (substance) |
| 72522000 | Mephenesin (substance) |
| 72526002 | Blood group antibody Hil (substance) |
| 72546007 | Hemoglobin G-Audhali (substance) |
| 72551001 | Metal fumes (substance) |
| 72559004 | Streptomyces alkalophilic keratinase (substance) |
| 72563006 | Gastrin I (substance) |
| 72571005 | Platelet antibody HPA-3 (substance) |
| 72572003 | Diamond black stain (substance) |
| 72578004 | Osmium (substance) |
| 72582002 | Hemoglobin Sassari (substance) |
| 72584001 | Human leukocyte antigen Dw5 (substance) |
| 72586004 | beta-Alanine-pyruvate aminotransferase (substance) |
| 72590002 | Cerebronic acid (substance) |
| 72602006 | Blood group antigen ENKT (substance) |
| 72625007 | 3,4-Dihydroxyphenylacetate 2,3-dioxygenase (substance) |
| 72636000 | Pinene (substance) |
| 72675009 | Simple physiological organic compound (substance) |
| 72685005 | Blood group antigen Maliff (substance) |
| 72717003 | Magnesium (substance) |
| 72737004 | (S)-Tricyclamol (substance) |
| 72745009 | Flavodoxin |
| 72748006 | Blood group antibody Mansfield (substance) |
| 72750003 | Nucleoside-phosphate kinase (substance) |
| 72752006 | Atracurium besylate (substance) |
| 72763009 | Hydriodic acid (substance) |
| 72766001 | 2',3'-Cyclic-nucleotide 3'-phosphodiesterase (substance) |
| 72770009 | Metoprolol tartrate (substance) |
| 72772001 | Blood group antigen Boston (substance) |
| 72773006 | Linuron (substance) |
| 72774000 | Potassium p-aminosalicylate (substance) |
| 72778002 | Tyrosine-transfer ribonucleic acid ligase (substance) |
| 72784004 | Lactated potassic saline (substance) |
| 72785003 | Nasal antibiotic (substance) |
| 72802008 | Acetal (substance) |
| 72805005 | Chymopapain (substance) |
| 72808007 | Trolamine salicylate (substance) |
| 72812001 | Aspartate 4-decarboxylase (substance) |
| 72822007 | Homogentisic acid oxidase |
| 72833005 | Human leukocyte antigen A30 (substance) |
| 72835003 | ^119m^Tin (substance) |
| 72840006 | Valine (substance) |
| 72843008 | 2-Hydroxy-2,2-bis-(4-chlorophenyl) ethyl acetate (substance) |
| 72844002 | ^187^Platinum (substance) |
| 72857005 | Methitural (substance) |
| 72869002 | Upper respiratory fluids (substance) |
| 72873004 | Blood group antigen I^T^P>1< (substance) |
| 72886008 | Blood group antigen B 9724 (substance) |
| 72887004 | Pirimicarb (substance) |
| 72890005 | Reduced nicotinamide adenine dinucleotide (phosphate) dehydrogenase (quinone) (substance) |
| 72891009 | Cytophilic antibody |
| 72909000 | Tumor-associated antigen (substance) |
| 72926006 | Human leukocyte antigen Bw48 (substance) |
| 72927002 | Radon (substance) |
| 72929004 | Phosphate acetyltransferase (substance) |
| 72949008 | Pepsin C (substance) |
| 72955003 | Acetate-coenzyme A ligase (substance) |
| 72984007 | Muscarinic receptor (substance) |
| 72989002 | Blood group antibody Th^a^ (substance) |
| 72990006 | Alveolar air (substance) |
| 72993008 | Tributyrase |
| 73010004 | Methyl silicate (substance) |
| 73029005 | Fibrinogen Baltimore IV (substance) |
| 73031001 | alpha Ketoglutarate (substance) |
| 73040002 | Vanadium pentoxide fumes (substance) |
| 73065000 | Gallium^67^ citrate (substance) |
| 73076001 | Emylcamate (substance) |
| 73084002 | Ethylene glycol ester (substance) |
| 73085001 | Chlordane (substance) |
| 73106004 | Cycle-phase nonspecific agent (substance) |
| 73126000 | Digalloyl trioleate (substance) |
| 73127009 | Hemoglobin Bougardirey-Mali (substance) |
| 73129007 | ^131m^Xenon (substance) |
| 73131003 | Carotene (substance) |
| 73135007 | Soluble antigen (substance) |
| 73187006 | 3,5,3'5' Tetraiodothyronine |
| 73195005 | Blood group antibody HLA-B15 (substance) |
| 73196006 | Manganese compound (substance) |
| 73204005 | Myosin ATPase |
| 73213007 | Chlorphenesin carbamate (substance) |
| 73236003 | Hemoglobin Detroit (substance) |
| 73246001 | Streptomycin sulfate (substance) |
| 73251007 | Auramine G stain (substance) |
| 73254004 | Cytidine monophosphate-N-acetylneuraminate-beta-galactoside alpha-2,6-sialyltransferase (substance) |
| 73267001 | 1-1-bis-(p-chlorophenyl)-2-Nitrobutane |
| 73268006 | Para-aminobenzoic acid and ethyl alcohol (substance) |
| 73276008 | Staphylococcus aureus antibody test kit (substance) |
| 73279001 | 2-Dehydropantoate reductase (substance) |
| 73300004 | Hemoglobin F-Tokyo (substance) |
| 73314004 | Blood group antibody Wolfe (substance) |
| 73334003 | Scillaren A (substance) |
| 73347008 | Blood group antibody JMH (substance) |
| 73353008 | ^54^Manganese (substance) |
| 73360002 | Hemoglobin M-Hyde Park (substance) |
| 73362005 | Blood group antigen Rh37 (substance) |
| 73377002 | Propyl diethyl succinamate (substance) |
| 73386007 | Carbofuran (substance) |
| 73388008 | 1,3-beta-Glucan phosphorylase (substance) |
| 73389000 | Blood group antigen Groslouis (substance) |
| 73393006 | Oil of balm (substance) |
| 73404007 | Cyanamide compound (substance) |
| 73407000 | Yohimbine (substance) |
| 73417005 | Zetekitoxin (substance) |
| 73421003 | Fusel oil (substance) |
| 73427004 | Cholesterol ester (substance) |
| 73434002 | Fonofos (substance) |
| 73436000 | Lergotrile mesylate (substance) |
| 73440009 | Methyl chloro methyl ether (substance) |
| 73444000 | Procaine hydrochloride (substance) |
| 73461002 | Fibrinogen London II (substance) |
| 73469000 | Radium (substance) |
| 73476005 | Mipafox (substance) |
| 73520004 | Blood group antigen Bregi (substance) |
| 73522007 | ^105^Ruthenium (substance) |
| 73537006 | Purinergic receptor (substance) |
| 73553009 | Rosemary oil (substance) |
| 73559008 | Dialkyl dimethyl ammonium chloride (substance) |
| 73563001 | Hexose-1-phosphate guanylyltransferase (substance) |
| 73567000 | Human leukocyte antigen DQw (substance) |
| 73579000 | Carbidopa (substance) |
| 73586008 | L-3-Cyanoalanine synthase (substance) |
| 73591009 | Cytochalasin (substance) |
| 73596004 | 2-Amino-5-nitrothiazole (substance) |
| 73606003 | Gallate 1-beta-glucosyltransferase (substance) |
| 73613003 | Orotate reductase (reduced nicotinamide adenine dinucleotide) |
| 73628003 | Progesterone 11alpha-monooxygenase (substance) |
| 73637003 | Blood group antigen B 7358 (substance) |
| 73640003 | ^188^Iridium (substance) |
| 73656008 | Blood group antibody Langer (substance) |
| 73661005 | Hepatitis B surface antigen subtype ayw (substance) |
| 73667009 | N^6^-Acetyl-beta-lysine aminotransferase (substance) |
| 73680007 | Oil of levant wormseed (substance) |
| 73685002 | Thallous chloride Tl^201^ (substance) |
| 73694008 | Blood group antibody A (substance) |
| 73708009 | Diphenylchloroarsine (substance) |
| 73709001 | Blood group antibody hr^B^ (substance) |
| 73710006 | Blood group antibody K22 (substance) |
| 73717009 | Muconate cycloisomerase (substance) |
| 73722009 | Dibasic potassium phosphate (substance) |
| 73723004 | Estriol (substance) |
| 73734001 | ^8^Helium (substance) |
| 73741007 | Zearalenone (substance) |
| 73743005 | Oil of chamomile, German (substance) |
| 73745003 | Iodinated I^125^ oleic acid and triolein (substance) |
| 73748001 | alpha Ketobutyric acid (substance) |
| 73755004 | Blood group antigen Neut (substance) |
| 73758002 | ^117^Indium (substance) |
| 73778005 | Hemoglobin M-Boston (substance) |
| 73794003 | Folylpolyglutamate synthase (substance) |
| 73801006 | Activated factor VII |
| 73803009 | Glaucarubin (substance) |
| 73827006 | Econazole nitrate (substance) |
| 73828001 | Bilirubin-albumin complex (substance) |
| 73838006 | Phosphatidyl myo-inositol alpha-mannosyltransferase (substance) |
| 73842009 | Thymic ectopic endocrine substance (substance) |
| 73846007 | Blood group antigen RASM (substance) |
| 73858007 | Mandelate racemase (substance) |
| 73875001 | Uridine diphosphate glucuronate 5'-epimerase (substance) |
| 73880005 | Ribonuclease III (substance) |
| 73892005 | Carmine stain (substance) |
| 73909007 | Trifluoromonobromomethane (substance) |
| 73916008 | 5-Hydroxy tryptophan |
| 73923009 | Trinitrophenylmethylnitramine (substance) |
| 73925002 | ^152^Gadolinium (substance) |
| 73941001 | Chelated calcium (substance) |
| 73946006 | Phenylephrine hydrochloride (substance) |
| 73971009 | Dihydroorotate oxidase (substance) |
| 73980009 | Blood group antigen Rh29 (substance) |
| 73987007 | Oncogene (substance) |
| 73991002 | Connective tissue protein (substance) |
| 73992009 | 1-Alkylglycerophosphocholine acyltransferase (substance) |
| 74000003 | Lead chromate |
| 74002006 | Gliadin antibody (substance) |
| 74014003 | Phenylalanine ammonia-lyase (substance) |
| 74027004 | Protocatechuate 4,5-dioxygenase (substance) |
| 74032003 | Steroid 17-alpha-monooxygenase (substance) |
| 74054001 | Sodium 2,4-dichlorophenoxyethyl sulfate (substance) |
| 74055000 | Plant ketone oil (substance) |
| 74064005 | Blood group antibody JAL (substance) |
| 74075009 | Americium radioisotope (substance) |
| 74085005 | L-Fuculose-phosphate aldolase (substance) |
| 74090008 | Dimozide (substance) |
| 74124009 | Alpha-1,4-Glucan-protein synthase (adenosine diphosphate-forming) (substance) |
| 74130009 | ^71^Germanium (substance) |
| 74131008 | 4-Deoxy-L-threo-5-hexosulose-uronate ketol-isomerase (substance) |
| 74138002 | Interleukin-11 (substance) |
| 74143009 | Lysine 2-monooxygenase (substance) |
| 74144003 | Blood group antigen Sj (substance) |
| 74145002 | Carnitine decarboxylase (substance) |
| 74149008 | Blood group antibody Boldog (substance) |
| 74171003 | 1,1-Dimethylhydrazine (substance) |
| 74199007 | Galactosylceramide sulfotransferase (substance) |
| 74209006 | Hemoglobin Aichi (substance) |
| 74210001 | I-J region, major histocompatibility complex (substance) |
| 74237004 | Atropine sulfate (substance) |
| 74242007 | Food starch (substance) |
| 74243002 | Prostaglandin-D>2< 11-ketoreductase (substance) |
| 74271008 | Formaldehyde dehydrogenase (glutathione) (substance) |
| 74273006 | Cocaine hydrochloride (substance) |
| 74292008 | Blood group antibody Bullock (substance) |
| 74306001 | Aspartate racemase (substance) |
| 74330004 | Betaine-aldehyde dehydrogenase (substance) |
| 74374002 | Blood group antibody Th (substance) |
| 74405003 | Hemoglobin G-Waimanalo (substance) |
| 74407006 | Hemoglobin Bethesda (substance) |
| 74412007 | Blood group antibody Gero (substance) |
| 74420009 | Galactosylgalactosylglucosylceramide beta-D-acetyl-galactosaminyltransferase (substance) |
| 74426003 | Hemoglobin I (substance) |
| 74452009 | ^248^Californium (substance) |
| 74482003 | Lymphocyte antigen CD73 (substance) |
| 74483008 | Urethral secretion (substance) |
| 74484002 | Blood group antibody McKenney (substance) |
| 74505001 | Hemoglobin Savannah (substance) |
| 74510002 | Blood group antigen Xg^a^ (substance) |
| 74515007 | Hemoglobin Port Phillip (substance) |
| 74521006 | Deoxyribonucleic acid-directed ribonucleic acid polymerase (substance) |
| 74523009 | Sulfadiazine (substance) |
| 74526001 | D-Octopine dehydrogenase (substance) |
| 74554008 | Iodophthalein (substance) |
| 74564004 | Argininosuccinate lyase (substance) |
| 74567006 | Blood group antibody Bg^a^ (substance) |
| 74586003 | Streptococcus toxin (substance) |
| 74589005 | Chlormerodrin (substance) |
| 74600002 | Bisacodyl tannex (substance) |
| 74605007 | Triphosphatase (substance) |
| 74616000 | Sweat (substance) |
| 74623004 | Hemoglobin Icaria (substance) |
| 74628008 | Hydrolase (substance) |
| 74634001 | Pituitary pars intermedia colloid (substance) |
| 74639006 | D-Alanine-poly(phosphoribitol) ligase (substance) |
| 74640008 | Mevalonate kinase (substance) |
| 74643005 | Malate oxidase (substance) |
| 74646002 | ^129^Barium (substance) |
| 74652001 | Blood group antigen K (substance) |
| 74656003 | ^177^Tantalum (substance) |
| 74661001 | Blood group antibody c-like (substance) |
| 74665005 | Aluminum welding fumes (substance) |
| 74678005 | (R)-2-Methylmalate dehydratase (substance) |
| 74684008 | ^182^Osmium (substance) |
| 74690007 | Diiodophenylpyruvate reductase (substance) |
| 74700009 | Fibrinogen Homberg II (substance) |
| 74713003 | Thiopropazate (substance) |
| 74718007 | Zinc arsenate (substance) |
| 74719004 | ^99m^Rhodium (substance) |
| 74722002 | Rectal contents (substance) |
| 74727008 | Hydroxyproline (substance) |
| 74750002 | Tetrachloronaphthalene (substance) |
| 74755007 | Immunoglobulin IgG2, H chain (substance) |
| 74794008 | Exodeoxyribonuclease (Lambda-induced) (substance) |
| 74801000 | Sugar (substance) |
| 74804008 | 3-Hydroxybenzoate 4-monooxygenase (substance) |
| 74826009 | Hemoglobin Randwick (substance) |
| 74835002 | Phosphoserine phosphatase (substance) |
| 74849006 | Aspartoacylase (substance) |
| 74860002 | Citrate coenzyme A-transferase (substance) |
| 74866008 | Deoxycytidylic acid (substance) |
| 74868009 | Dihydrouracil dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 74880001 | Yellow ointment (substance) |
| 74889000 | Immunoglobulin M (substance) |
| 74897007 | Bromine trifluoride (substance) |
| 74905005 | Ethyl morphine (substance) |
| 74913006 | Pelletierine (substance) |
| 74916003 | Inorganic arsenic (substance) |
| 74941005 | Lactaldehyde reductase (DADPH) (substance) |
| 74947009 | Gaseous substance (substance) |
| 74950007 | Apomorphine hydrochloride (substance) |
| 74959008 | Protein disulfide-isomerase (substance) |
| 74979000 | Anthranilate 3-monooxygenase (substance) |
| 74981003 | Lewisite (substance) |
| 74985007 | Glucokinase (substance) |
| 74993007 | Low molecular weight kininogen (substance) |
| 74994001 | Jkab antigen |
| 74997008 | Glucose dehydrogenase (substance) |
| 75025002 | Adrenal medullary hormone (substance) |
| 75026001 | Fluorine monoxide (substance) |
| 75034007 | Blood group antigen BR 726750 (substance) |
| 75044009 | Sisal fiber (substance) |
| 75055009 | Nucleoside-triphosphate-hexose-1-phosphate nucleotidyltransferase (substance) |
| 75062000 | 2-Oxoaldehyde dehydrogenase (substance) |
| 75064004 | Plasmin inhibitor (substance) |
| 75081008 | Candida lipolytica serine proteinase (substance) |
| 75092009 | Histamine H1 receptor (substance) |
| 75097003 | beta-Glucuronidase (substance) |
| 75115009 | Fluoxetine hydrochloride (substance) |
| 75139004 | Auxin B (substance) |
| 75153004 | Blood group antigen Gerhany (substance) |
| 75163007 | 2-Methylcitrate synthase (substance) |
| 75175002 | Oil of cascarilla (substance) |
| 75197000 | Ytterbium isotope (substance) |
| 75214004 | Platelet antibody HPA-2b (substance) |
| 75215003 | Blood group antigen AnWj (substance) |
| 75225008 | Phosphoglucomutase (glucose-cofactor) (substance) |
| 75228005 | Blood group antibody Vienna (substance) |
| 75239008 | 3-Hydroxyacyl-coenzyme A dehydrogenase (substance) |
| 75247008 | Penicillin G benzathine (substance) |
| 75265007 | Cytidine (substance) |
| 75268009 | Mesoridazine besylate (substance) |
| 75272008 | Aldehyde dehydrogenase [NAD(P)+] |
| 75274009 | Fumarate reductase (NADH) |
| 75277002 | Oncogene protein H-RAS (substance) |
| 75284005 | Glutamate dehydrogenase (substance) |
| 75285006 | D-Arabinokinase (substance) |
| 75288008 | Cuprous salt (substance) |
| 75289000 | Fusarinine-C ornithinesterase (substance) |
| 75298002 | Proline-transfer ribonucleic acid ligase (substance) |
| 75322009 | Blood group antigen Arun (substance) |
| 75327003 | Xylometazoline hydrochloride (substance) |
| 75341007 | Ethacrynate sodium (substance) |
| 75348001 | 4-Androstene-3,17-dione monooxygenase (substance) |
| 75359005 | Timolol maleate (substance) |
| 75362008 | Tetrachloroethylene (substance) |
| 75363003 | Verrucarin (substance) |
| 75368007 | 4-Hydroxyphenylpyruvate dioxygenase (substance) |
| 75371004 | Theobromine (substance) |
| 75384008 | Hemoglobin Volga (substance) |
| 75399008 | Citric acid (substance) |
| 75405006 | 5-Aminopentanamidase (substance) |
| 75417008 | Cyclopiazonic acid (substance) |
| 75421001 | Triose-phosphate isomerase (substance) |
| 75466005 | Alkyl naphthyl methyl pyridinium chloride (substance) |
| 75476008 | Bovine growth hormone (substance) |
| 75495001 | Dimethylbenzene (substance) |
| 75512004 | Hemoglobin City of Hope |
| 75520002 | Hemoglobin Brigham (substance) |
| 75536000 | Metaldehyde (substance) |
| 75550005 | Chitin deacetylase (substance) |
| 75553007 | Protease inhibitor venom (substance) |
| 75560001 | 1-Nitropropane (substance) |
| 75561002 | Dihydro-beta-ergocryptine (substance) |
| 75563004 | alpha-1,3-Mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase (substance) |
| 75574008 | 42-kDa Protein (substance) |
| 75590008 | Liquefied petroleum gas (substance) |
| 75604003 | ^105m^Rhodium (substance) |
| 75619002 | Somatotropin binding globulin (substance) |
| 75624004 | Aluminum-based antacid (substance) |
| 75627006 | Insect repellent (substance) |
| 75635009 | Urobilin (substance) |
| 75645006 | Butaperazine (substance) |
| 75665004 | Monosodium glutamate (substance) |
| 75666003 | Blood group antibody M>2< (substance) |
| 75678004 | ^206^Bismuth (substance) |
| 75696008 | ^45^Titanium (substance) |
| 75698009 | Hemoglobin F-Urumqi (substance) |
| 75701001 | Deoxynucleotide 3'-phosphatase (substance) |
| 75725009 | Hydroxyglutamate decarboxylase (substance) |
| 75735003 | Blood group antigen M1^a^ (substance) |
| 75750007 | Escherichia coli antigen test kit (substance) |
| 75777003 | Cytokine |
| 75799006 | Lysine (substance) |
| 75808003 | Complement component C3b (substance) |
| 75811002 | Human leukocyte antigen A26 (substance) |
| 75812009 | Blood group antibody Wr^a^ (substance) |
| 75815006 | Zinc undecylenate (substance) |
| 75816007 | Blood group antibody f (substance) |
| 75819000 | Blood group antigen P^k^ (substance) |
| 75820006 | Blood group antibody C^w^ (substance) |
| 75828004 | Creatine kinase (substance) |
| 75839001 | ^77^Arsenic (substance) |
| 75840004 | Coagulation factor XIIa (substance) |
| 75842007 | Azobenzene (substance) |
| 75849003 | 3-Hydroxy-2-methylpyridine-4,5-dicarboxylate 4-decarboxylase (substance) |
| 75850003 | L-Idonate dehydrogenase (substance) |
| 75861006 | Hemoglobin Okazaki (substance) |
| 75871008 | Argininosuccinic acid (substance) |
| 75874000 | Krypton radioisotope (substance) |
| 75876003 | Sodium alginate (substance) |
| 75925000 | Vimentin (substance) |
| 75951003 | Iodine monobromide (substance) |
| 75956008 | Hematein stain (substance) |
| 75966000 | Steroid-lactonase (substance) |
| 75967009 | ^92^Strontium (substance) |
| 75982004 | N-Acetyl-beta-glucosaminidase (substance) |
| 75989008 | Pepsin B (substance) |
| 75999003 | Diiodotyrosine aminotransferase (substance) |
| 76001002 | Pyronine B stain (substance) |
| 76002009 | Fibrinogen Vancouver (substance) |
| 76003004 | Triiodobenzoic acid (substance) |
| 76004005 | Dioxybenzone (substance) |
| 76008008 | Blood group antibody Or^a^ (substance) |
| 76044003 | Nasal mucus (substance) |
| 76048000 | Azocarmine G (GX) stain (substance) |
| 76071003 | Blood group antigen Kuhn (substance) |
| 76088005 | alpha-L-Rhamnosidase (substance) |
| 76128005 | Antibody to hepatitis B core antigen, immunoglobulin G type (substance) |
| 76134003 | Neurotensin (substance) |
| 76136001 | Antibody to antigen in LW blood group system (substance) |
| 76150006 | Bacteriorhodopsin (substance) |
| 76159007 | ^193^Mercury (substance) |
| 76176006 | Acrolein phenylhydrazine (substance) |
| 76178007 | Mercuric cyanide (substance) |
| 76190009 | Talbutal (substance) |
| 76198002 | Ammonium hydroxide (substance) |
| 76213002 | Exhaust fumes (substance) |
| 76239004 | Hemoglobin San Diego (substance) |
| 76250001 | Beta lysin (substance) |
| 76252009 | Blood group antibody Lan (substance) |
| 76269006 | Ferroxidase |
| 76283008 | Cytisine (substance) |
| 76297000 | Ethanolamine-phosphate cytidylyltransferase (substance) |
| 76300005 | Guanosine triphosphate pyrophosphokinase (substance) |
| 76320006 | Fibrinogen London IV (substance) |
| 76325001 | Phosphoribosylaminoimidazolecarboxamide formyltransferase (substance) |
| 76370009 | Nomadic nitrogen (substance) |
| 76389009 | Phosphomethylpyrimidine kinase (substance) |
| 76411003 | Platelet antigen HPA-5a (substance) |
| 76421006 | Nabam (substance) |
| 76439002 | Fat red 7B stain (substance) |
| 76442008 | Oxammonium hydrochloride |
| 76448007 | Phosphoglycerate phosphatase (substance) |
| 76470005 | Flavonoid 3'-monooxygenase (substance) |
| 76488002 | Hemoglobin Camperdown (substance) |
| 76501008 | Pyrogallol (substance) |
| 76506003 | Fibrinogen Munich I (substance) |
| 76525000 | Ephedrine sulfate (substance) |
| 76526004 | ^194^Mercury (substance) |
| 76527008 | Sodium radioisotope (substance) |
| 76533004 | Mustard gas (substance) |
| 76557004 | Hemoglobin C-Georgetown (substance) |
| 76560006 | Ribulose-bisphosphate carboxylase (substance) |
| 76575003 | Podophyllotoxin (substance) |
| 76587005 | Ganciclovir sodium (substance) |
| 76592007 | Monoterpenyl-pyrophosphatase (substance) |
| 76595009 | Geranyltranstransferase (substance) |
| 76596005 | N-Acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase (substance) |
| 76600000 | ^102^Rhodium (substance) |
| 76605005 | Biebrich scarlet stain (substance) |
| 76607002 | Blood group antibody Bx^a^ (substance) |
| 76613006 | Glycidol (substance) |
| 76617007 | Ferrous chloride (substance) |
| 76622007 | Alternansucrase (substance) |
| 76633005 | Fast red TR salt stain (substance) |
| 76638001 | N-Acylglucosamine 2-epimerase (substance) |
| 76639009 | Chorionic fluid (substance) |
| 76643008 | Isopentenyladenosine (substance) |
| 76644002 | Antipyretic (substance) |
| 76645001 | Prodigiosin (substance) |
| 76655002 | Methylene chloride (substance) |
| 76669002 | Cellobiose epimerase (substance) |
| 76672009 | Cardiac lipoprotein (substance) |
| 76674005 | Oil of fleabane (substance) |
| 76688009 | Blood group antibody K19 (substance) |
| 76698003 | Immunostimulating conjugate antigen (substance) |
| 76701006 | Pseudogene (substance) |
| 76711004 | Adenosine triphosphate (substance) |
| 76716009 | Membrane-bound antibody (substance) |
| 76721007 | Blood group antigen Yh^a^ (substance) |
| 76728001 | Guanosine diphosphate mannose dehydrogenase |
| 76731000 | Native deoxyribonucleic acid (DNA) antibody |
| 76734008 | Blood group antigen Dalman (substance) |
| 76736005 | Perinucleolar chromatin (substance) |
| 76743004 | ^99^Technetium (substance) |
| 76767007 | Peyote agent (substance) |
| 76770006 | N-Acetylgalactosamine-6-sulfatase (substance) |
| 76781009 | Ketone body (substance) |
| 76787008 | Tridihexethyl chloride (substance) |
| 76829000 | Plant pyrrolizidine alkaloid (substance) |
| 76861001 | Laminaribiose phosphorylase (substance) |
| 76874007 | Blood group antibody Berrio (substance) |
| 76881000 | Borate decahydrate (substance) |
| 76885009 | Bleach (substance) |
| 76897005 | Blood group antibody Tc^c^ (substance) |
| 76898000 | Phenobarbital sodium (substance) |
| 76904007 | ^75^Germanium (substance) |
| 76907000 | Dodecenoyl-coenzyme A delta-isomerase (substance) |
| 76918000 | Human leukocyte antigen Bw53 (substance) |
| 76925007 | Alkali blue 5B (4B) stain (substance) |
| 76958003 | Blood group antibody Le^d^ (substance) |
| 76964005 | Blood group antigen Welsh |
| 76965006 | Blood group antigen Inaba |
| 76977001 | Aminopeptidase (human liver) (substance) |
| 76979003 | Sugar-1-phosphate nucleotidyltransferase (substance) |
| 77001006 | Protein-disulfide reductase (glutathione) (substance) |
| 77004003 | ^18^Fluorine (substance) |
| 77010003 | Blood group antigen BLe^d^ (substance) |
| 77012006 | Amniotic fluid (substance) |
| 77014007 | Fixed oil (substance) |
| 77023005 | Cardiac muscle antibody (substance) |
| 77025003 | Pentachlorophenol (substance) |
| 77033002 | Diaminohydroxyphosphoribosylaminopyrimidine deaminase (substance) |
| 77036005 | 2,4,5-Trimethoxyamphetamine (substance) |
| 77037001 | Decylcitrate synthase (substance) |
| 77042009 | Methyl mercaptan (substance) |
| 77043004 | Ethyl nitrite (substance) |
| 77073008 | Nile blue stain (substance) |
| 77079007 | Hemoglobin G-Honolulu (substance) |
| 77089006 | Rheumatoid factor (substance) |
| 77101008 | Blood group antibody Mi^a^ (substance) |
| 77118007 | Methyl ethyl ketone (substance) |
| 77124001 | Hemoglobin Lyon (substance) |
| 77132009 | Rocket fuel (substance) |
| 77136007 | alpha-Melanocyte stimulating hormone (substance) |
| 77148005 | Blood group antigen Cooper (substance) |
| 77160006 | Private blood group antigen (substance) |
| 77168004 | Phosphoribosylformylglycinamidine synthase (substance) |
| 77190004 | Hemoglobin F-Victoria Jubilee (substance) |
| 77192007 | Abrin (substance) |
| 77200000 | Endo-1,4-beta-xylanase (substance) |
| 77210009 | Guanosine monophosphate reductase (substance) |
| 77222007 | Spiperone (substance) |
| 77242003 | 4-Hydroxyphenylacetate 3-monooxygenase (substance) |
| 77245001 | 8-Hydroxyquinoline (substance) |
| 77247009 | 3-Phytase (substance) |
| 77249007 | Phthalic anhydride (substance) |
| 77275006 | Blood group antibody Big (substance) |
| 77313009 | Technetium Tc^99m^ exametazime (substance) |
| 77314003 | Serine carboxypeptidase (substance) |
| 77315002 | Antigen in LW blood group system (substance) |
| 77321003 | Hb 5(A2), Glu-gly |
| 77322005 | 2-Oxoisovalerate dehydrogenase (lipoamide) |
| 77328009 | Microbial serine proteinases (substance) |
| 77339007 | Hemoglobin Ube-2 (substance) |
| 77347007 | alpha-1,6-Mannosyl-glycoprotein beta-1,2-N-acetylglucosaminyltransferase (substance) |
| 77353007 | Fenoprofen calcium (substance) |
| 77370004 | Lactic acid (substance) |
| 77387002 | 2-Acylglycerophosphocholine acyltransferase (substance) |
| 77394004 | Cyclobutane |
| 77400002 | Territrem (substance) |
| 77404006 | Homoserine (substance) |
| 77409001 | Intramitochondrial ferritin (substance) |
| 77431009 | Potassium nitrate (substance) |
| 77433007 | Fullerene (substance) |
| 77438003 | C1q complement receptor (substance) |
| 77454000 | Mannoheptulose (substance) |
| 77473001 | Hemoglobin Contaldo |
| 77481000 | Pentamidine diisothionate (substance) |
| 77487001 | Blood group antibody VA (substance) |
| 77496001 | gamma Benzene hexachloride (substance) |
| 77499008 | Very high density lipoprotein (substance) |
| 77504008 | Fatty-acyl-coenzyme A synthase (substance) |
| 77510008 | Indium^113^ oxoquinoline white blood cell label |
| 77512000 | Blood group antibody HLA-B12 (substance) |
| 77515003 | Curare (substance) |
| 77523001 | Microbody matrix (substance) |
| 77525008 | B cell antibody (substance) |
| 77530007 | (S)-2-Methylmalate dehydratase (substance) |
| 77536001 | Dinocap (substance) |
| 77537005 | Blood group antigen Truax (substance) |
| 77544001 | Nicotine polacrilex (substance) |
| 77557009 | Lymphocyte antigen CD41b (substance) |
| 77582009 | Fibrinogen Nijmegen (substance) |
| 77586007 | D-Arabinose dehydrogenase (substance) |
| 77594000 | 2-N-dibutylamino-ethanol (substance) |
| 77597007 | 1,4-beta-D-Xylan synthase (substance) |
| 77610004 | 1,4-Lactonase (substance) |
| 77611000 | Inorganic dust (substance) |
| 77617001 | Hemoglobin Olomouc (substance) |
| 77625004 | Glycerol 2-phosphatase (substance) |
| 77632008 | Quinidine gluconate (substance) |
| 77662002 | Immunoprecipitate (substance) |
| 77671006 | Antidiuretic hormone (substance) |
| 77673009 | Norepinephrine bitartrate (substance) |
| 77683008 | Amygdalin (substance) |
| 77703004 | Amphotericin B (substance) |
| 77710005 | Plasmalogen (substance) |
| 77722008 | Poultry bone (substance) |
| 77729004 | Tetrasodium pyrophosphate (substance) |
| 77752000 | Hemoglobin K-Cameroon (substance) |
| 77756002 | L-Ascorbate-cytochrome-b>5< reductase (substance) |
| 77760004 | Neotran (substance) |
| 77762007 | Desulfoheparin sulfotransferase (substance) |
| 77764008 | Guanabenz acetate (substance) |
| 77767001 | Anti viral antibody (substance) |
| 77774006 | Blood group antibody Stowe (substance) |
| 77793008 | Isoamyl acetate (substance) |
| 77799007 | Aluminum phenolsulfonate (substance) |
| 77812005 | C3a complement receptor (substance) |
| 77824003 | Coprostanol (substance) |
| 77828000 | myo-Inositol-1-phosphate synthase (substance) |
| 77829008 | Hypotaurine dehydrogenase (substance) |
| 77832006 | Acetyl-coenzyme A carboxylase (substance) |
| 77847002 | Ceramide glucosyltransferase (substance) |
| 77849004 | Potassium bicarbonate (substance) |
| 77850004 | Organic arsenic (substance) |
| 77864004 | Antioncogene (substance) |
| 77901009 | Cycloartenol synthase (substance) |
| 77907008 | Blood group antibody To^a^ (substance) |
| 77923008 | Phosphorus radioisotope (substance) |
| 77927009 | ^128^Barium (substance) |
| 77929007 | Hemoglobin Chicago (substance) |
| 77932005 | O-Acetylhomoserine (thiol)-lyase (substance) |
| 77934006 | Sulfurated lime solution (substance) |
| 77942007 | Integrin leukocyte adhesive protein (substance) |
| 77951004 | Aspartate carboxypeptidase (substance) |
| 77963009 | Central myelin protein (substance) |
| 77983005 | Lighter fluid (substance) |
| 77998007 | Deoxythymidine diphosphate (substance) |
| 78003007 | Fibrinogen New Orleans II (substance) |
| 78014005 | Urine (substance) |
| 78020006 | Blood group antigen Westerlund (substance) |
| 78023008 | ^87m^Strontium (substance) |
| 78032005 | Resorcinol (substance) |
| 78036008 | Complement component fragment (substance) |
| 78047001 | 1-1-bis-(p-chlorophenyl)-2-Nitropropane (substance) |
| 78059002 | Bisulfite salt (substance) |
| 78073006 | Acetyldiaminopimelate deacetylase (substance) |
| 78075004 | 12alpha-Hydroxysteroid dehydrogenase (substance) |
| 78116009 | Ceramide cholinephosphotransferase (substance) |
| 78130004 | Dihydrostreptomycin-6-phosphate 3'alpha-kinase (substance) |
| 78134008 | Piminodine (substance) |
| 78137001 | Pumiliotoxin C (substance) |
| 78151001 | Trichloroacetic acid (substance) |
| 78173008 | T cell antibody (substance) |
| 78175001 | Glutarate-semialdehyde dehydrogenase (substance) |
| 78178004 | Anti rickettsial antibody (substance) |
| 78215002 | Blood group antigen Rh35 (substance) |
| 78219008 | Gelsemine (substance) |
| 78221003 | Cobra venom (substance) |
| 78228009 | ^129m^Tellurium (substance) |
| 78231005 | Blood group antibody Js^a^ (substance) |
| 78232003 | Acylglycerol kinase (substance) |
| 78242001 | Oncogene protein KS3 (substance) |
| 78249005 | Hemoglobin North Chicago |
| 78252002 | Blood group antibody Finlay (substance) |
| 78255000 | Coagulation factor II San Juan 1 variant (substance) |
| 78257008 | Sternutator (substance) |
| 78258003 | Deoxycholic acid (substance) |
| 78263004 | Immunoglobulin, constant region (substance) |
| 78286006 | Lantadene A (substance) |
| 78316004 | Dehydroepiandrosterone (substance) |
| 78327002 | Hypotaurocyamine kinase |
| 78334000 | Citidine monophosphate-N-acylneuraminate phosphodiesterase (substance) |
| 78339005 | Human leukocyte antigen B14 (substance) |
| 78343009 | Isopropylamine (substance) |
| 78346001 | Spermidine dehydrogenase (substance) |
| 78350008 | Triethylamine (substance) |
| 78369003 | Alizarin 2-beta-glucosyltransferase (substance) |
| 78380003 | Water repellent (substance) |
| 78386009 | Blood group antigen I^S^ (substance) |
| 78388005 | Histidine-transfer ribonucleic acid ligase (substance) |
| 78400000 | Crotonoyl-[acyl-carrier-protein] hydratase (substance) |
| 78404009 | Ethanolamine oxidase |
| 78414000 | Rubber compound (substance) |
| 78433005 | Methylaminoheptane (substance) |
| 78445001 | Hemoglobin Jackson (substance) |
| 78446000 | ^194^Osmium (substance) |
| 78447009 | Phospholipid (substance) |
| 78452004 | Xanthosine-5-phosphate (substance) |
| 78454003 | Immunoglobulin, GM>11< allotype (substance) |
| 78460003 | Antistreptolysin O (substance) |
| 78462006 | ^134^Cesium (substance) |
| 78467000 | Lymphocyte antigen CDw60 (substance) |
| 78481003 | Iofetamine I^123^ hydrochloride |
| 78491009 | Trinitrobenzene (substance) |
| 78505007 | Glutamate-cysteine ligase (substance) |
| 78520001 | Dazomet (substance) |
| 78527003 | Fucose (substance) |
| 78529000 | ^130^Iodine (substance) |
| 78552001 | Chloral betaine (substance) |
| 78556003 | Dihydroorotase (substance) |
| 78570003 | Indium^111^ transferrin |
| 78573001 | Lignoceric acid (substance) |
| 78588006 | Plasmin (substance) |
| 78589003 | Diphenylcyanoarsine (substance) |
| 78594003 | Blood group antigen Bonde (substance) |
| 78597005 | Intracisternal material of known identity (substance) |
| 78602003 | Shikimate kinase (substance) |
| 78604002 | Sphingosine cholinephosphotransferase (substance) |
| 78605001 | Human leukocyte antigen Dw15 (substance) |
| 78617004 | Barium hydroxide (substance) |
| 78636009 | Aminopyridine (substance) |
| 78637000 | 3-Ethylmalate synthase (substance) |
| 78650004 | Adenosylhomocysteine nucleosidase (substance) |
| 78655009 | Benzoyl chloride (substance) |
| 78661007 | Blood group antibody Rb^a^ (substance) |
| 78665003 | Hemoglobin Daneshgah-Tehran (substance) |
| 78671009 | Zinc arsenite (substance) |
| 78686003 | Copper^64^ acetate (substance) |
| 78688002 | Blood group antigen Henry (substance) |
| 78702007 | Thalidomide (substance) |
| 78707001 | Blood group antibody Fl (substance) |
| 78708006 | Sodium arsanilate (substance) |
| 78709003 | Human leukocyte antigen Bw67 (substance) |
| 78713005 | Caproic acid (substance) |
| 78720003 | N-Acyl mannosamine kinase (substance) |
| 78721004 | Nervonic acid (substance) |
| 78730007 | ^189^Iridium (substance) |
| 78736001 | alpha>2< HS glycoprotein (substance) |
| 78744001 | Hydrogen dehydrogenase (substance) |
| 78749006 | Human leukocyte antigen DQ (substance) |
| 78750006 | Blood group antibody Sc2 (substance) |
| 78751005 | Kynurenine-oxoglutarate aminotransferase (substance) |
| 78758004 | 2,3-Dimethylmalate lyase (substance) |
| 78759007 | Pyridoxamine-phosphate aminotransferase (substance) |
| 78760002 | Angiotensinase (substance) |
| 78772008 | Phenanthrene (substance) |
| 78774009 | Flavin mononucleotide adenylyltransferase (substance) |
| 78782009 | Silver chloride (substance) |
| 78787003 | Hydroxyphenyl mercurichloride (substance) |
| 78796003 | 7-Dehydrocholesterol reductase (substance) |
| 78802001 | Blood group antigen Norlander (substance) |
| 78825000 | Fibrinogen Leuven (substance) |
| 78833004 | ^246^Californium (substance) |
| 78834005 | Fucosylglycoprotein 3-alpha-galactosyltransferase (substance) |
| 78837003 | Glycine benzoyltransferase (substance) |
| 78851003 | Lipoprotein-X (substance) |
| 78859001 | Morrhuate sodium (substance) |
| 78866000 | Human leukocyte antigen Aw68 |
| 78869007 | Nuclear fast red stain (substance) |
| 78870008 | Cobalt radioisotope (substance) |
| 78903005 | Pancreatic elastase I |
| 78910004 | Solid substance (substance) |
| 78924000 | Hemoglobin J-Cubujuqui (substance) |
| 78936006 | Propoxycaine hydrochloride (substance) |
| 78955006 | Blood group antibody Hollister (substance) |
| 78959000 | Sulfathiourea (substance) |
| 78966004 | Metham sodium (substance) |
| 78971006 | Toluenediamine (substance) |
| 79005005 | Immunoglobulin gene GM allotype (substance) |
| 79006006 | Methylglutaconyl-coenzyme A hydratase (substance) |
| 79007002 | Industrial agent (substance) |
| 79008007 | Blood group antibody Dh^a^ (substance) |
| 79018002 | Amylosucrase (substance) |
| 79027001 | Hemoglobin J-Cairo (substance) |
| 79029003 | Blood group antibody Mitch (substance) |
| 79039009 | Methacrylic acid (substance) |
| 79055002 | Hydroxylamine oxidase (substance) |
| 79061004 | Germanium (substance) |
| 79066009 | Hemoglobin Cranston (substance) |
| 79080002 | Blood group antibody Rh39 (substance) |
| 79084006 | Clostridial toxin (substance) |
| 79098003 | Hemoglobin Beograd (substance) |
| 79124006 | Blood group antigen To^a^ (substance) |
| 79127004 | Fibrin monomer (substance) |
| 79135001 | Promazine hydrochloride (substance) |
| 79136000 | ^146^Gadolinium (substance) |
| 79141008 | Crotalus adamanteus serine proteinase (substance) |
| 79146003 | Citrated calcium carbimide (substance) |
| 79166007 | Acyl-phosphate-hexose phosphotransferase (substance) |
| 79176005 | Blood group antigen Rh40 (substance) |
| 79193005 | Fibrinogen Homberg I (substance) |
| 79197006 | ^82^Rubidium (substance) |
| 79198001 | Alloalbumin (substance) |
| 79209008 | Dicumarol (substance) |
| 79211004 | Alcohol dehydrogenase [NAD(P)+] (substance) |
| 79212006 | Proinsulin (substance) |
| 79219002 | Hemoglobin Sunnybrook (substance) |
| 79226002 | Blood group antigen Stairwalt (substance) |
| 79242009 | [Acyl carrier-protein] acetyltransferase (substance) |
| 79245006 | Glutamate synthase (ferredoxin) (substance) |
| 79249000 | Lochia flava (substance) |
| 79251001 | Glyceraldehyde-3-phosphate dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (phosphorylating) (substance) |
| 79271005 | Tremetol (substance) |
| 79288003 | Cross reacting antigen (substance) |
| 79293000 | Nucleoside-triphosphatase (substance) |
| 79316006 | Alkyl aryl polyether sulfate (substance) |
| 79326004 | Lymphocyte antigen CD23 (substance) |
| 79328003 | Lysine decarboxylase (substance) |
| 79329006 | Serum protein (substance) |
| 79330001 | Zinc trichlorophenate (substance) |
| 79331002 | Blood group antibody Hr (substance) |
| 79338008 | ^97m^Technetium (substance) |
| 79341004 | Lymphocyte antigen CD71 (substance) |
| 79343001 | Oil of parsley (substance) |
| 79370008 | Thiocyanate compound (substance) |
| 79375003 | Proteoglycan (substance) |
| 79380007 | Hydrocortisone acetate (substance) |
| 79388000 | Aryl acylamidase (substance) |
| 79391000 | Adenosine triphosphate phosphoribosyltransferase (substance) |
| 79396005 | Purine-nucleoside phosphorylase (substance) |
| 79415006 | Procollagen-proline,2-oxoglutarate 4-dioxygenase (substance) |
| 79422003 | Gadolinium radioisotope (substance) |
| 79428004 | Dihydroxyaluminum aminoacetate (substance) |
| 79446005 | Imidazole acetyltransferase (substance) |
| 79448006 | ^91m^Yttrium (substance) |
| 79477007 | ^66^Gallium (substance) |
| 79482000 | ^174^Hafnium (substance) |
| 79496006 | Blood group antigen Y. Bern (substance) |
| 79498007 | Zeta-chain hemoglobin (substance) |
| 79506002 | ^196m^Iridium (substance) |
| 79514008 | Methylenetetrahydrofolate reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 79522001 | Carbamate pesticide (substance) |
| 79523006 | ^76^Bromine (substance) |
| 79531001 | Aminopeptidase P (substance) |
| 79545007 | trans-L-3-Hydroxyproline dehydratase (substance) |
| 79549001 | Cyanoacrylate (substance) |
| 79550001 | ^197^Gold (substance) |
| 79568003 | Acetylornithine aminotransferase (substance) |
| 79576001 | Titanium sulfate (substance) |
| 79580006 | Adrenal hormone (substance) |
| 79581005 | Hydrated sodium borate (substance) |
| 79610008 | Technetium Tc^99m^ serum albumin (substance) |
| 79612000 | Myelin (substance) |
| 79625008 | Methylenetetrahydrofolate dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) |
| 79630007 | Extracellular secretion material following exocytosis, luminal, exocrine (substance) |
| 79638000 | Blood group antibody Hr^B^ (substance) |
| 79640005 | Deoxythymidylic acid (substance) |
| 79651005 | Naphthyl acetic acid (substance) |
| 79657009 | Type III site-specific deoxyribonuclease (substance) |
| 79680001 | Sporotrichum proteinase I (substance) |
| 79685006 | 5-Aminolevulinate synthase (substance) |
| 79689000 | Amprotropine (substance) |
| 79691008 | Oximinotransferase (substance) |
| 79697007 | Leukocyte-adhesion receptor (substance) |
| 79706000 | Bilirubin (substance) |
| 79721006 | Flavone apiosyltransferase (substance) |
| 79744009 | beta-Lactamase (substance) |
| 79761007 | Di-2-ethylhexyl phthalate (substance) |
| 79769009 | Anti parasitic antibody (substance) |
| 79773007 | Active C4b2a (substance) |
| 79775000 | Terebene (substance) |
| 79778003 | Acetylene (substance) |
| 79784000 | Lead acetate (substance) |
| 79796007 | Blood group antibody Pt^a^ (substance) |
| 79798008 | Spleen exonuclease (substance) |
| 79803004 | Chloroacetophenone |
| 79813007 | Blood group antibody H (substance) |
| 79846001 | Coagulation factor IX Cambridge variant (substance) |
| 79850008 | Augusticeps-type venom (substance) |
| 79862007 | Alanopine dehydrogenase (substance) |
| 79900002 | Methionine S-methyltransferase (substance) |
| 79907004 | Aminobenzoic acid derivative (substance) |
| 79912003 | Squalene monooxygenase (substance) |
| 79937008 | Sodium cacodylate (substance) |
| 79943005 | Nucleoside-diphosphatase (substance) |
| 79973001 | Complement component C9 (substance) |
| 79976009 | 2-Isopropoxyethanol (substance) |
| 80044001 | Polysaccharide methyltransferase (substance) |
| 80048003 | Blood group antibody Walls (substance) |
| 80086007 | Hemoglobin Toyoake (substance) |
| 80105007 | Blood group antibody iP>1< (substance) |
| 80120001 | Tryptophan 2,3-dioxygenase (substance) |
| 80122009 | Human leukocyte antigen B40 (substance) |
| 80133007 | Blood group antibody Westerlund (substance) |
| 80143005 | Guanosine monophosphate synthase (glutamine-hydrolysing) (substance) |
| 80164009 | Cinnabar (substance) |
| 80188006 | Human leukocyte antigen C (substance) |
| 80189003 | Plant steroid alkaloid (substance) |
| 80191006 | Protocatechuate 3,4-dioxygenase (substance) |
| 80214006 | Micrococcus caseolyticus neutral proteinase (substance) |
| 80222004 | 5'-Nucleotidase (substance) |
| 80230003 | 2,6-Dichloro-4-nitrobenzenamine (substance) |
| 80234007 | Matrix of cartilage (substance) |
| 80237000 | Cocoa butter (substance) |
| 80238005 | Prodipidine (substance) |
| 80253002 | Aminometradine (substance) |
| 80259003 | Food flavoring agent (substance) |
| 80260008 | Iodinated I^125^ levothyroxine (substance) |
| 80263005 | Aminotriazole (substance) |
| 80269009 | Keratan-sulfate endo-1,4-beta-galactosidase (substance) |
| 80276004 | Blood group antigen Savior (substance) |
| 80283006 | Uridine diphosphate galactopyranose mutase (substance) |
| 80305003 | Pontamine sky blue 6BX stain (substance) |
| 80312007 | Platinum isotope (substance) |
| 80322001 | Synthetic alkaloid (substance) |
| 80324000 | Stone dust (substance) |
| 80343000 | Bacterial antibody |
| 80344006 | ^85m^Krypton (substance) |
| 80373009 | Sedoheptulokinase (substance) |
| 80382003 | Hydrocarbon (substance) |
| 80393001 | Diiodotyrosine (substance) |
| 80403006 | Blood group antibody Clements (substance) |
| 80413003 | Blood group antigen Stowe (substance) |
| 80424001 | Blood group antigen McKenney (substance) |
| 80429006 | Uridine diphosphate-N-acetylglucosamine pyrophosphorylase (substance) |
| 80453000 | Proline racemase (substance) |
| 80458009 | Aminoacyl-lysine dipeptidase (substance) |
| 80464002 | Anthranilate 1,2-dioxygenase (deaminating, decarboxylating) (substance) |
| 80465001 | Blood group antigen Lan (substance) |
| 80472000 | Hemoglobin Strasbourg (substance) |
| 80482004 | Blood group antigen Rh32 (substance) |
| 80485002 | Sulfur monochloride (substance) |
| 80492007 | Alkyl dimethyl ethylbenzyl ammonium chloride (substance) |
| 80494008 | Reticulin (substance) |
| 80506001 | Aldose dehydrogenase (substance) |
| 80516009 | Blood group antigen Davis J (substance) |
| 80517000 | Heparosan-N-sulfate-glucuronate 5-epimerase (substance) |
| 80521007 | ^200^Platinum (substance) |
| 80532007 | Aprobarbital (substance) |
| 80537001 | Peptide YY (substance) |
| 80539003 | Cobalt salt (substance) |
| 80540001 | Succinyl-coenzyme A hydrolase (substance) |
| 80553003 | Tetrachloroquinone |
| 80558007 | Blood group antibody HLA-A8 (substance) |
| 80562001 | Deoxy guanosine triphosphate (substance) |
| 80572003 | Colony-stimulating factor, granulocytic (substance) |
| 80575001 | Blood group antigen Kaj (substance) |
| 80582002 | Glycerol (substance) |
| 80590002 | Lymphocyte antigen CDw12 (substance) |
| 80591003 | N-Acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase (substance) |
| 80605008 | Acokantherin (substance) |
| 80613009 | Mannitol dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 80616001 | Hemoglobin Radcliffe (substance) |
| 80620002 | Human leukocyte antigen B35 (substance) |
| 80630006 | Sodium arsenite (substance) |
| 80652002 | Phenyl mercuric salt (substance) |
| 80688007 | Pro-opiomelanocortin (substance) |
| 80705000 | Blood group antigen Knoebnchild (substance) |
| 80706004 | Alkyl dimethyl ethyl ammonium chloride (substance) |
| 80741000 | Plasma kinin (substance) |
| 80743002 | Mustard black (substance) |
| 80745009 | Barium thioglycolate (substance) |
| 80751004 | ^133^Xenon (substance) |
| 80754007 | MNS19 (ISBT symbol) |
| 80760007 | Blood group antigen Nijhuis (substance) |
| 80789009 | Diosgenin (substance) |
| 80819005 | Proline carboxypeptidase (substance) |
| 80832000 | Ketopantoaldolase (substance) |
| 80837006 | Sialidase (substance) |
| 80839009 | D-Amino-acid dehydrogenase (substance) |
| 80854003 | ^211^Lead (substance) |
| 80861004 | Nucleolus organizer region (substance) |
| 80869002 | Immunoglobulin, GM>19< allotype (substance) |
| 80873004 | Oxyhemoglobin (substance) |
| 80876007 | Phosphomannan mannosephosphotransferase (substance) |
| 80892002 | Blood group antibody Zd (substance) |
| 80903004 | Haplotoxin (substance) |
| 80911009 | Exodeoxyribonuclease III (substance) |
| 80916004 | Potassium phosphate (substance) |
| 80917008 | Toxin (substance) |
| 80918003 | Protoporphyrin IX (substance) |
| 80920000 | ^176^Tungsten (substance) |
| 80929004 | Blood group antigen Cs^a^ |
| 80946001 | Thromboxane (substance) |
| 80959009 | Methylprednisolone acetate (substance) |
| 80972005 | Cephazolin sodium (substance) |
| 80987000 | Animal genome (substance) |
| 80992003 | erythro-3-Hydroxyaspartate dehydratase (substance) |
| 80994002 | 4-Aminopyridine (substance) |
| 81017004 | Encainide hydrochloride (substance) |
| 81044009 | 2-Ethoxyacetate (substance) |
| 81053002 | Blood group antibody Welsh (substance) |
| 81080009 | Blood group antigen En^a^FR |
| 81100008 | Pentose (substance) |
| 81111000 | Glycogen-synthase-D phosphatase (substance) |
| 81114008 | Phosphatidylcholine-dolichol acyltransferase (substance) |
| 81118006 | Gonadal hormone (substance) |
| 81123006 | Interleukin-5 (substance) |
| 81172004 | Creatinase (substance) |
| 81176001 | Batrachotoxin (substance) |
| 81181005 | Chitobiosyldiphosphodolichol alpha-mannosyltransferase (substance) |
| 81195008 | n-Pentane |
| 81205009 | Blood group antigen Do^a^ (substance) |
| 81213005 | Blood group antigen Snyder (substance) |
| 81222006 | Sutilains (substance) |
| 81243007 | Isocitrate dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 81255001 | beta-Ketothiolase |
| 81262005 | Blood group antibody Gy^a^ (substance) |
| 81273003 | Fibrinogen Louisville (substance) |
| 81286007 | Growth factor (substance) |
| 81290009 | Tyrosine decarboxylase (substance) |
| 81297007 | Blood group antibody Boil (substance) |
| 81312003 | 5-Aminovalerate aminotransferase (substance) |
| 81322009 | Phosphoamidase (substance) |
| 81324005 | Zirconium radioisotope (substance) |
| 81329000 | Blood group antibody PeCo (substance) |
| 81332002 | Blood group antibody N>2< (substance) |
| 81357007 | Aspartate ammonia-lyase (substance) |
| 81362008 | Hexobarbital (substance) |
| 81365005 | Levamisole hydrochloride (substance) |
| 81384008 | Blood group antibody Dautriche (substance) |
| 81394003 | Bence Jones protein (substance) |
| 81395002 | Arachidonate 12-lipoxygenase (substance) |
| 81397005 | Auramine O stain (substance) |
| 81419006 | Chemical fumes (substance) |
| 81426006 | Blood group antigen HLA-B8 (substance) |
| 81430009 | Titanium oxide (substance) |
| 81432001 | Human leukocyte antigen Dw18 (substance) |
| 81444003 | Coagulation factor X (substance) |
| 81458001 | Eucatropine (substance) |
| 81461000 | Fetal fibrinogen (substance) |
| 81473000 | Sulfite reductase (substance) |
| 81481004 | 4-Aminobutyrate aminotransferase (substance) |
| 81494002 | Cholinephosphotransferase (substance) |
| 81508005 | Doxycycline monohydrate (substance) |
| 81522005 | Deoxythymidine triphosphate (substance) |
| 81537009 | Tartronate-semialdehyde synthase (substance) |
| 81578006 | Lymphocyte antigen CD25 (substance) |
| 81582008 | Hemoglobin Santa Ana (substance) |
| 81584009 | Brombenzyl cyanide (substance) |
| 81589004 | Moniliformin (substance) |
| 81599009 | Paraoxon (substance) |
| 81600007 | Blood group antigen Gy^a^ (substance) |
| 81602004 | Naled (substance) |
| 81605002 | gamma Fetoprotein (substance) |
| 81610003 | Blood group antigen Frando (substance) |
| 81615008 | Hypercalcemic steroid agent (substance) |
| 81620008 | Human leukocyte antigen A23 (substance) |
| 81621007 | Indium^111^ red cell label (substance) |
| 81625003 | 3beta-Hydroxy-delta 5-steroid dehydrogenase (substance) |
| 81641002 | Blood group antigen Chase (substance) |
| 81651001 | Diagnostic antiserum (substance) |
| 81655005 | Protoporphyrinogen oxidase (substance) |
| 81663006 | Glucuronokinase (substance) |
| 81679007 | Blood group antibody Chase (substance) |
| 81689006 | Prostatic secretions (substance) |
| 81692005 | Adenosine triphoshate deaminase (substance) |
| 81702008 | Active C5b67 (substance) |
| 81719005 | Tremorgenic mycotoxin (substance) |
| 81732000 | Indolepyruvate methyltransferase (substance) |
| 81761004 | Technetium Tc^99m^ microaggregated albumin (substance) |
| 81778008 | Mercurophylline injection (substance) |
| 81784006 | Blood group antibody Rod (substance) |
| 81801009 | Alcohol oxidase (substance) |
| 81809006 | Fumarylacetoacetase (substance) |
| 81810001 | Vanillylmandelic acid (substance) |
| 81816007 | Candicidin (substance) |
| 81821005 | ^243^Americium (substance) |
| 81837004 | Uridine kinase (substance) |
| 81847001 | Hemoglobin Setif (substance) |
| 81859002 | Dichlorophenarsine hydrochloride (substance) |
| 81860007 | Isoetharine mesylate (substance) |
| 81863009 | Watasemia-luciferin 2-monooxogenase (substance) |
| 81867005 | Tantalum isotope (substance) |
| 81868000 | Linolenic acid (substance) |
| 81880008 | beta-Alanyl-CoA ammonia-lyase (substance) |
| 81886002 | Ethylene glycol (substance) |
| 81901008 | Hemoglobin Deer Lodge (substance) |
| 81905004 | Globulin (substance) |
| 81911001 | Chewing tobacco (substance) |
| 81926004 | T-cell antigen receptor (substance) |
| 81929006 | Hemoglobin Raleigh (substance) |
| 81945008 | Chloromuconate cycloisomerase (substance) |
| 81946009 | Dantrolene sodium (substance) |
| 81948005 | Iron silicate (substance) |
| 81963008 | Blood group antigen BOA 3150 (substance) |
| 81969007 | Phosphoenolpyruvate carboxylase (substance) |
| 81989008 | Nucleoside phosphoacylhydrolase (substance) |
| 82004000 | Methyl acetate (substance) |
| 82017002 | 5-Carboxymethyl-2-hydroxymuconate delta-isomerase (substance) |
| 82021009 | Lotus aspartic proteinase (substance) |
| 82026004 | Butyl methyl ketone (substance) |
| 82055007 | Spermidine synthase (substance) |
| 82061005 | Triphenylamine (substance) |
| 82064002 | Coproporphyrinogen I |
| 82075003 | Bismuth subsalicylate (substance) |
| 82083009 | Phosphoprotein phosphatase (substance) |
| 82100006 | Inosine monophosphate dehydrogenase (substance) |
| 82122004 | Bacillus thuringiensis agent (substance) |
| 82131004 | Heptabarbital (substance) |
| 82134007 | Apyrase (substance) |
| 82149004 | Hemoglobin Hofu (substance) |
| 82150004 | Diisopropyl-fluorophosphatase (substance) |
| 82154008 | Rubber cis-polyprenylcistransferase (substance) |
| 82160008 | Cathepsin L (substance) |
| 82171009 | Blood group antibody Hoalzel (substance) |
| 82175000 | Transfer ribonucleic acid (guanine-N^1^)-methyltransferase (substance) |
| 82176004 | Blood group antigen Koopman (substance) |
| 82183006 | Cytoadhesin receptor (substance) |
| 82205007 | Tetrachloro-1,4- benzoquinone (substance) |
| 82216000 | Metazocine (substance) |
| 82220001 | Staphylococcal serine proteinase (substance) |
| 82222009 | Acetoacetate-coenzyme A ligase (substance) |
| 82224005 | Ethyl mercury phosphate (substance) |
| 82227003 | D-Lysopine dehydrogenase (substance) |
| 82230005 | Quinidine sulfate (substance) |
| 82239006 | Blood group antigen Naz (substance) |
| 82246002 | Exoribonuclease H (substance) |
| 82256003 | Human gene (substance) |
| 82270003 | Blood group antibody Bi (substance) |
| 82279002 | Blood group antibody Rh32 (substance) |
| 82282007 | Apigenin O^4'^-methyltransferase (substance) |
| 82299008 | Blood group antibody M^A^ (substance) |
| 82322007 | Oil of dill (substance) |
| 82332000 | Chlorodimethyl phenoxy ethanol (substance) |
| 82335003 | Gluconolactonase (substance) |
| 82337006 | Isopentyl alcohol (substance) |
| 82359008 | Prulaurasin (substance) |
| 82391009 | Hemoglobin F-Poole |
| 82394001 | Glucose-1-phosphate adenylyltransferase |
| 82395000 | Cytidine monophosphate-N-acetylneuraminate-beta-galactoside alpha-2,3-sialyltransferase (substance) |
| 82398003 | Chlorinated biphenyl oxide (substance) |
| 82409003 | Antibody to hepatitis B core antigen (substance) |
| 82411007 | Rose bengal stain (substance) |
| 82412000 | Methylmethionine-sulphonium-salt hydrolase |
| 82444001 | 3-Hydroxybutyryl-coenzyme A dehydrogenase (substance) |
| 82450006 | Cottonseed oil (substance) |
| 82469001 | Glutathione dehydrogenase (ascorbate) (substance) |
| 82481002 | White phosphorus (substance) |
| 82485006 | Pentamethonium bromide (substance) |
| 82489000 | Blood group antibody IAB (substance) |
| 82490009 | Chenodiol (substance) |
| 82503004 | ^164^Ytterbium (substance) |
| 82544003 | Hemoglobin Bibba (substance) |
| 82549008 | Hemoglobin J-Broussais (substance) |
| 82565009 | Mucopolysaccharide (substance) |
| 82566005 | Animal feed (substance) |
| 82570002 | Glucose-1-phosphatase (substance) |
| 82571003 | Blood group antigen Zim (substance) |
| 82572005 | Sulfenone (substance) |
| 82592003 | Complement factor Bb (substance) |
| 82594002 | Blood group antibody Riv (substance) |
| 82604001 | Echis carnatus prothrombin-activating proteinase (substance) |
| 82609006 | Haptoglobin 1-1 (substance) |
| 82620006 | Blood group antigen M^g^ (substance) |
| 82622003 | Vitamin A (substance) |
| 82623008 | Dihydrodipicolinate synthase (substance) |
| 82645009 | Antibody to hepatitis B surface antigen (substance) |
| 82671008 | Alkylmercury lyase (substance) |
| 82682000 | Victoria blue 4R stain (substance) |
| 82693003 | Myoglobin |
| 82720002 | Blood group antigen Lu16 (substance) |
| 82753007 | Leucocyte 16 |
| 82759006 | Dihydrofolate synthetase |
| 82772007 | Formiminoaspartate deiminase (substance) |
| 82778006 | Uroporphyrin III (substance) |
| 82786006 | Citrate (re)-synthase (substance) |
| 82787002 | Chloridazon-catechol dioxygenase (substance) |
| 82792000 | Biotin-[methylmalonyl-coenzyme A-carboxyltransferase] ligase |
| 82798001 | Coagulation factor X Prower variant (substance) |
| 82803005 | Blood group antibody Juneau (substance) |
| 82846008 | L-Arabinitol dehydrogenase (substance) |
| 82850001 | Fibrinogen Charlottsville (substance) |
| 82855006 | ^115^Indium (substance) |
| 82861009 | Blood group antigen Kelly (substance) |
| 82863007 | Incomplete antibody (substance) |
| 82873009 | Abnormal hemoglobin, extended chain (substance) |
| 82885001 | Colistimethate (substance) |
| 82890003 | Hemoglobin Tashikuergan (substance) |
| 82906001 | Aldose-6-phosphate reductase (reduced nicotinamide adenine dinucleotide phosphate) (substance) |
| 82912006 | Non-ionized calcium (substance) |
| 82922000 | Coagulation factor II Poissy variant (substance) |
| 82927006 | High molecular weight kininogen (substance) |
| 82931000 | Sodium succinate (substance) |
| 82937001 | Factor VII antibody (substance) |
| 82963006 | Polygalacturonase (substance) |
| 82981009 | Decaborane (substance) |
| 82983007 | Euchromatin (substance) |
| 82989006 | Decylhomocitrate synthase (substance) |
| 83003003 | Lymphocyte antigen CD37 (substance) |
| 83024008 | Oil of patchouli (substance) |
| 83026005 | Ribonucleic acid uridylyltransferase (substance) |
| 83034004 | Monocrotaline (substance) |
| 83036002 | Lactate (substance) |
| 83042003 | Erythropoietin (substance) |
| 83051006 | Cimetidine hydrochloride (substance) |
| 83054003 | Undecaprenol kinase (substance) |
| 83055002 | Escin (substance) |
| 83064007 | Hemoglobin J-Guantanamo (substance) |
| 83066009 | Hemoglobin Harbin (substance) |
| 83068005 | Factor XI antibody (substance) |
| 83078008 | Blood group antibody Os^a^ (substance) |
| 83087004 | 6-Phospho-beta-galactosidase (substance) |
| 83098003 | Intracellular fibril (substance) |
| 83102006 | Sorbitol-6-phosphatase (substance) |
| 83108005 | Blood group antigen Vg^a^ (substance) |
| 83109002 | Blood group antibody Baugh (substance) |
| 83115002 | Dichlorophenazone (substance) |
| 83131005 | Blood group antigen Perry (substance) |
| 83143006 | Glutethimide (substance) |
| 83149005 | Transaldolase (substance) |
| 83177001 | Thallium compound (substance) |
| 83180000 | Phenylpyruvate tautomerase (substance) |
| 83182008 | 2-Dehydro-3-deoxy-L-arabinonate dehydratase (substance) |
| 83184009 | Asparagine-transfer ribonucleic acid ligase (substance) |
| 83188007 | Adenylylsulfate-ammonia adenylyltransferase |
| 83191007 | Organic sulfone compound (substance) |
| 83205002 | ^76^Krypton (substance) |
| 83235009 | Bovine growth hormone recombinant (substance) |
| 83237001 | Titanium isotope (substance) |
| 83261008 | myo-Inositol 1-kinase (substance) |
| 83267007 | Phenacetin (substance) |
| 83280005 | Fibrinogen Lille (substance) |
| 83283007 | Chloramphenicol acetyltransferase (substance) |
| 83298009 | Ethyl acetate (substance) |
| 83309005 | Ethopropazine hydrochloride (substance) |
| 83310000 | Cupric salt (substance) |
| 83334005 | Adenine phosphoribosyltransferase (substance) |
| 83342006 | Cyanate hydrolase (substance) |
| 83348005 | Phosphatidylinositol-bisphosphatase (substance) |
| 83349002 | Viomycin kinase (substance) |
| 83357004 | Red veterinary petrolatum |
| 83388000 | Uridine diphosphate-N-acetylglucosamine-dolichyl-phosphate-N-acetylglucosaminephosphotransferase (substance) |
| 83391000 | Human leukocyte antigen Bw |
| 83399003 | Glycerone kinase (substance) |
| 83400005 | Phosphoglycerate kinase (guanosine triphosphate) (substance) |
| 83404001 | Blood group antibody K (substance) |
| 83407008 | Protoveratrine A (substance) |
| 83423008 | Sodium diprotrizoate (substance) |
| 83432005 | Blood group antigen 1123K (substance) |
| 83438009 | Dobesilate calcium (substance) |
| 83446005 | Riboflavin synthase (substance) |
| 83475004 | Desmin (substance) |
| 83496006 | Human leukocyte antigen class I (substance) |
| 83498007 | Boric acid otic agent (substance) |
| 83499004 | Blood group antibody Maliff (substance) |
| 83515009 | Human leukocyte antigen DRw17 (substance) |
| 83534009 | Cyclopentolate hydrochloride (substance) |
| 83539004 | Dihydrofolate reductase (substance) |
| 83545007 | Fumitremorgen (substance) |
| 83552009 | Pharyngeal mucus (substance) |
| 83581005 | Silicon dioxide (substance) |
| 83595008 | Goat's milk (substance) |
| 83596009 | Iron oxide (substance) |
| 83598005 | Xenon |
| 83600004 | Ethyl eosin |
| 83601000 | ^38^Sulfur |
| 83614004 | ^229^Thorium (substance) |
| 83615003 | Hemoglobin A>2< Fitzroy (substance) |
| 83616002 | Thrombomodulin-thrombin complex (substance) |
| 83619009 | Polyvinyl alcohol (substance) |
| 83621004 | Complement receptor 5 (substance) |
| 83625008 | Antimony thioglycolate (substance) |
| 83640005 | Uridine diphosphate-N-acetylmuramoylalanyl-D-glutamate-2,6 diaminopimelate ligase (substance) |
| 83667004 | Enterogastrone (substance) |
| 83671001 | Hydroxylysine kinase (substance) |
| 83672008 | Pentachloronitrobenzene (substance) |
| 83682009 | Methylaspartate mutase (substance) |
| 83688008 | Flumethrin (substance) |
| 83695004 | Hemoglobin Spanish Town (substance) |
| 83696003 | Oncogene protein LYL1 (substance) |
| 83700006 | Glyceraldehyde-3-phosphate dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 83701005 | Erythrulose reductase (substance) |
| 83702003 | Bialamicol (substance) |
| 83704002 | Piperilate (substance) |
| 83705001 | Nitrogenase (substance) |
| 83717004 | Big big gastrin (substance) |
| 83732006 | Hb 114(G16), Leu (substance) |
| 83734007 | Blood group antigen Eggenberger (substance) |
| 83737000 | Tedion (substance) |
| 83749004 | Acid radical (substance) |
| 83769009 | Phosphoglycolate phosphatase (substance) |
| 83770005 | Phospho-2-dehydro-3-deoxygluconate aldolase (substance) |
| 83792009 | Succinate-coenzyme A ligase (adenosine diphosphate-forming) (substance) |
| 83797003 | Leucine (substance) |
| 83814001 | Sorghum aspartic proteinase (substance) |
| 83815000 | Hemoglobin E (substance) |
| 83847005 | Palladium radioisotope (substance) |
| 83849008 | 1,1-Dichloroethylene (substance) |
| 83863002 | Deoxyguanosine kinase (substance) |
| 83869003 | Blood group antibody Co3 |
| 83871003 | Hemoglobin Sogn (substance) |
| 83872005 | Phenyramidol (substance) |
| 83873000 | Sodium monofluorophosphate (substance) |
| 83881004 | Aluminum oxide (substance) |
| 83882006 | Juniper oil (substance) |
| 83884007 | Blood group antigen Lu4 (substance) |
| 83897009 | Paralytic shellfish toxin (substance) |
| 83912003 | ^129^Iodine (substance) |
| 83933007 | Hydroxyzine pamoate (substance) |
| 83945003 | Hydroxyzine hydrochloride (substance) |
| 83963003 | Uranium nitrate (substance) |
| 83968007 | Clemastine fumarate (substance) |
| 83972006 | ^233^Uranium (substance) |
| 83981000 | Erythromycin gluceptate (substance) |
| 83989003 | Blood group antigen Messenger (substance) |
| 84006004 | Dihydrodipicolinate reductase (substance) |
| 84019000 | Deoxyribonucleic acid alpha-glucosyltransferase (substance) |
| 84024002 | Dolichyl-phosphate beta-glucosyltransferase (substance) |
| 84035007 | Cystathionine (substance) |
| 84055008 | ^204^Bismuth (substance) |
| 84059002 | Pinguinain (substance) |
| 84079005 | Blood group antigen Clements (substance) |
| 84083005 | Hemoglobin Khartoum (substance) |
| 84103009 | Phenoxyethanol (substance) |
| 84123005 | Nitrofurfuryl methylether (substance) |
| 84131000 | Urate oxidase (substance) |
| 84136005 | Hemoglobin Stanleyville-II (substance) |
| 84144005 | Sodium cyanide (substance) |
| 84145006 | Cryptenamine (substance) |
| 84147003 | Thymidine,2-oxoglutarate dioxygenase (substance) |
| 84163006 | Blood group antigen Je^a^ (substance) |
| 84164000 | Chloramben (substance) |
| 84165004 | Cefoxitin sodium (substance) |
| 84169005 | Collidine (substance) |
| 84171005 | Blood group antibody Tc^b^ (substance) |
| 84181009 | Phenylethylene |
| 84191003 | ^193^Platinum (substance) |
| 84212004 | Ethylenimine (substance) |
| 84213009 | Midazolam hydrochloride (substance) |
| 84217005 | Titan yellow stain (substance) |
| 84230006 | Plant sesquiterpene (substance) |
| 84242001 | ^245^Plutonium (substance) |
| 84250005 | Fumitoxin (substance) |
| 84259006 | Blood group antigen Wb (substance) |
| 84270004 | Pix oxycedri |
| 84274008 | Hydrobromic acid (substance) |
| 84276005 | Lymphocyte antigen CD43 |
| 84317008 | Phosphonacetic acid (substance) |
| 84323003 | Mercocresols (substance) |
| 84341006 | ^254^Californium (substance) |
| 84342004 | Rubidium radioisotope (substance) |
| 84345002 | Hemoglobin Saverne (substance) |
| 84348000 | Fructose 5-dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 84361000 | Fibrinogen Los Angeles (substance) |
| 84363002 | Hydroxyketone dye (substance) |
| 84372005 | Blood group antibody Hartley (substance) |
| 84373000 | Hyaluronoglucuronidase (substance) |
| 84375007 | Hemoglobin J-Sicilia (substance) |
| 84377004 | Staphylococcal cysteine proteinase (substance) |
| 84381004 | Menthyl anthranilate and titanium oxide (substance) |
| 84386009 | Tribromoethanol (substance) |
| 84406006 | Human leukocyte antigen DPw (substance) |
| 84424008 | Potassium cyanide (substance) |
| 84429003 | Rubredoxin-nicotinamide adenine dinucleotide phosphate ^+^ reductase (substance) |
| 84430008 | Cross reacting antibody (substance) |
| 84433005 | Human leukocyte antigen Bw56 (substance) |
| 84443008 | ^225^Radium (substance) |
| 84464007 | Lymphocyte antigen CD42b (substance) |
| 84486008 | Mannose-1-phosphate guanylyltransferase (substance) |
| 84488009 | Compound blood group antigen iH (substance) |
| 84498003 | Pipe smoking tobacco (substance) |
| 84509001 | Hemoglobin Siriraj (substance) |
| 84520001 | Viral structural gene (substance) |
| 84524005 | Iduronate 2-sulfatase (substance) |
| 84536004 | Fibrinogen Metz (substance) |
| 84538003 | Blood group antigen C (substance) |
| 84547006 | L-Ascorbate oxidase (substance) |
| 84553006 | ^93m^Molybdenum |
| 84560000 | Leucine aminotransferase (substance) |
| 84583002 | Active C5b (substance) |
| 84601005 | Immunoglobulin, GM>24< allotype (substance) |
| 84609007 | Blood group antibody Xg^a^ (substance) |
| 84616008 | Dolichyl-xylosyl-phosphate-protein xylosyltransferase (substance) |
| 84629008 | Androgen (substance) |
| 84650004 | Intestinal contents (substance) |
| 84653002 | Blood group antibody Swarts (substance) |
| 84656005 | Atebrin FS stain (substance) |
| 84658006 | Blood group antibody Elder (substance) |
| 84671009 | Acyl-[acyl-carrier-protein] desaturase (substance) |
| 84698008 | Cholesterol (substance) |
| 84704008 | Pyridoxamine-oxaloacetate aminotransferase (substance) |
| 84708006 | Blood group antigen Gill (substance) |
| 84717006 | Diacylglycerol-sterol acyltransferase (substance) |
| 84718001 | Alkyl dimethyl ethyl ammonium bromide (substance) |
| 84720003 | Complement component C4a (substance) |
| 84746004 | Pituitary hormone (substance) |
| 84748003 | Doxapram hydrochloride (substance) |
| 84761003 | Phosphodiesterase I (substance) |
| 84770000 | Polyphosphate kinase (substance) |
| 84771001 | D-Xylose dehydrogenase (substance) |
| 84786007 | Dehydrogluconokinase (substance) |
| 84791008 | Sodium metabisulfite (substance) |
| 84802001 | Equinatoxin (substance) |
| 84818007 | 17,21-Dihydroxypregnenolone (substance) |
| 84822002 | Methyl methacrylate (substance) |
| 84823007 | Transfer ribonucleic acid isopentenyltransferase (substance) |
| 84835006 | Cyclic adenosine monophosphate (substance) |
| 84847000 | Platinum (substance) |
| 84865001 | Active C1r/C1s (substance) |
| 84870008 | Blood group antibody Horn (substance) |
| 84874004 | Iodohippurate I^123^ sodium (substance) |
| 84896005 | T-cell leukaemia-lymphoma gene 3 |
| 84905003 | Beta interferon (substance) |
| 84922001 | Blood group antibody McAuley (substance) |
| 84926003 | Homovanillic acid (substance) |
| 84927007 | Fungal gene (substance) |
| 84933003 | Germanium tetrahydride (substance) |
| 84934009 | Hemoglobin Cowtown (substance) |
| 84935005 | Tumor-angiogenesis factor (substance) |
| 84960005 | Auxin A (substance) |
| 84963007 | ^3^Helium (substance) |
| 84973009 | Glucan 1,6-alpha-isomaltosidase (substance) |
| 84987009 | Ethyl phosphate (substance) |
| 84990003 | ^80^Bromine (substance) |
| 85012003 | Protein-glutamate methyltransferase (substance) |
| 85024005 | Plant estrogenic glycoside (substance) |
| 85035000 | Griseofulvin microsize (substance) |
| 85037008 | Doxepin hydrochloride (substance) |
| 85043005 | D-Alanine aminotransferase |
| 85060000 | Blood group antibody Duvall (substance) |
| 85066006 | Azo black stain (substance) |
| 85074007 | ^103m^Rhodium (substance) |
| 85105005 | Hemoglobin Inkster (substance) |
| 85112001 | Cellodextrin phosphorylase (substance) |
| 85115004 | Methylmalonate-semialdehyde dehydrogenase (acylating) (substance) |
| 85122007 | Globoside alpha-N-acetylgalactosaminyltransferase |
| 85129003 | Blood group antigen Wr^a^ (substance) |
| 85134004 | Phospholipase D (substance) |
| 85137006 | Tetrachlorophenol (substance) |
| 85142003 | Germanium isotope (substance) |
| 85146000 | Thorium radioisotope (substance) |
| 85155002 | Anti rheumatoid associated nuclear antigen antibody (substance) |
| 85160003 | Mucous membrane anti-inflammatory agent (substance) |
| 85172009 | Bromine pentafluoride (substance) |
| 85174005 | Phthalocyanine dye (substance) |
| 85181003 | Fibrous protein (substance) |
| 85185007 | p-Nitrobiphenyl (substance) |
| 85190005 | Bismark brown Y stain (substance) |
| 85197008 | Coagulation factor IX Vancouver variant (substance) |
| 85205004 | beta-Adrenergic receptor (substance) |
| 85214009 | L-Glutamic acid |
| 85236007 | D region, major histocompatibility complex (substance) |
| 85242006 | Levamphetamine (substance) |
| 85246009 | Barbiturase (substance) |
| 85252005 | Cuscohygrine (substance) |
| 85253000 | Blood group antigen Bp^a^ (substance) |
| 85254006 | Opheline kinase (substance) |
| 85258009 | Chromic acid (substance) |
| 85267009 | Angiotensin II (substance) |
| 85268004 | 5-Dehydro-2-deoxygluconokinase (substance) |
| 85270008 | Wood splinter (substance) |
| 85283009 | Glutamine-phenylpyruvate aminotransferase (substance) |
| 85287005 | Hypoxanthine (substance) |
| 85294008 | Haptoglobin (substance) |
| 85297001 | Maltose synthase (substance) |
| 85310002 | Bis(5'-adenosyl)-triphosphatase (substance) |
| 85335008 | beta Pyridyl carbinol (substance) |
| 85347002 | Cardiotoxin venom (substance) |
| 85351000 | Aldehyde oxidase (substance) |
| 85364004 | Coagulation factor II Madrid variant (substance) |
| 85369009 | Tin radioisotope (substance) |
| 85374001 | Blood group antigen Donavieski (substance) |
| 85378003 | Bromine (substance) |
| 85391002 | Meralluride |
| 85393004 | Blood group antigen ILe^bH^ (substance) |
| 85404003 | ^131^Tellurium (substance) |
| 85410003 | Hemoglobin Linkoping (substance) |
| 85427006 | Hemoglobin Owari (substance) |
| 85433002 | Butoconazole nitrate (substance) |
| 85451001 | Nitrite reductase (cytochrome) (substance) |
| 85459004 | Exophthalmos producing substance (substance) |
| 85460009 | Oncogene protein K-RAS (substance) |
| 85462001 | Pentanone (substance) |
| 85475001 | Cypermethrin (substance) |
| 85482002 | Sorbitol-6-phosphate dehydrogenase (substance) |
| 85491003 | Catalase |
| 85494006 | Gold sodium thiosulfate (substance) |
| 85504001 | Complement component C5a (substance) |
| 85508003 | 5-Pyridoxate dioxygenase (substance) |
| 85565002 | Blood group antigen Fy5 (substance) |
| 85574000 | Zinc oxide fumes |
| 85577007 | Diaminobutyrate-pyruvate aminotransferase (substance) |
| 85580008 | Capreomycin sulfate (substance) |
| 85584004 | Achromobacter iophogus collagenase (substance) |
| 85594009 | Blood group antigen Sc1 (substance) |
| 85596006 | Fluorescein stain (substance) |
| 85600001 | Triacylglycerol (substance) |
| 85603004 | Triphenamyl (substance) |
| 85608008 | Methacrylonitrile (substance) |
| 85609000 | Methionine gamma-lyase (substance) |
| 85612002 | Atrazine (substance) |
| 85633006 | Para-nitrosulfathiazole (substance) |
| 85643009 | Filicin (substance) |
| 85661000 | Tetrahydropteroyltriglutamate methyltransferase |
| 85668006 | Starch powder (substance) |
| 85673000 | Intracisternal material (substance) |
| 85689002 | Coproporphyrinogen III (substance) |
| 85693008 | Technetium Tc^99m^ aggregated albumin (substance) |
| 85701007 | Ganglioside GM>2< (substance) |
| 85717001 | Carbonate dehydratase (substance) |
| 85724000 | Oxacillin sodium (substance) |
| 85727007 | Xanthine phosphoribosyltransferase (substance) |
| 85731001 | Immunoglobulin, secretory piece (substance) |
| 85737002 | Chlorpheniramine maleate (substance) |
| 85751002 | 17-Hydroxyprogesterone (substance) |
| 85760005 | Hyperosmotic laxative (substance) |
| 85766004 | myo-Inositol 3-methyltransferase (substance) |
| 85773009 | Hemoglobin D-Ouled Rabah (substance) |
| 85784002 | Cytosine deaminase (substance) |
| 85788004 | Thioglycolic acid (substance) |
| 85794007 | Blood group antibody Snyder (substance) |
| 85822005 | Zeatin (substance) |
| 85829001 | Left bronchial mucus (substance) |
| 85834002 | Blood group antibody Cooper (substance) |
| 85839007 | Glutamine-scyllo-inosose aminotransferase (substance) |
| 85854001 | Alkane 1-monooxygenase (substance) |
| 85860001 | Nervous system hormone-like substance (substance) |
| 85877001 | Ethanolamine kinase (substance) |
| 85886006 | Blood group antigen Peretz (substance) |
| 85889004 | ^191^Platinum (substance) |
| 85894004 | Ketol-acid reductoisomerase (substance) |
| 85899009 | Lithium (substance) |
| 85906005 | Bulbogastrone (substance) |
| 85923001 | Oil of marjoram (substance) |
| 85937005 | Acrolein (substance) |
| 85943007 | Ca^2+^-transporting adenosine triphosphatase (substance) |
| 85954002 | Blood group antigen Berrio (substance) |
| 85955001 | Hemoglobin A>2< Zagreb (substance) |
| 85958004 | ^72^Selenium (substance) |
| 85969001 | Hemoglobin Rampa (substance) |
| 85977002 | Crag herbicide (substance) |
| 85981002 | Chromotrope 2R stain (substance) |
| 85984005 | Hemoglobin Memphis (substance) |
| 85988008 | Blood group antibody Jk^a^ (substance) |
| 85997007 | Oncogene protein mas (substance) |
| 85998002 | Blood group antibody Ull (substance) |
| 86001006 | Human leukocyte antigen DPw2 (substance) |
| 86026002 | Hemoglobin Stanmore (substance) |
| 86027006 | Argon isotope (substance) |
| 86054009 | Riboflavinase (substance) |
| 86076000 | Lymphocyte antigen CD45RO (substance) |
| 86083007 | Blood group antigen Pantaysh (substance) |
| 86108002 | Messenger ribonucleic acid (O^2^'-methyladenosine-N^6^)-methyltransferase (substance) |
| 86120005 | Phosphoribulokinase (substance) |
| 86132009 | Haemoglobin A>2< Honai |
| 86141004 | Uridine triphosphate-glucose-1-phosphate uridylyltransferase (substance) |
| 86155007 | Lanosterol (substance) |
| 86180007 | Serpentine asbestos (substance) |
| 86186001 | ^37^Argon (substance) |
| 86202008 | Nicotinamide adenine dinucleotide ^+^ pyrophosphatase (substance) |
| 86205005 | Carbon oxysulfide (substance) |
| 86211008 | Free thyroxin (substance) |
| 86218002 | Cantharidin (substance) |
| 86223002 | Carboxypeptidase B (substance) |
| 86227001 | Ytterbium (substance) |
| 86233005 | Sulfur dioxide (substance) |
| 86239009 | Galactoside 3(4)-L-fucosyltransferase (substance) |
| 86241005 | ^66^Germanium (substance) |
| 86243008 | ^109^Cadmium (substance) |
| 86254003 | Blood group antigen Tichmeyer (substance) |
| 86257005 | Ritodrine hydrochloride (substance) |
| 86261004 | Decay accelerating factor (substance) |
| 86272009 | Human leukocyte antigen Dw8 (substance) |
| 86281003 | 2-Nitropropane (substance) |
| 86301004 | Posterior pituitary hormone (substance) |
| 86315002 | Dibutyl succinate (substance) |
| 86320002 | Fibrinogen Milano I (substance) |
| 86332003 | Blood group antigen Yt^b^ (substance) |
| 86336000 | Hemoglobin Chiapas (substance) |
| 86340009 | Glucose 1-phosphate thymidylyltransferase (substance) |
| 86355000 | Electrolyte (substance) |
| 86383003 | Coccidioidin (substance) |
| 86388007 | Mercuric oxide (substance) |
| 86399009 | Nickel isotope (substance) |
| 86416000 | Potassium arsenite (substance) |
| 86420001 | Biotin-[propionyl-coenzyme A-carboxylase,(adenosine triphosphate-hydrolysing)] ligase (substance) |
| 86430005 | L-Iduronidase (substance) |
| 86431009 | Pantothenic acid (substance) |
| 86436004 | Ethyl nitrophenyl benzene thiophosphonate (substance) |
| 86447006 | Phosphoglyceride (substance) |
| 86460000 | D-Methionine-pyruvate aminotransferase (substance) |
| 86461001 | Plant diterpene (substance) |
| 86471004 | Tribasic copper sulfate (substance) |
| 86478005 | Diisopropylamine (substance) |
| 86506005 | Mercury (II) reductase (substance) |
| 86518001 | Steroid sulfotransferase (substance) |
| 86520003 | Hemoglobin J-Chicago (substance) |
| 86521004 | ^77^Bromine (substance) |
| 86526009 | Deoxyguanylic acid (substance) |
| 86529002 | N-Sulfoglucosamine-3-sulfatase (substance) |
| 86530007 | Blood group antibody Hu (substance) |
| 86532004 | Blood group antibody Sj (substance) |
| 86537005 | Penicillium roqueforti neutral proteinase (substance) |
| 86541009 | Brilliant crocein stain (substance) |
| 86549006 | Hypothalamic or pituitary hormone (substance) |
| 86551005 | Hemoglobin Chad (substance) |
| 86575005 | Nitrogen isotope (substance) |
| 86579004 | Nitrogen fumes |
| 86584005 | Iodoalphionic acid (substance) |
| 86600008 | Fish toxin (substance) |
| 86609009 | Wood preservative (substance) |
| 86613002 | Sarcosine oxidase (substance) |
| 86621008 | Hamamelose kinase (substance) |
| 86622001 | Blood group antibody Taur (substance) |
| 86627007 | Hemoglobin F-Ube (substance) |
| 86633003 | Cadmium salt (substance) |
| 86637002 | ^81^Rubidium (substance) |
| 86640002 | 3-Demethylubiquinone-9 3-methyltransferase (substance) |
| 86659000 | Thiethylperazine malate (substance) |
| 86668003 | Blood group antigen Barrett (substance) |
| 86692006 | ^206^Thallium (substance) |
| 86697000 | Human leukocyte antigen Aw36 (substance) |
| 86701002 | Nucleoside-triphosphate pyrophosphatase (substance) |
| 86710005 | Nitrogen radioisotope (substance) |
| 86712002 | (S)-2-Hydroxy-fatty-acid dehydrogenase (substance) |
| 86739005 | Zinc (substance) |
| 86742004 | Deoxycytidylate hydroxymethyltransferase (substance) |
| 86750008 | Nitrazine yellow stain (substance) |
| 86754004 | ^197^Platinum (substance) |
| 86756002 | Tincture of green soap (substance) |
| 86759009 | Blood group antibody Gallner (substance) |
| 86778009 | Polyribonucleotide synthase (adenosine triphosphate) (substance) |
| 86783001 | L-Galactonolactone oxidase (substance) |
| 86790006 | Blood group antibody JL (substance) |
| 86813000 | Oxalomalate lyase (substance) |
| 86822004 | Neurine (substance) |
| 86836009 | Hemoglobin J-Baltimore (substance) |
| 86848007 | Penicillin amidase (substance) |
| 86852007 | ^196m>2<^Gold (substance) |
| 86865003 | ^65^Nickel (substance) |
| 86878003 | Retinal dehydrogenase (substance) |
| 86884000 | 2,4,5-Trichlorophenoxyacetic acid (substance) |
| 86887007 | Hemoglobin I-Interlaken (substance) |
| 86904001 | Cholestenone 5alpha-reductase (substance) |
| 86913004 | Blood group antibody Milne (substance) |
| 86922003 | Plant cardiac glycoside (substance) |
| 86928004 | Sulfur tetrafluoride (substance) |
| 86935007 | Blood group antigen An^a^ (substance) |
| 86946005 | Trichlorophenoxy ethyl sulfate (substance) |
| 86951004 | Blood group antibody Hands (substance) |
| 86953001 | Zinc salt (substance) |
| 86955008 | Glycobiarsol (substance) |
| 86960007 | Epidermal growth factor-urogastrone receptor (substance) |
| 86963009 | Lower respiratory tract mucus (substance) |
| 86973006 | ^133m^Barium (substance) |
| 86988001 | Ergotoxine |
| 86990000 | Deoxycytidine kinase |
| 86994009 | Human leukocyte antigen B38 (substance) |
| 87028007 | Hemp fiber (substance) |
| 87032001 | Dipeptidyl peptidase II (substance) |
| 87033006 | Itaconyl-coenzyme A hydratase (substance) |
| 87036003 | Blood group antibody R1^a^ (substance) |
| 87039005 | Carbamoyl-serine ammonia-lyase (substance) |
| 87044003 | Palmitic acid (substance) |
| 87067001 | Sublimed sulfur (substance) |
| 87090006 | Flavoxate hydrochloride (substance) |
| 87097009 | Nitrofurazone (substance) |
| 87112000 | Blood group antigen Zaw (substance) |
| 87116002 | 5,25-Dihydroxy cholecalciferol (substance) |
| 87122006 | Blood group antibody Covas (substance) |
| 87136001 | Asparagine (substance) |
| 87148003 | Amphetamine sulfate (substance) |
| 87151005 | Neostigmine methylsulfate (substance) |
| 87154002 | Cystine reductase (reduced nicotinamide adenine dinucleotide) (substance) |
| 87167004 | Oncogene protein int-2 (substance) |
| 87171001 | ^127m^Tellurium (substance) |
| 87174009 | Guaifenesin (substance) |
| 87200008 | Lower respiratory fluids (substance) |
| 87205003 | Maldison |
| 87212007 | Lysine-transfer ribonucleic acid ligase (substance) |
| 87222001 | Citrate(si)-synthase (substance) |
| 87236006 | Dihydroxyphenylalanine ammonia-lyase (substance) |
| 87251002 | 4-Methoxyamphetamine (substance) |
| 87283008 | Clidinium bromide (substance) |
| 87300005 | 2,4-Dichlorophenol 6-monooxygenase (substance) |
| 87303007 | Cephapirin (substance) |
| 87304001 | Acetylglutamate kinase (substance) |
| 87312009 | Colony-stimulating factor, multiple (substance) |
| 87316007 | Immunoglobulin, light chain (substance) |
| 87332005 | Homogentisic acid (substance) |
| 87336008 | Alcohol dehydrogenase (substance) |
| 87337004 | Sulfur iodide (substance) |
| 87344008 | Pantothenate kinase (substance) |
| 87347001 | Urocanic acid (substance) |
| 87368000 | Blood group antibody En^a^FR (substance) |
| 87371008 | Phosphoribosyl pyrophosphate (substance) |
| 87399004 | Apolipoprotein A (substance) |
| 87401005 | ^212^Lead (substance) |
| 87403008 | Heptane (substance) |
| 87410002 | Technetium Tc^99^ N-substituted iminodiacetate (substance) |
| 87437000 | ^73^Selenium (substance) |
| 87440000 | Tryptophan 5-monooxygenase (substance) |
| 87444009 | Immunoglobulin, GM>12< allotype (substance) |
| 87445005 | Ipodate (substance) |
| 87452007 | Light metal compound (substance) |
| 87453002 | Carbon (substance) |
| 87468001 | Magnesium bromide (substance) |
| 87472002 | Vecuronium bromide (substance) |
| 87477008 | Phytanic acid (substance) |
| 87478003 | ^239^Plutonium (substance) |
| 87485004 | Strontium bromide (substance) |
| 87499000 | Blood group antigen Mckeever (substance) |
| 87504000 | Enoyl-CoA hydratase (substance) |
| 87524001 | Immunoglobulin, hypervariable region (substance) |
| 87526004 | Bilirubin oxidase (substance) |
| 87542006 | Blood group antigen Rh33 (substance) |
| 87549002 | Blood group antigen Gd (substance) |
| 87568004 | Hormone (substance) |
| 87574004 | o-Aminophenol oxidase (substance) |
| 87585002 | ^41^Calcium (substance) |
| 87593002 | Blood group antibody Er^a^ (substance) |
| 87599003 | Metaxalone |
| 87609004 | Hexokinase (substance) |
| 87610009 | Aflatoxin B (substance) |
| 87612001 | Blood (substance) |
| 87624008 | L-Iditol dehydrogenase (substance) |
| 87625009 | 4-Hydroxy-2-oxoglutarate aldolase (substance) |
| 87629003 | Coagulation factor X variant (substance) |
| 87645001 | Hexylene glycol (substance) |
| 87657005 | Blood group antibody E. Amos (substance) |
| 87661004 | Lymphocyte antigen CD59 (substance) |
| 87664007 | Hemoglobin A>2< NYU (substance) |
| 87672009 | Blood group antigen Mateen (substance) |
| 87692002 | Wax-ester hydrolase (substance) |
| 87708000 | Vitamin (substance) |
| 87714007 | ^185^Iridium (substance) |
| 87718005 | Acetyl-coenzyme A carboxylase-phosphatase (substance) |
| 87723005 | Cholestenone 5beta-reductase (substance) |
| 87729009 | Sulfite oxidase (substance) |
| 87738006 | Isopropyl cresol (substance) |
| 87741002 | Hemoglobin D-Bushman (substance) |
| 87744005 | Calcium arsenate (substance) |
| 87802005 | ^33^Phosphorus (substance) |
| 87805007 | Deoxycytidine deaminase (substance) |
| 87811005 | Injectable fibrinolysin (substance) |
| 87817009 | Glycerol-3-phosphate dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) |
| 87831009 | Trimipramine maleate (substance) |
| 87835000 | Blood group antibody Dantu (substance) |
| 87847006 | Promoxolane (substance) |
| 87853006 | Technetium Tc^99m^ iron ascorbate (substance) |
| 87869004 | Manganese (substance) |
| 87873001 | Ribonuclease U>2< (substance) |
| 87882007 | 3-Isopropylmalate dehydratase (substance) |
| 87889003 | Hemoglobin Chapel Hill (substance) |
| 87896001 | Creosote (substance) |
| 87897005 | Human antihemophilic plasma (substance) |
| 87901004 | Catechol l,2 dioxygenase (substance) |
| 87918000 | Mineral (substance) |
| 87924006 | N-Acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase (substance) |
| 87925007 | Biotin-coenzyme A ligase (substance) |
| 87926008 | Deoxythymidine diphosphate-4-amino-4,6-dideoxy-D-glucose aminotransferase (substance) |
| 87929001 | Ribose dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 87930006 | Fibrinogen Baltimore I (substance) |
| 87931005 | Mimosine (substance) |
| 87940009 | ^179^Tantalum (substance) |
| 87946003 | Blood group antigen U^x^ (substance) |
| 87954001 | Guanosine deaminase (substance) |
| 87957008 | Calotropin (substance) |
| 87958003 | Ferrous citrate Fe^59^ (substance) |
| 87972007 | Blood group antibody Sadler (substance) |
| 87981001 | o-Pyrocatechuate decarboxylase (substance) |
| 87983003 | Rhodium salt (substance) |
| 87990008 | Phospho-N-acetylmuramoyl-pentapeptide-transferase (substance) |
| 88001004 | Chlorpropham (substance) |
| 88005008 | Hemoglobin Helsinki (substance) |
| 88007000 | Sodium tetrahydride (substance) |
| 88014003 | Beryllium (substance) |
| 88020002 | Ketoacid (substance) |
| 88023000 | LYT antigen (substance) |
| 88025007 | Silvex (substance) |
| 88038004 | Fructuronate reductase (substance) |
| 88043006 | Allose kinase (substance) |
| 88064005 | Hemoglobin F-Forest Park (substance) |
| 88074008 | Cytokinins (substance) |
| 88087002 | Dodecylguanidine monoacetate (substance) |
| 88090008 | Tellurium isotope (substance) |
| 88097006 | Tin compound (substance) |
| 88122008 | Passiflorine (substance) |
| 88131008 | Human leukocyte antigen DRw12 (substance) |
| 88166005 | Copper^64^ versenate (substance) |
| 88171003 | Cytidine deaminase (substance) |
| 88179001 | Robin (substance) |
| 88184007 | Acetyl chloride |
| 88194002 | Dichlorodiphenyltrichloroethane (substance) |
| 88204001 | Antigen in Kidd (JK) blood group system (substance) |
| 88222003 | Phosphatidylcholine 12-monooxygenase (substance) |
| 88236008 | Phosphine (substance) |
| 88237004 | ^82m^Rubidium (substance) |
| 88245009 | Bacillus subtilis ribonuclease (substance) |
| 88262004 | Phenylphosphine (substance) |
| 88287006 | Sulfur radioisotope (substance) |
| 88292008 | Blood group antigen Zt^a^ (substance) |
| 88304003 | Lymphocyte antigen CD48 (substance) |
| 88319002 | Prompt zinc insulin (substance) |
| 88325003 | Calcium undecylenate (substance) |
| 88330004 | Cevine (substance) |
| 88337001 | Maleylacetoacetate isomerase (substance) |
| 88341002 | Blood group antibody k (substance) |
| 88342009 | Human leukocyte antigen D (substance) |
| 88352008 | Bromindione |
| 88368002 | Angiotensin I (substance) |
| 88375001 | Blood group antibody Van Buggenhout (substance) |
| 88376000 | Carcinogen (substance) |
| 88381009 | Methyl chloride (substance) |
| 88383007 | Phosphoglucokinase (substance) |
| 88404004 | alpha>2< Neuramino glycoprotein (substance) |
| 88406002 | Chymotrypsin C (substance) |
| 88408001 | D-Amino-acid oxidase (substance) |
| 88426003 | Oncogene protein N-MYC (substance) |
| 88427007 | Methyl acetylene (substance) |
| 88432008 | Arabinose isomerase (substance) |
| 88452009 | Steroid delta-isomerase (substance) |
| 88453004 | Platelet antigen HPA-1a (substance) |
| 88457003 | ^198^Lead (substance) |
| 88462002 | Human leukocyte antigen Aw33 (substance) |
| 88468003 | Magnesium silicate (substance) |
| 88473009 | Selenomethionine Se^75^ (substance) |
| 88476001 | Urate (substance) |
| 88480006 | Potassium (substance) |
| 88485001 | Etidocaine (substance) |
| 88486000 | Poly (ribitol-phosphate) beta-glucosyltransferase (substance) |
| 88488004 | Lead (substance) |
| 88502003 | Behenic acid (substance) |
| 88525002 | 2-Coumarate O-beta-glucosyltransferase (substance) |
| 88543003 | Hydroxyphenamate (substance) |
| 88546006 | Sarcosine (substance) |
| 88551000 | 5-Azacytidine (substance) |
| 88555009 | Aminodeoxygluconate dehydratase (substance) |
| 88557001 | Phosphatidylcholine-sterol acyltransferase (substance) |
| 88574001 | Otic sulfonamide agent (substance) |
| 88583006 | Creatinine deiminase (substance) |
| 88585004 | Chlorprothixene hydrochloride (substance) |
| 88589005 | Cyclocumarol (substance) |
| 88602005 | Glucagon-like peptide 2 (substance) |
| 88605007 | ^224^Radium (substance) |
| 88617009 | Magnesium isotope (substance) |
| 88625006 | Water soluble aniline blue stain (substance) |
| 88631009 | beta Sitosterol (substance) |
| 88637008 | Hemoglobin A>2< Babinga (substance) |
| 88640008 | Deoxyribodipyrimidine endonucleosidase (substance) |
| 88660000 | Fast sulfon black F stain (substance) |
| 88661001 | Platelet antibody HPA-4a (substance) |
| 88662008 | Pyridoxine 5-dehydrogenase (substance) |
| 88683002 | Active C4b2a3b (substance) |
| 88689003 | Long-chain-alcohol dehydrogenase (substance) |
| 88704000 | Bacterial insecticide (substance) |
| 88709005 | Deoxythymidine monophosphate kinase (substance) |
| 88710000 | alpha-1,3-Mannosyl-glycoprotein beta-1,2-N-acetylglucosaminyltransferase |
| 88724001 | Ptomatropine (substance) |
| 88730001 | Fibrinogen Paris IV (substance) |
| 88736007 | Betamethasone dipropionate (substance) |
| 88754006 | alpha-Naphthyl thiourea (substance) |
| 88757004 | Sulfisoxazole acetyl (substance) |
| 88770008 | Indole-3-acetaldehyde reductase (NADH) |
| 88781006 | Americium (substance) |
| 88785002 | Nitroso dye (substance) |
| 88792007 | Peptidoglycan glycosyltransferase (substance) |
| 88802007 | Chlorazanil (substance) |
| 88811007 | Witch hazel (substance) |
| 88832004 | 3alpha-Hydroxycholanate dehydrogenase (substance) |
| 88863000 | tert-Butyl alcohol (substance) |
| 88864006 | ^250^Californium (substance) |
| 88878007 | Protein (substance) |
| 88881002 | Blood group antigen H (substance) |
| 88896003 | Threonine racemase (substance) |
| 88913006 | Blood group antigen Milano (substance) |
| 88919005 | Fibroblast growth factor |
| 88921000 | Fibril (substance) |
| 88941005 | Hemoglobin Thailand |
| 88949007 | 2-Alkyn-1-ol dehydrogenase (substance) |
| 88954003 | ^55^Iron (substance) |
| 88958000 | Blood group antibody Mo^a^ (substance) |
| 88970001 | Eudermol (substance) |
| 88983000 | Lymphocyte antigen CD61 (substance) |
| 89006002 | Vipera russelli proteinase (substance) |
| 89009009 | Methylphosphothioglycerate phosphatase (substance) |
| 89015009 | Choleretic agent (substance) |
| 89025004 | 2-Methyl-4-chlorophenoxyacetic acid sodium salt (substance) |
| 89028002 | Curcumin stain (substance) |
| 89033003 | Blood-group-substance endo-1,4-beta-galactosidase (substance) |
| 89041003 | Blood group antigen Sk^a^ (substance) |
| 89043000 | Blood group antibody Geslin (substance) |
| 89048009 | Collagen type IV (substance) |
| 89055006 | Penicillin G sodium (substance) |
| 89064001 | Oncogene protein met (substance) |
| 89067008 | Cinchonidine (substance) |
| 89071006 | Phenylpyruvic acid (substance) |
| 89074003 | Blood group antigen Wolfe (substance) |
| 89086000 | Fibrin degradation agent (substance) |
| 89094007 | Thrombospondin (substance) |
| 89095008 | Takabrucem salicylanilide (substance) |
| 89119000 | Nitrate salt (substance) |
| 89128004 | Xanthates |
| 89139001 | Light green SF stain (substance) |
| 89148006 | Fast garnet GBC salt stain (substance) |
| 89152006 | Dynein adenosine triphosphatase (substance) |
| 89177007 | Proton (substance) |
| 89184004 | Vinbarbital (substance) |
| 89189009 | Neurohumoral receptor (substance) |
| 89191001 | 15-Hydroperoxy-5,8,11,13-eicosatetraenoic acid (substance) |
| 89195005 | Octamethyl pyrophosphoramide (substance) |
| 89197002 | Germanium compound (substance) |
| 89201002 | Carbonyl reductase (reduced nicotinamide adenine dinucleotide phosphate) |
| 89203004 | Acetolactate decarboxylase (substance) |
| 89214001 | Chlorotoloxyacetic acid (substance) |
| 89219006 | Potassium gluconate (substance) |
| 89224009 | Glucan 1,6-alpha-glucosidase (substance) |
| 89227002 | Paracrine substance (substance) |
| 89249008 | Dipyrrole (substance) |
| 89256002 | Formate dehydrogenase |
| 89263002 | Glucose-1-phosphate cytidylyltransferase (substance) |
| 89264008 | Ribosomal ribonucleic acid (adenine-N^6^)-methyltransferase (substance) |
| 89272005 | ^58^Cobalt (substance) |
| 89284007 | N^6^-Methyl-lysine oxidase (substance) |
| 89289002 | [Hydroxymethylglutaryl-coenzyme A reductase (reduced nicotinamide adenine dinucleotide phosphate)]-phosphatase (substance) |
| 89301000 | 2-Oxoadipate reductase (substance) |
| 89306005 | Imidazoleacetate-phosphoribosyldiphosphate ligase (substance) |
| 89307001 | 15-Hydroxyprostaglandin dehydrogenase (nicotinamide adenine dinucleotide ^+^) (substance) |
| 89309003 | Organic sulfur compound (substance) |
| 89326009 | Glucosulfone sodium (substance) |
| 89335002 | Copper undecylenate |
| 89336001 | Caffeate 3,4-dioxygenase (substance) |
| 89349006 | Hexachloroacetone (substance) |
| 89350006 | Blood group antibody O'Connor (substance) |
| 89351005 | Potassium iodide (substance) |
| 89364006 | Leucine dehydrogenase (substance) |
| 89371001 | 5-Oxoprolyl-peptidase (substance) |
| 89401004 | Potassium guaiacolsulfonate (substance) |
| 89422005 | Allobarbital (substance) |
| 89436000 | Blood group antigen Rich (substance) |
| 89453007 | Citryl-coenzyme A lyase (substance) |
| 89457008 | Radioactive isotope (substance) |
| 89468008 | Coagulation factor IX Seattle variant (substance) |
| 89482008 | Histidinol-phosphate aminotransferase (substance) |
| 89506006 | Oxalic acid (substance) |
| 89515004 | Hypochlorite salt (substance) |
| 89518002 | N-octylbicycloheptene dicarboximide (substance) |
| 89526005 | Human leukocyte antigen B18 (substance) |
| 89543008 | Blood group antibody V (substance) |
| 89553009 | Sulfite reductase (ferredoxin) (substance) |
| 89564007 | Blood group antigen Cameron (substance) |
| 89577003 | Pontamine sky blue 5BX stain (substance) |
| 89588009 | Aryl-aldehyde dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 89592002 | Blood group antibody Be^a^ (substance) |
| 89595000 | Iodized oil (substance) |
| 89612008 | Petrichloral (substance) |
| 89619004 | Ubiquinol-cytochrome-c reductase |
| 89632009 | ^227^Thorium (substance) |
| 89668004 | Blood group antigen Terschurr (substance) |
| 89669007 | Carboxypeptidase S (substance) |
| 89678001 | Cefuroxime axetil (substance) |
| 89701003 | Dithiazanine iodide (substance) |
| 89702005 | Selenium salt (substance) |
| 89707004 | Sesame oil (substance) |
| 89717009 | Bilirubin Z transport protein (substance) |
| 89735000 | Blood group antibody Kenneddy (substance) |
| 89745003 | Somatotropin receptor (substance) |
| 89750009 | Adonidin (substance) |
| 89767002 | Blood group antibody Mateen (substance) |
| 89771004 | Lymphocyte antigen CD34 (substance) |
| 89772006 | Tranylcypromine sulfate (substance) |
| 89775008 | Pipamazine (substance) |
| 89781000 | Hydroxymandelonitrile lyase (substance) |
| 89803009 | Blood group antigen Mackin |
| 89811004 | Gluten (substance) |
| 89818005 | Technetium Tc^99^ tagged red cells (substance) |
| 89822000 | 4-Nitroso dimethylamine (substance) |
| 89829009 | Etioporphyrin (substance) |
| 89838006 | Coagulation factor IX Hilo variant (substance) |
| 89841002 | Blood group antibody AY (substance) |
| 89848008 | (S)-Norlaudanosoline synthase (substance) |
| 89851001 | Thebaine (substance) |
| 89853003 | Cortilymph |
| 89856006 | Ponceau S stain (substance) |
| 89864000 | Entomophthora collagenolytic proteinase |
| 89866003 | Plotospasmin toxin (substance) |
| 89867007 | Triorthocresyl phosphate (substance) |
| 89875001 | Serogically-defined antigen (substance) |
| 89889006 | Cotton fiber (substance) |
| 89920007 | Blood group antibody Pr>1d< (substance) |
| 89926001 | ^236^Uranium (substance) |
| 89952007 | Blood group antigen s^D^ (substance) |
| 89981008 | Nucleoside ribosyltransferase (substance) |
| 90011005 | Cytidine diphosphate glycerol pyrophosphatase (substance) |
| 90018004 | 6-Phospho-beta-glucosidase (substance) |
| 90019007 | (N-Acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase (substance) |
| 90025006 | ^95^Zirconium (substance) |
| 90026007 | Ajacine (substance) |
| 90029000 | Tyrosine carboxypeptidase (substance) |
| 90047006 | Aminobenzoate decarboxylase (substance) |
| 90058002 | Bauxite fumes (substance) |
| 90059005 | ^79^Krypton (substance) |
| 90066006 | Oxalyl-coenzyme A decarboxylase (substance) |
| 90077000 | Progesterone monooxygenase (substance) |
| 90086005 | Sphingosine (substance) |
| 90088006 | Human leukocyte antigen B39 (substance) |
| 90095002 | Oil of angelica (substance) |
| 90100000 | Isopropanol dehydrogenase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 90106006 | Blood group antibody En^a^FS (substance) |
| 90107002 | Alkylglycerone kinase (substance) |
| 90118002 | Dobutamine hydrochloride (substance) |
| 90136002 | Pink wine (substance) |
| 90142003 | Calcium caseinate (substance) |
| 90148004 | Succinate-hydroxymethylglutarate coenzyme A-transferase |
| 90150007 | ^117m^Tin (substance) |
| 90156001 | Blood group antigen Becker (substance) |
| 90160003 | Blood group antibody Bell (substance) |
| 90170001 | Propargyl alcohol (substance) |
| 90192002 | Aspergillus oryzae neutral proteinase (substance) |
| 90193007 | Agmatine 4-coumaroyltransferase (substance) |
| 90209005 | ^100^Rhodium (substance) |
| 90220005 | Novobiocin (substance) |
| 90234005 | Candicin toxin (substance) |
| 90247000 | Blood group antibody Gould (substance) |
| 90260006 | Allergen (substance) |
| 90266000 | Hemoglobin D (substance) |
| 90296005 | Blood group antibody Fy4 (substance) |
| 90299003 | Blood group antigen U^z^ (substance) |
| 90304002 | Blood group antibody Wetz (substance) |
| 90311003 | Lymphocyte chemotactic factor (substance) |
| 90317004 | Helium (substance) |
| 90339002 | Germicide (substance) |
| 90342008 | Carbazochrome salicylate (substance) |
| 90344009 | Etazocine (substance) |
| 90350004 | 1-Pyrroline-4-hydroxy-2-carboxylate deaminase (substance) |
| 90355009 | Carbon radioisotope (substance) |
| 90404003 | Fibrinogen Barcelona I (substance) |
| 90495007 | Plant alcoholic oil (substance) |
| 90529007 | ^77^Germanium (substance) |
| 90534006 | (R)-Dehydropantoate dehydrogenase (substance) |
| 90537004 | ^232^Plutonium (substance) |
| 90544008 | Iodine monochloride (substance) |
| 90567005 | Iron isotope (substance) |
| 90581007 | Carbamide peroxide (substance) |
| 90582000 | Cytidine triphosphate (substance) |
| 90595005 | Silver bromide (substance) |
| 90615000 | Human leukocyte antigen Bw61 (substance) |
| 90617008 | Indium^113^ bleomycin (substance) |
| 90618003 | Gold compound (substance) |
| 90624009 | Blood group antigen Mo^a^ (substance) |
| 90633006 | Azobilirubin pigment (substance) |
| 90644003 | L-Gulonate dehydrogenase (substance) |
| 90656002 | Blood group antigen LW^a^ (substance) |
| 90664008 | ^127^Tin (substance) |
| 90666005 | Glyoxylate reductase (nicotinamide adenine dinucleotide phosphate ^+^) (substance) |
| 90667001 | Lymphocyte antigen CD72 (substance) |
| 90668006 | Enzyme (substance) |
| 90670002 | Deltamethrin (substance) |
| 90671003 | Potassium thiocyanate (substance) |
| 90677004 | Mustard white (substance) |
| 90694002 | Asparagine synthase (glutamine-hydrolysing) (substance) |
| 90696000 | Neosaxitonin (substance) |
| 90698004 | Chondro-6-sulfatase (substance) |
| 90714008 | HLA-Aw74 antigen |
| 90720009 | Cytoplasmic antibody (substance) |
| 90724000 | 3-Hydroxymethylcephem carbamoyltransferase (substance) |
| 90733003 | Metrizamide (substance) |
| 90737002 | Leaves (substance) |
| 90743000 | Deoxycytidine triphosphate deaminase (substance) |
| 90745007 | Bunamiodyl (substance) |
| 90758008 | Coparaffinate (substance) |
| 90762002 | Blood group antibody Jk3 (substance) |
| 90812004 | Hot liquid (substance) |
| 90836000 | Blood group antigen Reiter (substance) |
| 90841008 | Thallium radioisotope (substance) |
| 90847007 | Guanine transfer ribonucleic acid-ribosyltransferase (substance) |
| 90851009 | Coagulation factor Va (substance) |
| 90865006 | Haemoglobin J-Cambridge |
| 90867003 | Cytochrome-b>5< reductase (substance) |
| 90872007 | Ephedrine dehydrogenase (substance) |
| 90873002 | Malate dehydrogenase (acceptor) (substance) |
| 90875009 | Doxorubicin hydrochloride (substance) |
| 90879003 | Thorium compound (substance) |
| 90902007 | (S)-2-Hydroxy-acid oxidase (substance) |
| 90922006 | Protopine (substance) |
| 90936001 | Hemoglobin Crete (substance) |
| 90943007 | Carnitine dehydrogenase (substance) |
| 90944001 | Coumarinic anhydride (substance) |
| 90945000 | beta 2 microglobulin (substance) |
| 90953008 | Gallium compound (substance) |
| 90957009 | Thiosulfate sulfurtransferase (substance) |
| 90960002 | Tartrate dehydrogenase (substance) |
| 90971001 | beta-2 Adrenergic receptor (substance) |
| 90977002 | Blood group antibody Driver (substance) |
| 91004000 | Organic dust (substance) |
| 91007007 | Sodium selenate (substance) |
| 91013003 | Pentazocine hydrochloride (substance) |
| 91016006 | Polydeoxyribonucleotide synthase (adenosine triphosphate) (substance) |
| 91018007 | Cresylic acid (substance) |
| 91023007 | Alverine citrate (substance) |
| 91026004 | Sodium isopropyl xanthate (substance) |
| 91067009 | Prostaglandin-E>2< 9-ketoreductase (substance) |
| 91100006 | Allantoin racemase (substance) |
| 91103008 | Blood group antigen IP (substance) |
| 91132006 | Curcin (substance) |
| 91137000 | Deuterium (substance) |
| 91163005 | ^242^Californium (substance) |
| 91166002 | Monoiodotyrosine (substance) |
| 91171009 | Pesticide adjuvant (substance) |
| 91185004 | Active C1q (substance) |
| 91190001 | Dextran 1,6-alpha-isomaltotriosidase (substance) |
| 91194005 | Cellulose synthase (guanosine diphosphate-forming) (substance) |
| 91205007 | Deoxythymidine diphosphate-galactose dehydrogenase (substance) |
| 91215001 | Acetylene tetrabromite (substance) |
| 91239006 | ^111m^Silver (substance) |
| 91245003 | Oncogene protein C-MYC (substance) |
| 91254000 | gamma-Glutamylcyclotransferase (substance) |
| 91255004 | Copper fumes (substance) |
| 91262008 | Guanosine triphosphate (substance) |
| 91263003 | Blood group antigen Th^a^ (substance) |
| 91266006 | Sulfoxone (substance) |
| 91279002 | ^77^Krypton (substance) |
| 91283002 | Glutathione peroxidase (substance) |
| 91295002 | Fast blue BB salt stain |
| 91306006 | Unclassified vasodilating agent (substance) |
| 91309004 | Acute phase reactant (substance) |
| 91312001 | Hemoglobin St. Etienne (substance) |
| 91314000 | Furazolidone (substance) |
| 91319005 | Levanase (substance) |
| 91351006 | Hemoglobin Kenitra (substance) |
| 91353009 | Cephalotoxin (substance) |
| 91370001 | Peroxyacetic acid (substance) |
| 91384006 | Dibenzoxepin derivative (substance) |
| 91403002 | Lobeline (substance) |
| 91410008 | Silicon compound (substance) |
| 91423001 | Coagulation factor II Quick variant (substance) |
| 91424007 | Nitrogen dioxide (substance) |
| 91426009 | Antigen in Duffy (FY) blood group system (substance) |
| 91455001 | Wood tar (substance) |
| 91464006 | Lymphocyte antigen CD36 (substance) |
| 91495004 | Palladium isotope (substance) |
| 91518003 | Polybrominated biphenyl (substance) |
| 91521001 | Corticosterone (substance) |
| 91542004 | Blood group antibody Peretz (substance) |
| 91543009 | Serine palmitoyltransferase (substance) |
| 91548000 | Mandelate 4-monooxygenase (substance) |
| 91560004 | Isopropyl benzene (substance) |
| 91572005 | Blood group antibody rr-35 (substance) |
| 91574006 | Hemoglobin British Columbia (substance) |
| 91577004 | Fibrinogen Chapel Hill III (substance) |
| 91594002 | Methohexital sodium (substance) |
| 91598004 | Benzoyl peroxide (substance) |
| 91606004 | Cochineal stain (substance) |
| 91611002 | Iodide peroxidase (substance) |
| 91616007 | Arsenic trisulfide (substance) |
| 91619000 | Andirine (substance) |
| 91626000 | Blood group antigen Sharp (substance) |
| 91638009 | Hemoglobin Miyashiro (substance) |
| 91639001 | Cold cream (substance) |
| 91645009 | Thymine (substance) |
| 91665002 | ^26^Aluminum (substance) |
| 91668000 | Orcinol 2-monooxygenase (substance) |
| 91677007 | Aplysiatoxin (substance) |
| 91680008 | Formiminoglutamase (substance) |
| 91720002 | Body substance (substance) |
| 95969004 | Organic acid (substance) |
| 95970003 | Trace element (substance) |
| 95971004 | Urea nitrogen (substance) |
| 95972006 | Ammonia nitrogen (substance) |
| 95973001 | Protein nitrogen (substance) |
| 95974007 | alpha-Amino acid nitrogen (substance) |
| 95975008 | Inorganic sulfate (substance) |
| 95976009 | Aluminum stearate (substance) |
| 95977000 | Chelated iron (substance) |
| 95978005 | Spot remover (substance) |
| 95979002 | Trichloroethyl alcohol (substance) |
| 95980004 | Creosol (substance) |
| 95981000 | Paradimethylaminobenzaldehyde (substance) |
| 95982007 | Methoxyacetate (substance) |
| 95983002 | Adipic acid (substance) |
| 95984008 | alpha-Aminoadipic acid (substance) |
| 95985009 | 2,4 Toluenediamine (substance) |
| 95986005 | 2,6 Toluenediamine (substance) |
| 95987001 | Chloramine B (substance) |
| 95988006 | Poloxalene (substance) |
| 95989003 | Organic chloride compound (substance) |
| 95990007 | Grubicide (substance) |
| 95991006 | Famphur (substance) |
| 95992004 | Cythioate (substance) |
| 95993009 | Bromadiolone (substance) |
| 95994003 | Camptothecin (substance) |
| 95995002 | Capsaicin (substance) |
| 95996001 | Kapok (substance) |
| 95997005 | Capsanthin (substance) |
| 95999008 | Bacterial enterotoxin (substance) |
| 96001009 | Clostridium difficile toxin B (substance) |
| 96002002 | Verotoxin 1 |
| 96003007 | Verotoxin 2 |
| 96004001 | Colitoxin |
| 96007008 | Tazobactam |
| 96008003 | Sulbactam |
| 96009006 | Bacitracin methylene disalicylate |
| 96010001 | Sulfomyxin (substance) |
| 96012009 | Carbomycin A (substance) |
| 96013004 | Carbomycin B (substance) |
| 96016007 | Carbadox (substance) |
| 96017003 | Thiostrepton (substance) |
| 96019000 | Tiamulin fumarate (substance) |
| 96021005 | Tylosin phosphate (substance) |
| 96022003 | Tylosin tartrate (substance) |
| 96024002 | Tilmicosin phosphate (substance) |
| 96025001 | Butirosin (substance) |
| 96026000 | Neomycin palmitate (substance) |
| 96027009 | Neomycin undecylenate (substance) |
| 96028004 | Dihydrostreptomycin sulfate (substance) |
| 96030002 | Apramycin sulfate (substance) |
| 96031003 | Sisomicin (substance) |
| 96032005 | Erythromycin phosphate (substance) |
| 96033000 | Erythromycin thiocyanate (substance) |
| 96035007 | Dirithromycin (substance) |
| 96036008 | Miokamycin (substance) |
| 96037004 | Roxithromycin (substance) |
| 96039001 | Mercaptobenzothiazole (substance) |
| 96040004 | Mercaptobenzothiazole zinc (substance) |
| 96041000 | Mercaptobenzothiazole sodium (substance) |
| 96042007 | Cephalonium (substance) |
| 96043002 | Cephapirin benzathine (substance) |
| 96045009 | Ceftiofur sodium (substance) |
| 96046005 | Ceftiofur hydrochloride (substance) |
| 96048006 | Cefepime (substance) |
| 96050003 | Cefpodoxime proxetil (substance) |
| 96056009 | Cefatrizine (substance) |